First Commit

externals/boost/libs/atomic/config/Jamfile.v2

@@ -0,0 +1,20 @@
+#
+#             Copyright Andrey Semashev 2020.
+# Distributed under the Boost Software License, Version 1.0.
+#    (See accompanying file LICENSE_1_0.txt or copy at
+#          http://www.boost.org/LICENSE_1_0.txt)
+#
+
+import atomic-arch-config ;
+
+lib synchronization ;
+explicit synchronization ;
+
+exe has_synchronization_lib : has_synchronization_lib.cpp : <library>synchronization ;
+explicit has_synchronization_lib ;
+
+obj has_sse2 : has_sse2.cpp : <conditional>@atomic-arch-config.sse2-flags ;
+explicit has_sse2 ;
+
+obj has_sse41 : has_sse41.cpp : <conditional>@atomic-arch-config.sse41-flags ;
+explicit has_sse41 ;

externals/boost/libs/atomic/config/has_sse2.cpp

@@ -0,0 +1,17 @@
+/*
+ *             Copyright Andrey Semashev 2020.
+ * Distributed under the Boost Software License, Version 1.0.
+ *    (See accompanying file LICENSE_1_0.txt or copy at
+ *          http://www.boost.org/LICENSE_1_0.txt)
+ */
+
+#include <emmintrin.h>
+
+int main(int, char*[])
+{
+    __m128i mm = _mm_setzero_si128();
+    mm = _mm_cmpeq_epi32(mm, mm);
+    mm = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm), _mm_castsi128_ps(mm), _MM_SHUFFLE(2, 0, 2, 0)));
+    mm = _mm_packs_epi32(mm, mm);
+    return _mm_movemask_epi8(mm);
+}

externals/boost/libs/atomic/config/has_sse41.cpp

@@ -0,0 +1,17 @@
+/*
+ *             Copyright Andrey Semashev 2020.
+ * Distributed under the Boost Software License, Version 1.0.
+ *    (See accompanying file LICENSE_1_0.txt or copy at
+ *          http://www.boost.org/LICENSE_1_0.txt)
+ */
+
+#include <smmintrin.h>
+
+int main(int, char*[])
+{
+    __m128i mm = _mm_setzero_si128();
+    mm = _mm_cmpeq_epi64(mm, mm);
+    mm = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm), _mm_castsi128_ps(mm), _MM_SHUFFLE(2, 0, 2, 0)));
+    mm = _mm_packs_epi32(mm, mm);
+    return _mm_movemask_epi8(mm);
+}

externals/boost/libs/atomic/config/has_synchronization_lib.cpp

@@ -0,0 +1,33 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+
+#define BOOST_USE_WINAPI_VERSION 0x0602
+
+// Include Boost.Predef first so that windows.h is guaranteed to be not included
+#include <boost/predef/os/windows.h>
+#include <boost/predef/os/cygwin.h>
+#if !BOOST_OS_WINDOWS && !BOOST_OS_CYGWIN
+#error "This config test is for Windows only"
+#endif
+
+#include <boost/winapi/config.hpp>
+#include <boost/predef/platform.h>
+#if !(BOOST_USE_WINAPI_VERSION >= BOOST_WINAPI_VERSION_WIN8 && (BOOST_WINAPI_PARTITION_APP || BOOST_WINAPI_PARTITION_SYSTEM))
+#error "No WaitOnAddress API"
+#endif
+
+#include <cstddef>
+#include <boost/winapi/basic_types.hpp>
+#include <boost/winapi/wait_on_address.hpp>
+
+int main()
+{
+    unsigned int n = 0u, compare = 0u;
+    boost::winapi::WaitOnAddress(&n, &compare, sizeof(n), 0);
+    return 0;
+}

externals/boost/libs/atomic/src/bit_operation_tools.hpp

@@ -0,0 +1,82 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+/*!
+ * \file   bit_operation_tools.hpp
+ *
+ * This file contains bit operation tools
+ */
+
+#ifndef BOOST_ATOMIC_BIT_OPERATION_TOOLS_HPP_INCLUDED_
+#define BOOST_ATOMIC_BIT_OPERATION_TOOLS_HPP_INCLUDED_
+
+#include <boost/predef/architecture/x86.h>
+
+#if BOOST_ARCH_X86
+
+#include <boost/atomic/detail/config.hpp>
+#include <boost/atomic/detail/header.hpp>
+
+#if defined(_MSC_VER)
+extern "C" unsigned char _BitScanForward(unsigned long* index, unsigned long x);
+#if defined(BOOST_MSVC)
+#pragma intrinsic(_BitScanForward)
+#endif
+#endif
+
+namespace boost {
+namespace atomics {
+namespace detail {
+
+//! Counts trailing zero bits
+BOOST_FORCEINLINE unsigned int count_trailing_zeros(unsigned int x)
+{
+#if defined(__GNUC__)
+    return __builtin_ctz(x);
+#elif defined(_MSC_VER)
+    unsigned long index;
+    _BitScanForward(&index, x);
+    return static_cast< unsigned int >(index);
+#else
+    unsigned int index = 0u;
+    if ((x & 0xFFFF) == 0u)
+    {
+        x >>= 16;
+        index += 16u;
+    }
+    if ((x & 0xFF) == 0u)
+    {
+        x >>= 8;
+        index += 8u;
+    }
+    if ((x & 0xF) == 0u)
+    {
+        x >>= 4;
+        index += 4u;
+    }
+    if ((x & 0x3) == 0u)
+    {
+        x >>= 2;
+        index += 2u;
+    }
+    if ((x & 0x1) == 0u)
+    {
+        index += 1u;
+    }
+    return index;
+#endif
+}
+
+} // namespace detail
+} // namespace atomics
+} // namespace boost
+
+#include <boost/atomic/detail/footer.hpp>
+
+#endif // BOOST_ARCH_X86
+
+#endif // BOOST_ATOMIC_BIT_OPERATION_TOOLS_HPP_INCLUDED_

externals/boost/libs/atomic/src/cpuid.hpp

@@ -0,0 +1,86 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+/*!
+ * \file   cpuid.hpp
+ *
+ * This file contains declaration of \c cpuid function
+ */
+
+#ifndef BOOST_ATOMIC_CPUID_HPP_INCLUDED_
+#define BOOST_ATOMIC_CPUID_HPP_INCLUDED_
+
+#include <boost/predef/architecture/x86.h>
+
+#if BOOST_ARCH_X86
+
+#if defined(_MSC_VER)
+#include <intrin.h> // __cpuid
+#endif
+#include <boost/cstdint.hpp>
+#include <boost/atomic/detail/config.hpp>
+
+#include <boost/atomic/detail/header.hpp>
+
+namespace boost {
+namespace atomics {
+namespace detail {
+
+//! The function invokes x86 cpuid instruction
+inline void cpuid(uint32_t& eax, uint32_t& ebx, uint32_t& ecx, uint32_t& edx)
+{
+#if defined(__GNUC__)
+#if (defined(__i386__) || defined(__VXWORKS__)) && (defined(__PIC__) || defined(__PIE__)) && !(defined(__clang__) || (defined(BOOST_GCC) && BOOST_GCC >= 50100))
+    // Unless the compiler can do it automatically, we have to backup ebx in 32-bit PIC/PIE code because it is reserved by the ABI.
+    // For VxWorks ebx is reserved on 64-bit as well.
+#if defined(__x86_64__)
+    uint64_t rbx = ebx;
+    __asm__ __volatile__
+    (
+        "xchgq %%rbx, %0\n\t"
+        "cpuid\n\t"
+        "xchgq %%rbx, %0\n\t"
+            : "+DS" (rbx), "+a" (eax), "+c" (ecx), "+d" (edx)
+    );
+    ebx = static_cast< uint32_t >(rbx);
+#else // defined(__x86_64__)
+    __asm__ __volatile__
+    (
+        "xchgl %%ebx, %0\n\t"
+        "cpuid\n\t"
+        "xchgl %%ebx, %0\n\t"
+            : "+DS" (ebx), "+a" (eax), "+c" (ecx), "+d" (edx)
+    );
+#endif // defined(__x86_64__)
+#else
+    __asm__ __volatile__
+    (
+        "cpuid\n\t"
+            : "+a" (eax), "+b" (ebx), "+c" (ecx), "+d" (edx)
+    );
+#endif
+#elif defined(_MSC_VER)
+    int regs[4] = {};
+    __cpuid(regs, eax);
+    eax = regs[0];
+    ebx = regs[1];
+    ecx = regs[2];
+    edx = regs[3];
+#else
+#error "Boost.Atomic: Unsupported compiler, cpuid instruction cannot be generated"
+#endif
+}
+
+} // namespace detail
+} // namespace atomics
+} // namespace boost
+
+#include <boost/atomic/detail/footer.hpp>
+
+#endif // BOOST_ARCH_X86
+
+#endif // BOOST_ATOMIC_CPUID_HPP_INCLUDED_

externals/boost/libs/atomic/src/find_address.hpp

@@ -0,0 +1,45 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+/*!
+ * \file   find_address.hpp
+ *
+ * This file contains declaration of \c find_address algorithm
+ */
+
+#ifndef BOOST_ATOMIC_FIND_ADDRESS_HPP_INCLUDED_
+#define BOOST_ATOMIC_FIND_ADDRESS_HPP_INCLUDED_
+
+#include <cstddef>
+#include <boost/predef/architecture/x86.h>
+#include <boost/atomic/detail/config.hpp>
+#include <boost/atomic/detail/int_sizes.hpp>
+#include <boost/atomic/detail/header.hpp>
+
+namespace boost {
+namespace atomics {
+namespace detail {
+
+//! \c find_address signature
+typedef std::size_t (find_address_t)(const volatile void* addr, const volatile void* const* addrs, std::size_t size);
+
+extern find_address_t find_address_generic;
+
+#if BOOST_ARCH_X86 && defined(BOOST_ATOMIC_DETAIL_SIZEOF_POINTER) && (BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8 || BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 4)
+extern find_address_t find_address_sse2;
+#if BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8
+extern find_address_t find_address_sse41;
+#endif // BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8
+#endif // BOOST_ARCH_X86 && defined(BOOST_ATOMIC_DETAIL_SIZEOF_POINTER) && (BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8 || BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 4)
+
+} // namespace detail
+} // namespace atomics
+} // namespace boost
+
+#include <boost/atomic/detail/footer.hpp>
+
+#endif // BOOST_ATOMIC_FIND_ADDRESS_HPP_INCLUDED_

externals/boost/libs/atomic/src/find_address_sse2.cpp

@@ -0,0 +1,289 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+/*!
+ * \file   find_address_sse2.cpp
+ *
+ * This file contains SSE2 implementation of the \c find_address algorithm
+ */
+
+#include <boost/predef/architecture/x86.h>
+#include <boost/atomic/detail/int_sizes.hpp>
+
+#if BOOST_ARCH_X86 && defined(BOOST_ATOMIC_DETAIL_SIZEOF_POINTER) && (BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8 || BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 4)
+
+#include <cstddef>
+#include <emmintrin.h>
+
+#include <boost/cstdint.hpp>
+#include <boost/atomic/detail/config.hpp>
+#include <boost/atomic/detail/intptr.hpp>
+#include "find_address.hpp"
+#include "x86_vector_tools.hpp"
+#include "bit_operation_tools.hpp"
+
+#include <boost/atomic/detail/header.hpp>
+
+namespace boost {
+namespace atomics {
+namespace detail {
+
+#if BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8
+namespace {
+
+BOOST_FORCEINLINE __m128i mm_pand_si128(__m128i mm1, __m128i mm2)
+{
+    // As of 2020, gcc, clang and icc prefer to generate andps instead of pand if the surrounding
+    // instructions pertain to FP domain, even if we use the _mm_and_si128 intrinsic. In our
+    // algorithm implementation, the FP instruction happen to be shufps, which is not actually
+    // restricted to FP domain (it is actually implemented in a separate MMX EU in Pentium 4 or
+    // a shuffle EU in INT domain in Core 2; on AMD K8/K10 all SSE instructions are implemented in
+    // FADD, FMUL and FMISC EUs regardless of INT/FP data types, and shufps is implemented in FADD/FMUL).
+    // In other words, there should be no domain bypass penalty between shufps and pand.
+    //
+    // This would usually not pose a problem since andps and pand have the same latency and throughput
+    // on most architectures of that age (before SSE4.1). However, it is possible that a newer architecture
+    // runs the SSE2 code path (e.g. because some weird compiler doesn't support SSE4.1 or because
+    // a hypervisor blocks SSE4.1 detection), and there pand may have a better throughput. For example,
+    // Sandy Bridge can execute 3 pand instructions per cycle, but only one andps. For this reason
+    // we prefer to generate pand and not andps.
+#if defined(__GNUC__)
+#if defined(__AVX__)
+    // Generate VEX-coded variant if the code is compiled for AVX and later.
+    __asm__("vpand %1, %0, %0\n\t" : "+x" (mm1) : "x" (mm2));
+#else
+    __asm__("pand %1, %0\n\t" : "+x" (mm1) : "x" (mm2));
+#endif
+#else
+    mm1 = _mm_and_si128(mm1, mm2);
+#endif
+    return mm1;
+}
+
+} // namespace
+#endif // BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8
+
+//! SSE2 implementation of the \c find_address algorithm
+std::size_t find_address_sse2(const volatile void* addr, const volatile void* const* addrs, std::size_t size)
+{
+#if BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8
+
+    if (size < 12u)
+        return find_address_generic(addr, addrs, size);
+
+    const __m128i mm_addr = mm_set1_epiptr((uintptr_t)addr);
+    std::size_t pos = 0u;
+    const std::size_t n = (size + 1u) & ~static_cast< std::size_t >(1u);
+    for (std::size_t m = n & ~static_cast< std::size_t >(15u); pos < m; pos += 16u)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+        __m128i mm2 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 2u));
+        __m128i mm3 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 4u));
+        __m128i mm4 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 6u));
+        __m128i mm5 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 8u));
+        __m128i mm6 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 10u));
+        __m128i mm7 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 12u));
+        __m128i mm8 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 14u));
+
+        mm1 = _mm_cmpeq_epi32(mm1, mm_addr);
+        mm2 = _mm_cmpeq_epi32(mm2, mm_addr);
+        mm3 = _mm_cmpeq_epi32(mm3, mm_addr);
+        mm4 = _mm_cmpeq_epi32(mm4, mm_addr);
+        mm5 = _mm_cmpeq_epi32(mm5, mm_addr);
+        mm6 = _mm_cmpeq_epi32(mm6, mm_addr);
+        mm7 = _mm_cmpeq_epi32(mm7, mm_addr);
+        mm8 = _mm_cmpeq_epi32(mm8, mm_addr);
+
+        __m128i mm_mask1_lo = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(2, 0, 2, 0)));
+        __m128i mm_mask1_hi = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(3, 1, 3, 1)));
+
+        __m128i mm_mask2_lo = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm3), _mm_castsi128_ps(mm4), _MM_SHUFFLE(2, 0, 2, 0)));
+        __m128i mm_mask2_hi = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm3), _mm_castsi128_ps(mm4), _MM_SHUFFLE(3, 1, 3, 1)));
+
+        __m128i mm_mask3_lo = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm5), _mm_castsi128_ps(mm6), _MM_SHUFFLE(2, 0, 2, 0)));
+        __m128i mm_mask3_hi = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm5), _mm_castsi128_ps(mm6), _MM_SHUFFLE(3, 1, 3, 1)));
+
+        __m128i mm_mask4_lo = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm7), _mm_castsi128_ps(mm8), _MM_SHUFFLE(2, 0, 2, 0)));
+        __m128i mm_mask4_hi = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm7), _mm_castsi128_ps(mm8), _MM_SHUFFLE(3, 1, 3, 1)));
+
+        mm_mask1_lo = mm_pand_si128(mm_mask1_lo, mm_mask1_hi);
+        mm_mask2_lo = mm_pand_si128(mm_mask2_lo, mm_mask2_hi);
+        mm_mask3_lo = mm_pand_si128(mm_mask3_lo, mm_mask3_hi);
+        mm_mask4_lo = mm_pand_si128(mm_mask4_lo, mm_mask4_hi);
+
+        mm_mask1_lo = _mm_packs_epi32(mm_mask1_lo, mm_mask2_lo);
+        mm_mask3_lo = _mm_packs_epi32(mm_mask3_lo, mm_mask4_lo);
+
+        mm_mask1_lo = _mm_packs_epi16(mm_mask1_lo, mm_mask3_lo);
+
+        uint32_t mask = _mm_movemask_epi8(mm_mask1_lo);
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask);
+            goto done;
+        }
+    }
+
+    if ((n - pos) >= 8u)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+        __m128i mm2 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 2u));
+        __m128i mm3 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 4u));
+        __m128i mm4 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 6u));
+
+        mm1 = _mm_cmpeq_epi32(mm1, mm_addr);
+        mm2 = _mm_cmpeq_epi32(mm2, mm_addr);
+        mm3 = _mm_cmpeq_epi32(mm3, mm_addr);
+        mm4 = _mm_cmpeq_epi32(mm4, mm_addr);
+
+        __m128i mm_mask1_lo = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(2, 0, 2, 0)));
+        __m128i mm_mask1_hi = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(3, 1, 3, 1)));
+
+        __m128i mm_mask2_lo = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm3), _mm_castsi128_ps(mm4), _MM_SHUFFLE(2, 0, 2, 0)));
+        __m128i mm_mask2_hi = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm3), _mm_castsi128_ps(mm4), _MM_SHUFFLE(3, 1, 3, 1)));
+
+        mm_mask1_lo = mm_pand_si128(mm_mask1_lo, mm_mask1_hi);
+        mm_mask2_lo = mm_pand_si128(mm_mask2_lo, mm_mask2_hi);
+
+        mm_mask1_lo = _mm_packs_epi32(mm_mask1_lo, mm_mask2_lo);
+
+        uint32_t mask = _mm_movemask_epi8(mm_mask1_lo);
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask) / 2u;
+            goto done;
+        }
+
+        pos += 8u;
+    }
+
+    if ((n - pos) >= 4u)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+        __m128i mm2 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 2u));
+
+        mm1 = _mm_cmpeq_epi32(mm1, mm_addr);
+        mm2 = _mm_cmpeq_epi32(mm2, mm_addr);
+
+        __m128i mm_mask1_lo = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(2, 0, 2, 0)));
+        __m128i mm_mask1_hi = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(3, 1, 3, 1)));
+
+        mm_mask1_lo = mm_pand_si128(mm_mask1_lo, mm_mask1_hi);
+
+        uint32_t mask = _mm_movemask_ps(_mm_castsi128_ps(mm_mask1_lo));
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask);
+            goto done;
+        }
+
+        pos += 4u;
+    }
+
+    if (pos < n)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+
+        mm1 = _mm_cmpeq_epi32(mm1, mm_addr);
+        __m128i mm_mask = _mm_shuffle_epi32(mm1, _MM_SHUFFLE(2, 3, 0, 1));
+        mm_mask = mm_pand_si128(mm_mask, mm1);
+
+        uint32_t mask = _mm_movemask_pd(_mm_castsi128_pd(mm_mask));
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask);
+            goto done;
+        }
+
+        pos += 2u;
+    }
+
+done:
+    return pos;
+
+#else // BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8
+
+    if (size < 10u)
+        return find_address_generic(addr, addrs, size);
+
+    const __m128i mm_addr = _mm_set1_epi32((uintptr_t)addr);
+    std::size_t pos = 0u;
+    const std::size_t n = (size + 3u) & ~static_cast< std::size_t >(3u);
+    for (std::size_t m = n & ~static_cast< std::size_t >(15u); pos < m; pos += 16u)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+        __m128i mm2 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 4u));
+        __m128i mm3 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 8u));
+        __m128i mm4 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 12u));
+
+        mm1 = _mm_cmpeq_epi32(mm1, mm_addr);
+        mm2 = _mm_cmpeq_epi32(mm2, mm_addr);
+        mm3 = _mm_cmpeq_epi32(mm3, mm_addr);
+        mm4 = _mm_cmpeq_epi32(mm4, mm_addr);
+
+        mm1 = _mm_packs_epi32(mm1, mm2);
+        mm3 = _mm_packs_epi32(mm3, mm4);
+
+        mm1 = _mm_packs_epi16(mm1, mm3);
+
+        uint32_t mask = _mm_movemask_epi8(mm1);
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask);
+            goto done;
+        }
+    }
+
+    if ((n - pos) >= 8u)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+        __m128i mm2 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 4u));
+
+        mm1 = _mm_cmpeq_epi32(mm1, mm_addr);
+        mm2 = _mm_cmpeq_epi32(mm2, mm_addr);
+
+        mm1 = _mm_packs_epi32(mm1, mm2);
+
+        uint32_t mask = _mm_movemask_epi8(mm1);
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask) / 2u;
+            goto done;
+        }
+
+        pos += 8u;
+    }
+
+    if (pos < n)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+
+        mm1 = _mm_cmpeq_epi32(mm1, mm_addr);
+
+        uint32_t mask = _mm_movemask_ps(_mm_castsi128_ps(mm1));
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask);
+            goto done;
+        }
+
+        pos += 4u;
+    }
+
+done:
+    return pos;
+
+#endif // BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8
+}
+
+} // namespace detail
+} // namespace atomics
+} // namespace boost
+
+#include <boost/atomic/detail/footer.hpp>
+
+#endif // BOOST_ARCH_X86 && defined(BOOST_ATOMIC_DETAIL_SIZEOF_POINTER) && (BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8 || BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 4)

externals/boost/libs/atomic/src/find_address_sse41.cpp

@@ -0,0 +1,154 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+/*!
+ * \file   find_address_sse41.cpp
+ *
+ * This file contains SSE4.1 implementation of the \c find_address algorithm
+ */
+
+#include <boost/predef/architecture/x86.h>
+#include <boost/atomic/detail/int_sizes.hpp>
+
+#if BOOST_ARCH_X86 && defined(BOOST_ATOMIC_DETAIL_SIZEOF_POINTER) && (BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8)
+
+#include <cstddef>
+#include <smmintrin.h>
+
+#include <boost/cstdint.hpp>
+#include <boost/atomic/detail/config.hpp>
+#include <boost/atomic/detail/intptr.hpp>
+#include "find_address.hpp"
+#include "x86_vector_tools.hpp"
+#include "bit_operation_tools.hpp"
+
+#include <boost/atomic/detail/header.hpp>
+
+namespace boost {
+namespace atomics {
+namespace detail {
+
+//! SSE4.1 implementation of the \c find_address algorithm
+std::size_t find_address_sse41(const volatile void* addr, const volatile void* const* addrs, std::size_t size)
+{
+    if (size < 12u)
+        return find_address_generic(addr, addrs, size);
+
+    const __m128i mm_addr = mm_set1_epiptr((uintptr_t)addr);
+    std::size_t pos = 0u;
+    const std::size_t n = (size + 1u) & ~static_cast< std::size_t >(1u);
+    for (std::size_t m = n & ~static_cast< std::size_t >(15u); pos < m; pos += 16u)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+        __m128i mm2 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 2u));
+        __m128i mm3 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 4u));
+        __m128i mm4 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 6u));
+        __m128i mm5 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 8u));
+        __m128i mm6 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 10u));
+        __m128i mm7 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 12u));
+        __m128i mm8 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 14u));
+
+        mm1 = _mm_cmpeq_epi64(mm1, mm_addr);
+        mm2 = _mm_cmpeq_epi64(mm2, mm_addr);
+        mm3 = _mm_cmpeq_epi64(mm3, mm_addr);
+        mm4 = _mm_cmpeq_epi64(mm4, mm_addr);
+        mm5 = _mm_cmpeq_epi64(mm5, mm_addr);
+        mm6 = _mm_cmpeq_epi64(mm6, mm_addr);
+        mm7 = _mm_cmpeq_epi64(mm7, mm_addr);
+        mm8 = _mm_cmpeq_epi64(mm8, mm_addr);
+
+        mm1 = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(2, 0, 2, 0)));
+        mm3 = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm3), _mm_castsi128_ps(mm4), _MM_SHUFFLE(2, 0, 2, 0)));
+        mm5 = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm5), _mm_castsi128_ps(mm6), _MM_SHUFFLE(2, 0, 2, 0)));
+        mm7 = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm7), _mm_castsi128_ps(mm8), _MM_SHUFFLE(2, 0, 2, 0)));
+
+        mm1 = _mm_packs_epi32(mm1, mm3);
+        mm5 = _mm_packs_epi32(mm5, mm7);
+
+        mm1 = _mm_packs_epi16(mm1, mm5);
+
+        uint32_t mask = _mm_movemask_epi8(mm1);
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask);
+            goto done;
+        }
+    }
+
+    if ((n - pos) >= 8u)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+        __m128i mm2 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 2u));
+        __m128i mm3 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 4u));
+        __m128i mm4 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 6u));
+
+        mm1 = _mm_cmpeq_epi64(mm1, mm_addr);
+        mm2 = _mm_cmpeq_epi64(mm2, mm_addr);
+        mm3 = _mm_cmpeq_epi64(mm3, mm_addr);
+        mm4 = _mm_cmpeq_epi64(mm4, mm_addr);
+
+        mm1 = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(2, 0, 2, 0)));
+        mm3 = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm3), _mm_castsi128_ps(mm4), _MM_SHUFFLE(2, 0, 2, 0)));
+
+        mm1 = _mm_packs_epi32(mm1, mm3);
+
+        uint32_t mask = _mm_movemask_epi8(mm1);
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask) / 2u;
+            goto done;
+        }
+
+        pos += 8u;
+    }
+
+    if ((n - pos) >= 4u)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+        __m128i mm2 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos + 2u));
+
+        mm1 = _mm_cmpeq_epi64(mm1, mm_addr);
+        mm2 = _mm_cmpeq_epi64(mm2, mm_addr);
+
+        mm1 = _mm_castps_si128(_mm_shuffle_ps(_mm_castsi128_ps(mm1), _mm_castsi128_ps(mm2), _MM_SHUFFLE(2, 0, 2, 0)));
+
+        uint32_t mask = _mm_movemask_ps(_mm_castsi128_ps(mm1));
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask);
+            goto done;
+        }
+
+        pos += 4u;
+    }
+
+    if (pos < n)
+    {
+        __m128i mm1 = _mm_load_si128(reinterpret_cast< const __m128i* >(addrs + pos));
+
+        mm1 = _mm_cmpeq_epi64(mm1, mm_addr);
+        uint32_t mask = _mm_movemask_pd(_mm_castsi128_pd(mm1));
+        if (mask)
+        {
+            pos += atomics::detail::count_trailing_zeros(mask);
+            goto done;
+        }
+
+        pos += 2u;
+    }
+
+done:
+    return pos;
+}
+
+} // namespace detail
+} // namespace atomics
+} // namespace boost
+
+#include <boost/atomic/detail/footer.hpp>
+
+#endif // BOOST_ARCH_X86 && defined(BOOST_ATOMIC_DETAIL_SIZEOF_POINTER) && (BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8)

externals/boost/libs/atomic/src/lock_pool_init1.ipp

@@ -0,0 +1,13 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+
+#if BOOST_PP_ITERATION() > 1
+,
+#endif
+
+{ BOOST_ATOMIC_LOCK_STATE_INIT }

externals/boost/libs/atomic/src/lock_pool_init256.ipp

@@ -0,0 +1,79 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+
+#if BOOST_PP_ITERATION() > 1
+,
+#endif
+
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT },
+{ BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }, { BOOST_ATOMIC_LOCK_STATE_INIT }

externals/boost/libs/atomic/src/wait_on_address.cpp

@@ -0,0 +1,113 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+/*!
+ * \file   wait_on_address.cpp
+ *
+ * This file contains implementation of runtime detection of \c WaitOnAddress and related APIs on Windows.
+ *
+ * https://docs.microsoft.com/en-us/windows/win32/api/synchapi/nf-synchapi-waitonaddress
+ * https://docs.microsoft.com/en-us/windows/win32/api/synchapi/nf-synchapi-wakebyaddresssingle
+ * https://docs.microsoft.com/en-us/windows/win32/api/synchapi/nf-synchapi-wakebyaddressall
+ */
+
+// Include boost/winapi/config.hpp first to make sure target Windows version is selected by Boost.WinAPI
+#include <boost/winapi/config.hpp>
+
+#include <boost/winapi/basic_types.hpp>
+
+#include <boost/atomic/detail/config.hpp>
+#include <boost/atomic/detail/link.hpp>
+#include <boost/atomic/detail/once_flag.hpp>
+#include <boost/atomic/detail/wait_on_address.hpp>
+
+#if BOOST_WINAPI_PARTITION_DESKTOP || BOOST_WINAPI_PARTITION_SYSTEM
+
+#include <boost/static_assert.hpp>
+#include <boost/memory_order.hpp>
+#include <boost/winapi/thread.hpp>
+#include <boost/winapi/get_proc_address.hpp>
+#include <boost/winapi/dll.hpp>
+
+#include <boost/atomic/detail/core_operations.hpp>
+
+#endif // BOOST_WINAPI_PARTITION_DESKTOP || BOOST_WINAPI_PARTITION_SYSTEM
+
+#include <boost/atomic/detail/header.hpp>
+
+namespace boost {
+namespace atomics {
+namespace detail {
+
+BOOST_ATOMIC_DECL wait_on_address_t* wait_on_address = NULL;
+BOOST_ATOMIC_DECL wake_by_address_t* wake_by_address_single = NULL;
+BOOST_ATOMIC_DECL wake_by_address_t* wake_by_address_all = NULL;
+
+#if BOOST_WINAPI_PARTITION_DESKTOP || BOOST_WINAPI_PARTITION_SYSTEM
+
+BOOST_ATOMIC_DECL once_flag wait_functions_once_flag = { 2u };
+
+BOOST_ATOMIC_DECL void initialize_wait_functions() BOOST_NOEXCEPT
+{
+    BOOST_STATIC_ASSERT_MSG(once_flag_operations::is_always_lock_free, "Boost.Atomic unsupported target platform: native atomic operations not implemented for bytes");
+
+    once_flag_operations::storage_type old_val = once_flag_operations::load(wait_functions_once_flag.m_flag, boost::memory_order_acquire);
+    while (true)
+    {
+        if (old_val == 2u)
+        {
+            if (BOOST_UNLIKELY(!once_flag_operations::compare_exchange_strong(wait_functions_once_flag.m_flag, old_val, 1u, boost::memory_order_relaxed, boost::memory_order_relaxed)))
+                continue;
+
+            boost::winapi::HMODULE_ kernel_base = boost::winapi::get_module_handle(L"api-ms-win-core-synch-l1-2-0.dll");
+            if (BOOST_LIKELY(kernel_base != NULL))
+            {
+                wait_on_address_t* woa = (wait_on_address_t*)boost::winapi::get_proc_address(kernel_base, "WaitOnAddress");
+                if (BOOST_LIKELY(woa != NULL))
+                {
+                    wake_by_address_t* wbas = (wake_by_address_t*)boost::winapi::get_proc_address(kernel_base, "WakeByAddressSingle");
+                    wake_by_address_t* wbaa = (wake_by_address_t*)boost::winapi::get_proc_address(kernel_base, "WakeByAddressAll");
+
+                    if (BOOST_LIKELY(wbas != NULL && wbaa != NULL))
+                    {
+                        wait_on_address = woa;
+                        wake_by_address_single = wbas;
+                        wake_by_address_all = wbaa;
+                    }
+                }
+            }
+
+            once_flag_operations::store(wait_functions_once_flag.m_flag, 0u, boost::memory_order_release);
+            break;
+        }
+        else if (old_val == 1u)
+        {
+            boost::winapi::SwitchToThread();
+            old_val = once_flag_operations::load(wait_functions_once_flag.m_flag, boost::memory_order_acquire);
+        }
+        else
+        {
+            break;
+        }
+    }
+}
+
+#else // BOOST_WINAPI_PARTITION_DESKTOP || BOOST_WINAPI_PARTITION_SYSTEM
+
+BOOST_ATOMIC_DECL once_flag wait_functions_once_flag = { 0u };
+
+BOOST_ATOMIC_DECL void initialize_wait_functions() BOOST_NOEXCEPT
+{
+}
+
+#endif // BOOST_WINAPI_PARTITION_DESKTOP || BOOST_WINAPI_PARTITION_SYSTEM
+
+} // namespace detail
+} // namespace atomics
+} // namespace boost
+
+#include <boost/atomic/detail/footer.hpp>

externals/boost/libs/atomic/src/x86_vector_tools.hpp

@@ -0,0 +1,52 @@
+/*
+ * Distributed under the Boost Software License, Version 1.0.
+ * (See accompanying file LICENSE_1_0.txt or copy at
+ * http://www.boost.org/LICENSE_1_0.txt)
+ *
+ * Copyright (c) 2020 Andrey Semashev
+ */
+/*!
+ * \file   x86_vector_tools.hpp
+ *
+ * This file contains common tools for x86 vectorization
+ */
+
+#ifndef BOOST_ATOMIC_X86_VECTOR_TOOLS_HPP_INCLUDED_
+#define BOOST_ATOMIC_X86_VECTOR_TOOLS_HPP_INCLUDED_
+
+#include <boost/predef/architecture/x86.h>
+#include <boost/atomic/detail/int_sizes.hpp>
+
+#if BOOST_ARCH_X86 && defined(BOOST_ATOMIC_DETAIL_SIZEOF_POINTER) && (BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8)
+
+#include <emmintrin.h>
+#include <boost/cstdint.hpp>
+#include <boost/atomic/detail/intptr.hpp>
+#include <boost/atomic/detail/config.hpp>
+
+#include <boost/atomic/detail/header.hpp>
+
+namespace boost {
+namespace atomics {
+namespace detail {
+
+BOOST_FORCEINLINE __m128i mm_set1_epiptr(uintptr_t ptr)
+{
+#if !defined(_MSC_VER) || _MSC_FULL_VER >= 190024210
+    return _mm_set1_epi64x(ptr);
+#else
+    // MSVC up until 14.0 update 3 doesn't provide _mm_set1_epi64x
+    uint32_t lo = static_cast< uint32_t >(ptr), hi = static_cast< uint32_t >(ptr >> 32);
+    return _mm_set_epi32(hi, lo, hi, lo);
+#endif
+}
+
+} // namespace detail
+} // namespace atomics
+} // namespace boost
+
+#include <boost/atomic/detail/footer.hpp>
+
+#endif // BOOST_ARCH_X86 && defined(BOOST_ATOMIC_DETAIL_SIZEOF_POINTER) && (BOOST_ATOMIC_DETAIL_SIZEOF_POINTER == 8)
+
+#endif // BOOST_ATOMIC_X86_VECTOR_TOOLS_HPP_INCLUDED_

externals/boost/libs/chrono/src/chrono.cpp

@@ -0,0 +1,15 @@
+//  chrono.cpp  --------------------------------------------------------------//
+
+//  Copyright Beman Dawes 2008
+//  Copyright Vicente J. Botet Escriba 2009-2010
+
+//  Distributed under the Boost Software License, Version 1.0.
+//  See http://www.boost.org/LICENSE_1_0.txt
+
+// define BOOST_CHRONO_SOURCE so that <boost/filesystem/config.hpp> knows
+// the library is being built (possibly exporting rather than importing code)
+
+#define BOOST_CHRONO_SOURCE
+
+#include <boost/chrono/detail/inlined/chrono.hpp>
+

externals/boost/libs/chrono/src/process_cpu_clocks.cpp

@@ -0,0 +1,18 @@
+//  boost process_cpu_clocks.cpp  -----------------------------------------------------------//
+
+//  Copyright 2009-2010 Vicente J. Botet Escriba
+
+//  Distributed under the Boost Software License, Version 1.0.
+//  See http://www.boost.org/LICENSE_1_0.txt
+
+//  See http://www.boost.org/libs/chrono for documentation.
+
+//--------------------------------------------------------------------------------------//
+
+// define BOOST_CHRONO_SOURCE so that <boost/chrono/config.hpp> knows
+// the library is being built (possibly exporting rather than importing code)
+
+#define BOOST_CHRONO_SOURCE
+
+#include <boost/chrono/detail/inlined/process_cpu_clocks.hpp>
+

externals/boost/libs/chrono/src/thread_clock.cpp

@@ -0,0 +1,19 @@
+//  boost thread_clock.cpp  -----------------------------------------------------------//
+
+//  Copyright 2010 Vicente J. Botet Escriba
+
+//  Distributed under the Boost Software License, Version 1.0.
+//  See http://www.boost.org/LICENSE_1_0.txt
+
+//  See http://www.boost.org/libs/chrono for documentation.
+
+//--------------------------------------------------------------------------------------//
+
+
+// define BOOST_CHRONO_SOURCE so that <boost/chrono/config.hpp> knows
+// the library is being built (possibly exporting rather than importing code)
+
+#define BOOST_CHRONO_SOURCE
+
+#include <boost/chrono/detail/inlined/thread_clock.hpp>
+

externals/boost/libs/date_time/src/date_time.doc

@@ -0,0 +1,72 @@
+/* Copyright (c) 2001-2004 CrystalClear Software, Inc.
+ * Use, modification and distribution is subject to the 
+ * Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or http://www.boost.org/LICENSE_1_0.txt)
+ * Author: Jeff Garland 
+ * $Date$
+ */
+
+
+/*! @mainpage Boost Date-Time Library Reference Documentation
+ *  
+ * 
+ *@section intro Introduction
+ *
+ * The Boost Date-Time Library (originally the Generic Date-Time Library or GDTL) 
+ * is a set of C++ date-time libraries based on the concepts of generic programming. 
+ * This is an online reference guide generated from the source code
+ * that provides a handy way to learn about the details of the 
+ * library.  If you are a user you should start with the 
+ * <a href="../user_docs/index.html">User Documentation</a>.
+ *
+ *@section using Using This Documentation
+ *
+ * The online documentation provides extensive information about the details
+ * of the library including:
+ * - <A href="inherits.html">Class hierarchy</A>
+ * - <A href="namespaces.html">Namespace Documentation</A>
+ * - List of <A href="files.html">source files</A>
+ * - Annotated list of classes and structs  
+ *   <A href="annotated.html">(Compound List)</A>
+ *
+ * For example, suppose you wanted to learn more about the 
+ * gregorian::greg_month class.
+ * You could alternatively browse the 
+ * - <A href="classboost_1_1gregorian_1_1greg__month.html">Class documentation page</A>
+ * - Include dependencies for greg_month.hpp
+ * - Hyperlinked and colorized source files: <A href="greg__month_8hpp-source.html">[hpp file]</A> <A href="greg__month_8cpp-source.html">[cpp file]</A>
+ *
+ * The main navigation bar at the top provides that access to many 
+ * different modes of naviation through the library.
+
+ *  
+ */
+
+//! Overall boost namespace -- library does not put any symbols here
+namespace boost {
+
+//! Namespace for basic templates and components used to construct date-time systems
+/*!
+ This namespace encapsulates various types of templates and classes used 
+ to construct coherent date-time systems including date, time, etc.  These
+ components should be considered helper components to be utilized in the
+ construction of specific date-time system implementations.  See namespace
+ gregorian for one such example.
+*/
+namespace date_time {}
+
+}
+/*! Namespace for the c++ standard library.  Library does not define any symbols in the namespace, but uses some classes from this namespace.
+*/
+namespace std {}
+
+/*!\class std::out_of_range
+   \brief Exception class defined in c++ standard library.
+  A derivative of std::logic_error and std::exception and base class for 
+  many exceptions in the library.  See also:
+
+   <a href="http://docs.mandragor.org/files/Programming_languages/Cpp/libstdcpp_v3_Source_Documentation/classstd_1_1out__of__range.html">Mandragor docs for libstdcpp_v3 std::out_of_range</a>
+*/
+
+
+

externals/boost/libs/date_time/src/gregorian/date_generators.cpp

@@ -0,0 +1,38 @@
+/* Copyright (c) 2002,2003 CrystalClear Software, Inc.
+ * Use, modification and distribution is subject to the 
+ * Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or http://www.boost.org/LICENSE_1_0.txt)
+ * Author: Jeff Garland, Bart Garst 
+ * $Date$
+ */
+
+
+
+#ifndef BOOST_DATE_TIME_SOURCE
+#define BOOST_DATE_TIME_SOURCE
+#endif
+#include "boost/date_time/date_generators.hpp"
+
+namespace boost {
+namespace date_time {
+
+  const char* const _nth_as_str[] = {"out of range", "first", "second",
+    "third", "fourth", "fifth"};
+    
+  //! Returns nth arg as string. 1 -> "first", 2 -> "second", max is 5.
+  BOOST_DATE_TIME_DECL const char* nth_as_str(int ele)
+  {
+    if(ele >= 1 && ele <= 5) {
+      return _nth_as_str[ele];
+    } 
+    else {
+      return _nth_as_str[0];
+    }
+  }
+
+} } //namespace date_time 
+
+
+
+
+

externals/boost/libs/date_time/src/gregorian/greg_month.cpp

@@ -0,0 +1,173 @@
+/* Copyright (c) 2002-2005 CrystalClear Software, Inc.
+ * Use, modification and distribution is subject to the 
+ * Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or http://www.boost.org/LICENSE_1_0.txt)
+ * Author: Jeff Garland, Bart Garst
+ * $Date$
+ */
+
+
+
+#ifndef BOOST_DATE_TIME_SOURCE
+#define BOOST_DATE_TIME_SOURCE
+#endif
+#include "boost/date_time/gregorian/greg_month.hpp"
+#include "boost/date_time/gregorian/greg_facet.hpp"
+#include "boost/date_time/date_format_simple.hpp"
+#include "boost/date_time/compiler_config.hpp"
+#if defined(BOOST_DATE_TIME_INCLUDE_LIMITED_HEADERS)
+#include "boost/date_time/gregorian/formatters_limited.hpp"
+#else
+#include "boost/date_time/gregorian/formatters.hpp"
+#endif
+#include "boost/date_time/date_parsing.hpp"
+#include "boost/date_time/gregorian/parsers.hpp"
+
+#include "greg_names.hpp"
+namespace boost {
+namespace gregorian {
+
+  /*! Returns a shared pointer to a map of Month strings & numbers.
+   * Strings are both full names and abbreviations.
+   * Ex. ("jan",1), ("february",2), etc...
+   * Note: All characters are lowercase - for case insensitivity
+   */
+  greg_month::month_map_ptr_type greg_month::get_month_map_ptr()
+  {
+    static month_map_ptr_type month_map_ptr(new greg_month::month_map_type());
+
+    if(month_map_ptr->empty()) {
+      std::string s("");
+      for(unsigned short i = 1; i <= 12; ++i) {
+        greg_month m(static_cast<month_enum>(i));
+        s = m.as_long_string();
+        s = date_time::convert_to_lower(s);
+        month_map_ptr->insert(std::make_pair(s, i));
+        s = m.as_short_string();
+        s = date_time::convert_to_lower(s);
+        month_map_ptr->insert(std::make_pair(s, i));
+      }
+    }
+    return month_map_ptr;
+  }
+
+
+  //! Returns 3 char english string for the month ex: Jan, Feb, Mar, Apr
+  const char*
+  greg_month::as_short_string() const 
+  {
+    return short_month_names[value_-1];
+  }
+  
+  //! Returns full name of month as string in english ex: January, February
+  const char*
+  greg_month::as_long_string()  const 
+  {
+    return long_month_names[value_-1];
+  }
+ 
+  //! Return special_value from string argument
+  /*! Return special_value from string argument. If argument is 
+   * not one of the special value names (defined in names.hpp), 
+   * return 'not_special' */
+  special_values special_value_from_string(const std::string& s) {
+    short i = date_time::find_match(special_value_names,
+                                    special_value_names,
+                                    date_time::NumSpecialValues,
+                                    s);
+    if(i >= date_time::NumSpecialValues) { // match not found
+      return not_special;
+    }
+    else {
+      return static_cast<special_values>(i);
+    }
+  }
+
+
+#ifndef BOOST_NO_STD_WSTRING
+  //! Returns 3 wchar_t english string for the month ex: Jan, Feb, Mar, Apr
+  const wchar_t*
+  greg_month::as_short_wstring() const 
+  {
+    return w_short_month_names[value_-1];
+  }
+  
+  //! Returns full name of month as wchar_t string in english ex: January, February
+  const wchar_t*
+  greg_month::as_long_wstring()  const 
+  {
+    return w_long_month_names[value_-1];
+  }
+#endif // BOOST_NO_STD_WSTRING
+  
+#ifndef BOOST_DATE_TIME_NO_LOCALE
+  /*! creates an all_date_names_put object with the correct set of names.
+   * This function is only called in the event of an exception where
+   * the imbued locale containing the needed facet is for some reason 
+   * unreachable.
+   */
+  BOOST_DATE_TIME_DECL 
+  boost::date_time::all_date_names_put<greg_facet_config, char>* 
+  create_facet_def(char /*type*/)
+  {
+    typedef 
+      boost::date_time::all_date_names_put<greg_facet_config, char> facet_def;
+    
+    return new facet_def(short_month_names,
+                         long_month_names,
+                         special_value_names,
+                         short_weekday_names,
+                         long_weekday_names);
+  }
+  
+  //! generates a locale with the set of gregorian name-strings of type char*
+  BOOST_DATE_TIME_DECL std::locale generate_locale(std::locale& loc, char /*type*/){
+    typedef boost::date_time::all_date_names_put<greg_facet_config, char> facet_def;
+    return std::locale(loc, new facet_def(short_month_names,
+                                          long_month_names,
+                                          special_value_names,
+                                          short_weekday_names,
+                                          long_weekday_names)
+        );
+  }
+  
+#ifndef BOOST_NO_STD_WSTRING
+  /*! creates an all_date_names_put object with the correct set of names.
+   * This function is only called in the event of an exception where
+   * the imbued locale containing the needed facet is for some reason 
+   * unreachable.
+   */
+  BOOST_DATE_TIME_DECL 
+  boost::date_time::all_date_names_put<greg_facet_config, wchar_t>* 
+  create_facet_def(wchar_t /*type*/)
+  {
+    typedef 
+      boost::date_time::all_date_names_put<greg_facet_config,wchar_t> facet_def;
+    
+    return new facet_def(w_short_month_names,
+                         w_long_month_names,
+                         w_special_value_names,
+                         w_short_weekday_names,
+                         w_long_weekday_names);
+  }
+
+  //! generates a locale with the set of gregorian name-strings of type wchar_t*
+  BOOST_DATE_TIME_DECL std::locale generate_locale(std::locale& loc, wchar_t /*type*/){
+    typedef boost::date_time::all_date_names_put<greg_facet_config, wchar_t> facet_def;
+    return std::locale(loc, new facet_def(w_short_month_names,
+                                          w_long_month_names,
+                                          w_special_value_names,
+                                          w_short_weekday_names,
+                                          w_long_weekday_names)
+        );
+  }
+#endif // BOOST_NO_STD_WSTRING
+#endif // BOOST_DATE_TIME_NO_LOCALE
+
+} } //namespace gregorian
+
+
+
+
+
+

externals/boost/libs/date_time/src/gregorian/greg_names.hpp

@@ -0,0 +1,43 @@
+/* Copyright (c) 2002-2004 CrystalClear Software, Inc.
+ * Use, modification and distribution is subject to the 
+ * Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or http://www.boost.org/LICENSE_1_0.txt)
+ * Author: Jeff Garland, Bart Garst
+ * $Date$
+ */
+
+
+
+#ifndef DATE_TIME_SRC_GREG_NAMES_HPP___
+#define DATE_TIME_SRC_GREG_NAMES_HPP___
+
+#include "boost/date_time/gregorian/greg_month.hpp"
+#include "boost/date_time/special_defs.hpp"
+namespace boost {
+namespace gregorian {
+
+
+  const char* const short_month_names[NumMonths]={"Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec", "NAM"};
+  const char* const long_month_names[NumMonths]={"January","February","March","April","May","June","July","August","September","October","November","December","NotAMonth"};
+  const char* const special_value_names[date_time::NumSpecialValues]={"not-a-date-time","-infinity","+infinity","min_date_time","max_date_time","not_special"};
+
+
+  const char* const short_weekday_names[]={"Sun", "Mon", "Tue", 
+                                           "Wed", "Thu", "Fri", "Sat"};
+  const char* const long_weekday_names[]= {"Sunday","Monday","Tuesday",
+                                           "Wednesday", "Thursday",
+                                           "Friday", "Saturday"};
+
+#ifndef BOOST_NO_STD_WSTRING
+  const wchar_t* const w_short_month_names[NumMonths]={L"Jan",L"Feb",L"Mar",L"Apr",L"May",L"Jun",L"Jul",L"Aug",L"Sep",L"Oct",L"Nov",L"Dec",L"NAM"};
+  const wchar_t* const w_long_month_names[NumMonths]={L"January",L"February",L"March",L"April",L"May",L"June",L"July",L"August",L"September",L"October",L"November",L"December",L"NotAMonth"};
+  const wchar_t* const w_special_value_names[date_time::NumSpecialValues]={L"not-a-date-time",L"-infinity",L"+infinity",L"min_date_time",L"max_date_time",L"not_special"};
+
+  const wchar_t* const w_short_weekday_names[]={L"Sun", L"Mon", L"Tue", 
+                                           L"Wed", L"Thu", L"Fri", L"Sat"};
+  const wchar_t* const w_long_weekday_names[]= {L"Sunday",L"Monday",L"Tuesday",
+                                           L"Wednesday", L"Thursday",
+                                           L"Friday", L"Saturday"};
+#endif // BOOST_NO_STD_WSTRING
+} } // boost::gregorian
+#endif // DATE_TIME_SRC_GREG_NAMES_HPP___

externals/boost/libs/date_time/src/gregorian/greg_weekday.cpp

@@ -0,0 +1,50 @@
+/* Copyright (c) 2002-2004 CrystalClear Software, Inc.
+ * Use, modification and distribution is subject to the 
+ * Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or http://www.boost.org/LICENSE_1_0.txt)
+ * Author: Jeff Garland, Bart Garst
+ * $Date$
+ */
+
+
+
+#ifndef BOOST_DATE_TIME_SOURCE
+#define BOOST_DATE_TIME_SOURCE
+#endif
+#include "boost/date_time/gregorian/greg_weekday.hpp"
+
+#include "greg_names.hpp"
+
+namespace boost {
+namespace gregorian {
+  
+  //! Return a 3 digit english string of the day of week (eg: Sun)
+  const char*
+  greg_weekday::as_short_string() const 
+  {
+    return short_weekday_names[value_];
+  }
+  //! Return a point to a long english string representing day of week
+  const char*
+  greg_weekday::as_long_string()  const 
+  {
+    return long_weekday_names[value_];
+  }
+  
+#ifndef BOOST_NO_STD_WSTRING
+  //! Return a 3 digit english wchar_t string of the day of week (eg: Sun)
+  const wchar_t*
+  greg_weekday::as_short_wstring() const 
+  {
+    return w_short_weekday_names[value_];
+  }
+  //! Return a point to a long english wchar_t string representing day of week
+  const wchar_t*
+  greg_weekday::as_long_wstring()  const 
+  {
+    return w_long_weekday_names[value_];
+  }
+#endif // BOOST_NO_STD_WSTRING
+  
+} } //namespace gregorian
+

externals/boost/libs/date_time/src/gregorian/gregorian_types.cpp

@@ -0,0 +1,62 @@
+/* Copyright (c) 2002,2003 CrystalClear Software, Inc.
+ * Use, modification and distribution is subject to the 
+ * Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or http://www.boost.org/LICENSE_1_0.txt)
+ * Author: Jeff Garland 
+ * $Date$
+ */
+
+
+/** @defgroup date_basics Date Basics
+  This page summarizes some of the key user types and functions needed 
+  to write programs using the gregorian date system.  This is not a
+  comprehensive list, but rather some key types to start exploring.
+
+
+**/ 
+
+/** @defgroup date_alg Date Algorithms / Generators
+  Date algorithms or generators are tools for generating other dates or
+  schedules of dates.  A generator function starts with some part of a
+  date such as a month and day and is supplied another part to then
+  generate a final date.
+
+**/ 
+
+/** @defgroup date_format Date Formatting
+  The functions on these page are some of the key formatting functions
+  for dates.  
+**/ 
+
+
+//File doesn't have a current purpose except to generate docs
+//and keep it changeable without recompiles
+/*! @example days_alive.cpp 
+  Calculate the number of days you have been living using durations and dates.
+*/
+/*! @example days_till_new_year.cpp 
+  Calculate the number of days till new years
+*/
+/*! @example print_month.cpp 
+  Simple utility to print out days of the month with the days of a month.  Demontstrates date iteration (date_time::date_itr). 
+*/
+/*! @example localization.cpp
+  An example showing localized stream-based I/O.
+*/
+/*! @example dates_as_strings.cpp 
+  Various parsing and output of strings (mostly supported for 
+  compilers that do not support localized streams).
+*/
+/*! @example period_calc.cpp 
+  Calculates if a date is in an 'irregular' collection of periods using
+  period calculation functions.
+*/
+/*! @example print_holidays.cpp
+  This is an example of using functors to define a holiday schedule
+ */
+/*! @example localization.cpp
+  Demonstrates the use of facets to localize date output for Gregorian dates.
+ */
+
+ 
+

externals/boost/libs/date_time/src/posix_time/posix_time_types.cpp

@@ -0,0 +1,35 @@
+
+/* Copyright (c) 2002-2004 CrystalClear Software, Inc.
+ * Use, modification and distribution is subject to the 
+ * Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or http://www.boost.org/LICENSE_1_0.txt)
+ * Author: Jeff Garland 
+ * $Date$
+ */
+
+
+//File doesn't have a current purpose except to generate docs
+//and keep it changeable without recompiles
+
+/** @defgroup time_basics Time Basics
+  
+**/ 
+
+/** @defgroup time_format Time Formatting
+  
+**/ 
+
+
+
+/*! @example local_utc_conversion.cpp
+  Demonstrate utc to local and local to utc calculations including dst.
+*/
+/*! @example time_periods.cpp Demonstrate some simple uses of time periods.
+*/
+/*! @example print_hours.cpp Demonstrate time iteration, clock retrieval, and simple calculation.
+ */
+/*! @example time_math.cpp Various types of calculations with times and time durations.
+ */
+
+ 
+

externals/boost/libs/exception/src/clone_current_exception_non_intrusive.cpp

@@ -0,0 +1,349 @@
+//Copyright (c) 2006-2009 Emil Dotchevski and Reverge Studios, Inc.
+
+//Distributed under the Boost Software License, Version 1.0. (See accompanying
+//file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
+
+//This MSVC-specific cpp file implements non-intrusive cloning of exception objects.
+//Based on an exception_ptr implementation by Anthony Williams.
+
+#ifdef BOOST_NO_EXCEPTIONS
+#error This file requires exception handling to be enabled.
+#endif
+
+#include <boost/config.hpp>
+#include <boost/exception/detail/clone_current_exception.hpp>
+
+#if defined(BOOST_ENABLE_NON_INTRUSIVE_EXCEPTION_PTR) && defined(_MSC_VER) && (defined(_M_IX86) || defined(_M_X64))
+
+//Non-intrusive cloning support implemented below, only for MSVC versions mentioned above.
+//Thanks Anthony Williams!
+//Thanks to Martin Weiss for implementing 64-bit support!
+
+#include <boost/exception/exception.hpp>
+#include <boost/shared_ptr.hpp>
+#include <windows.h>
+#include <malloc.h>
+
+namespace
+    {
+    unsigned const exception_maximum_parameters=15;
+    unsigned const exception_noncontinuable=1;
+
+#if _MSC_VER==1310
+    int const exception_info_offset=0x74;
+#elif ((_MSC_VER==1400 || _MSC_VER==1500) && !defined _M_X64)
+    int const exception_info_offset=0x80;
+#elif ((_MSC_VER==1400 || _MSC_VER==1500) && defined _M_X64)
+    int const exception_info_offset=0xE0;
+#else
+    int const exception_info_offset=-1;
+#endif
+
+    struct
+    exception_record
+        {
+        unsigned long ExceptionCode;
+        unsigned long ExceptionFlags;
+        exception_record * ExceptionRecord;
+        void * ExceptionAddress;
+        unsigned long NumberParameters;
+        ULONG_PTR ExceptionInformation[exception_maximum_parameters];
+        };
+
+    struct
+    exception_pointers
+        {
+        exception_record * ExceptionRecord;
+        void * ContextRecord;
+        };
+
+    unsigned const cpp_exception_code=0xE06D7363;
+    unsigned const cpp_exception_magic_flag=0x19930520;
+#ifdef _M_X64
+    unsigned const cpp_exception_parameter_count=4;
+#else
+    unsigned const cpp_exception_parameter_count=3;
+#endif
+
+    struct
+    dummy_exception_type
+        {
+        };
+
+    typedef int(dummy_exception_type::*normal_copy_constructor_ptr)(void * src);
+    typedef int(dummy_exception_type::*copy_constructor_with_virtual_base_ptr)(void * src,void * dst);
+    typedef void (dummy_exception_type::*destructor_ptr)();
+
+    union
+    cpp_copy_constructor
+        {
+        void * address;
+        normal_copy_constructor_ptr normal_copy_constructor;
+        copy_constructor_with_virtual_base_ptr copy_constructor_with_virtual_base;
+        };
+
+    union
+    cpp_destructor
+        {
+        void * address;
+        destructor_ptr destructor;
+        };
+
+    enum
+    cpp_type_flags
+        {
+        class_is_simple_type=1,
+        class_has_virtual_base=4
+        };
+
+    // ATTENTION: On x86 fields such as type_info and copy_constructor are really pointers
+    // but on 64bit these are 32bit offsets from HINSTANCE. Hints on the 64bit handling from
+    // http://blogs.msdn.com/b/oldnewthing/archive/2010/07/30/10044061.aspx .
+    struct
+    cpp_type_info
+        {
+        unsigned flags;
+        int type_info;
+        int this_offset;
+        int vbase_descr;
+        int vbase_offset;
+        unsigned long size;
+        int copy_constructor;
+        };
+
+    struct
+    cpp_type_info_table
+        {
+        unsigned count;
+        int info;
+        };
+
+    struct
+    cpp_exception_type
+        {
+        unsigned flags;
+        int destructor;
+        int custom_handler;
+        int type_info_table;
+        };
+
+    struct
+    exception_object_deleter
+        {
+        cpp_exception_type const & et_;
+        size_t image_base_;
+
+        exception_object_deleter( cpp_exception_type const & et, size_t image_base ):
+            et_(et),
+            image_base_(image_base)
+            {
+            }
+
+        void
+        operator()( void * obj )
+            {
+            BOOST_ASSERT(obj!=0);
+            dummy_exception_type* dummy_exception_ptr = static_cast<dummy_exception_type *>(obj);
+            if( et_.destructor )
+                {
+                cpp_destructor destructor;
+                destructor.address = reinterpret_cast<void *>(et_.destructor + image_base_);
+                (dummy_exception_ptr->*(destructor.destructor))();
+                }
+            free(obj);
+            }
+        };
+
+    cpp_type_info const &
+    get_cpp_type_info( cpp_exception_type const & et, size_t image_base )
+        {
+        cpp_type_info_table * const typearray = reinterpret_cast<cpp_type_info_table * const>(et.type_info_table + image_base);
+        cpp_type_info * const ti = reinterpret_cast<cpp_type_info * const>(typearray->info + image_base);
+        BOOST_ASSERT(ti!=0);
+        return *ti;
+        }
+
+    void
+    copy_msvc_exception( void * dst, void * src, cpp_type_info const & ti, size_t image_base )
+        {
+        cpp_copy_constructor copy_constructor;
+        copy_constructor.address = reinterpret_cast<void *>(ti.copy_constructor + image_base);
+
+        if( !(ti.flags & class_is_simple_type) && copy_constructor.normal_copy_constructor )
+            {
+            dummy_exception_type * dummy_exception_ptr = static_cast<dummy_exception_type *>(dst);
+            if( ti.flags & class_has_virtual_base )
+                (dummy_exception_ptr->*(copy_constructor.copy_constructor_with_virtual_base))(src,dst);
+            else
+                (dummy_exception_ptr->*(copy_constructor.normal_copy_constructor))(src);
+            }
+        else
+            memmove(dst,src,ti.size);
+        }
+
+    boost::shared_ptr<void>
+    clone_msvc_exception( void * src, cpp_exception_type const & et, size_t image_base )
+        {
+        BOOST_ASSERT(src!=0);
+        cpp_type_info const & ti=get_cpp_type_info(et,image_base);
+        if( void * dst = malloc(ti.size) )
+            {
+            try
+                {
+                copy_msvc_exception(dst,src,ti,image_base);
+                }
+            catch(
+            ... )
+                {
+                free(dst);
+                throw;
+                }
+            return boost::shared_ptr<void>(dst,exception_object_deleter(et,image_base));
+            }
+        else
+            throw std::bad_alloc();
+        }
+
+    class
+    cloned_exception:
+        public boost::exception_detail::clone_base
+        {
+        cloned_exception( cloned_exception const & );
+        cloned_exception & operator=( cloned_exception const & );
+
+        cpp_exception_type const & et_;
+        size_t image_base_;
+        boost::shared_ptr<void> exc_;
+
+        public:
+        cloned_exception( EXCEPTION_RECORD const * record ):
+            et_(*reinterpret_cast<cpp_exception_type const *>(record->ExceptionInformation[2])),
+            image_base_((cpp_exception_parameter_count==4) ? record->ExceptionInformation[3] : 0),
+            exc_(clone_msvc_exception(reinterpret_cast<void *>(record->ExceptionInformation[1]),et_,image_base_))
+            {
+            }
+
+        cloned_exception( void * exc, cpp_exception_type const & et, size_t image_base ):
+            et_(et),
+            image_base_(image_base),
+            exc_(clone_msvc_exception(exc,et_,image_base))
+            {
+            }
+
+        ~cloned_exception() BOOST_NOEXCEPT_OR_NOTHROW
+            {
+            }
+
+        boost::exception_detail::clone_base const *
+        clone() const
+            {
+            return new cloned_exception(exc_.get(),et_,image_base_);
+            }
+
+        void
+        rethrow() const
+            {
+            cpp_type_info const & ti=get_cpp_type_info(et_,image_base_);
+            void * dst = _alloca(ti.size);
+            copy_msvc_exception(dst,exc_.get(),ti,image_base_);
+            ULONG_PTR args[cpp_exception_parameter_count];
+            args[0]=cpp_exception_magic_flag;
+            args[1]=reinterpret_cast<ULONG_PTR>(dst);
+            args[2]=reinterpret_cast<ULONG_PTR>(&et_);
+            if (cpp_exception_parameter_count==4)
+                args[3]=image_base_;
+
+            RaiseException(cpp_exception_code,EXCEPTION_NONCONTINUABLE,cpp_exception_parameter_count,args);
+            }
+        };
+
+    bool
+    is_cpp_exception( EXCEPTION_RECORD const * record )
+        {
+        return record && 
+            (record->ExceptionCode==cpp_exception_code) &&
+            (record->NumberParameters==cpp_exception_parameter_count) &&
+            (record->ExceptionInformation[0]==cpp_exception_magic_flag);
+        }
+
+    unsigned long
+    exception_cloning_filter( int & result, boost::exception_detail::clone_base const * & ptr, void * info_ )
+        {
+        BOOST_ASSERT(exception_info_offset>=0);
+        BOOST_ASSERT(info_!=0);
+        EXCEPTION_RECORD* record = static_cast<EXCEPTION_POINTERS *>(info_)->ExceptionRecord;
+        if( is_cpp_exception(record) )
+            {
+            if( !record->ExceptionInformation[2] )
+                record = *reinterpret_cast<EXCEPTION_RECORD * *>(reinterpret_cast<char *>(_errno())+exception_info_offset);
+            if( is_cpp_exception(record) && record->ExceptionInformation[2] )
+                try
+                    {
+                    ptr = new cloned_exception(record);
+                    result = boost::exception_detail::clone_current_exception_result::success;
+                    }
+                catch(
+                std::bad_alloc & )
+                    {
+                    result = boost::exception_detail::clone_current_exception_result::bad_alloc;
+                    }
+                catch(
+                ... )
+                    {
+                    result = boost::exception_detail::clone_current_exception_result::bad_exception;
+                    }
+            }
+        return EXCEPTION_EXECUTE_HANDLER;
+        }
+    }
+
+namespace
+boost
+    {
+    namespace
+    exception_detail
+        {
+        int
+        clone_current_exception_non_intrusive( clone_base const * & cloned )
+            {
+            BOOST_ASSERT(!cloned);
+            int result = clone_current_exception_result::not_supported;
+            if( exception_info_offset>=0 )
+                {
+                 clone_base const * ptr=0;
+                __try
+                    {
+                    throw;
+                    }
+                __except(exception_cloning_filter(result,ptr,GetExceptionInformation()))
+                    {
+                    }
+                if( result==clone_current_exception_result::success )
+                    cloned=ptr;
+                }
+            BOOST_ASSERT(result!=clone_current_exception_result::success || cloned);
+            return result;
+            }
+        }
+    }
+
+#else
+
+//On all other compilers, return clone_current_exception_result::not_supported.
+//On such platforms, only the intrusive enable_current_exception() cloning will work.
+
+namespace
+boost
+    {
+    namespace
+    exception_detail
+        {
+        int
+        clone_current_exception_non_intrusive( clone_base const * & )
+            {
+            return clone_current_exception_result::not_supported;
+            }
+        }
+    }
+
+#endif

externals/boost/libs/iostreams/src/bzip2.cpp

@@ -0,0 +1,171 @@
+// (C) Copyright 2008 CodeRage, LLC (turkanis at coderage dot com)
+// (C) Copyright 2003-2007 Jonathan Turkanis
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt.)
+
+// See http://www.boost.org/libs/iostreams for documentation.
+
+// To configure Boost to work with libbz2, see the 
+// installation instructions here:
+// http://boost.org/libs/iostreams/doc/index.html?path=7
+
+// Define BOOST_IOSTREAMS_SOURCE so that <boost/iostreams/detail/config.hpp> 
+// knows that we are building the library (possibly exporting code), rather 
+// than using it (possibly importing code).
+#define BOOST_IOSTREAMS_SOURCE 
+
+#include <boost/throw_exception.hpp>
+#include <boost/iostreams/detail/config/dyn_link.hpp>
+#include <boost/iostreams/filter/bzip2.hpp> 
+#include "bzlib.h"  // Julian Seward's "bzip.h" header.
+                    // To configure Boost to work with libbz2, see the 
+                    // installation instructions here:
+                    // http://boost.org/libs/iostreams/doc/index.html?path=7
+                    
+namespace boost { namespace iostreams {
+
+namespace bzip2 {
+
+                    // Status codes
+
+const int ok                   = BZ_OK;
+const int run_ok               = BZ_RUN_OK;
+const int flush_ok             = BZ_FLUSH_OK;
+const int finish_ok            = BZ_FINISH_OK;
+const int stream_end           = BZ_STREAM_END;
+const int sequence_error       = BZ_SEQUENCE_ERROR;
+const int param_error          = BZ_PARAM_ERROR;
+const int mem_error            = BZ_MEM_ERROR;
+const int data_error           = BZ_DATA_ERROR;
+const int data_error_magic     = BZ_DATA_ERROR_MAGIC;
+const int io_error             = BZ_IO_ERROR;
+const int unexpected_eof       = BZ_UNEXPECTED_EOF;
+const int outbuff_full         = BZ_OUTBUFF_FULL;
+const int config_error         = BZ_CONFIG_ERROR;
+
+                    // Action codes
+
+const int finish               = BZ_FINISH;
+const int run                  = BZ_RUN;
+
+} // End namespace bzip2. 
+
+//------------------Implementation of bzip2_error-----------------------------//
+                    
+bzip2_error::bzip2_error(int error)
+    : BOOST_IOSTREAMS_FAILURE("bzip2 error"), error_(error) 
+    { }
+
+void bzip2_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(int error)
+{
+    switch (error) {
+    case BZ_OK: 
+    case BZ_RUN_OK: 
+    case BZ_FLUSH_OK:
+    case BZ_FINISH_OK:
+    case BZ_STREAM_END:
+        return;
+    case BZ_MEM_ERROR: 
+        boost::throw_exception(std::bad_alloc());
+    default:
+        boost::throw_exception(bzip2_error(error));
+    }
+}
+
+//------------------Implementation of bzip2_base------------------------------//
+
+namespace detail {
+
+bzip2_base::bzip2_base(const bzip2_params& params)
+    : params_(params), stream_(new bz_stream), ready_(false) 
+    { }
+
+bzip2_base::~bzip2_base() { delete static_cast<bz_stream*>(stream_); }
+
+void bzip2_base::before( const char*& src_begin, const char* src_end,
+                         char*& dest_begin, char* dest_end )
+{
+    bz_stream* s = static_cast<bz_stream*>(stream_);
+    s->next_in = const_cast<char*>(src_begin);
+    s->avail_in = static_cast<unsigned>(src_end - src_begin);
+    s->next_out = reinterpret_cast<char*>(dest_begin);
+    s->avail_out= static_cast<unsigned>(dest_end - dest_begin);
+}
+
+void bzip2_base::after(const char*& src_begin, char*& dest_begin)
+{
+    bz_stream* s = static_cast<bz_stream*>(stream_);
+    src_begin = const_cast<char*>(s->next_in);
+    dest_begin = s->next_out;
+}
+
+int bzip2_base::check_end(const char* src_begin, const char* dest_begin)
+{
+    bz_stream* s = static_cast<bz_stream*>(stream_);
+    if( src_begin == s->next_in &&
+        s->avail_in == 0 &&
+        dest_begin == s->next_out) {
+        return bzip2::unexpected_eof;
+    } else {
+        return bzip2::ok;
+    }
+}
+
+int bzip2_base::end(bool compress, std::nothrow_t)
+{
+    if (!ready_) return bzip2::ok;
+    ready_ = false;
+    bz_stream* s = static_cast<bz_stream*>(stream_);
+    return compress ? BZ2_bzCompressEnd(s) :  BZ2_bzDecompressEnd(s);
+}
+
+void bzip2_base::end(bool compress)
+{
+    bzip2_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(
+        end(compress, std::nothrow)
+    );
+}
+
+int bzip2_base::compress(int action)
+{
+    return BZ2_bzCompress(static_cast<bz_stream*>(stream_), action);
+}
+
+int bzip2_base::decompress()
+{
+    return BZ2_bzDecompress(static_cast<bz_stream*>(stream_));
+}
+
+void bzip2_base::do_init
+    ( bool compress, 
+      bzip2::alloc_func /* alloc */, 
+      bzip2::free_func /* free */, 
+      void* derived )
+{
+    bz_stream* s = static_cast<bz_stream*>(stream_);
+
+    // Current interface for customizing memory management 
+    // is non-conforming and has been disabled:
+    //    s->bzalloc = alloc;
+    //    s->bzfree = free;
+        s->bzalloc = 0;
+        s->bzfree = 0;
+    s->opaque = derived;
+    bzip2_error::check BOOST_PREVENT_MACRO_SUBSTITUTION( 
+        compress ?
+            BZ2_bzCompressInit( s,
+                                params_.block_size, 
+                                0, 
+                                params_.work_factor ) :
+            BZ2_bzDecompressInit( s, 
+                                  0, 
+                                  params_.small )
+    );
+    ready_ = true;
+}
+
+} // End namespace detail.
+
+//----------------------------------------------------------------------------//
+
+} } // End namespaces iostreams, boost.

externals/boost/libs/iostreams/src/file_descriptor.cpp

@@ -0,0 +1,621 @@
+// (C) Copyright 2008 CodeRage, LLC (turkanis at coderage dot com)
+// (C) Copyright 2003-2007 Jonathan Turkanis
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt.)
+
+// See http://www.boost.org/libs/iostreams for documentation.
+
+// Define BOOST_IOSTREAMS_SOURCE so that <boost/iostreams/detail/config.hpp>
+// knows that we are building the library (possibly exporting code), rather
+// than using it (possibly importing code).
+#define BOOST_IOSTREAMS_SOURCE
+
+#include <cassert>
+#include <cerrno>
+#include <cstdio>                                 // SEEK_SET, etc.
+#include <boost/config.hpp>                       // BOOST_JOIN
+#include <boost/iostreams/detail/error.hpp>
+#include <boost/iostreams/detail/config/dyn_link.hpp>
+#include <boost/iostreams/detail/config/rtl.hpp>  // BOOST_IOSTREAMS_FD_XXX
+#include <boost/iostreams/detail/config/windows_posix.hpp>
+#include <boost/iostreams/detail/system_failure.hpp>
+#include <boost/iostreams/detail/ios.hpp>         // openmodes, failure.
+#include <boost/iostreams/device/file_descriptor.hpp>
+#include <boost/integer_traits.hpp>
+#include <boost/throw_exception.hpp>
+
+// Must come last.
+#include <boost/iostreams/detail/config/disable_warnings.hpp>
+
+    // OS-specific headers for low-level i/o.
+
+#include <fcntl.h>       // file opening flags.
+#include <sys/stat.h>    // file access permissions.
+#ifdef BOOST_IOSTREAMS_WINDOWS
+# include <io.h>         // low-level file i/o.
+# define WINDOWS_LEAN_AND_MEAN
+# include <windows.h>
+# ifndef INVALID_SET_FILE_POINTER
+#  define INVALID_SET_FILE_POINTER ((DWORD)-1)
+# endif
+#else
+# include <sys/types.h>  // mode_t.
+# include <unistd.h>     // low-level file i/o.
+#endif
+
+namespace boost { namespace iostreams {
+
+//------------------Definition of file_descriptor_impl------------------------//
+
+namespace detail {
+
+// Contains the platform dependant implementation
+struct file_descriptor_impl {
+    // Note: These need to match file_desciptor_flags
+    enum flags {
+        never_close = 0,
+        close_on_exit = 1,
+        close_on_close = 2,
+        close_always = 3
+    };
+
+    file_descriptor_impl();
+    ~file_descriptor_impl();
+    void open(file_handle fd, flags);
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    void open(int fd, flags);
+#endif
+    void open(const detail::path&, BOOST_IOS::openmode);
+    bool is_open() const;
+    void close();
+    void close_impl(bool close_flag, bool throw_);
+    std::streamsize read(char* s, std::streamsize n);
+    std::streamsize write(const char* s, std::streamsize n);
+    std::streampos seek(stream_offset off, BOOST_IOS::seekdir way);
+    static file_handle invalid_handle();
+    file_handle  handle_;
+    int          flags_;
+};
+
+//------------------Implementation of file_descriptor_impl--------------------//
+
+file_descriptor_impl::file_descriptor_impl() 
+    : handle_(invalid_handle()), flags_(0) 
+    { }
+
+file_descriptor_impl::~file_descriptor_impl() 
+{ 
+    close_impl(flags_ & close_on_exit, false);
+}
+
+void file_descriptor_impl::open(file_handle fd, flags f)
+{
+    // Using 'close' to close the existing handle so that it will throw an
+    // exception if it fails.
+    //
+    // Only closing after assigning the new handle, so that the class will
+    // take ownership of the handle regardless of whether close throws.
+
+    file_descriptor_impl tmp;
+    tmp.handle_ = handle_;
+    tmp.flags_ = flags_ & close_on_exit ? close_on_close : never_close;
+
+    handle_ = fd;
+    flags_ = f;
+    
+    tmp.close();
+}
+
+#ifdef BOOST_IOSTREAMS_WINDOWS //---------------------------------------------//
+
+void file_descriptor_impl::open(int fd, flags f)
+{ open(reinterpret_cast<file_handle>(_get_osfhandle(fd)), f); }
+
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS //-----------------------------------//
+
+void file_descriptor_impl::open(const detail::path& p, BOOST_IOS::openmode mode)
+{
+    close_impl(flags_ & close_on_exit, true);
+
+#ifdef BOOST_IOSTREAMS_WINDOWS //---------------------------------------------//
+    DWORD dwDesiredAccess;
+    DWORD dwCreationDisposition;
+    
+    if ( !(mode & (BOOST_IOS::in | BOOST_IOS::out | BOOST_IOS::app)) ||
+            ((mode & BOOST_IOS::trunc) &&
+            ((mode & BOOST_IOS::app) || !(mode & BOOST_IOS::out))) ) {
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE("bad open mode"));
+    }
+    else if ( mode & BOOST_IOS::in ) {
+        if ( mode & BOOST_IOS::app )
+            {
+            dwCreationDisposition = OPEN_ALWAYS;
+            dwDesiredAccess = 
+                GENERIC_READ | 
+                FILE_APPEND_DATA |
+                FILE_WRITE_ATTRIBUTES |
+                FILE_WRITE_EA |
+                STANDARD_RIGHTS_WRITE |
+                SYNCHRONIZE;
+            }
+        else if ( mode & BOOST_IOS::trunc )
+            {
+            dwCreationDisposition = CREATE_ALWAYS;
+            dwDesiredAccess = GENERIC_READ | GENERIC_WRITE;
+            }
+        else if ( mode & BOOST_IOS::out )
+            {
+            dwCreationDisposition = OPEN_EXISTING;
+            dwDesiredAccess = GENERIC_READ | GENERIC_WRITE;
+            }
+        else
+            {
+            dwCreationDisposition = OPEN_EXISTING;
+            dwDesiredAccess = GENERIC_READ;
+            }
+    }
+    else {
+        if ( mode & BOOST_IOS::app )
+            {
+            dwCreationDisposition = OPEN_ALWAYS;
+            dwDesiredAccess = 
+                FILE_APPEND_DATA |
+                FILE_WRITE_ATTRIBUTES |
+                FILE_WRITE_EA |
+                STANDARD_RIGHTS_WRITE |
+                SYNCHRONIZE;
+            }
+        else
+            {
+            dwCreationDisposition = CREATE_ALWAYS;
+            dwDesiredAccess = GENERIC_WRITE;
+            }
+    }
+    
+
+    HANDLE handle = p.is_wide() ?
+        ::CreateFileW( p.c_wstr(),
+                       dwDesiredAccess,
+                       FILE_SHARE_READ | FILE_SHARE_WRITE,
+                       NULL,                   // lpSecurityAttributes
+                       dwCreationDisposition,
+                       FILE_ATTRIBUTE_NORMAL,
+                       NULL ) :                // hTemplateFile
+        ::CreateFileA( p.c_str(),
+                       dwDesiredAccess,
+                       FILE_SHARE_READ | FILE_SHARE_WRITE,
+                       NULL,                   // lpSecurityAttributes
+                       dwCreationDisposition,
+                       FILE_ATTRIBUTE_NORMAL,
+                       NULL );                 // hTemplateFile
+    if (handle != INVALID_HANDLE_VALUE) {
+        handle_ = handle;
+        flags_ = close_always;
+    } else {
+        flags_ = 0;
+        throw_system_failure("failed opening file");
+    }
+#else // #ifdef BOOST_IOSTREAMS_WINDOWS //------------------------------------//
+
+        // Calculate oflag argument to open.
+
+    int oflag = 0;
+    if ( !(mode & (BOOST_IOS::in | BOOST_IOS::out | BOOST_IOS::app)) ||
+            ((mode & BOOST_IOS::trunc) &&
+            ((mode & BOOST_IOS::app) || !(mode & BOOST_IOS::out))) ) {
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE("bad open mode"));
+    }
+    else if ( mode & BOOST_IOS::in ) {
+        if ( mode & BOOST_IOS::app )
+            oflag |= O_CREAT | O_APPEND | O_RDWR;
+        else if ( mode & BOOST_IOS::trunc )
+            oflag |= O_CREAT | O_TRUNC | O_RDWR;
+        else if ( mode & BOOST_IOS::out )
+            oflag |= O_RDWR;
+        else
+            oflag |= O_RDONLY;
+    }
+    else {
+        if ( mode & BOOST_IOS::app )
+            oflag |= O_CREAT | O_APPEND | O_WRONLY;
+        else
+            oflag |= O_CREAT | O_TRUNC | O_WRONLY;
+    }
+    #ifdef _LARGEFILE64_SOURCE
+        oflag |= O_LARGEFILE;
+    #endif
+
+        // Calculate pmode argument to open.
+
+    mode_t pmode = S_IRUSR | S_IWUSR |
+                   S_IRGRP | S_IWGRP |
+                   S_IROTH | S_IWOTH;
+
+        // Open file.
+
+    int fd = BOOST_IOSTREAMS_FD_OPEN(p.c_str(), oflag, pmode);
+    if (fd == -1) {
+        boost::throw_exception(system_failure("failed opening file"));
+    } else {
+        if ( mode & BOOST_IOS::ate ) {
+            if (BOOST_IOSTREAMS_FD_SEEK(fd, 0, SEEK_END) == -1) {
+                BOOST_IOSTREAMS_FD_CLOSE(fd);
+                boost::throw_exception(system_failure("failed opening file"));
+            }
+        }
+        handle_ = fd;
+        flags_ = close_always;
+    }
+#endif // #ifndef BOOST_IOSTREAMS_WINDOWS //----------------------------------//
+}
+
+bool file_descriptor_impl::is_open() const
+{ return handle_ != invalid_handle(); }
+
+void file_descriptor_impl::close()
+{
+    close_impl((flags_ & close_on_close) != 0, true);
+}
+
+void file_descriptor_impl::close_impl(bool close_flag, bool throw_) {
+    if (handle_ != invalid_handle()) {
+        bool success = true;
+
+        if (close_flag) {
+#ifdef BOOST_IOSTREAMS_WINDOWS
+            success = ::CloseHandle(handle_) == 1;
+#else
+            success = BOOST_IOSTREAMS_FD_CLOSE(handle_) != -1;
+#endif
+        }
+    //  Even if the close fails, we want nothing more to do with the handle
+        handle_ = invalid_handle();
+        flags_ = 0;
+        if (!success && throw_)
+            throw_system_failure("failed closing file");
+    }
+}
+
+std::streamsize file_descriptor_impl::read(char* s, std::streamsize n)
+{
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    DWORD result;
+    if (!::ReadFile(handle_, s, static_cast<DWORD>(n), &result, NULL))
+    {
+        // report EOF if the write-side of a pipe has been closed
+        if (GetLastError() == ERROR_BROKEN_PIPE)
+        {
+            result = 0;
+        }
+        else
+            throw_system_failure("failed reading");
+    }
+    return result == 0 ? -1 : static_cast<std::streamsize>(result);
+#else // #ifdef BOOST_IOSTREAMS_WINDOWS
+    errno = 0;
+    std::streamsize result = BOOST_IOSTREAMS_FD_READ(handle_, s, n);
+    if (errno != 0)
+        throw_system_failure("failed reading");
+    return result == 0 ? -1 : result;
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS
+}
+
+std::streamsize file_descriptor_impl::write(const char* s, std::streamsize n)
+{
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    DWORD ignore;
+    if (!::WriteFile(handle_, s, static_cast<DWORD>(n), &ignore, NULL))
+        throw_system_failure("failed writing");
+    return n;
+#else // #ifdef BOOST_IOSTREAMS_WINDOWS
+    int amt = BOOST_IOSTREAMS_FD_WRITE(handle_, s, n);
+    if (amt < n) // Handles blocking fd's only.
+        throw_system_failure("failed writing");
+    return n;
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS
+}
+
+std::streampos file_descriptor_impl::seek
+    (stream_offset off, BOOST_IOS::seekdir way)
+{
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    LONG lDistanceToMove = static_cast<LONG>(off & 0xffffffff);
+    LONG lDistanceToMoveHigh = static_cast<LONG>(off >> 32);
+    DWORD dwResultLow =
+        ::SetFilePointer( handle_,
+                          lDistanceToMove,
+                          &lDistanceToMoveHigh,
+                          way == BOOST_IOS::beg ?
+                              FILE_BEGIN :
+                              way == BOOST_IOS::cur ?
+                                FILE_CURRENT :
+                                FILE_END );
+    if ( dwResultLow == INVALID_SET_FILE_POINTER &&
+         ::GetLastError() != NO_ERROR )
+    {
+        boost::throw_exception(system_failure("failed seeking"));
+    } else {
+       return offset_to_position(
+                  (stream_offset(lDistanceToMoveHigh) << 32) + dwResultLow
+              );
+    }
+#else // #ifdef BOOST_IOSTREAMS_WINDOWS
+    if ( off > integer_traits<BOOST_IOSTREAMS_FD_OFFSET>::const_max ||
+         off < integer_traits<BOOST_IOSTREAMS_FD_OFFSET>::const_min )
+    {
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE("bad offset"));
+    }
+    stream_offset result =
+        BOOST_IOSTREAMS_FD_SEEK(
+            handle_,
+            static_cast<BOOST_IOSTREAMS_FD_OFFSET>(off),
+            ( way == BOOST_IOS::beg ?
+                  SEEK_SET :
+                  way == BOOST_IOS::cur ?
+                      SEEK_CUR :
+                      SEEK_END ) 
+        );
+    if (result == -1)
+        boost::throw_exception(system_failure("failed seeking"));
+    return offset_to_position(result);
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS
+}
+
+// Returns the value stored in a file_handle variable when no file is open
+file_handle file_descriptor_impl::invalid_handle()
+{
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    return INVALID_HANDLE_VALUE;
+#else
+    return -1;
+#endif
+}
+
+} // End namespace detail.
+
+//------------------Implementation of file_descriptor-------------------------//
+
+file_descriptor::file_descriptor() : pimpl_(new impl_type) { }
+
+file_descriptor::file_descriptor(handle_type fd, file_descriptor_flags f)
+    : pimpl_(new impl_type)
+{ open(fd, f); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+file_descriptor::file_descriptor(handle_type fd, bool close_on_exit)
+    : pimpl_(new impl_type)
+{ open(fd, close_on_exit); }
+#endif
+
+#ifdef BOOST_IOSTREAMS_WINDOWS //---------------------------------------------//
+
+file_descriptor::file_descriptor(int fd, file_descriptor_flags f)
+    : pimpl_(new impl_type)
+{ open(fd, f); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+file_descriptor::file_descriptor(int fd, bool close_on_exit)
+    : pimpl_(new impl_type)
+{ open(fd, close_on_exit); }
+#endif
+
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS //-----------------------------------//
+
+file_descriptor::file_descriptor( const std::string& path,
+                                  BOOST_IOS::openmode mode )
+    : pimpl_(new impl_type)
+{ open(path, mode); }
+
+file_descriptor::file_descriptor( const char* path,
+                                  BOOST_IOS::openmode mode )
+    : pimpl_(new impl_type)
+{ open(path, mode); }
+
+file_descriptor::file_descriptor(const file_descriptor& other) 
+    : pimpl_(other.pimpl_) 
+    { }
+
+void file_descriptor::open(handle_type fd, file_descriptor_flags f)
+{ pimpl_->open(fd, static_cast<detail::file_descriptor_impl::flags>(f)); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+void file_descriptor::open(handle_type fd, bool close_on_exit)
+{ pimpl_->open(fd, close_on_exit ?
+    detail::file_descriptor_impl::close_always :
+    detail::file_descriptor_impl::close_on_close); }
+#endif
+
+#ifdef BOOST_IOSTREAMS_WINDOWS //---------------------------------------------//
+
+void file_descriptor::open(int fd, file_descriptor_flags f)
+{ pimpl_->open(fd, static_cast<detail::file_descriptor_impl::flags>(f)); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+void file_descriptor::open(int fd, bool close_on_exit)
+{ pimpl_->open(fd, close_on_exit ?
+    detail::file_descriptor_impl::close_always :
+    detail::file_descriptor_impl::close_on_close); }
+#endif
+
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS //-----------------------------------//
+
+void file_descriptor::open(const std::string& path, BOOST_IOS::openmode mode)
+{ open(detail::path(path), mode); }
+
+void file_descriptor::open(const char* path, BOOST_IOS::openmode mode)
+{ open(detail::path(path), mode); }
+
+bool file_descriptor::is_open() const { return pimpl_->is_open(); }
+
+void file_descriptor::close() { pimpl_->close(); }
+
+std::streamsize file_descriptor::read(char_type* s, std::streamsize n)
+{ return pimpl_->read(s, n); }
+
+std::streamsize file_descriptor::write(const char_type* s, std::streamsize n)
+{ return pimpl_->write(s, n); }
+
+std::streampos file_descriptor::seek(stream_offset off, BOOST_IOS::seekdir way)
+{ return pimpl_->seek(off, way); }
+
+detail::file_handle file_descriptor::handle() const { return pimpl_->handle_; }
+
+void file_descriptor::init() { pimpl_.reset(new impl_type); }
+
+void file_descriptor::open(
+    const detail::path& path, 
+    BOOST_IOS::openmode mode, 
+    BOOST_IOS::openmode base )
+{
+    mode |= base;
+    pimpl_->open(path, mode);
+}
+                    
+//------------------Implementation of file_descriptor_source------------------//
+
+file_descriptor_source::file_descriptor_source(
+    handle_type fd, file_descriptor_flags f)
+{ open(fd, f); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+file_descriptor_source::file_descriptor_source(
+    handle_type fd, bool close_on_exit)
+{ open(fd, close_on_exit); }
+#endif
+
+#ifdef BOOST_IOSTREAMS_WINDOWS //---------------------------------------------//
+
+file_descriptor_source::file_descriptor_source(int fd, file_descriptor_flags f)
+{ open(fd, f); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+file_descriptor_source::file_descriptor_source(int fd, bool close_on_exit)
+{ open(fd, close_on_exit); }
+#endif
+
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS //-----------------------------------//
+
+file_descriptor_source::file_descriptor_source(
+    const std::string& path, BOOST_IOS::openmode mode)
+{ open(path, mode); }
+
+file_descriptor_source::file_descriptor_source(
+    const char* path, BOOST_IOS::openmode mode)
+{ open(path, mode); }
+
+file_descriptor_source::file_descriptor_source(
+    const file_descriptor_source& other) 
+        : file_descriptor(static_cast<const file_descriptor&>(other)) 
+    { }
+
+void file_descriptor_source::open(handle_type fd, file_descriptor_flags f)
+{ file_descriptor::open(fd, f);  }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+void file_descriptor_source::open(handle_type fd, bool close_on_exit)
+{ file_descriptor::open(fd, close_on_exit); }
+#endif
+
+#ifdef BOOST_IOSTREAMS_WINDOWS //---------------------------------------------//
+
+void file_descriptor_source::open(int fd, file_descriptor_flags f)
+{ file_descriptor::open(fd, f); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+void file_descriptor_source::open(int fd, bool close_on_exit)
+{ file_descriptor::open(fd, close_on_exit); }
+#endif
+
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS //-----------------------------------//
+
+void file_descriptor_source::open(
+    const std::string& path, BOOST_IOS::openmode mode)
+{ open(detail::path(path), mode); }
+
+void file_descriptor_source::open(
+    const char* path, BOOST_IOS::openmode mode)
+{ open(detail::path(path), mode); }
+
+void file_descriptor_source::open(
+    const detail::path& path, BOOST_IOS::openmode mode)
+{ 
+    if (mode & (BOOST_IOS::out | BOOST_IOS::trunc))
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE("invalid mode"));
+    file_descriptor::open(path, mode, BOOST_IOS::in); 
+}
+                    
+//------------------Implementation of file_descriptor_sink--------------------//
+
+file_descriptor_sink::file_descriptor_sink(
+    handle_type fd, file_descriptor_flags f)
+{ open(fd, f); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+file_descriptor_sink::file_descriptor_sink(
+    handle_type fd, bool close_on_exit)
+{ open(fd, close_on_exit); }
+#endif
+
+#ifdef BOOST_IOSTREAMS_WINDOWS //---------------------------------------------//
+
+file_descriptor_sink::file_descriptor_sink(int fd, file_descriptor_flags f)
+{ open(fd, f); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+file_descriptor_sink::file_descriptor_sink(int fd, bool close_on_exit)
+{ open(fd, close_on_exit); }
+#endif
+
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS //-----------------------------------//
+
+file_descriptor_sink::file_descriptor_sink(
+    const std::string& path, BOOST_IOS::openmode mode)
+{ open(path, mode); }
+
+file_descriptor_sink::file_descriptor_sink(
+    const char* path, BOOST_IOS::openmode mode)
+{ open(path, mode); }
+
+file_descriptor_sink::file_descriptor_sink(const file_descriptor_sink& other) 
+    : file_descriptor(static_cast<const file_descriptor&>(other)) 
+    { }
+
+void file_descriptor_sink::open(handle_type fd, file_descriptor_flags f)
+{ file_descriptor::open(fd, f);  }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+void file_descriptor_sink::open(handle_type fd, bool close_on_exit)
+{ file_descriptor::open(fd, close_on_exit); }
+#endif
+
+#ifdef BOOST_IOSTREAMS_WINDOWS //---------------------------------------------//
+
+void file_descriptor_sink::open(int fd, file_descriptor_flags f)
+{ file_descriptor::open(fd, f); }
+
+#if defined(BOOST_IOSTREAMS_USE_DEPRECATED)
+void file_descriptor_sink::open(int fd, bool close_on_exit)
+{ file_descriptor::open(fd, close_on_exit); }
+#endif
+
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS //-----------------------------------//
+
+void file_descriptor_sink::open(
+    const std::string& path, BOOST_IOS::openmode mode)
+{ open(detail::path(path), mode); }
+
+void file_descriptor_sink::open(
+    const char* path, BOOST_IOS::openmode mode)
+{ open(detail::path(path), mode); }
+
+void file_descriptor_sink::open(
+    const detail::path& path, BOOST_IOS::openmode mode)
+{ 
+    if (mode & BOOST_IOS::in)
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE("invalid mode"));
+    file_descriptor::open(path, mode, BOOST_IOS::out); 
+}
+
+#include <boost/iostreams/detail/config/enable_warnings.hpp>
+
+} } // End namespaces iostreams, boost.

externals/boost/libs/iostreams/src/gzip.cpp

@@ -0,0 +1,174 @@
+// (C) Copyright 2008 CodeRage, LLC (turkanis at coderage dot com)
+// (C) Copyright 2003-2007 Jonathan Turkanis
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt.)
+
+// See http://www.boost.org/libs/iostreams for documentation.
+
+// To configure Boost to work with libbz2, see the 
+// installation instructions here:
+// http://boost.org/libs/iostreams/doc/index.html?path=7
+
+// Define BOOST_IOSTREAMS_SOURCE so that <boost/iostreams/detail/config.hpp> 
+// knows that we are building the library (possibly exporting code), rather 
+// than using it (possibly importing code).
+#define BOOST_IOSTREAMS_SOURCE 
+
+#include <boost/iostreams/detail/config/dyn_link.hpp>
+#include <boost/iostreams/filter/gzip.hpp>
+#include <boost/throw_exception.hpp>
+
+namespace boost { namespace iostreams {
+
+//------------------Implementation of gzip_header-----------------------------//
+
+namespace detail {
+
+void gzip_header::process(char c)
+{
+    uint8_t value = static_cast<uint8_t>(c);
+    switch (state_) {
+    case s_id1:
+        if (value != gzip::magic::id1)
+            boost::throw_exception(gzip_error(gzip::bad_header));
+        state_ = s_id2;
+        break;
+    case s_id2:
+        if (value != gzip::magic::id2)
+            boost::throw_exception(gzip_error(gzip::bad_header));
+        state_ = s_cm;
+        break;
+    case s_cm:
+        if (value != gzip::method::deflate)
+            boost::throw_exception(gzip_error(gzip::bad_method));
+        state_ = s_flg;
+        break;
+    case s_flg:
+        flags_ = value;
+        state_ = s_mtime;
+        break;
+    case s_mtime:
+        mtime_ += value << (offset_ * 8);
+        if (offset_ == 3) {
+            state_ = s_xfl;
+            offset_ = 0;
+        } else {
+            ++offset_;
+        }
+        break;
+    case s_xfl:
+        state_ = s_os;
+        break;
+    case s_os:
+        os_ = value;
+        if (flags_ & gzip::flags::extra) {
+            state_ = s_xlen;
+        } else if (flags_ & gzip::flags::name) {
+            state_ = s_name;
+        } else if (flags_ & gzip::flags::comment) {
+            state_ = s_comment;
+        } else if (flags_ & gzip::flags::header_crc) {
+            state_ = s_hcrc;
+        } else {
+            state_ = s_done;
+        }
+        break;
+    case s_xlen:
+        xlen_ += value << (offset_ * 8);
+        if (offset_ == 1) {
+            state_ = s_extra;
+            offset_ = 0;
+        } else {
+            ++offset_;
+        }
+        break;
+    case s_extra:
+        if (--xlen_ == 0) {
+            if (flags_ & gzip::flags::name) {
+                state_ = s_name;
+            } else if (flags_ & gzip::flags::comment) {
+                state_ = s_comment;
+            } else if (flags_ & gzip::flags::header_crc) {
+                state_ = s_hcrc;
+            } else {
+                state_ = s_done;
+            }
+        }
+        break;
+    case s_name:
+        if (c != 0) {
+            file_name_ += c;
+        } else if (flags_ & gzip::flags::comment) {
+            state_ = s_comment;
+        } else if (flags_ & gzip::flags::header_crc) {
+            state_ = s_hcrc;
+        } else {
+            state_ = s_done;
+        }
+        break;
+    case s_comment:
+        if (c != 0) {
+            comment_ += c;
+        } else if (flags_ & gzip::flags::header_crc) {
+            state_ = s_hcrc;
+        } else {
+            state_ = s_done;
+        }
+        break;
+    case s_hcrc:
+        if (offset_ == 1) {
+            state_ = s_done;
+            offset_ = 0;
+        } else {
+            ++offset_;
+        }
+        break;
+    default:
+        BOOST_ASSERT(0);
+    }
+}
+
+void gzip_header::reset()
+{
+    file_name_.clear();
+    comment_.clear();
+    os_ = flags_ = offset_ = xlen_ = 0;
+    mtime_ = 0;
+    state_ = s_id1;
+}
+
+//------------------Implementation of gzip_footer-----------------------------//
+
+void gzip_footer::process(char c)
+{
+    uint8_t value = static_cast<uint8_t>(c);
+    if (state_ == s_crc) {
+        crc_ += value << (offset_ * 8);
+        if (offset_ == 3) {
+            state_ = s_isize;
+            offset_ = 0;
+        } else {
+            ++offset_;
+        }
+    } else if (state_ == s_isize) {
+        isize_ += value << (offset_ * 8);
+        if (offset_ == 3) {
+            state_ = s_done;
+            offset_ = 0;
+        } else {
+            ++offset_;
+        }
+    } else {
+        BOOST_ASSERT(0);
+    }
+}
+
+void gzip_footer::reset()
+{
+    crc_ = isize_ = offset_ = 0;
+    state_ = s_crc;
+}
+
+} // End namespace boost::iostreams::detail.
+
+} } // End namespaces iostreams, boost.

externals/boost/libs/iostreams/src/lzma.cpp

@@ -0,0 +1,171 @@
+// (C) Copyright Milan Svoboda 2008.
+// Originally developed under the fusecompress project.
+// Based on bzip2.cpp by:
+// (C) Copyright Jonathan Turkanis 2003.
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt.)
+
+// See http://www.boost.org/libs/iostreams for documentation.
+
+// Define BOOST_IOSTREAMS_SOURCE so that <boost/iostreams/detail/config.hpp>
+// knows that we are building the library (possibly exporting code), rather
+// than using it (possibly importing code).
+#define BOOST_IOSTREAMS_SOURCE
+
+#include <lzma.h>
+
+#include <boost/throw_exception.hpp>
+#include <boost/iostreams/detail/config/dyn_link.hpp>
+#include <boost/iostreams/filter/lzma.hpp>
+
+
+#ifndef BOOST_IOSTREAMS_LZMA_NO_MULTITHREADED
+    #if LZMA_VERSION < 50020002
+        #define BOOST_IOSTREAMS_LZMA_NO_MULTITHREADED
+    #endif
+#endif
+
+namespace boost { namespace iostreams {
+
+namespace lzma {
+
+                    // Compression levels
+
+const uint32_t no_compression       = 0;
+const uint32_t best_speed           = 1;
+const uint32_t best_compression     = 9;
+const uint32_t default_compression  = 2;
+
+                    // Status codes
+
+const int okay                 = LZMA_OK;
+const int stream_end           = LZMA_STREAM_END;
+const int unsupported_check    = LZMA_UNSUPPORTED_CHECK;
+const int mem_error            = LZMA_MEM_ERROR;
+const int options_error        = LZMA_OPTIONS_ERROR;
+const int data_error           = LZMA_DATA_ERROR;
+const int buf_error            = LZMA_BUF_ERROR;
+const int prog_error           = LZMA_PROG_ERROR;
+
+                    // Flush codes
+
+const int finish               = LZMA_FINISH;
+const int full_flush           = LZMA_FULL_FLUSH;
+const int sync_flush           = LZMA_SYNC_FLUSH;
+const int run                  = LZMA_RUN;
+
+                    // Code for current OS
+
+} // End namespace lzma.
+
+//------------------Implementation of lzma_error------------------------------//
+
+lzma_error::lzma_error(int error)
+    : BOOST_IOSTREAMS_FAILURE("lzma error"), error_(error)
+    { }
+
+void lzma_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(int error)
+{
+    switch (error) {
+    case LZMA_OK:
+    case LZMA_STREAM_END:
+        return;
+    case LZMA_MEM_ERROR:
+        boost::throw_exception(std::bad_alloc());
+    default:
+        boost::throw_exception(lzma_error(error));
+    }
+}
+
+//------------------Implementation of lzma_base-------------------------------//
+
+namespace detail {
+
+lzma_base::lzma_base()
+    : stream_(new lzma_stream), level_(lzma::default_compression), threads_(1)
+    { }
+
+lzma_base::~lzma_base() { delete static_cast<lzma_stream*>(stream_); }
+
+void lzma_base::before( const char*& src_begin, const char* src_end,
+                        char*& dest_begin, char* dest_end )
+{
+    lzma_stream* s = static_cast<lzma_stream*>(stream_);
+    s->next_in = reinterpret_cast<uint8_t*>(const_cast<char*>(src_begin));
+    s->avail_in = static_cast<size_t>(src_end - src_begin);
+    s->next_out = reinterpret_cast<uint8_t*>(dest_begin);
+    s->avail_out= static_cast<size_t>(dest_end - dest_begin);
+}
+
+void lzma_base::after(const char*& src_begin, char*& dest_begin, bool)
+{
+    lzma_stream* s = static_cast<lzma_stream*>(stream_);
+    src_begin = const_cast<const char*>(reinterpret_cast<const char*>(s->next_in));
+    dest_begin = reinterpret_cast<char*>(s->next_out);
+}
+
+int lzma_base::deflate(int action)
+{
+    return lzma_code(static_cast<lzma_stream*>(stream_), static_cast<lzma_action>(action));
+}
+
+int lzma_base::inflate(int action)
+{
+    return lzma_code(static_cast<lzma_stream*>(stream_), static_cast<lzma_action>(action));
+}
+
+void lzma_base::reset(bool compress, bool realloc)
+{
+    lzma_stream* s = static_cast<lzma_stream*>(stream_);
+    lzma_end(s);
+    if (realloc)
+    {
+        init_stream(compress);
+    }
+}
+
+void lzma_base::do_init
+    ( const lzma_params& p, bool compress,
+      lzma::alloc_func, lzma::free_func,
+      void* )
+{
+
+    level_ = p.level;
+    threads_ = p.threads;
+
+#ifndef BOOST_IOSTREAMS_LZMA_NO_MULTITHREADED
+    if (threads_ == 0) {
+        threads_ = lzma_cputhreads();
+    }
+#endif
+
+    init_stream(compress);
+}
+
+void lzma_base::init_stream(bool compress)
+{
+    lzma_stream* s = static_cast<lzma_stream*>(stream_);
+
+    memset(s, 0, sizeof(*s));
+
+#ifndef BOOST_IOSTREAMS_LZMA_NO_MULTITHREADED
+    const lzma_mt opt = { 0, threads_, 0, 1000, level_, NULL, LZMA_CHECK_CRC32 };
+#endif
+
+    lzma_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(
+        compress ?
+#ifdef BOOST_IOSTREAMS_LZMA_NO_MULTITHREADED
+            lzma_easy_encoder(s, level_, LZMA_CHECK_CRC32) :
+#else
+            lzma_stream_encoder_mt(s, &opt) :
+#endif
+            lzma_stream_decoder(s, 100 * 1024 * 1024, LZMA_CONCATENATED)
+    );
+}
+
+
+} // End namespace detail.
+
+//----------------------------------------------------------------------------//
+
+} } // End namespaces iostreams, boost.

externals/boost/libs/iostreams/src/mapped_file.cpp

@@ -0,0 +1,499 @@
+// (C) Copyright Craig Henderson 2002 'boost/memmap.hpp' from sandbox
+// (C) Copyright Jonathan Turkanis 2004.
+// (C) Copyright Jonathan Graehl 2004.
+// (C) Copyright Jorge Lodos 2008.
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt.)
+
+// Define BOOST_IOSTREAMS_SOURCE so that <boost/iostreams/detail/config.hpp>
+// knows that we are building the library (possibly exporting code), rather
+// than using it (possibly importing code).
+#define BOOST_IOSTREAMS_SOURCE
+
+#include <cassert>
+#include <stdexcept>
+#include <boost/iostreams/detail/config/rtl.hpp>
+#include <boost/iostreams/detail/config/windows_posix.hpp>
+#include <boost/iostreams/detail/file_handle.hpp>
+#include <boost/iostreams/detail/system_failure.hpp>
+#include <boost/iostreams/device/mapped_file.hpp>
+#include <boost/throw_exception.hpp>
+#include <boost/numeric/conversion/cast.hpp>
+
+#ifdef BOOST_IOSTREAMS_WINDOWS
+# define WIN32_LEAN_AND_MEAN  // Exclude rarely-used stuff from Windows headers
+# include <windows.h>
+#else
+# include <errno.h>
+# include <fcntl.h>
+# include <sys/mman.h>      // mmap, munmap.
+# include <sys/stat.h>
+# include <sys/types.h>     // struct stat.
+# include <unistd.h>        // sysconf.
+#endif
+
+namespace boost { namespace iostreams {
+
+namespace detail {
+
+// Class containing the platform-sepecific implementation
+// Invariant: The members params_, data_, size_, handle_ (and mapped_handle_ 
+// on Windows) either
+//    - all have default values (or INVALID_HANDLE_VALUE for
+//      Windows handles), or
+//    - all have values reflecting a successful mapping.
+// In the first case, error_ may be true, reflecting a recent unsuccessful
+// open or close attempt; in the second case, error_ is always false.
+class mapped_file_impl {
+public:
+    typedef mapped_file_source::size_type   size_type;
+    typedef mapped_file_source::param_type  param_type;
+    typedef mapped_file_source::mapmode     mapmode;
+    BOOST_STATIC_CONSTANT(
+        size_type, max_length =  mapped_file_source::max_length);
+    mapped_file_impl();
+    ~mapped_file_impl();
+    void open(param_type p);
+    bool is_open() const { return data_ != 0; }
+    void close();
+    bool error() const { return error_; }
+    mapmode flags() const { return params_.flags; }
+    std::size_t size() const { return static_cast<std::size_t>(size_); }
+    char* data() const { return data_; }
+    void resize(stream_offset new_size);
+    static int alignment();
+private:
+    void open_file(param_type p);
+    void try_map_file(param_type p);
+    void map_file(param_type& p);
+    bool unmap_file();
+    void clear(bool error);
+    void cleanup_and_throw(const char* msg);
+    param_type     params_;
+    char*          data_;
+    stream_offset  size_;
+    file_handle    handle_;
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    file_handle    mapped_handle_;
+#endif
+    bool           error_;
+};
+
+mapped_file_impl::mapped_file_impl() { clear(false); }
+
+mapped_file_impl::~mapped_file_impl() 
+{ try { close(); } catch (...) { } }
+
+void mapped_file_impl::open(param_type p)
+{
+    if (is_open())
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE("file already open"));
+    p.normalize();
+    open_file(p);
+    map_file(p);  // May modify p.hint
+    params_ = p;
+}
+
+void mapped_file_impl::close()
+{
+    if (data_ == 0)
+        return;
+    bool error = false;
+    error = !unmap_file() || error;
+    error = 
+        #ifdef BOOST_IOSTREAMS_WINDOWS
+            !::CloseHandle(handle_) 
+        #else
+            ::close(handle_) != 0 
+        #endif
+            || error;
+    clear(error);
+    if (error)
+        throw_system_failure("failed closing mapped file");
+}
+
+void mapped_file_impl::resize(stream_offset new_size)
+{
+    if (!is_open())
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE("file is closed"));
+    if (flags() & mapped_file::priv)
+        boost::throw_exception(
+            BOOST_IOSTREAMS_FAILURE("can't resize private mapped file")
+        );
+    if (!(flags() & mapped_file::readwrite))
+        boost::throw_exception(
+            BOOST_IOSTREAMS_FAILURE("can't resize readonly mapped file")
+        );
+    if (params_.offset >= new_size)
+        boost::throw_exception(
+            BOOST_IOSTREAMS_FAILURE("can't resize below mapped offset")
+        );
+    if (!unmap_file())
+        cleanup_and_throw("failed unmapping file");
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    stream_offset offset = ::SetFilePointer(handle_, 0, NULL, FILE_CURRENT);
+    if (offset == INVALID_SET_FILE_POINTER && ::GetLastError() != NO_ERROR)
+         cleanup_and_throw("failed querying file pointer");
+    LONG sizehigh = (new_size >> (sizeof(LONG) * 8));
+    LONG sizelow = (new_size & 0xffffffff);
+    DWORD result = ::SetFilePointer(handle_, sizelow, &sizehigh, FILE_BEGIN);
+    if ((result == INVALID_SET_FILE_POINTER && ::GetLastError() != NO_ERROR)
+        || !::SetEndOfFile(handle_))
+        cleanup_and_throw("failed resizing mapped file");
+    sizehigh = (offset >> (sizeof(LONG) * 8));
+    sizelow = (offset & 0xffffffff);
+    ::SetFilePointer(handle_, sizelow, &sizehigh, FILE_BEGIN);
+#else
+    if (BOOST_IOSTREAMS_FD_TRUNCATE(handle_, new_size) == -1)
+        cleanup_and_throw("failed resizing mapped file");
+#endif
+    size_ = new_size;
+    param_type p(params_);
+    map_file(p);  // May modify p.hint
+    params_ = p;
+}
+
+int mapped_file_impl::alignment()
+{
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    SYSTEM_INFO info;
+    ::GetSystemInfo(&info);
+    return static_cast<int>(info.dwAllocationGranularity);
+#else
+    return static_cast<int>(sysconf(_SC_PAGESIZE));
+#endif
+}
+
+void mapped_file_impl::open_file(param_type p)
+{
+    bool readonly = p.flags != mapped_file::readwrite;
+#ifdef BOOST_IOSTREAMS_WINDOWS
+
+    // Open file
+    DWORD dwDesiredAccess =
+        readonly ?
+            GENERIC_READ :
+            (GENERIC_READ | GENERIC_WRITE);
+    DWORD dwCreationDisposition = (p.new_file_size != 0 && !readonly) ? 
+        CREATE_ALWAYS : 
+        OPEN_EXISTING;
+    DWORD dwFlagsandAttributes =
+        readonly ?
+            FILE_ATTRIBUTE_READONLY :
+            FILE_ATTRIBUTE_TEMPORARY;
+    handle_ = p.path.is_wide() ?
+        ::CreateFileW( 
+            p.path.c_wstr(),
+            dwDesiredAccess,
+            FILE_SHARE_READ,
+            NULL,
+            dwCreationDisposition,
+            dwFlagsandAttributes,
+            NULL ) :
+        ::CreateFileA( 
+            p.path.c_str(),
+            dwDesiredAccess,
+            FILE_SHARE_READ,
+            NULL,
+            dwCreationDisposition,
+            dwFlagsandAttributes,
+            NULL );
+    if (handle_ == INVALID_HANDLE_VALUE)
+        cleanup_and_throw("failed opening file");
+
+    // Set file size
+    if (p.new_file_size != 0 && !readonly) {
+        LONG sizehigh = (p.new_file_size >> (sizeof(LONG) * 8));
+        LONG sizelow = (p.new_file_size & 0xffffffff);
+        DWORD result = ::SetFilePointer(handle_, sizelow, &sizehigh, FILE_BEGIN);
+        if ((result == INVALID_SET_FILE_POINTER && ::GetLastError() != NO_ERROR)
+            || !::SetEndOfFile(handle_))
+            cleanup_and_throw("failed setting file size");
+    }
+
+    // Determine file size. Dynamically locate GetFileSizeEx for compatibility
+    // with old Platform SDK (thanks to Pavel Vozenilik).
+    typedef BOOL (WINAPI *func)(HANDLE, PLARGE_INTEGER);
+    HMODULE hmod = ::GetModuleHandleA("kernel32.dll");
+    func get_size =
+        reinterpret_cast<func>(::GetProcAddress(hmod, "GetFileSizeEx"));
+    if (get_size) {
+        LARGE_INTEGER info;
+        if (get_size(handle_, &info)) {
+            boost::intmax_t size =
+                ( (static_cast<boost::intmax_t>(info.HighPart) << 32) |
+                  info.LowPart );
+            size_ =
+                static_cast<std::size_t>(
+                    p.length != max_length ?
+                        std::min<boost::intmax_t>(p.length, size) :
+                        size
+                );
+        } else {
+            cleanup_and_throw("failed querying file size");
+            return;
+        }
+    } else {
+        DWORD hi;
+        DWORD low;
+        if ( (low = ::GetFileSize(handle_, &hi))
+                 !=
+             INVALID_FILE_SIZE )
+        {
+            boost::intmax_t size =
+                (static_cast<boost::intmax_t>(hi) << 32) | low;
+            size_ =
+                static_cast<std::size_t>(
+                    p.length != max_length ?
+                        std::min<boost::intmax_t>(p.length, size) :
+                        size
+                );
+        } else {
+            cleanup_and_throw("failed querying file size");
+            return;
+        }
+    }
+#else // #ifdef BOOST_IOSTREAMS_WINDOWS
+
+    // Open file
+    int flags = (readonly ? O_RDONLY : O_RDWR);
+    if (p.new_file_size != 0 && !readonly)
+        flags |= (O_CREAT | O_TRUNC);
+    #ifdef _LARGEFILE64_SOURCE
+        flags |= O_LARGEFILE;
+    #endif
+    errno = 0;
+    if (p.path.is_wide()) { errno = EINVAL; cleanup_and_throw("wide path not supported here"); } // happens on CYGWIN
+    handle_ = ::open(p.path.c_str(), flags, S_IRWXU);
+    if (errno != 0)
+        cleanup_and_throw("failed opening file");
+
+    //--------------Set file size---------------------------------------------//
+
+    if (p.new_file_size != 0 && !readonly)
+        if (BOOST_IOSTREAMS_FD_TRUNCATE(handle_, p.new_file_size) == -1)
+            cleanup_and_throw("failed setting file size");
+
+    //--------------Determine file size---------------------------------------//
+
+    bool success = true;
+    if (p.length != max_length) {
+        size_ = p.length;
+    } else {
+        struct BOOST_IOSTREAMS_FD_STAT info;
+        success = ::BOOST_IOSTREAMS_FD_FSTAT(handle_, &info) != -1;
+        size_ = info.st_size;
+    }
+    if (!success)
+        cleanup_and_throw("failed querying file size");
+#endif // #ifdef BOOST_IOSTREAMS_WINDOWS
+}
+
+void mapped_file_impl::try_map_file(param_type p)
+{
+    bool priv = p.flags == mapped_file::priv;
+    bool readonly = p.flags == mapped_file::readonly;
+#ifdef BOOST_IOSTREAMS_WINDOWS
+
+    // Create mapping
+    DWORD protect = priv ? 
+        PAGE_WRITECOPY : 
+        readonly ? 
+            PAGE_READONLY : 
+            PAGE_READWRITE;
+    mapped_handle_ = 
+        ::CreateFileMappingA( 
+            handle_, 
+            NULL,
+            protect,
+            0, 
+            0, 
+            NULL );
+    if (mapped_handle_ == NULL)
+        cleanup_and_throw("failed create mapping");
+
+    // Access data
+    DWORD access = priv ? 
+        FILE_MAP_COPY : 
+        readonly ? 
+            FILE_MAP_READ : 
+            FILE_MAP_WRITE;
+    void* data =
+        ::MapViewOfFileEx( 
+            mapped_handle_,
+            access,
+            (DWORD) (p.offset >> 32),
+            (DWORD) (p.offset & 0xffffffff),
+            (SIZE_T) (numeric_cast<size_type>(size_) != max_length ? size_ : 0),
+            (LPVOID) p.hint );
+    if (!data)
+        cleanup_and_throw("failed mapping view");
+#else
+    void* data = 
+        ::BOOST_IOSTREAMS_FD_MMAP( 
+            const_cast<char*>(p.hint), 
+            size_,
+            readonly ? PROT_READ : (PROT_READ | PROT_WRITE),
+            priv ? MAP_PRIVATE : MAP_SHARED,
+            handle_, 
+            p.offset );
+    if (data == MAP_FAILED)
+        cleanup_and_throw("failed mapping file");
+#endif
+    data_ = static_cast<char*>(data);
+}
+
+void mapped_file_impl::map_file(param_type& p)
+{
+    try {
+        try_map_file(p);
+    } catch (const std::exception&) {
+        if (p.hint) {
+            p.hint = 0;
+            try_map_file(p);
+        } else {
+            throw;
+        }
+    }
+}
+
+bool mapped_file_impl::unmap_file()
+{
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    bool error = false;
+    error = !::UnmapViewOfFile(data_) || error;
+    error = !::CloseHandle(mapped_handle_) || error;
+    mapped_handle_ = NULL;
+    return !error;
+#else
+    return ::munmap(data_, size_) == 0;
+#endif
+}
+
+void mapped_file_impl::clear(bool error)
+{
+    params_ = param_type();
+    data_ = 0;
+    size_ = 0;
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    handle_ = INVALID_HANDLE_VALUE;
+    mapped_handle_ = NULL;
+#else
+    handle_ = 0;
+#endif
+    error_ = error;
+}
+
+// Called when an error is encountered during the execution of open_file or
+// map_file
+void mapped_file_impl::cleanup_and_throw(const char* msg)
+{
+#ifdef BOOST_IOSTREAMS_WINDOWS
+    DWORD error = GetLastError();
+    if (mapped_handle_ != NULL)
+        ::CloseHandle(mapped_handle_);
+    if (handle_ != INVALID_HANDLE_VALUE)
+        ::CloseHandle(handle_);
+    SetLastError(error);
+#else
+    int error = errno;
+    if (handle_ != 0)
+        ::close(handle_);
+    errno = error;
+#endif
+    clear(true);
+    boost::iostreams::detail::throw_system_failure(msg);
+}
+
+//------------------Implementation of mapped_file_params_base-----------------//
+
+void mapped_file_params_base::normalize()
+{
+    if (mode && flags)
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE(
+            "at most one of 'mode' and 'flags' may be specified"
+        ));
+    if (flags) {
+        switch (flags) {
+        case mapped_file::readonly:
+        case mapped_file::readwrite:
+        case mapped_file::priv:
+            break;
+        default:
+            boost::throw_exception(BOOST_IOSTREAMS_FAILURE("invalid flags"));
+        }
+    } else {
+        flags = (mode & BOOST_IOS::out) ? 
+            mapped_file::readwrite :
+            mapped_file::readonly;
+        mode = BOOST_IOS::openmode();
+    }
+    if (offset < 0)
+        boost::throw_exception(BOOST_IOSTREAMS_FAILURE("invalid offset"));
+    if (new_file_size < 0)
+        boost::throw_exception(
+            BOOST_IOSTREAMS_FAILURE("invalid new file size")
+        );
+}
+
+} // End namespace detail.
+
+//------------------Implementation of mapped_file_source----------------------//
+
+mapped_file_source::mapped_file_source() 
+    : pimpl_(new impl_type)
+    { }
+
+mapped_file_source::mapped_file_source(const mapped_file_source& other)
+    : pimpl_(other.pimpl_)
+    { }
+
+bool mapped_file_source::is_open() const
+{ return pimpl_->is_open(); }
+
+void mapped_file_source::close() { pimpl_->close(); }
+
+// safe_bool is explicitly qualified below to please msvc 7.1
+mapped_file_source::operator mapped_file_source::safe_bool() const
+{ return pimpl_->error() ? &safe_bool_helper::x : 0; }
+
+bool mapped_file_source::operator!() const
+{ return pimpl_->error(); }
+
+mapped_file_source::mapmode mapped_file_source::flags() const 
+{ return pimpl_->flags(); }
+
+mapped_file_source::size_type mapped_file_source::size() const
+{ return pimpl_->size(); }
+
+const char* mapped_file_source::data() const { return pimpl_->data(); }
+
+const char* mapped_file_source::begin() const { return data(); }
+
+const char* mapped_file_source::end() const { return data() + size(); }
+int mapped_file_source::alignment()
+{ return detail::mapped_file_impl::alignment(); }
+
+void mapped_file_source::init() { pimpl_.reset(new impl_type); }
+
+void mapped_file_source::open_impl(const param_type& p)
+{ pimpl_->open(p); }
+
+//------------------Implementation of mapped_file-----------------------------//
+
+mapped_file::mapped_file(const mapped_file& other)
+    : delegate_(other.delegate_)
+    { }
+
+void mapped_file::resize(stream_offset new_size)
+{ delegate_.pimpl_->resize(new_size); }
+
+//------------------Implementation of mapped_file_sink------------------------//
+
+mapped_file_sink::mapped_file_sink(const mapped_file_sink& other)
+    : mapped_file(static_cast<const mapped_file&>(other))
+    { }
+
+//----------------------------------------------------------------------------//
+
+} } // End namespaces iostreams, boost.

externals/boost/libs/iostreams/src/zlib.cpp

@@ -0,0 +1,188 @@
+// (C) Copyright 2008 CodeRage, LLC (turkanis at coderage dot com)
+// (C) Copyright 2003-2007 Jonathan Turkanis
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt.)
+
+// See http://www.boost.org/libs/iostreams for documentation.
+
+// To configure Boost to work with zlib, see the 
+// installation instructions here:
+// http://boost.org/libs/iostreams/doc/index.html?path=7
+
+// Define BOOST_IOSTREAMS_SOURCE so that <boost/iostreams/detail/config.hpp> 
+// knows that we are building the library (possibly exporting code), rather 
+// than using it (possibly importing code).
+#define BOOST_IOSTREAMS_SOURCE 
+
+#include <boost/throw_exception.hpp>
+#include <boost/iostreams/detail/config/dyn_link.hpp>
+#include <boost/iostreams/filter/zlib.hpp> 
+#include "zlib.h"   // Jean-loup Gailly's and Mark Adler's "zlib.h" header.
+                    // To configure Boost to work with zlib, see the 
+                    // installation instructions here:
+                    // http://boost.org/libs/iostreams/doc/index.html?path=7
+
+namespace boost { namespace iostreams {
+
+namespace zlib {
+
+                    // Compression levels
+
+const int no_compression       = Z_NO_COMPRESSION;
+const int best_speed           = Z_BEST_SPEED;
+const int best_compression     = Z_BEST_COMPRESSION;
+const int default_compression  = Z_DEFAULT_COMPRESSION;
+
+                    // Compression methods
+
+const int deflated             = Z_DEFLATED;
+
+                    // Compression strategies
+
+const int default_strategy     = Z_DEFAULT_STRATEGY;
+const int filtered             = Z_FILTERED;
+const int huffman_only         = Z_HUFFMAN_ONLY;
+
+                    // Status codes
+
+const int okay                 = Z_OK;
+const int stream_end           = Z_STREAM_END;
+const int stream_error         = Z_STREAM_ERROR;
+const int version_error        = Z_VERSION_ERROR;
+const int data_error           = Z_DATA_ERROR;
+const int mem_error            = Z_MEM_ERROR;
+const int buf_error            = Z_BUF_ERROR;
+
+                    // Flush codes
+
+const int finish               = Z_FINISH;
+const int no_flush             = Z_NO_FLUSH;
+const int sync_flush           = Z_SYNC_FLUSH;
+
+                    // Code for current OS
+
+//const int os_code              = OS_CODE;
+
+} // End namespace zlib. 
+
+//------------------Implementation of zlib_error------------------------------//
+                    
+zlib_error::zlib_error(int error) 
+    : BOOST_IOSTREAMS_FAILURE("zlib error"), error_(error) 
+    { }
+
+void zlib_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(int error)
+{
+    switch (error) {
+    case Z_OK: 
+    case Z_STREAM_END: 
+    //case Z_BUF_ERROR: 
+        return;
+    case Z_MEM_ERROR: 
+        boost::throw_exception(std::bad_alloc());
+    default:
+        boost::throw_exception(zlib_error(error));
+        ;
+    }
+}
+
+//------------------Implementation of zlib_base-------------------------------//
+
+namespace detail {
+
+zlib_base::zlib_base()
+    : stream_(new z_stream), calculate_crc_(false), crc_(0), crc_imp_(0),
+      total_in_(0), total_out_(0)
+    { }
+
+zlib_base::~zlib_base() { delete static_cast<z_stream*>(stream_); }
+
+void zlib_base::before( const char*& src_begin, const char* src_end,
+                        char*& dest_begin, char* dest_end )
+{
+    z_stream* s = static_cast<z_stream*>(stream_);
+    s->next_in = reinterpret_cast<zlib::byte*>(const_cast<char*>(src_begin));
+    s->avail_in = static_cast<zlib::uint>(src_end - src_begin);
+    s->next_out = reinterpret_cast<zlib::byte*>(dest_begin);
+    s->avail_out= static_cast<zlib::uint>(dest_end - dest_begin);
+}
+
+void zlib_base::after(const char*& src_begin, char*& dest_begin, bool compress)
+{
+    z_stream* s = static_cast<z_stream*>(stream_);
+    const char* next_in = reinterpret_cast<const char*>(s->next_in);
+    char* next_out = reinterpret_cast<char*>(s->next_out);
+    if (calculate_crc_) {
+        const zlib::byte* buf = compress ?
+            reinterpret_cast<const zlib::byte*>(src_begin) :
+            reinterpret_cast<const zlib::byte*>(
+                const_cast<const char*>(dest_begin)
+            );
+        zlib::uint length = compress ?
+            static_cast<zlib::uint>(next_in - src_begin) :
+            static_cast<zlib::uint>(next_out - dest_begin);
+        crc_ = crc_imp_ = crc32(crc_imp_, buf, length);
+    }
+    total_in_ = s->total_in;
+    total_out_ = s->total_out;
+    src_begin = next_in;
+    dest_begin = next_out;
+}
+
+int zlib_base::xdeflate(int flush)
+{ 
+    return ::deflate(static_cast<z_stream*>(stream_), flush);
+}
+
+int zlib_base::xinflate(int flush)
+{ 
+    return ::inflate(static_cast<z_stream*>(stream_), flush);
+}
+
+void zlib_base::reset(bool compress, bool realloc)
+{
+    z_stream* s = static_cast<z_stream*>(stream_);
+    // Undiagnosed bug:
+    // deflateReset(), etc., return Z_DATA_ERROR
+    //zlib_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(
+        realloc ?
+            (compress ? deflateReset(s) : inflateReset(s)) :
+            (compress ? deflateEnd(s) : inflateEnd(s))
+                ;
+    //);
+    crc_imp_ = 0;
+}
+
+void zlib_base::do_init
+    ( const zlib_params& p, bool compress, 
+      zlib::xalloc_func /* alloc */, zlib::xfree_func /* free*/, 
+      void* derived )
+{
+    calculate_crc_ = p.calculate_crc;
+    z_stream* s = static_cast<z_stream*>(stream_);
+
+    // Current interface for customizing memory management 
+    // is non-conforming and has been disabled:
+    //    s->zalloc = alloc;
+    //    s->zfree = free;
+        s->zalloc = 0;
+        s->zfree = 0;
+    s->opaque = derived;
+    int window_bits = p.noheader? -p.window_bits : p.window_bits;
+    zlib_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(
+        compress ?
+            deflateInit2( s, 
+                          p.level,
+                          p.method,
+                          window_bits,
+                          p.mem_level,
+                          p.strategy ) :
+            inflateInit2(s, window_bits)
+    );
+}
+
+} // End namespace detail.
+
+//----------------------------------------------------------------------------//
+
+} } // End namespaces iostreams, boost.

externals/boost/libs/iostreams/src/zstd.cpp

@@ -0,0 +1,166 @@
+// (C) Copyright Reimar Döffinger 2018.
+// Based on zstd.cpp by:
+// (C) Copyright Milan Svoboda 2008.
+// (C) Copyright Jonathan Turkanis 2003.
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt.)
+
+// See http://www.boost.org/libs/iostreams for documentation.
+
+// Define BOOST_IOSTREAMS_SOURCE so that <boost/iostreams/detail/config.hpp>
+// knows that we are building the library (possibly exporting code), rather
+// than using it (possibly importing code).
+#define BOOST_IOSTREAMS_SOURCE
+
+#include <zstd.h>
+
+#include <boost/throw_exception.hpp>
+#include <boost/iostreams/detail/config/dyn_link.hpp>
+#include <boost/iostreams/filter/zstd.hpp>
+
+namespace boost { namespace iostreams {
+
+namespace zstd {
+                    // Compression levels
+
+const uint32_t best_speed           = 1;
+const uint32_t best_compression     = 19;
+const uint32_t default_compression  = 3;
+
+                    // Status codes
+
+const int okay                 = 0;
+const int stream_end           = 1;
+
+                    // Flush codes
+
+const int finish               = 0;
+const int flush                = 1;
+const int run                  = 2;
+} // End namespace zstd.
+
+//------------------Implementation of zstd_error------------------------------//
+
+zstd_error::zstd_error(size_t error)
+    : BOOST_IOSTREAMS_FAILURE(ZSTD_getErrorName(error)), error_(error)
+    { }
+
+void zstd_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(size_t error)
+{
+    if (ZSTD_isError(error))
+        boost::throw_exception(zstd_error(error));
+}
+
+//------------------Implementation of zstd_base-------------------------------//
+
+namespace detail {
+
+zstd_base::zstd_base()
+    : cstream_(ZSTD_createCStream()), dstream_(ZSTD_createDStream()), in_(new ZSTD_inBuffer), out_(new ZSTD_outBuffer), eof_(0)
+    { }
+
+zstd_base::~zstd_base()
+{
+    ZSTD_freeCStream(static_cast<ZSTD_CStream *>(cstream_));
+    ZSTD_freeDStream(static_cast<ZSTD_DStream *>(dstream_));
+    delete static_cast<ZSTD_inBuffer*>(in_);
+    delete static_cast<ZSTD_outBuffer*>(out_);
+}
+
+void zstd_base::before( const char*& src_begin, const char* src_end,
+                        char*& dest_begin, char* dest_end )
+{
+    ZSTD_inBuffer *in = static_cast<ZSTD_inBuffer *>(in_);
+    ZSTD_outBuffer *out = static_cast<ZSTD_outBuffer *>(out_);
+    in->src = src_begin;
+    in->size = static_cast<size_t>(src_end - src_begin);
+    in->pos = 0;
+    out->dst = dest_begin;
+    out->size = static_cast<size_t>(dest_end - dest_begin);
+    out->pos = 0;
+}
+
+void zstd_base::after(const char*& src_begin, char*& dest_begin, bool)
+{
+    ZSTD_inBuffer *in = static_cast<ZSTD_inBuffer *>(in_);
+    ZSTD_outBuffer *out = static_cast<ZSTD_outBuffer *>(out_);
+    src_begin = reinterpret_cast<const char*>(in->src) + in->pos;
+    dest_begin = reinterpret_cast<char*>(out->dst) + out->pos;
+}
+
+int zstd_base::deflate(int action)
+{
+    ZSTD_CStream *s = static_cast<ZSTD_CStream *>(cstream_);
+    ZSTD_inBuffer *in = static_cast<ZSTD_inBuffer *>(in_);
+    ZSTD_outBuffer *out = static_cast<ZSTD_outBuffer *>(out_);
+    // Ignore spurious extra calls.
+    // Note size > 0 will trigger an error in this case.
+    if (eof_ && in->size == 0) return zstd::stream_end;
+    size_t result = ZSTD_compressStream(s, out, in);
+    zstd_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(result);
+    if (action != zstd::run)
+    {
+        result = action == zstd::finish ? ZSTD_endStream(s, out) : ZSTD_flushStream(s, out);
+        zstd_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(result);
+        eof_ = action == zstd::finish && result == 0;
+        return result == 0 ? zstd::stream_end : zstd::okay;
+    }
+    return zstd::okay;
+}
+
+int zstd_base::inflate(int action)
+{
+    ZSTD_DStream *s = static_cast<ZSTD_DStream *>(dstream_);
+    ZSTD_inBuffer *in = static_cast<ZSTD_inBuffer *>(in_);
+    ZSTD_outBuffer *out = static_cast<ZSTD_outBuffer *>(out_);
+    // need loop since iostream code cannot handle short reads
+    do {
+        size_t result = ZSTD_decompressStream(s, out, in);
+        zstd_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(result);
+    } while (in->pos < in->size && out->pos < out->size);
+    return action == zstd::finish && in->size == 0 && out->pos == 0 ? zstd::stream_end : zstd::okay;
+}
+
+void zstd_base::reset(bool compress, bool realloc)
+{
+    ZSTD_inBuffer *in = static_cast<ZSTD_inBuffer *>(in_);
+    ZSTD_outBuffer *out = static_cast<ZSTD_outBuffer *>(out_);
+    if (realloc)
+    {
+        memset(in, 0, sizeof(*in));
+        memset(out, 0, sizeof(*out));
+        eof_ = 0;
+
+        zstd_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(
+            compress ?
+                ZSTD_initCStream(static_cast<ZSTD_CStream *>(cstream_), level) :
+                ZSTD_initDStream(static_cast<ZSTD_DStream *>(dstream_))
+        );
+    }
+}
+
+void zstd_base::do_init
+    ( const zstd_params& p, bool compress,
+      zstd::alloc_func, zstd::free_func,
+      void* )
+{
+    ZSTD_inBuffer *in = static_cast<ZSTD_inBuffer *>(in_);
+    ZSTD_outBuffer *out = static_cast<ZSTD_outBuffer *>(out_);
+
+    memset(in, 0, sizeof(*in));
+    memset(out, 0, sizeof(*out));
+    eof_ = 0;
+
+    level = p.level;
+    zstd_error::check BOOST_PREVENT_MACRO_SUBSTITUTION(
+        compress ?
+            ZSTD_initCStream(static_cast<ZSTD_CStream *>(cstream_), level) :
+            ZSTD_initDStream(static_cast<ZSTD_DStream *>(dstream_))
+    );
+}
+
+} // End namespace detail.
+
+//----------------------------------------------------------------------------//
+
+} } // End namespaces iostreams, boost.

externals/boost/libs/locale/src/boost/locale/encoding/codepage.cpp

@@ -0,0 +1,163 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/hold_ptr.hpp>
+#include <memory>
+#include <string>
+
+#include "boost/locale/encoding/conv.hpp"
+#if BOOST_LOCALE_USE_WIN32_API
+#    define BOOST_LOCALE_WITH_WCONV
+#endif
+#ifdef BOOST_LOCALE_WITH_ICONV
+#    include "boost/locale/encoding/iconv_codepage.ipp"
+#endif
+#ifdef BOOST_LOCALE_WITH_ICU
+#    include "boost/locale/encoding/uconv_codepage.ipp"
+#endif
+#ifdef BOOST_LOCALE_WITH_WCONV
+#    include "boost/locale/encoding/wconv_codepage.ipp"
+#endif
+
+namespace boost { namespace locale { namespace conv {
+    namespace impl {
+
+        std::string convert_between(const char* begin,
+                                    const char* end,
+                                    const char* to_charset,
+                                    const char* from_charset,
+                                    method_type how)
+        {
+            hold_ptr<converter_between> cvt;
+#ifdef BOOST_LOCALE_WITH_ICONV
+            cvt.reset(new iconv_between());
+            if(cvt->open(to_charset, from_charset, how))
+                return cvt->convert(begin, end);
+#endif
+#ifdef BOOST_LOCALE_WITH_ICU
+            cvt.reset(new uconv_between());
+            if(cvt->open(to_charset, from_charset, how))
+                return cvt->convert(begin, end);
+#endif
+#ifdef BOOST_LOCALE_WITH_WCONV
+            cvt.reset(new wconv_between());
+            if(cvt->open(to_charset, from_charset, how))
+                return cvt->convert(begin, end);
+#endif
+            throw invalid_charset_error(std::string(to_charset) + " or " + from_charset);
+        }
+
+        template<typename CharType>
+        std::basic_string<CharType> convert_to(const char* begin, const char* end, const char* charset, method_type how)
+        {
+            hold_ptr<converter_to_utf<CharType>> cvt;
+#ifdef BOOST_LOCALE_WITH_ICONV
+            cvt.reset(new iconv_to_utf<CharType>());
+            if(cvt->open(charset, how))
+                return cvt->convert(begin, end);
+#endif
+#ifdef BOOST_LOCALE_WITH_ICU
+            cvt.reset(new uconv_to_utf<CharType>());
+            if(cvt->open(charset, how))
+                return cvt->convert(begin, end);
+#endif
+#ifdef BOOST_LOCALE_WITH_WCONV
+            cvt.reset(new wconv_to_utf<CharType>());
+            if(cvt->open(charset, how))
+                return cvt->convert(begin, end);
+#endif
+            throw invalid_charset_error(charset);
+        }
+
+        template<typename CharType>
+        std::string convert_from(const CharType* begin, const CharType* end, const char* charset, method_type how)
+        {
+            hold_ptr<converter_from_utf<CharType>> cvt;
+#ifdef BOOST_LOCALE_WITH_ICONV
+            cvt.reset(new iconv_from_utf<CharType>());
+            if(cvt->open(charset, how))
+                return cvt->convert(begin, end);
+#endif
+#ifdef BOOST_LOCALE_WITH_ICU
+            cvt.reset(new uconv_from_utf<CharType>());
+            if(cvt->open(charset, how))
+                return cvt->convert(begin, end);
+#endif
+#ifdef BOOST_LOCALE_WITH_WCONV
+            cvt.reset(new wconv_from_utf<CharType>());
+            if(cvt->open(charset, how))
+                return cvt->convert(begin, end);
+#endif
+            throw invalid_charset_error(charset);
+        }
+
+    } // namespace impl
+
+    using namespace impl;
+
+    std::string between(const char* begin,
+                        const char* end,
+                        const std::string& to_charset,
+                        const std::string& from_charset,
+                        method_type how)
+    {
+        return convert_between(begin, end, to_charset.c_str(), from_charset.c_str(), how);
+    }
+
+    template<>
+    std::basic_string<char> to_utf(const char* begin, const char* end, const std::string& charset, method_type how)
+    {
+        return convert_to<char>(begin, end, charset.c_str(), how);
+    }
+
+    template<>
+    std::string from_utf(const char* begin, const char* end, const std::string& charset, method_type how)
+    {
+        return convert_from<char>(begin, end, charset.c_str(), how);
+    }
+
+    template<>
+    std::basic_string<wchar_t> to_utf(const char* begin, const char* end, const std::string& charset, method_type how)
+    {
+        return convert_to<wchar_t>(begin, end, charset.c_str(), how);
+    }
+
+    template<>
+    std::string from_utf(const wchar_t* begin, const wchar_t* end, const std::string& charset, method_type how)
+    {
+        return convert_from<wchar_t>(begin, end, charset.c_str(), how);
+    }
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+    template<>
+    std::basic_string<char16_t> to_utf(const char* begin, const char* end, const std::string& charset, method_type how)
+    {
+        return convert_to<char16_t>(begin, end, charset.c_str(), how);
+    }
+
+    template<>
+    std::string from_utf(const char16_t* begin, const char16_t* end, const std::string& charset, method_type how)
+    {
+        return convert_from<char16_t>(begin, end, charset.c_str(), how);
+    }
+#endif
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+    template<>
+    std::basic_string<char32_t> to_utf(const char* begin, const char* end, const std::string& charset, method_type how)
+    {
+        return convert_to<char32_t>(begin, end, charset.c_str(), how);
+    }
+
+    template<>
+    std::string from_utf(const char32_t* begin, const char32_t* end, const std::string& charset, method_type how)
+    {
+        return convert_from<char32_t>(begin, end, charset.c_str(), how);
+    }
+#endif
+
+}}} // namespace boost::locale::conv

externals/boost/libs/locale/src/boost/locale/encoding/conv.hpp

@@ -0,0 +1,73 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_CONV_IMPL_HPP
+#define BOOST_LOCALE_CONV_IMPL_HPP
+
+#include <boost/locale/config.hpp>
+#include <boost/locale/encoding.hpp>
+
+namespace boost { namespace locale { namespace conv { namespace impl {
+
+    template<typename CharType>
+    const char* utf_name()
+    {
+        switch(sizeof(CharType)) {
+            case 1: return "UTF-8";
+            case 2: {
+                const int16_t endianMark = 1;
+                const bool isLittleEndian = reinterpret_cast<const char*>(&endianMark)[0] == 1;
+                return isLittleEndian ? "UTF-16LE" : "UTF-16BE";
+            }
+            case 4: {
+                const int32_t endianMark = 1;
+                const bool isLittleEndian = reinterpret_cast<const char*>(&endianMark)[0] == 1;
+                return isLittleEndian ? "UTF-32LE" : "UTF-32BE";
+            }
+        }
+        return "Unknown Character Encoding";
+    }
+
+    class converter_between {
+    public:
+        typedef char char_type;
+        typedef std::string string_type;
+
+        virtual bool open(const char* to_charset, const char* from_charset, method_type how) = 0;
+
+        virtual std::string convert(const char* begin, const char* end) = 0;
+
+        virtual ~converter_between() = default;
+    };
+
+    template<typename CharType>
+    class converter_from_utf {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        virtual bool open(const char* charset, method_type how) = 0;
+
+        virtual std::string convert(const CharType* begin, const CharType* end) = 0;
+
+        virtual ~converter_from_utf() = default;
+    };
+
+    template<typename CharType>
+    class converter_to_utf {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        virtual bool open(const char* charset, method_type how) = 0;
+
+        virtual string_type convert(const char* begin, const char* end) = 0;
+
+        virtual ~converter_to_utf() = default;
+    };
+}}}} // namespace boost::locale::conv::impl
+
+#endif

externals/boost/libs/locale/src/boost/locale/encoding/iconv_codepage.ipp

@@ -0,0 +1,175 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_ICONV_CODEPAGE_HPP
+#define BOOST_LOCALE_IMPL_ICONV_CODEPAGE_HPP
+
+#include <boost/locale/encoding.hpp>
+#include "boost/locale/encoding/conv.hpp"
+#include "boost/locale/util/iconv.hpp"
+#include <cerrno>
+
+namespace boost { namespace locale { namespace conv { namespace impl {
+
+    class iconverter_base {
+    public:
+        iconverter_base() : cvt_((iconv_t)(-1)) {}
+        ~iconverter_base() { close(); }
+
+        bool do_open(const char* to, const char* from, method_type how)
+        {
+            close();
+            cvt_ = iconv_open(to, from);
+            how_ = how;
+            return cvt_ != (iconv_t)(-1);
+        }
+
+        template<typename OutChar, typename InChar>
+        std::basic_string<OutChar> real_convert(const InChar* ubegin, const InChar* uend)
+        {
+            std::basic_string<OutChar> sresult;
+
+            sresult.reserve(uend - ubegin);
+
+            OutChar result[64];
+
+            char* out_start = reinterpret_cast<char*>(&result[0]);
+            const char* begin = reinterpret_cast<const char*>(ubegin);
+            const char* end = reinterpret_cast<const char*>(uend);
+
+            enum { normal, unshifting, done } state = normal;
+
+            while(state != done) {
+                size_t in_left = end - begin;
+                size_t out_left = sizeof(result);
+
+                char* out_ptr = out_start;
+                size_t res = 0;
+                if(in_left == 0)
+                    state = unshifting;
+
+                if(state == normal)
+                    res = conv(&begin, &in_left, &out_ptr, &out_left);
+                else
+                    res = conv(0, 0, &out_ptr, &out_left);
+
+                int err = errno;
+
+                size_t output_count = (out_ptr - out_start) / sizeof(OutChar);
+
+                if(res != 0 && res != (size_t)(-1)) {
+                    if(how_ == stop) {
+                        throw conversion_error();
+                    }
+                }
+
+                sresult.append(&result[0], output_count);
+
+                if(res == (size_t)(-1)) {
+                    if(err == EILSEQ || err == EINVAL) {
+                        if(how_ == stop) {
+                            throw conversion_error();
+                        }
+
+                        if(begin != end) {
+                            begin += sizeof(InChar);
+                            if(begin >= end)
+                                break;
+                        } else {
+                            break;
+                        }
+                    } else if(err == E2BIG) {
+                        continue;
+                    } else {
+                        // We should never get there
+                        // but if we do
+                        if(how_ == stop)
+                            throw conversion_error();
+                        else
+                            break;
+                    }
+                }
+                if(state == unshifting)
+                    state = done;
+            }
+            return sresult;
+        }
+
+    private:
+        void close()
+        {
+            if(cvt_ != (iconv_t)(-1)) {
+                iconv_close(cvt_);
+                cvt_ = (iconv_t)(-1);
+            }
+        }
+
+        size_t conv(const char** inbuf, size_t* inchar_left, char** outbuf, size_t* outchar_left)
+        {
+            return call_iconv(cvt_, inbuf, inchar_left, outbuf, outchar_left);
+        }
+
+        iconv_t cvt_;
+        method_type how_;
+    };
+
+    template<typename CharType>
+    class iconv_from_utf : public converter_from_utf<CharType> {
+    public:
+        typedef CharType char_type;
+
+        bool open(const char* charset, method_type how) override
+        {
+            return self_.do_open(charset, utf_name<CharType>(), how);
+        }
+
+        std::string convert(const char_type* ubegin, const char_type* uend) override
+        {
+            return self_.template real_convert<char, char_type>(ubegin, uend);
+        }
+
+    private:
+        iconverter_base self_;
+    };
+
+    class iconv_between : public converter_between {
+    public:
+        bool open(const char* to_charset, const char* from_charset, method_type how) override
+        {
+            return self_.do_open(to_charset, from_charset, how);
+        }
+        std::string convert(const char* begin, const char* end) override
+        {
+            return self_.real_convert<char, char>(begin, end);
+        }
+
+    private:
+        iconverter_base self_;
+    };
+
+    template<typename CharType>
+    class iconv_to_utf : public converter_to_utf<CharType> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        bool open(const char* charset, method_type how) override
+        {
+            return self_.do_open(utf_name<CharType>(), charset, how);
+        }
+
+        string_type convert(const char* begin, const char* end) override
+        {
+            return self_.template real_convert<char_type, char>(begin, end);
+        }
+
+    private:
+        iconverter_base self_;
+    };
+
+}}}} // namespace boost::locale::conv::impl
+
+#endif

externals/boost/libs/locale/src/boost/locale/encoding/uconv_codepage.ipp

@@ -0,0 +1,141 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_UCONV_CODEPAGE_HPP
+#define BOOST_LOCALE_IMPL_UCONV_CODEPAGE_HPP
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/hold_ptr.hpp>
+#include "boost/locale/encoding/conv.hpp"
+#include "boost/locale/icu/icu_util.hpp"
+#include "boost/locale/icu/uconv.hpp"
+#include <unicode/ucnv.h>
+#include <unicode/ucnv_err.h>
+
+namespace boost { namespace locale { namespace conv { namespace impl {
+    template<typename CharType>
+    class uconv_to_utf : public converter_to_utf<CharType> {
+    public:
+        typedef CharType char_type;
+
+        typedef std::basic_string<char_type> string_type;
+
+        bool open(const char* charset, method_type how) override
+        {
+            close();
+            try {
+                using impl_icu::cpcvt_type;
+                cvt_from_.reset(new from_type(charset, how == skip ? cpcvt_type::skip : cpcvt_type::stop));
+                cvt_to_.reset(new to_type("UTF-8", how == skip ? cpcvt_type::skip : cpcvt_type::stop));
+            } catch(const std::exception& /*e*/) {
+                close();
+                return false;
+            }
+            return true;
+        }
+        void close()
+        {
+            cvt_from_.reset();
+            cvt_to_.reset();
+        }
+
+        string_type convert(const char* begin, const char* end) override
+        {
+            try {
+                return cvt_to_->std(cvt_from_->icu_checked(begin, end));
+            } catch(const std::exception& /*e*/) {
+                throw conversion_error();
+            }
+        }
+
+    private:
+        typedef impl_icu::icu_std_converter<char> from_type;
+        typedef impl_icu::icu_std_converter<CharType> to_type;
+
+        hold_ptr<from_type> cvt_from_;
+        hold_ptr<to_type> cvt_to_;
+    };
+
+    template<typename CharType>
+    class uconv_from_utf : public converter_from_utf<CharType> {
+    public:
+        typedef CharType char_type;
+        bool open(const char* charset, method_type how) override
+        {
+            close();
+            try {
+                using impl_icu::cpcvt_type;
+                cvt_from_.reset(new from_type("UTF-8", how == skip ? cpcvt_type::skip : cpcvt_type::stop));
+                cvt_to_.reset(new to_type(charset, how == skip ? cpcvt_type::skip : cpcvt_type::stop));
+            } catch(const std::exception& /*e*/) {
+                close();
+                return false;
+            }
+            return true;
+        }
+        void close()
+        {
+            cvt_from_.reset();
+            cvt_to_.reset();
+        }
+
+        std::string convert(const CharType* begin, const CharType* end) override
+        {
+            try {
+                return cvt_to_->std(cvt_from_->icu_checked(begin, end));
+            } catch(const std::exception& /*e*/) {
+                throw conversion_error();
+            }
+        }
+
+    private:
+        typedef impl_icu::icu_std_converter<CharType> from_type;
+        typedef impl_icu::icu_std_converter<char> to_type;
+
+        hold_ptr<from_type> cvt_from_;
+        hold_ptr<to_type> cvt_to_;
+    };
+
+    class uconv_between : public converter_between {
+    public:
+        bool open(const char* to_charset, const char* from_charset, method_type how) override
+        {
+            close();
+            try {
+                using impl_icu::cpcvt_type;
+                cvt_from_.reset(new from_type(from_charset, how == skip ? cpcvt_type::skip : cpcvt_type::stop));
+                cvt_to_.reset(new to_type(to_charset, how == skip ? cpcvt_type::skip : cpcvt_type::stop));
+            } catch(const std::exception& /*e*/) {
+                close();
+                return false;
+            }
+            return true;
+        }
+        void close()
+        {
+            cvt_from_.reset();
+            cvt_to_.reset();
+        }
+
+        std::string convert(const char* begin, const char* end) override
+        {
+            try {
+                return cvt_to_->std(cvt_from_->icu(begin, end));
+            } catch(const std::exception& /*e*/) {
+                throw conversion_error();
+            }
+        }
+
+    private:
+        typedef impl_icu::icu_std_converter<char> from_type;
+        typedef impl_icu::icu_std_converter<char> to_type;
+
+        hold_ptr<from_type> cvt_from_;
+        hold_ptr<to_type> cvt_to_;
+    };
+
+}}}} // namespace boost::locale::conv::impl
+
+#endif

externals/boost/libs/locale/src/boost/locale/encoding/wconv_codepage.ipp

@@ -0,0 +1,432 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_WCONV_CODEPAGE_HPP
+#define BOOST_LOCALE_IMPL_WCONV_CODEPAGE_HPP
+
+#ifndef NOMINMAX
+#    define NOMINMAX
+#endif
+#include <boost/locale/encoding.hpp>
+#include "boost/locale/encoding/conv.hpp"
+#include "boost/locale/util/encoding.hpp"
+#include <algorithm>
+#include <cstddef>
+#include <cstring>
+#include <limits>
+#include <string>
+#include <vector>
+#include <windows.h>
+
+namespace boost { namespace locale { namespace conv { namespace impl {
+
+    size_t remove_substitutions(std::vector<char>& v)
+    {
+        if(std::find(v.begin(), v.end(), 0) == v.end()) {
+            return v.size();
+        }
+        std::vector<char> v2;
+        v2.reserve(v.size());
+        for(unsigned i = 0; i < v.size(); i++) {
+            if(v[i] != 0)
+                v2.push_back(v[i]);
+        }
+        v.swap(v2);
+        return v.size();
+    }
+
+    void multibyte_to_wide_one_by_one(int codepage, const char* begin, const char* end, std::vector<wchar_t>& buf)
+    {
+        buf.reserve(end - begin);
+        DWORD flags = MB_ERR_INVALID_CHARS;
+        while(begin != end) {
+            wchar_t wide_buf[4];
+            int n = 0;
+            int len = IsDBCSLeadByteEx(codepage, *begin) ? 2 : 1;
+            if(len == 2 && begin + 1 == end)
+                return;
+            n = MultiByteToWideChar(codepage, flags, begin, len, wide_buf, 4);
+            if(n == 0 && flags != 0 && GetLastError() == ERROR_INVALID_FLAGS) {
+                flags = 0;
+                n = MultiByteToWideChar(codepage, flags, begin, len, wide_buf, 4);
+            }
+            for(int i = 0; i < n; i++)
+                buf.push_back(wide_buf[i]);
+            begin += len;
+        }
+    }
+
+    void multibyte_to_wide(int codepage, const char* begin, const char* end, bool do_skip, std::vector<wchar_t>& buf)
+    {
+        if(begin == end)
+            return;
+        const std::ptrdiff_t num_chars = end - begin;
+        if(num_chars > std::numeric_limits<int>::max())
+            throw conversion_error();
+        DWORD flags = MB_ERR_INVALID_CHARS;
+        int n = MultiByteToWideChar(codepage, flags, begin, static_cast<int>(num_chars), 0, 0);
+        if(n == 0 && GetLastError() == ERROR_INVALID_FLAGS) {
+            flags = 0;
+            n = MultiByteToWideChar(codepage, flags, begin, static_cast<int>(num_chars), 0, 0);
+        }
+
+        if(n == 0) {
+            if(do_skip) {
+                multibyte_to_wide_one_by_one(codepage, begin, end, buf);
+                return;
+            }
+            throw conversion_error();
+        }
+
+        buf.resize(n);
+        if(MultiByteToWideChar(codepage, flags, begin, static_cast<int>(num_chars), &buf.front(), n) == 0)
+            throw conversion_error();
+    }
+
+    void wide_to_multibyte_non_zero(int codepage,
+                                    const wchar_t* begin,
+                                    const wchar_t* end,
+                                    bool do_skip,
+                                    std::vector<char>& buf)
+    {
+        if(begin == end)
+            return;
+        BOOL substitute = FALSE;
+        BOOL* substitute_ptr = codepage == 65001 || codepage == 65000 ? 0 : &substitute;
+        char subst_char = 0;
+        char* subst_char_ptr = codepage == 65001 || codepage == 65000 ? 0 : &subst_char;
+
+        const std::ptrdiff_t num_chars = end - begin;
+        if(num_chars > std::numeric_limits<int>::max())
+            throw conversion_error();
+        int n =
+          WideCharToMultiByte(codepage, 0, begin, static_cast<int>(num_chars), 0, 0, subst_char_ptr, substitute_ptr);
+        buf.resize(n);
+
+        if(WideCharToMultiByte(codepage,
+                               0,
+                               begin,
+                               static_cast<int>(num_chars),
+                               &buf[0],
+                               n,
+                               subst_char_ptr,
+                               substitute_ptr)
+           == 0)
+            throw conversion_error();
+        if(substitute) {
+            if(do_skip)
+                remove_substitutions(buf);
+            else
+                throw conversion_error();
+        }
+    }
+
+    void wide_to_multibyte(int codepage, const wchar_t* begin, const wchar_t* end, bool do_skip, std::vector<char>& buf)
+    {
+        if(begin == end)
+            return;
+        buf.reserve(end - begin);
+        const wchar_t* e = std::find(begin, end, L'\0');
+        const wchar_t* b = begin;
+        for(;;) {
+            std::vector<char> tmp;
+            wide_to_multibyte_non_zero(codepage, b, e, do_skip, tmp);
+            size_t osize = buf.size();
+            buf.resize(osize + tmp.size());
+            std::copy(tmp.begin(), tmp.end(), buf.begin() + osize);
+            if(e != end) {
+                buf.push_back('\0');
+                b = e + 1;
+                e = std::find(b, end, L'0');
+            } else
+                break;
+        }
+    }
+
+    template<typename CharType>
+    bool validate_utf16(const CharType* str, size_t len)
+    {
+        const CharType* begin = str;
+        const CharType* end = str + len;
+        while(begin != end) {
+            utf::code_point c = utf::utf_traits<CharType, 2>::template decode<const CharType*>(begin, end);
+            if(c == utf::illegal || c == utf::incomplete)
+                return false;
+        }
+        return true;
+    }
+
+    template<typename CharType, typename OutChar>
+    void clean_invalid_utf16(const CharType* str, size_t len, std::vector<OutChar>& out)
+    {
+        out.reserve(len);
+        for(size_t i = 0; i < len; i++) {
+            uint16_t c = static_cast<uint16_t>(str[i]);
+
+            if(0xD800 <= c && c <= 0xDBFF) {
+                i++;
+                if(i >= len)
+                    return;
+                uint16_t c2 = static_cast<uint16_t>(str[i]);
+                if(0xDC00 <= c2 && c2 <= 0xDFFF) {
+                    out.push_back(static_cast<OutChar>(c));
+                    out.push_back(static_cast<OutChar>(c2));
+                }
+            } else if(0xDC00 <= c && c <= 0xDFFF)
+                continue;
+            else
+                out.push_back(static_cast<OutChar>(c));
+        }
+    }
+
+    class wconv_between : public converter_between {
+    public:
+        wconv_between() : how_(skip), to_code_page_(-1), from_code_page_(-1) {}
+        bool open(const char* to_charset, const char* from_charset, method_type how) override
+        {
+            how_ = how;
+            to_code_page_ = util::encoding_to_windows_codepage(to_charset);
+            from_code_page_ = util::encoding_to_windows_codepage(from_charset);
+            if(to_code_page_ == -1 || from_code_page_ == -1)
+                return false;
+            return true;
+        }
+        std::string convert(const char* begin, const char* end) override
+        {
+            if(to_code_page_ == 65001 && from_code_page_ == 65001)
+                return utf_to_utf<char>(begin, end, how_);
+
+            std::string res;
+
+            std::vector<wchar_t> tmp; // buffer for mb2w
+            std::wstring tmps;        // buffer for utf_to_utf
+            const wchar_t* wbegin = 0;
+            const wchar_t* wend = 0;
+
+            if(from_code_page_ == 65001) {
+                tmps = utf_to_utf<wchar_t>(begin, end, how_);
+                if(tmps.empty())
+                    return res;
+                wbegin = tmps.c_str();
+                wend = wbegin + tmps.size();
+            } else {
+                multibyte_to_wide(from_code_page_, begin, end, how_ == skip, tmp);
+                if(tmp.empty())
+                    return res;
+                wbegin = &tmp[0];
+                wend = wbegin + tmp.size();
+            }
+
+            if(to_code_page_ == 65001) {
+                return utf_to_utf<char>(wbegin, wend, how_);
+            }
+
+            std::vector<char> ctmp;
+            wide_to_multibyte(to_code_page_, wbegin, wend, how_ == skip, ctmp);
+            if(ctmp.empty())
+                return res;
+            res.assign(&ctmp.front(), ctmp.size());
+            return res;
+        }
+
+    private:
+        method_type how_;
+        int to_code_page_;
+        int from_code_page_;
+    };
+
+    template<typename CharType, int size = sizeof(CharType)>
+    class wconv_to_utf;
+
+    template<typename CharType, int size = sizeof(CharType)>
+    class wconv_from_utf;
+
+    template<>
+    class wconv_to_utf<char, 1> : public converter_to_utf<char> {
+    public:
+        bool open(const char* cs, method_type how) override { return cvt.open("UTF-8", cs, how); }
+        std::string convert(const char* begin, const char* end) override { return cvt.convert(begin, end); }
+
+    private:
+        wconv_between cvt;
+    };
+
+    template<>
+    class wconv_from_utf<char, 1> : public converter_from_utf<char> {
+    public:
+        bool open(const char* cs, method_type how) override { return cvt.open(cs, "UTF-8", how); }
+        std::string convert(const char* begin, const char* end) override { return cvt.convert(begin, end); }
+
+    private:
+        wconv_between cvt;
+    };
+
+    template<typename CharType>
+    class wconv_to_utf<CharType, 2> : public converter_to_utf<CharType> {
+    public:
+        typedef CharType char_type;
+
+        typedef std::basic_string<char_type> string_type;
+
+        wconv_to_utf() : how_(skip), code_page_(-1) {}
+
+        bool open(const char* charset, method_type how) override
+        {
+            how_ = how;
+            code_page_ = util::encoding_to_windows_codepage(charset);
+            return code_page_ != -1;
+        }
+
+        string_type convert(const char* begin, const char* end) override
+        {
+            if(code_page_ == 65001) {
+                return utf_to_utf<char_type>(begin, end, how_);
+            }
+            std::vector<wchar_t> tmp;
+            multibyte_to_wide(code_page_, begin, end, how_ == skip, tmp);
+            string_type res;
+            if(!tmp.empty())
+                res.assign(reinterpret_cast<char_type*>(&tmp.front()), tmp.size());
+            return res;
+        }
+
+    private:
+        method_type how_;
+        int code_page_;
+    };
+
+    template<typename CharType>
+    class wconv_from_utf<CharType, 2> : public converter_from_utf<CharType> {
+    public:
+        typedef CharType char_type;
+
+        typedef std::basic_string<char_type> string_type;
+
+        wconv_from_utf() : how_(skip), code_page_(-1) {}
+
+        bool open(const char* charset, method_type how) override
+        {
+            how_ = how;
+            code_page_ = util::encoding_to_windows_codepage(charset);
+            return code_page_ != -1;
+        }
+
+        std::string convert(const CharType* begin, const CharType* end) override
+        {
+            if(code_page_ == 65001) {
+                return utf_to_utf<char>(begin, end, how_);
+            }
+            const wchar_t* wbegin = 0;
+            const wchar_t* wend = 0;
+            std::vector<wchar_t> buffer; // if needed
+            if(begin == end)
+                return std::string();
+            if(validate_utf16(begin, end - begin)) {
+                wbegin = reinterpret_cast<const wchar_t*>(begin);
+                wend = reinterpret_cast<const wchar_t*>(end);
+            } else {
+                if(how_ == stop) {
+                    throw conversion_error();
+                } else {
+                    clean_invalid_utf16(begin, end - begin, buffer);
+                    if(!buffer.empty()) {
+                        wbegin = &buffer[0];
+                        wend = wbegin + buffer.size();
+                    }
+                }
+            }
+            std::string res;
+            if(wbegin == wend)
+                return res;
+            std::vector<char> ctmp;
+            wide_to_multibyte(code_page_, wbegin, wend, how_ == skip, ctmp);
+            if(ctmp.empty())
+                return res;
+            res.assign(&ctmp.front(), ctmp.size());
+            return res;
+        }
+
+    private:
+        method_type how_;
+        int code_page_;
+    };
+
+    template<typename CharType>
+    class wconv_to_utf<CharType, 4> : public converter_to_utf<CharType> {
+    public:
+        typedef CharType char_type;
+
+        typedef std::basic_string<char_type> string_type;
+
+        wconv_to_utf() : how_(skip), code_page_(-1) {}
+
+        bool open(const char* charset, method_type how) override
+        {
+            how_ = how;
+            code_page_ = util::encoding_to_windows_codepage(charset);
+            return code_page_ != -1;
+        }
+
+        string_type convert(const char* begin, const char* end) override
+        {
+            if(code_page_ == 65001) {
+                return utf_to_utf<char_type>(begin, end, how_);
+            }
+            std::vector<wchar_t> buf;
+            multibyte_to_wide(code_page_, begin, end, how_ == skip, buf);
+
+            if(buf.empty())
+                return string_type();
+
+            return utf_to_utf<CharType>(&buf[0], &buf[0] + buf.size(), how_);
+        }
+
+    private:
+        method_type how_;
+        int code_page_;
+    };
+
+    template<typename CharType>
+    class wconv_from_utf<CharType, 4> : public converter_from_utf<CharType> {
+    public:
+        typedef CharType char_type;
+
+        typedef std::basic_string<char_type> string_type;
+
+        wconv_from_utf() : how_(skip), code_page_(-1) {}
+
+        bool open(const char* charset, method_type how) override
+        {
+            how_ = how;
+            code_page_ = util::encoding_to_windows_codepage(charset);
+            return code_page_ != -1;
+        }
+
+        std::string convert(const CharType* begin, const CharType* end) override
+        {
+            if(code_page_ == 65001) {
+                return utf_to_utf<char>(begin, end, how_);
+            }
+            std::wstring tmp = utf_to_utf<wchar_t>(begin, end, how_);
+
+            std::vector<char> ctmp;
+            wide_to_multibyte(code_page_, tmp.c_str(), tmp.c_str() + tmp.size(), how_ == skip, ctmp);
+            std::string res;
+            if(ctmp.empty())
+                return res;
+            res.assign(&ctmp.front(), ctmp.size());
+            return res;
+        }
+
+    private:
+        method_type how_;
+        int code_page_;
+    };
+
+}}}} // namespace boost::locale::conv::impl
+
+// boostinspect:nominmax
+#endif

externals/boost/libs/locale/src/boost/locale/icu/all_generator.hpp

@@ -0,0 +1,24 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_ALL_GENERATOR_HPP
+#define BOOST_LOCALE_IMPL_ALL_GENERATOR_HPP
+
+#include <boost/locale/generator.hpp>
+
+namespace boost { namespace locale { namespace impl_icu {
+    struct cdata;
+    std::locale create_convert(const std::locale&, const cdata&, char_facet_t);
+    std::locale create_collate(const std::locale&, const cdata&, char_facet_t);
+    std::locale create_formatting(const std::locale&, const cdata&, char_facet_t);
+    std::locale create_parsing(const std::locale&, const cdata&, char_facet_t);
+    std::locale create_codecvt(const std::locale&, const std::string& encoding, char_facet_t);
+    std::locale create_boundary(const std::locale&, const cdata&, char_facet_t);
+    std::locale create_calendar(const std::locale&, const cdata&);
+
+}}} // namespace boost::locale::impl_icu
+
+#endif

externals/boost/libs/locale/src/boost/locale/icu/boundary.cpp

@@ -0,0 +1,213 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2021-2022 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/boundary.hpp>
+#include <boost/locale/generator.hpp>
+#include "boost/locale//util/encoding.hpp"
+#include "boost/locale/icu/all_generator.hpp"
+#include "boost/locale/icu/cdata.hpp"
+#include "boost/locale/icu/icu_util.hpp"
+#include "boost/locale/icu/uconv.hpp"
+#if BOOST_LOCALE_ICU_VERSION >= 306
+#    include <unicode/utext.h>
+#endif
+#include <memory>
+#include <unicode/brkiter.h>
+#include <unicode/rbbi.h>
+#include <vector>
+
+#ifdef BOOST_MSVC
+#    pragma warning(disable : 4244) // 'argument' : conversion from 'int'
+#    pragma warning(disable : 4267) // 'argument' : conversion from 'size_t'
+#endif
+
+namespace boost { namespace locale {
+    namespace boundary { namespace impl_icu {
+
+        using namespace boost::locale::impl_icu;
+
+        index_type map_direct(boundary_type t, icu::BreakIterator* it, int reserve)
+        {
+            index_type indx;
+            indx.reserve(reserve);
+#if U_ICU_VERSION_MAJOR_NUM >= 52
+            icu::BreakIterator* rbbi = it;
+#else
+            icu::RuleBasedBreakIterator* rbbi = icu_cast<icu::RuleBasedBreakIterator>(it);
+#endif
+
+            indx.push_back(break_info());
+            it->first();
+            int pos = 0;
+            while((pos = it->next()) != icu::BreakIterator::DONE) {
+                indx.push_back(break_info(pos));
+                /// Character does not have any specific break types
+                if(t != character && rbbi) {
+                    //
+                    // There is a collapse for MSVC: int32_t defined by both boost::cstdint and icu...
+                    // So need to pick one ;(
+                    //
+                    std::vector<int32_t> buffer;
+                    int32_t membuf[8] = {0}; // try not to use memory allocation if possible
+                    int32_t* buf = membuf;
+
+                    UErrorCode err = U_ZERO_ERROR;
+                    int n = rbbi->getRuleStatusVec(buf, 8, err);
+
+                    if(err == U_BUFFER_OVERFLOW_ERROR) {
+                        buf = &buffer.front();
+                        buffer.resize(n, 0);
+                        n = rbbi->getRuleStatusVec(buf, buffer.size(), err);
+                    }
+
+                    check_and_throw_icu_error(err);
+
+                    for(int i = 0; i < n; i++) {
+                        switch(t) {
+                            case word:
+                                if(UBRK_WORD_NONE <= buf[i] && buf[i] < UBRK_WORD_NONE_LIMIT)
+                                    indx.back().rule |= word_none;
+                                else if(UBRK_WORD_NUMBER <= buf[i] && buf[i] < UBRK_WORD_NUMBER_LIMIT)
+                                    indx.back().rule |= word_number;
+                                else if(UBRK_WORD_LETTER <= buf[i] && buf[i] < UBRK_WORD_LETTER_LIMIT)
+                                    indx.back().rule |= word_letter;
+                                else if(UBRK_WORD_KANA <= buf[i] && buf[i] < UBRK_WORD_KANA_LIMIT)
+                                    indx.back().rule |= word_kana;
+                                else if(UBRK_WORD_IDEO <= buf[i] && buf[i] < UBRK_WORD_IDEO_LIMIT)
+                                    indx.back().rule |= word_ideo;
+                                break;
+
+                            case line:
+                                if(UBRK_LINE_SOFT <= buf[i] && buf[i] < UBRK_LINE_SOFT_LIMIT)
+                                    indx.back().rule |= line_soft;
+                                else if(UBRK_LINE_HARD <= buf[i] && buf[i] < UBRK_LINE_HARD_LIMIT)
+                                    indx.back().rule |= line_hard;
+                                break;
+
+                            case sentence:
+                                if(UBRK_SENTENCE_TERM <= buf[i] && buf[i] < UBRK_SENTENCE_TERM_LIMIT)
+                                    indx.back().rule |= sentence_term;
+                                else if(UBRK_SENTENCE_SEP <= buf[i] && buf[i] < UBRK_SENTENCE_SEP_LIMIT)
+                                    indx.back().rule |= sentence_sep;
+                                break;
+                            case character: BOOST_UNREACHABLE_RETURN(0);
+                        }
+                    }
+                } else {
+                    indx.back().rule |= character_any; // Baisc mark... for character
+                }
+            }
+            return indx;
+        }
+
+        std::unique_ptr<icu::BreakIterator> get_iterator(boundary_type t, const icu::Locale& loc)
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            std::unique_ptr<icu::BreakIterator> bi;
+            switch(t) {
+                case character: bi.reset(icu::BreakIterator::createCharacterInstance(loc, err)); break;
+                case word: bi.reset(icu::BreakIterator::createWordInstance(loc, err)); break;
+                case sentence: bi.reset(icu::BreakIterator::createSentenceInstance(loc, err)); break;
+                case line: bi.reset(icu::BreakIterator::createLineInstance(loc, err)); break;
+            }
+            check_and_throw_icu_error(err);
+            if(!bi)
+                throw std::runtime_error("Failed to create break iterator");
+            return bi;
+        }
+
+        template<typename CharType>
+        index_type do_map(boundary_type t,
+                          const CharType* begin,
+                          const CharType* end,
+                          const icu::Locale& loc,
+                          const std::string& encoding)
+        {
+            index_type indx;
+            std::unique_ptr<icu::BreakIterator> bi = get_iterator(t, loc);
+
+#if BOOST_LOCALE_ICU_VERSION >= 306
+            UErrorCode err = U_ZERO_ERROR;
+            BOOST_LOCALE_START_CONST_CONDITION
+            if(sizeof(CharType) == 2 || (sizeof(CharType) == 1 && util::normalize_encoding(encoding) == "utf8")) {
+                UText* ut = 0;
+                try {
+                    if(sizeof(CharType) == 1)
+                        ut = utext_openUTF8(0, reinterpret_cast<const char*>(begin), end - begin, &err);
+                    else // sizeof(CharType)==2
+                        ut = utext_openUChars(0, reinterpret_cast<const UChar*>(begin), end - begin, &err);
+                    BOOST_LOCALE_END_CONST_CONDITION
+
+                    check_and_throw_icu_error(err);
+                    err = U_ZERO_ERROR;
+                    if(!ut)
+                        throw std::runtime_error("Failed to create UText");
+                    bi->setText(ut, err);
+                    check_and_throw_icu_error(err);
+                    index_type res = map_direct(t, bi.get(), end - begin);
+                    indx.swap(res);
+                } catch(...) {
+                    if(ut)
+                        utext_close(ut);
+                    throw;
+                }
+                if(ut)
+                    utext_close(ut);
+            } else
+#endif
+            {
+                icu_std_converter<CharType> cvt(encoding);
+                icu::UnicodeString str = cvt.icu(begin, end);
+                bi->setText(str);
+                index_type indirect = map_direct(t, bi.get(), str.length());
+                indx = indirect;
+                for(size_t i = 1; i < indirect.size(); i++) {
+                    size_t offset_inderect = indirect[i - 1].offset;
+                    size_t diff = indirect[i].offset - offset_inderect;
+                    size_t offset_direct = indx[i - 1].offset;
+                    indx[i].offset = offset_direct + cvt.cut(str, begin, end, diff, offset_inderect, offset_direct);
+                }
+            }
+            return indx;
+        } // do_map
+
+        template<typename CharType>
+        class boundary_indexing_impl : public boundary_indexing<CharType> {
+        public:
+            boundary_indexing_impl(const cdata& data) : locale_(data.locale), encoding_(data.encoding) {}
+            index_type map(boundary_type t, const CharType* begin, const CharType* end) const
+            {
+                return do_map<CharType>(t, begin, end, locale_, encoding_);
+            }
+
+        private:
+            icu::Locale locale_;
+            std::string encoding_;
+        };
+
+    }} // namespace boundary::impl_icu
+
+    namespace impl_icu {
+        std::locale create_boundary(const std::locale& in, const cdata& cd, char_facet_t type)
+        {
+            using namespace boost::locale::boundary::impl_icu;
+            switch(type) {
+                case char_facet_t::nochar: break;
+                case char_facet_t::char_f: return std::locale(in, new boundary_indexing_impl<char>(cd));
+                case char_facet_t::wchar_f: return std::locale(in, new boundary_indexing_impl<wchar_t>(cd));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+                case char_facet_t::char16_f: return std::locale(in, new boundary_indexing_impl<char16_t>(cd));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+                case char_facet_t::char32_f: return std::locale(in, new boundary_indexing_impl<char32_t>(cd));
+#endif
+            }
+            return in;
+        }
+    } // namespace impl_icu
+
+}} // namespace boost::locale

externals/boost/libs/locale/src/boost/locale/icu/cdata.hpp

@@ -0,0 +1,22 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_ICU_CDATA_HPP
+#define BOOST_LOCALE_ICU_CDATA_HPP
+
+#include <boost/locale/config.hpp>
+#include <string>
+#include <unicode/locid.h>
+
+namespace boost { namespace locale { namespace impl_icu {
+    struct cdata {
+        icu::Locale locale;
+        std::string encoding;
+        bool utf8;
+    };
+}}} // namespace boost::locale::impl_icu
+
+#endif

externals/boost/libs/locale/src/boost/locale/icu/codecvt.cpp

@@ -0,0 +1,129 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/icu/codecvt.hpp"
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/encoding_errors.hpp>
+#include <boost/locale/hold_ptr.hpp>
+#include <boost/locale/util.hpp>
+#include "boost/locale/encoding/conv.hpp"
+#include "boost/locale/icu/all_generator.hpp"
+#include "boost/locale/icu/icu_util.hpp"
+#include "boost/locale/icu/uconv.hpp"
+#include "boost/locale/util/encoding.hpp"
+#include <unicode/ucnv.h>
+#include <unicode/ucnv_err.h>
+
+#ifdef BOOST_MSVC
+#    pragma warning(disable : 4244) // loose data
+#endif
+
+namespace boost { namespace locale { namespace impl_icu {
+    class uconv_converter : public util::base_converter {
+    public:
+        uconv_converter(const std::string& encoding) : encoding_(encoding)
+        {
+            UErrorCode err = U_ZERO_ERROR;
+
+            // No need to check err each time, this
+            // is how ICU works.
+            cvt_ = ucnv_open(encoding.c_str(), &err);
+            ucnv_setFromUCallBack(cvt_, UCNV_FROM_U_CALLBACK_STOP, 0, 0, 0, &err);
+            ucnv_setToUCallBack(cvt_, UCNV_TO_U_CALLBACK_STOP, 0, 0, 0, &err);
+
+            if(!cvt_ || U_FAILURE(err)) {
+                if(cvt_)
+                    ucnv_close(cvt_);
+                throw conv::invalid_charset_error(encoding);
+            }
+
+            max_len_ = ucnv_getMaxCharSize(cvt_);
+        }
+
+        ~uconv_converter() { ucnv_close(cvt_); }
+
+        bool is_thread_safe() const override { return false; }
+
+        uconv_converter* clone() const override { return new uconv_converter(encoding_); }
+
+        uint32_t to_unicode(const char*& begin, const char* end) override
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            const char* tmp = begin;
+            UChar32 c = ucnv_getNextUChar(cvt_, &tmp, end, &err);
+            ucnv_reset(cvt_);
+            if(err == U_TRUNCATED_CHAR_FOUND) {
+                return incomplete;
+            }
+            if(U_FAILURE(err)) {
+                return illegal;
+            }
+
+            begin = tmp;
+            return c;
+        }
+
+        uint32_t from_unicode(uint32_t u, char* begin, const char* end) override
+        {
+            UChar code_point[2] = {0};
+            int len;
+            if(u <= 0xFFFF) {
+                if(0xD800 <= u && u <= 0xDFFF) // No surrogates
+                    return illegal;
+                code_point[0] = u;
+                len = 1;
+            } else {
+                u -= 0x10000;
+                code_point[0] = 0xD800 | (u >> 10);
+                code_point[1] = 0xDC00 | (u & 0x3FF);
+                len = 2;
+            }
+            UErrorCode err = U_ZERO_ERROR;
+            int olen = ucnv_fromUChars(cvt_, begin, end - begin, code_point, len, &err);
+            ucnv_reset(cvt_);
+            if(err == U_BUFFER_OVERFLOW_ERROR)
+                return incomplete;
+            if(U_FAILURE(err))
+                return illegal;
+            return olen;
+        }
+
+        int max_len() const override { return max_len_; }
+
+    private:
+        std::string encoding_;
+        UConverter* cvt_;
+        int max_len_;
+    };
+
+    std::unique_ptr<util::base_converter> create_uconv_converter(const std::string& encoding)
+    {
+        try {
+            return std::unique_ptr<util::base_converter>(new uconv_converter(encoding));
+        } catch(const std::exception& /*e*/) {
+            return nullptr;
+        }
+    }
+
+    std::locale create_codecvt(const std::locale& in, const std::string& encoding, char_facet_t type)
+    {
+        if(util::normalize_encoding(encoding) == "utf8")
+            return util::create_utf8_codecvt(in, type);
+
+        try {
+            return util::create_simple_codecvt(in, encoding, type);
+        } catch(const boost::locale::conv::invalid_charset_error&) {
+            std::unique_ptr<util::base_converter> cvt;
+            try {
+                cvt = create_uconv_converter(encoding);
+            } catch(const std::exception& /*e*/) {
+                cvt.reset(new util::base_converter());
+            }
+            return util::create_codecvt(in, std::move(cvt), type);
+        }
+    }
+
+}}} // namespace boost::locale::impl_icu

externals/boost/libs/locale/src/boost/locale/icu/codecvt.hpp

@@ -0,0 +1,20 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_ICU_CODECVT_HPP
+#define BOOST_LOCALE_IMPL_ICU_CODECVT_HPP
+
+#include <boost/locale/util.hpp>
+#include <memory>
+#include <string>
+
+namespace boost { namespace locale { namespace impl_icu {
+    BOOST_LOCALE_DECL
+    std::unique_ptr<util::base_converter> create_uconv_converter(const std::string& encoding);
+
+}}} // namespace boost::locale::impl_icu
+
+#endif

externals/boost/libs/locale/src/boost/locale/icu/collator.cpp

@@ -0,0 +1,193 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/collator.hpp>
+#include <boost/locale/generator.hpp>
+#include "boost/locale/icu/all_generator.hpp"
+#include "boost/locale/icu/cdata.hpp"
+#include "boost/locale/icu/icu_util.hpp"
+#include "boost/locale/icu/uconv.hpp"
+#include "boost/locale/shared/mo_hash.hpp"
+#include <boost/thread.hpp>
+#include <limits>
+#include <unicode/coll.h>
+#include <vector>
+#if BOOST_LOCALE_ICU_VERSION >= 402
+#    define BOOST_LOCALE_WITH_STRINGPIECE 1
+#    include <unicode/stringpiece.h>
+#else
+#    define BOOST_LOCALE_WITH_STRINGPIECE 0
+#endif
+
+#ifdef BOOST_MSVC
+#    pragma warning(disable : 4244) // 'argument' : conversion from 'int'
+#    pragma warning(disable : 4267) // 'argument' : conversion from 'size_t'
+#endif
+
+namespace boost { namespace locale { namespace impl_icu {
+    template<typename CharType>
+    class collate_impl : public collator<CharType> {
+    public:
+        int level_to_int(collate_level level) const
+        {
+            const auto res = static_cast<int>(level);
+            if(res < 0)
+                return 0;
+            if(res >= level_count)
+                return level_count - 1;
+            return res;
+        }
+
+#if BOOST_LOCALE_WITH_STRINGPIECE
+        int do_utf8_compare(collate_level level,
+                            const char* b1,
+                            const char* e1,
+                            const char* b2,
+                            const char* e2,
+                            UErrorCode& status) const
+        {
+            icu::StringPiece left(b1, e1 - b1);
+            icu::StringPiece right(b2, e2 - b2);
+            return get_collator(level)->compareUTF8(left, right, status);
+        }
+#endif
+
+        int do_ustring_compare(collate_level level,
+                               const CharType* b1,
+                               const CharType* e1,
+                               const CharType* b2,
+                               const CharType* e2,
+                               UErrorCode& status) const
+        {
+            icu::UnicodeString left = cvt_.icu(b1, e1);
+            icu::UnicodeString right = cvt_.icu(b2, e2);
+            return get_collator(level)->compare(left, right, status);
+        }
+
+        int do_real_compare(collate_level level,
+                            const CharType* b1,
+                            const CharType* e1,
+                            const CharType* b2,
+                            const CharType* e2,
+                            UErrorCode& status) const
+        {
+            return do_ustring_compare(level, b1, e1, b2, e2, status);
+        }
+
+        int do_compare(collate_level level,
+                       const CharType* b1,
+                       const CharType* e1,
+                       const CharType* b2,
+                       const CharType* e2) const override
+        {
+            UErrorCode status = U_ZERO_ERROR;
+
+            int res = do_real_compare(level, b1, e1, b2, e2, status);
+
+            if(U_FAILURE(status))
+                throw std::runtime_error(std::string("Collation failed:") + u_errorName(status));
+            if(res < 0)
+                return -1;
+            else if(res > 0)
+                return 1;
+            return 0;
+        }
+
+        std::vector<uint8_t> do_basic_transform(collate_level level, const CharType* b, const CharType* e) const
+        {
+            icu::UnicodeString str = cvt_.icu(b, e);
+            std::vector<uint8_t> tmp;
+            tmp.resize(str.length() + 1u);
+            icu::Collator* collate = get_collator(level);
+            const int len = collate->getSortKey(str, &tmp[0], tmp.size());
+            if(len > int(tmp.size())) {
+                tmp.resize(len);
+                collate->getSortKey(str, &tmp[0], tmp.size());
+            } else
+                tmp.resize(len);
+            return tmp;
+        }
+        std::basic_string<CharType>
+        do_transform(collate_level level, const CharType* b, const CharType* e) const override
+        {
+            std::vector<uint8_t> tmp = do_basic_transform(level, b, e);
+            return std::basic_string<CharType>(tmp.begin(), tmp.end());
+        }
+
+        long do_hash(collate_level level, const CharType* b, const CharType* e) const override
+        {
+            std::vector<uint8_t> tmp = do_basic_transform(level, b, e);
+            tmp.push_back(0);
+            return gnu_gettext::pj_winberger_hash_function(reinterpret_cast<char*>(&tmp.front()));
+        }
+
+        collate_impl(const cdata& d) : cvt_(d.encoding), locale_(d.locale), is_utf8_(d.utf8) {}
+
+        icu::Collator* get_collator(collate_level level) const
+        {
+            const int lvl_idx = level_to_int(level);
+            constexpr icu::Collator::ECollationStrength levels[level_count] = {icu::Collator::PRIMARY,
+                                                                               icu::Collator::SECONDARY,
+                                                                               icu::Collator::TERTIARY,
+                                                                               icu::Collator::QUATERNARY,
+                                                                               icu::Collator::IDENTICAL};
+
+            icu::Collator* col = collates_[lvl_idx].get();
+            if(col)
+                return col;
+
+            UErrorCode status = U_ZERO_ERROR;
+
+            collates_[lvl_idx].reset(icu::Collator::createInstance(locale_, status));
+
+            if(U_FAILURE(status))
+                throw std::runtime_error(std::string("Creation of collate failed:") + u_errorName(status));
+
+            collates_[lvl_idx]->setStrength(levels[lvl_idx]);
+            return collates_[lvl_idx].get();
+        }
+
+    private:
+        static constexpr int level_count = static_cast<int>(collate_level::identical) + 1;
+        icu_std_converter<CharType> cvt_;
+        icu::Locale locale_;
+        mutable boost::thread_specific_ptr<icu::Collator> collates_[level_count];
+        bool is_utf8_;
+    };
+
+#if BOOST_LOCALE_WITH_STRINGPIECE
+    template<>
+    int collate_impl<char>::do_real_compare(collate_level level,
+                                            const char* b1,
+                                            const char* e1,
+                                            const char* b2,
+                                            const char* e2,
+                                            UErrorCode& status) const
+    {
+        if(is_utf8_)
+            return do_utf8_compare(level, b1, e1, b2, e2, status);
+        else
+            return do_ustring_compare(level, b1, e1, b2, e2, status);
+    }
+#endif
+
+    std::locale create_collate(const std::locale& in, const cdata& cd, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return std::locale(in, new collate_impl<char>(cd));
+            case char_facet_t::wchar_f: return std::locale(in, new collate_impl<wchar_t>(cd));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return std::locale(in, new collate_impl<char16_t>(cd));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return std::locale(in, new collate_impl<char32_t>(cd));
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_icu

externals/boost/libs/locale/src/boost/locale/icu/conversion.cpp

@@ -0,0 +1,186 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/conversion.hpp>
+#include "boost/locale/icu/all_generator.hpp"
+#include "boost/locale/icu/cdata.hpp"
+#include "boost/locale/icu/icu_util.hpp"
+#include "boost/locale/icu/uconv.hpp"
+#include <limits>
+#include <unicode/locid.h>
+#include <unicode/normlzr.h>
+#include <unicode/ustring.h>
+#if BOOST_LOCALE_ICU_VERSION >= 308
+#    include <unicode/ucasemap.h>
+#    define BOOST_LOCALE_WITH_CASEMAP
+#endif
+#include <vector>
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    namespace {
+        void normalize_string(icu::UnicodeString& str, int flags)
+        {
+            UErrorCode code = U_ZERO_ERROR;
+            UNormalizationMode mode = UNORM_DEFAULT;
+            switch(flags) {
+                case norm_nfd: mode = UNORM_NFD; break;
+                case norm_nfc: mode = UNORM_NFC; break;
+                case norm_nfkd: mode = UNORM_NFKD; break;
+                case norm_nfkc: mode = UNORM_NFKC; break;
+            }
+            icu::UnicodeString tmp;
+            icu::Normalizer::normalize(str, mode, 0, tmp, code);
+
+            check_and_throw_icu_error(code);
+
+            str = tmp;
+        }
+    } // namespace
+
+    template<typename CharType>
+    class converter_impl : public converter<CharType> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        converter_impl(const cdata& d) : locale_(d.locale), encoding_(d.encoding) {}
+
+        string_type convert(converter_base::conversion_type how,
+                            const char_type* begin,
+                            const char_type* end,
+                            int flags = 0) const override
+        {
+            icu_std_converter<char_type> cvt(encoding_);
+            icu::UnicodeString str = cvt.icu(begin, end);
+            switch(how) {
+                case converter_base::normalization: normalize_string(str, flags); break;
+                case converter_base::upper_case: str.toUpper(locale_); break;
+                case converter_base::lower_case: str.toLower(locale_); break;
+                case converter_base::title_case: str.toTitle(0, locale_); break;
+                case converter_base::case_folding: str.foldCase(); break;
+            }
+            return cvt.std(str);
+        }
+
+    private:
+        icu::Locale locale_;
+        std::string encoding_;
+    }; // converter_impl
+
+#ifdef BOOST_LOCALE_WITH_CASEMAP
+    template<typename T>
+    struct get_casemap_size_type;
+
+    template<typename TRes, typename TCaseMap, typename TSize>
+    struct get_casemap_size_type<TRes (*)(TCaseMap*, char*, TSize, const char*, TSize, UErrorCode*)> {
+        using type = TSize;
+    };
+
+    class raii_casemap {
+    public:
+        raii_casemap(const raii_casemap&) = delete;
+        void operator=(const raii_casemap&) = delete;
+
+        raii_casemap(const std::string& locale_id) : map_(0)
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            map_ = ucasemap_open(locale_id.c_str(), 0, &err);
+            check_and_throw_icu_error(err);
+            if(!map_)
+                throw std::runtime_error("Failed to create UCaseMap");
+        }
+        template<typename Conv>
+        std::string convert(Conv func, const char* begin, const char* end) const
+        {
+            using size_type = typename get_casemap_size_type<Conv>::type;
+            if((end - begin) >= std::numeric_limits<std::ptrdiff_t>::max() / 11)
+                throw std::range_error("String to long to be converted by ICU");
+            const auto max_converted_size = (end - begin) * 11 / 10 + 1;
+            if(max_converted_size >= std::numeric_limits<size_type>::max())
+                throw std::range_error("String to long to be converted by ICU");
+            std::vector<char> buf(max_converted_size);
+            UErrorCode err = U_ZERO_ERROR;
+            auto size = func(map_,
+                             &buf.front(),
+                             static_cast<size_type>(buf.size()),
+                             begin,
+                             static_cast<size_type>(end - begin),
+                             &err);
+            if(err == U_BUFFER_OVERFLOW_ERROR) {
+                err = U_ZERO_ERROR;
+                buf.resize(size + 1);
+                size = func(map_,
+                            &buf.front(),
+                            static_cast<size_type>(buf.size()),
+                            begin,
+                            static_cast<size_type>(end - begin),
+                            &err);
+            }
+            check_and_throw_icu_error(err);
+            return std::string(&buf.front(), size);
+        }
+        ~raii_casemap() { ucasemap_close(map_); }
+
+    private:
+        UCaseMap* map_;
+    };
+
+    class utf8_converter_impl : public converter<char> {
+    public:
+        utf8_converter_impl(const cdata& d) : locale_id_(d.locale.getName()), map_(locale_id_) {}
+
+        std::string
+        convert(converter_base::conversion_type how, const char* begin, const char* end, int flags = 0) const override
+        {
+            switch(how) {
+                case converter_base::upper_case: return map_.convert(ucasemap_utf8ToUpper, begin, end);
+                case converter_base::lower_case: return map_.convert(ucasemap_utf8ToLower, begin, end);
+                case converter_base::title_case: {
+                    // Non-const method, so need to create a separate map
+                    raii_casemap map(locale_id_);
+                    return map.convert(ucasemap_utf8ToTitle, begin, end);
+                }
+                case converter_base::case_folding: return map_.convert(ucasemap_utf8FoldCase, begin, end);
+                case converter_base::normalization: {
+                    icu_std_converter<char> cvt("UTF-8");
+                    icu::UnicodeString str = cvt.icu(begin, end);
+                    normalize_string(str, flags);
+                    return cvt.std(str);
+                }
+            }
+            return std::string(begin, end - begin);
+        }
+
+    private:
+        std::string locale_id_;
+        raii_casemap map_;
+    }; // converter_impl
+
+#endif // BOOST_LOCALE_WITH_CASEMAP
+
+    std::locale create_convert(const std::locale& in, const cdata& cd, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f:
+#ifdef BOOST_LOCALE_WITH_CASEMAP
+                if(cd.utf8)
+                    return std::locale(in, new utf8_converter_impl(cd));
+#endif
+                return std::locale(in, new converter_impl<char>(cd));
+            case char_facet_t::wchar_f: return std::locale(in, new converter_impl<wchar_t>(cd));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return std::locale(in, new converter_impl<char16_t>(cd));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return std::locale(in, new converter_impl<char32_t>(cd));
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_icu

externals/boost/libs/locale/src/boost/locale/icu/date_time.cpp

@@ -0,0 +1,234 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2021-2022 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/date_time.hpp>
+#include <boost/locale/date_time_facet.hpp>
+#include <boost/locale/formatting.hpp>
+#include <boost/locale/hold_ptr.hpp>
+#include "boost/locale/icu/all_generator.hpp"
+#include "boost/locale/icu/cdata.hpp"
+#include "boost/locale/icu/icu_util.hpp"
+#include "boost/locale/icu/time_zone.hpp"
+#include "boost/locale/icu/uconv.hpp"
+#include <boost/thread.hpp>
+#include <cmath>
+#include <memory>
+#include <unicode/calendar.h>
+#include <unicode/gregocal.h>
+#include <unicode/utypes.h>
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    static void check_and_throw_dt(UErrorCode& e)
+    {
+        if(U_FAILURE(e)) {
+            throw date_time_error(u_errorName(e));
+        }
+    }
+    using period::marks::period_mark;
+
+    static UCalendarDateFields to_icu(period::marks::period_mark f)
+    {
+        using namespace period::marks;
+
+        switch(f) {
+            case era: return UCAL_ERA;
+            case year: return UCAL_YEAR;
+            case extended_year: return UCAL_EXTENDED_YEAR;
+            case month: return UCAL_MONTH;
+            case day: return UCAL_DATE;
+            case day_of_year: return UCAL_DAY_OF_YEAR;
+            case day_of_week: return UCAL_DAY_OF_WEEK;
+            case day_of_week_in_month: return UCAL_DAY_OF_WEEK_IN_MONTH;
+            case day_of_week_local: return UCAL_DOW_LOCAL;
+            case hour: return UCAL_HOUR_OF_DAY;
+            case hour_12: return UCAL_HOUR;
+            case am_pm: return UCAL_AM_PM;
+            case minute: return UCAL_MINUTE;
+            case second: return UCAL_SECOND;
+            case week_of_year: return UCAL_WEEK_OF_YEAR;
+            case week_of_month: return UCAL_WEEK_OF_MONTH;
+            case first_day_of_week:
+            case invalid: break;
+        }
+        throw std::invalid_argument("Invalid date_time period type");
+    }
+
+    class calendar_impl : public abstract_calendar {
+    public:
+        calendar_impl(const cdata& dat)
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            calendar_.reset(icu::Calendar::createInstance(dat.locale, err));
+            check_and_throw_dt(err);
+#if BOOST_LOCALE_ICU_VERSION < 402
+            // workaround old/invalid data, it should be 4 in general
+            calendar_->setMinimalDaysInFirstWeek(4);
+#endif
+            encoding_ = dat.encoding;
+        }
+        calendar_impl(const calendar_impl& other)
+        {
+            calendar_.reset(other.calendar_->clone());
+            encoding_ = other.encoding_;
+        }
+
+        calendar_impl* clone() const override
+        {
+            return new calendar_impl(*this);
+        }
+
+        void set_value(period::marks::period_mark p, int value) override
+        {
+            calendar_->set(to_icu(p), int32_t(value));
+        }
+
+        int get_value(period::marks::period_mark p, value_type type) const override
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            int v = 0;
+            if(p == period::marks::first_day_of_week) {
+                guard l(lock_);
+                v = calendar_->getFirstDayOfWeek(err);
+            } else {
+                UCalendarDateFields uper = to_icu(p);
+                guard l(lock_);
+                switch(type) {
+                    case absolute_minimum: v = calendar_->getMinimum(uper); break;
+                    case actual_minimum: v = calendar_->getActualMinimum(uper, err); break;
+                    case greatest_minimum: v = calendar_->getGreatestMinimum(uper); break;
+                    case current: v = calendar_->get(uper, err); break;
+                    case least_maximum: v = calendar_->getLeastMaximum(uper); break;
+                    case actual_maximum: v = calendar_->getActualMaximum(uper, err); break;
+                    case absolute_maximum: v = calendar_->getMaximum(uper); break;
+                }
+            }
+            check_and_throw_dt(err);
+            return v;
+        }
+
+        void set_time(const posix_time& p) override
+        {
+            double utime = p.seconds * 1000.0 + p.nanoseconds / 1000000.0;
+            UErrorCode code = U_ZERO_ERROR;
+            calendar_->setTime(utime, code);
+            check_and_throw_dt(code);
+        }
+        void normalize() override
+        {
+            // Can't call complete() explicitly (protected)
+            // calling get which calls complete
+            UErrorCode code = U_ZERO_ERROR;
+            calendar_->get(UCAL_YEAR, code);
+            check_and_throw_dt(code);
+        }
+        posix_time get_time() const override
+        {
+            const double timeMs = get_time_ms();
+            posix_time res;
+            res.seconds = static_cast<int64_t>(std::floor(timeMs / 1e3));
+            const double remainTimeMs = std::fmod(timeMs, 1e3); // = timeMs - seconds * 1000
+            constexpr uint32_t ns_in_s = static_cast<uint32_t>(1000) * 1000 * 1000;
+            res.nanoseconds = std::min(static_cast<uint32_t>(remainTimeMs * 1e6), ns_in_s - 1u);
+            return res;
+        }
+        double get_time_ms() const override
+        {
+            UErrorCode code = U_ZERO_ERROR;
+            double result;
+            {
+                guard l(lock_);
+                result = calendar_->getTime(code);
+            }
+            check_and_throw_dt(code);
+            return result;
+        }
+        void set_option(calendar_option_type opt, int /*v*/) override
+        {
+            switch(opt) {
+                case is_gregorian: throw date_time_error("is_gregorian is not settable options for calendar");
+                case is_dst: throw date_time_error("is_dst is not settable options for calendar");
+            }
+        }
+        int get_option(calendar_option_type opt) const override
+        {
+            switch(opt) {
+                case is_gregorian: return icu_cast<const icu::GregorianCalendar>(calendar_.get()) != 0;
+                case is_dst: {
+                    guard l(lock_);
+                    UErrorCode err = U_ZERO_ERROR;
+                    bool res = (calendar_->inDaylightTime(err) != 0);
+                    check_and_throw_dt(err);
+                    return res;
+                }
+            }
+            return 0;
+        }
+        void adjust_value(period::marks::period_mark p, update_type u, int difference) override
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            switch(u) {
+                case move: calendar_->add(to_icu(p), difference, err); break;
+                case roll: calendar_->roll(to_icu(p), difference, err); break;
+            }
+            check_and_throw_dt(err);
+        }
+        int difference(const abstract_calendar& other, period::marks::period_mark m) const override
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            const double other_time_ms = other.get_time_ms();
+
+            // fieldDifference has side effect of moving calendar (WTF?)
+            // So we clone it for performing this operation
+            hold_ptr<icu::Calendar> self(calendar_->clone());
+
+            int diff = self->fieldDifference(other_time_ms, to_icu(m), err);
+
+            check_and_throw_dt(err);
+            return diff;
+        }
+        void set_timezone(const std::string& tz) override
+        {
+            calendar_->adoptTimeZone(get_time_zone(tz));
+        }
+        std::string get_timezone() const override
+        {
+            icu::UnicodeString tz;
+            calendar_->getTimeZone().getID(tz);
+            icu_std_converter<char> cvt(encoding_);
+            return cvt.std(tz);
+        }
+        bool same(const abstract_calendar* other) const override
+        {
+            const calendar_impl* oc = dynamic_cast<const calendar_impl*>(other);
+            if(!oc)
+                return false;
+            return calendar_->isEquivalentTo(*oc->calendar_) != 0;
+        }
+
+    private:
+        typedef boost::unique_lock<boost::mutex> guard;
+        mutable boost::mutex lock_;
+        std::string encoding_;
+        hold_ptr<icu::Calendar> calendar_;
+    };
+
+    class icu_calendar_facet : public calendar_facet {
+    public:
+        icu_calendar_facet(const cdata& d, size_t refs = 0) : calendar_facet(refs), data_(d) {}
+        abstract_calendar* create_calendar() const override { return new calendar_impl(data_); }
+
+    private:
+        cdata data_;
+    };
+
+    std::locale create_calendar(const std::locale& in, const cdata& d)
+    {
+        return std::locale(in, new icu_calendar_facet(d));
+    }
+
+}}} // namespace boost::locale::impl_icu

externals/boost/libs/locale/src/boost/locale/icu/formatter.cpp

@@ -0,0 +1,459 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2021-2022 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/icu/formatter.hpp"
+#include <boost/locale/formatting.hpp>
+#include <boost/locale/info.hpp>
+#include "boost/locale/icu/formatters_cache.hpp"
+#include "boost/locale/icu/icu_util.hpp"
+#include "boost/locale/icu/time_zone.hpp"
+#include "boost/locale/icu/uconv.hpp"
+#include <limits>
+#include <memory>
+#include <unicode/datefmt.h>
+#include <unicode/decimfmt.h>
+#include <unicode/numfmt.h>
+#include <unicode/rbnf.h>
+#include <unicode/smpdtfmt.h>
+
+#ifdef BOOST_MSVC
+#    pragma warning(disable : 4244) // lose data
+#endif
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    namespace {
+        // Set the min/max fraction digits for the NumberFormat
+        void set_fraction_digits(icu::NumberFormat& nf, const std::ios_base::fmtflags how, std::streamsize precision)
+        {
+#if BOOST_LOCALE_ICU_VERSION >= 5601
+            // Since ICU 56.1 the integer part counts to the fraction part
+            if(how == std::ios_base::scientific)
+                precision += nf.getMaximumIntegerDigits();
+#endif
+            nf.setMaximumFractionDigits(precision);
+            if(how == std::ios_base::scientific || how == std::ios_base::fixed) {
+                nf.setMinimumFractionDigits(precision);
+            } else {
+                nf.setMinimumFractionDigits(0);
+            }
+        }
+    } // namespace
+
+    template<typename CharType>
+    class number_format : public formatter<CharType> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<CharType> string_type;
+
+        number_format(icu::NumberFormat& fmt, std::string codepage) : cvt_(codepage), icu_fmt_(fmt) {}
+
+        string_type format(double value, size_t& code_points) const override { return do_format(value, code_points); }
+        string_type format(int64_t value, size_t& code_points) const override { return do_format(value, code_points); }
+        string_type format(int32_t value, size_t& code_points) const override { return do_format(value, code_points); }
+        size_t parse(const string_type& str, double& value) const override { return do_parse(str, value); }
+        size_t parse(const string_type& str, int64_t& value) const override { return do_parse(str, value); }
+        size_t parse(const string_type& str, int32_t& value) const override { return do_parse(str, value); }
+
+    private:
+        bool get_value(double& v, icu::Formattable& fmt) const
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            v = fmt.getDouble(err);
+            if(U_FAILURE(err))
+                return false;
+            return true;
+        }
+
+        bool get_value(int64_t& v, icu::Formattable& fmt) const
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            v = fmt.getInt64(err);
+            if(U_FAILURE(err))
+                return false;
+            return true;
+        }
+
+        bool get_value(int32_t& v, icu::Formattable& fmt) const
+        {
+            UErrorCode err = U_ZERO_ERROR;
+            v = fmt.getLong(err);
+            if(U_FAILURE(err))
+                return false;
+            return true;
+        }
+
+        template<typename ValueType>
+        string_type do_format(ValueType value, size_t& code_points) const
+        {
+            icu::UnicodeString tmp;
+            icu_fmt_.format(value, tmp);
+            code_points = tmp.countChar32();
+            return cvt_.std(tmp);
+        }
+
+        template<typename ValueType>
+        size_t do_parse(const string_type& str, ValueType& v) const
+        {
+            icu::Formattable val;
+            icu::ParsePosition pp;
+            icu::UnicodeString tmp = cvt_.icu(str.data(), str.data() + str.size());
+
+            icu_fmt_.parse(tmp, val, pp);
+
+            ValueType tmp_v;
+
+            if(pp.getIndex() == 0 || !get_value(tmp_v, val))
+                return 0;
+            size_t cut = cvt_.cut(tmp, str.data(), str.data() + str.size(), pp.getIndex());
+            if(cut == 0)
+                return 0;
+            v = tmp_v;
+            return cut;
+        }
+
+        icu_std_converter<CharType> cvt_;
+        icu::NumberFormat& icu_fmt_;
+    };
+
+    template<typename CharType>
+    class date_format : public formatter<CharType> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<CharType> string_type;
+
+        string_type format(double value, size_t& code_points) const override { return do_format(value, code_points); }
+        string_type format(int64_t value, size_t& code_points) const override { return do_format(value, code_points); }
+
+        string_type format(int32_t value, size_t& code_points) const override { return do_format(value, code_points); }
+
+        size_t parse(const string_type& str, double& value) const override { return do_parse(str, value); }
+        size_t parse(const string_type& str, int64_t& value) const override { return do_parse(str, value); }
+        size_t parse(const string_type& str, int32_t& value) const override { return do_parse(str, value); }
+
+        date_format(icu::DateFormat& fmt, const std::string& encoding) : cvt_(encoding), icu_fmt_(fmt) {}
+        date_format(std::unique_ptr<icu::DateFormat> fmt, const std::string& encoding) :
+            cvt_(encoding), icu_fmt_holder_(std::move(fmt)), icu_fmt_(*icu_fmt_holder_)
+        {}
+
+    private:
+        template<typename ValueType>
+        size_t do_parse(const string_type& str, ValueType& value) const
+        {
+            icu::ParsePosition pp;
+            icu::UnicodeString tmp = cvt_.icu(str.data(), str.data() + str.size());
+
+            UDate udate = icu_fmt_.parse(tmp, pp);
+            if(pp.getIndex() == 0)
+                return 0;
+            double date = udate / 1000.0;
+            typedef std::numeric_limits<ValueType> limits_type;
+            // Explicit cast to double to avoid warnings changing value (e.g. for INT64_MAX -> double)
+            if(date > static_cast<double>(limits_type::max()) || date < static_cast<double>(limits_type::min()))
+                return 0;
+            size_t cut = cvt_.cut(tmp, str.data(), str.data() + str.size(), pp.getIndex());
+            if(cut == 0)
+                return 0;
+            // Handle the edge case where the double is slightly out of range and hence the cast would be UB
+            // by rounding to the min/max values
+            if(date == static_cast<double>(limits_type::max()))
+                value = limits_type::max();
+            else if(date == static_cast<double>(limits_type::min()))
+                value = limits_type::min();
+            else
+                value = static_cast<ValueType>(date);
+            return cut;
+        }
+
+        string_type do_format(double value, size_t& codepoints) const
+        {
+            UDate date = value * 1000.0; /// UDate is time_t in milliseconds
+            icu::UnicodeString tmp;
+            icu_fmt_.format(date, tmp);
+            codepoints = tmp.countChar32();
+            return cvt_.std(tmp);
+        }
+
+        icu_std_converter<CharType> cvt_;
+        std::unique_ptr<icu::DateFormat> icu_fmt_holder_;
+        icu::DateFormat& icu_fmt_;
+    };
+
+    icu::UnicodeString strftime_symbol_to_icu(const char c, const formatters_cache& cache)
+    {
+        switch(c) {
+            case 'a': // Abbr Weekday
+                return "EE";
+            case 'A': // Full Weekday
+                return "EEEE";
+            case 'b': // Abbr Month
+                return "MMM";
+            case 'B': // Full Month
+                return "MMMM";
+            case 'c': // DateTime
+                return cache.default_date_time_format();
+            // not supported by ICU ;(
+            //  case 'C': // Century -> 1980 -> 19
+            case 'd': // Day of Month [01,31]
+                return "dd";
+            case 'D': // %m/%d/%y
+                return "MM/dd/yy";
+            case 'e': // Day of Month [1,31]
+                return "d";
+            case 'h': // == b
+                return "MMM";
+            case 'H': // 24 clock hour 00,23
+                return "HH";
+            case 'I': // 12 clock hour 01,12
+                return "hh";
+            case 'j': // day of year 001,366
+                return "D";
+            case 'm': // month as [01,12]
+                return "MM";
+            case 'M': // minute [00,59]
+                return "mm";
+            case 'n': // \n
+                return "\n";
+            case 'p': // am-pm
+                return "a";
+            case 'r': // time with AM/PM %I:%M:%S %p
+                return "hh:mm:ss a";
+            case 'R': // %H:%M
+                return "HH:mm";
+            case 'S': // second [00,61]
+                return "ss";
+            case 't': // \t
+                return "\t";
+            case 'T': // %H:%M:%S
+                return "HH:mm:ss";
+                /*          case 'u': // weekday 1,7 1=Monday
+                            case 'U': // week number of year [00,53] Sunday first
+                            case 'V': // week number of year [01,53] Monday first
+                            case 'w': // weekday 0,7 0=Sunday
+                            case 'W': // week number of year [00,53] Monday first, */
+            case 'x': // Date
+                return cache.default_date_format();
+            case 'X': // Time
+                return cache.default_time_format();
+            case 'y': // Year [00-99]
+                return "yy";
+            case 'Y': // Year 1998
+                return "yyyy";
+            case 'Z': // timezone
+                return "vvvv";
+            case '%': // %
+                return "%";
+            default: return "";
+        }
+    }
+
+    icu::UnicodeString strftime_to_icu(const icu::UnicodeString& ftime, const formatters_cache& cache)
+    {
+        const unsigned len = ftime.length();
+        icu::UnicodeString result;
+        bool escaped = false;
+        for(unsigned i = 0; i < len; i++) {
+            UChar c = ftime[i];
+            if(c == '%') {
+                i++;
+                c = ftime[i];
+                if(c == 'E' || c == 'O') {
+                    i++;
+                    c = ftime[i];
+                }
+                if(escaped) {
+                    result += "'";
+                    escaped = false;
+                }
+                result += strftime_symbol_to_icu(c, cache);
+            } else if(c == '\'') {
+                result += "''";
+            } else {
+                if(!escaped) {
+                    result += "'";
+                    escaped = true;
+                }
+                result += c;
+            }
+        }
+        if(escaped)
+            result += "'";
+        return result;
+    }
+
+    format_len time_flags_to_len(const uint64_t time_flags)
+    {
+        switch(time_flags) {
+            using namespace boost::locale::flags;
+            case time_short: return format_len::Short;
+            case time_medium: return format_len::Medium;
+            case time_long: return format_len::Long;
+            case time_full: return format_len::Full;
+            default: return format_len::Medium;
+        }
+    }
+    format_len date_flags_to_len(const uint64_t date_flags)
+    {
+        switch(date_flags) {
+            using namespace boost::locale::flags;
+            case date_short: return format_len::Short;
+            case date_medium: return format_len::Medium;
+            case date_long: return format_len::Long;
+            case date_full: return format_len::Full;
+            default: return format_len::Medium;
+        }
+    }
+    icu::DateFormat::EStyle time_flags_to_icu_len(const uint64_t time_flags)
+    {
+        switch(time_flags) {
+            using namespace boost::locale::flags;
+            case time_short: return icu::DateFormat::kShort;
+            case time_medium: return icu::DateFormat::kMedium;
+            case time_long: return icu::DateFormat::kLong;
+            case time_full: return icu::DateFormat::kFull;
+            case time_default:
+            default: return icu::DateFormat::kDefault;
+        }
+    }
+    icu::DateFormat::EStyle date_flags_to_icu_len(const uint64_t date_flags)
+    {
+        switch(date_flags) {
+            using namespace boost::locale::flags;
+            case date_short: return icu::DateFormat::kShort;
+            case date_medium: return icu::DateFormat::kMedium;
+            case date_long: return icu::DateFormat::kLong;
+            case date_full: return icu::DateFormat::kFull;
+            case date_default:
+            default: return icu::DateFormat::kDefault;
+        }
+    }
+
+    template<typename CharType>
+    std::unique_ptr<formatter<CharType>>
+    formatter<CharType>::create(std::ios_base& ios, const icu::Locale& locale, const std::string& encoding)
+    {
+        using ptr_type = std::unique_ptr<formatter<CharType>>;
+
+        const ios_info& info = ios_info::get(ios);
+        const formatters_cache& cache = std::use_facet<formatters_cache>(ios.getloc());
+
+        const uint64_t disp = info.display_flags();
+        switch(disp) {
+            using namespace boost::locale::flags;
+            case posix:
+                BOOST_ASSERT_MSG(false, "Shouldn't try to create a posix formatter"); // LCOV_EXCL_LINE
+                break;                                                                // LCOV_EXCL_LINE
+            case number: {
+                const std::ios_base::fmtflags how = (ios.flags() & std::ios_base::floatfield);
+                icu::NumberFormat& nf =
+                  cache.number_format((how == std::ios_base::scientific) ? num_fmt_type::sci : num_fmt_type::number);
+                set_fraction_digits(nf, how, ios.precision());
+                return ptr_type(new number_format<CharType>(nf, encoding));
+            }
+            case currency: {
+                icu::NumberFormat& nf = cache.number_format(
+                  (info.currency_flags() == currency_iso) ? num_fmt_type::curr_iso : num_fmt_type::curr_nat);
+                return ptr_type(new number_format<CharType>(nf, encoding));
+            }
+            case percent: {
+                icu::NumberFormat& nf = cache.number_format(num_fmt_type::percent);
+                set_fraction_digits(nf, ios.flags() & std::ios_base::floatfield, ios.precision());
+                return ptr_type(new number_format<CharType>(nf, encoding));
+            }
+            case spellout:
+                return ptr_type(new number_format<CharType>(cache.number_format(num_fmt_type::spell), encoding));
+            case ordinal:
+                return ptr_type(new number_format<CharType>(cache.number_format(num_fmt_type::ordinal), encoding));
+            case date:
+            case time:
+            case datetime:
+            case strftime: {
+                using namespace flags;
+                std::unique_ptr<icu::DateFormat> new_df;
+                icu::DateFormat* df = 0;
+                // try to use cached first
+                {
+                    icu::SimpleDateFormat* sdf = cache.date_formatter();
+                    if(sdf) {
+                        icu::UnicodeString pattern;
+                        switch(disp) {
+                            case date: pattern = cache.date_format(date_flags_to_len(info.date_flags())); break;
+                            case time: pattern = cache.time_format(time_flags_to_len(info.time_flags())); break;
+                            case datetime:
+                                pattern = cache.date_time_format(date_flags_to_len(info.date_flags()),
+                                                                 time_flags_to_len(info.time_flags()));
+                                break;
+                            case strftime: {
+                                icu_std_converter<CharType> cvt_(encoding);
+                                const std::basic_string<CharType>& f = info.date_time_pattern<CharType>();
+                                pattern = strftime_to_icu(cvt_.icu(f.c_str(), f.c_str() + f.size()), locale);
+                            } break;
+                        }
+                        if(!pattern.isEmpty()) {
+                            sdf->applyPattern(pattern);
+                            df = sdf;
+                        }
+                    }
+                }
+
+                if(!df) {
+                    switch(disp) {
+                        case date:
+                            new_df.reset(
+                              icu::DateFormat::createDateInstance(date_flags_to_icu_len(info.date_flags()), locale));
+                            break;
+                        case time:
+                            new_df.reset(
+                              icu::DateFormat::createTimeInstance(time_flags_to_icu_len(info.time_flags()), locale));
+                            break;
+                        case datetime:
+                            new_df.reset(
+                              icu::DateFormat::createDateTimeInstance(date_flags_to_icu_len(info.date_flags()),
+                                                                      time_flags_to_icu_len(info.time_flags()),
+                                                                      locale));
+                            break;
+                        case strftime: {
+                            icu_std_converter<CharType> cvt_(encoding);
+                            const std::basic_string<CharType>& f = info.date_time_pattern<CharType>();
+                            icu::UnicodeString pattern =
+                              strftime_to_icu(cvt_.icu(f.data(), f.data() + f.size()), locale);
+                            UErrorCode err = U_ZERO_ERROR;
+                            new_df.reset(new icu::SimpleDateFormat(pattern, locale, err));
+                            if(U_FAILURE(err))
+                                return nullptr;
+                        } break;
+                    }
+                    df = new_df.get();
+                    BOOST_ASSERT_MSG(df, "Failed to create date/time formatter");
+                }
+
+                df->adoptTimeZone(get_time_zone(info.time_zone()));
+
+                // Depending if we own formatter or not
+                if(new_df)
+                    return ptr_type(new date_format<CharType>(std::move(new_df), encoding));
+                else
+                    return ptr_type(new date_format<CharType>(*df, encoding));
+            } break;
+        }
+
+        return nullptr; // LCOV_EXCL_LINE
+    }
+
+    template class formatter<char>;
+    template class formatter<wchar_t>;
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+    template class formatter<char16_t>;
+#endif
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+    template class formatter<char32_t>;
+#endif
+}}} // namespace boost::locale::impl_icu
+
+// boostinspect:nominmax

externals/boost/libs/locale/src/boost/locale/icu/formatter.hpp

@@ -0,0 +1,73 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_FORMATTER_HPP_INCLUDED
+#define BOOST_LOCALE_FORMATTER_HPP_INCLUDED
+
+#include <boost/locale/config.hpp>
+#include <boost/cstdint.hpp>
+#include <memory>
+#include <string>
+#include <unicode/locid.h>
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    /// \brief Special base polymorphic class that is used as a character type independent base for all formatter
+    /// classes
+    class base_formatter {
+    public:
+        virtual ~base_formatter() = default;
+    };
+
+    /// \brief A class that is used for formatting numbers, currency and dates/times
+    template<typename CharType>
+    class formatter : public base_formatter {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<CharType> string_type;
+
+        /// Format the value and return the number of Unicode code points
+        virtual string_type format(double value, size_t& code_points) const = 0;
+        /// Format the value and return the number of Unicode code points
+        virtual string_type format(int64_t value, size_t& code_points) const = 0;
+        /// Format the value and return the number of Unicode code points
+        virtual string_type format(int32_t value, size_t& code_points) const = 0;
+
+        /// Parse the string and return the number of used characters. If it returns 0
+        /// then parsing failed.
+        virtual size_t parse(const string_type& str, double& value) const = 0;
+        /// Parse the string and return the number of used characters. If it returns 0
+        /// then parsing failed.
+        virtual size_t parse(const string_type& str, int64_t& value) const = 0;
+        /// Parse the string and return the number of used characters. If it returns 0
+        /// then parsing failed.
+        virtual size_t parse(const string_type& str, int32_t& value) const = 0;
+
+        /// Get formatter for the current state of ios_base -- flags and locale,
+        /// NULL may be returned if an invalid combination of flags is provided or this type
+        /// of formatting is not supported by locale.
+        ///
+        /// Note: formatter is cached. If \a ios is not changed (no flags or locale changed)
+        /// the formatter would remain the same. Otherwise it would be rebuild and cached
+        /// for future use. It is useful for saving time for generation
+        /// of multiple values with same locale.
+        ///
+        /// For example this code will create a new spelling formatter only once:
+        ///
+        /// \code
+        ///     std::cout << as::spellout;
+        ///     for(int i=1;i<=10;i++)
+        ///         std::cout << i << std::endl;
+        /// \endcode
+        ///
+        ///
+        static std::unique_ptr<formatter>
+        create(std::ios_base& ios, const icu::Locale& locale, const std::string& encoding);
+    }; // class formatter
+
+}}} // namespace boost::locale::impl_icu
+
+#endif

externals/boost/libs/locale/src/boost/locale/icu/formatters_cache.cpp

@@ -0,0 +1,143 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2021-2022 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/icu/formatters_cache.hpp"
+#include <boost/assert.hpp>
+#include <boost/core/ignore_unused.hpp>
+#include <memory>
+#include <type_traits>
+#ifdef BOOST_MSVC
+#    pragma warning(push)
+#    pragma warning(disable : 4251) // "identifier" : class "type" needs to have dll-interface...
+#endif
+#include <unicode/datefmt.h>
+#include <unicode/numfmt.h>
+#include <unicode/rbnf.h>
+#include <unicode/smpdtfmt.h>
+#ifdef BOOST_MSVC
+#    pragma warning(pop)
+#endif
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    std::locale::id formatters_cache::id;
+
+    namespace {
+
+        struct init {
+            init() { ignore_unused(std::has_facet<formatters_cache>(std::locale::classic())); }
+        } instance;
+
+        void get_icu_pattern(std::unique_ptr<icu::DateFormat> fmt, icu::UnicodeString& out_str)
+        {
+            icu::SimpleDateFormat* sfmt = icu_cast<icu::SimpleDateFormat>(fmt.get());
+            if(sfmt)
+                sfmt->toPattern(out_str);
+            else
+                out_str.remove(); // LCOV_EXCL_LINE
+        }
+        void get_icu_pattern(icu::DateFormat* fmt, icu::UnicodeString& out_str)
+        {
+            return get_icu_pattern(std::unique_ptr<icu::DateFormat>(fmt), out_str);
+        }
+    } // namespace
+
+    formatters_cache::formatters_cache(const icu::Locale& locale) : locale_(locale)
+    {
+#define BOOST_LOCALE_ARRAY_SIZE(T) std::extent<typename std::remove_reference<decltype(T)>::type>::value
+        constexpr icu::DateFormat::EStyle styles[]{icu::DateFormat::kShort,
+                                                   icu::DateFormat::kMedium,
+                                                   icu::DateFormat::kLong,
+                                                   icu::DateFormat::kFull};
+        constexpr int num_styles = BOOST_LOCALE_ARRAY_SIZE(styles);
+
+        static_assert(num_styles == BOOST_LOCALE_ARRAY_SIZE(date_format_), "!");
+        for(int i = 0; i < num_styles; i++)
+            get_icu_pattern(icu::DateFormat::createDateInstance(styles[i], locale), date_format_[i]);
+
+        static_assert(num_styles == BOOST_LOCALE_ARRAY_SIZE(time_format_), "!");
+        for(int i = 0; i < num_styles; i++)
+            get_icu_pattern(icu::DateFormat::createTimeInstance(styles[i], locale), time_format_[i]);
+
+        static_assert(num_styles == BOOST_LOCALE_ARRAY_SIZE(date_time_format_), "!");
+        static_assert(num_styles == BOOST_LOCALE_ARRAY_SIZE(date_time_format_[0]), "!");
+        for(int i = 0; i < num_styles; i++) {
+            for(int j = 0; j < num_styles; j++) {
+                get_icu_pattern(icu::DateFormat::createDateTimeInstance(styles[i], styles[j], locale),
+                                date_time_format_[i][j]);
+            }
+        }
+#undef BOOST_LOCALE_ARRAY_SIZE
+
+        const auto get_str_or = [](const icu::UnicodeString& str, const char* default_str) {
+            return str.isEmpty() ? default_str : str;
+        };
+        default_date_format_ = get_str_or(date_format(format_len::Medium), "yyyy-MM-dd");
+        default_time_format_ = get_str_or(time_format(format_len::Medium), "HH:mm:ss");
+        default_date_time_format_ =
+          get_str_or(date_time_format(format_len::Full, format_len::Full), "yyyy-MM-dd HH:mm:ss");
+    }
+
+    icu::NumberFormat* formatters_cache::create_number_format(num_fmt_type type, UErrorCode& err) const
+    {
+        switch(type) {
+            case num_fmt_type::number: return icu::NumberFormat::createInstance(locale_, err); break;
+            case num_fmt_type::sci: return icu::NumberFormat::createScientificInstance(locale_, err); break;
+#if BOOST_LOCALE_ICU_VERSION >= 408
+            case num_fmt_type::curr_nat: return icu::NumberFormat::createInstance(locale_, UNUM_CURRENCY, err); break;
+            case num_fmt_type::curr_iso:
+                return icu::NumberFormat::createInstance(locale_, UNUM_CURRENCY_ISO, err);
+                break;
+#elif BOOST_LOCALE_ICU_VERSION >= 402
+            case num_fmt_type::curr_nat:
+                return icu::NumberFormat::createInstance(locale_, icu::NumberFormat::kCurrencyStyle, err);
+                break;
+            case num_fmt_type::curr_iso:
+                return icu::NumberFormat::createInstance(locale_, icu::NumberFormat::kIsoCurrencyStyle, err);
+                break;
+#else
+            case num_fmt_type::curr_nat:
+            case num_fmt_type::curr_iso: return icu::NumberFormat::createCurrencyInstance(locale_, err); break;
+#endif
+            case num_fmt_type::percent: return icu::NumberFormat::createPercentInstance(locale_, err); break;
+            case num_fmt_type::spell: return new icu::RuleBasedNumberFormat(icu::URBNF_SPELLOUT, locale_, err); break;
+            case num_fmt_type::ordinal: return new icu::RuleBasedNumberFormat(icu::URBNF_ORDINAL, locale_, err); break;
+        }
+        throw std::logic_error("locale::internal error should not get there"); // LCOV_EXCL_LINE
+    }
+
+    icu::NumberFormat& formatters_cache::number_format(num_fmt_type type) const
+    {
+        icu::NumberFormat* result = number_format_[int(type)].get();
+        if(!result) {
+            UErrorCode err = U_ZERO_ERROR;
+            std::unique_ptr<icu::NumberFormat> new_ptr(create_number_format(type, err));
+            check_and_throw_icu_error(err, "Failed to create a formatter");
+            result = new_ptr.get();
+            BOOST_ASSERT(result);
+            number_format_[int(type)].reset(new_ptr.release());
+        }
+        return *result;
+    }
+
+    icu::SimpleDateFormat* formatters_cache::date_formatter() const
+    {
+        icu::SimpleDateFormat* result = date_formatter_.get();
+        if(!result) {
+            std::unique_ptr<icu::DateFormat> fmt(
+              icu::DateFormat::createDateTimeInstance(icu::DateFormat::kMedium, icu::DateFormat::kMedium, locale_));
+
+            result = icu_cast<icu::SimpleDateFormat>(fmt.get());
+            if(result) {
+                fmt.release();
+                date_formatter_.reset(result);
+            }
+        }
+        return result;
+    }
+
+}}} // namespace boost::locale::impl_icu

externals/boost/libs/locale/src/boost/locale/icu/formatters_cache.hpp

@@ -0,0 +1,78 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2021-2022 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_PREDEFINED_FORMATTERS_HPP_INCLUDED
+#define BOOST_LOCALE_PREDEFINED_FORMATTERS_HPP_INCLUDED
+
+#include <boost/locale/config.hpp>
+#include "boost/locale/icu/icu_util.hpp"
+#include <boost/thread/tss.hpp>
+#include <locale>
+
+#ifdef BOOST_MSVC
+#    pragma warning(push)
+#    pragma warning(disable : 4251) // "identifier" : class "type" needs to have dll-interface...
+#endif
+#include <unicode/locid.h>
+#include <unicode/numfmt.h>
+#include <unicode/smpdtfmt.h>
+#ifdef BOOST_MSVC
+#    pragma warning(pop)
+#endif
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    enum class format_len {
+        Short,
+        Medium,
+        Long,
+        Full,
+    };
+
+    enum class num_fmt_type { number, sci, curr_nat, curr_iso, percent, spell, ordinal };
+
+    class formatters_cache : public std::locale::facet {
+    public:
+        static std::locale::id id;
+
+        formatters_cache(const icu::Locale& locale);
+
+        icu::NumberFormat& number_format(num_fmt_type type) const;
+
+        const icu::UnicodeString& date_format(format_len f) const { return date_format_[int(f)]; }
+
+        const icu::UnicodeString& time_format(format_len f) const { return time_format_[int(f)]; }
+
+        const icu::UnicodeString& date_time_format(format_len d, format_len t) const
+        {
+            return date_time_format_[int(d)][int(t)];
+        }
+
+        const icu::UnicodeString& default_date_format() const { return default_date_format_; }
+        const icu::UnicodeString& default_time_format() const { return default_time_format_; }
+        const icu::UnicodeString& default_date_time_format() const { return default_date_time_format_; }
+
+        icu::SimpleDateFormat* date_formatter() const;
+
+    private:
+        icu::NumberFormat* create_number_format(num_fmt_type type, UErrorCode& err) const;
+
+        static constexpr auto num_fmt_type_count = static_cast<unsigned>(num_fmt_type::ordinal) + 1;
+        static constexpr auto format_len_count = static_cast<unsigned>(format_len::Full) + 1;
+
+        mutable boost::thread_specific_ptr<icu::NumberFormat> number_format_[num_fmt_type_count];
+        icu::UnicodeString date_format_[format_len_count];
+        icu::UnicodeString time_format_[format_len_count];
+        icu::UnicodeString date_time_format_[format_len_count][format_len_count];
+        icu::UnicodeString default_date_format_, default_time_format_, default_date_time_format_;
+        mutable boost::thread_specific_ptr<icu::SimpleDateFormat> date_formatter_;
+        icu::Locale locale_;
+    };
+
+}}} // namespace boost::locale::impl_icu
+
+#endif

externals/boost/libs/locale/src/boost/locale/icu/icu_backend.cpp

@@ -0,0 +1,135 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/icu/icu_backend.hpp"
+#include <boost/locale/gnu_gettext.hpp>
+#include <boost/locale/localization_backend.hpp>
+#include <boost/locale/util.hpp>
+#include <boost/locale/util/locale_data.hpp>
+#include "boost/locale/icu/all_generator.hpp"
+#include "boost/locale/icu/cdata.hpp"
+#include <algorithm>
+#include <iterator>
+
+#include <unicode/ucnv.h>
+
+namespace boost { namespace locale { namespace impl_icu {
+    class icu_localization_backend : public localization_backend {
+    public:
+        icu_localization_backend() : invalid_(true), use_ansi_encoding_(false) {}
+        icu_localization_backend(const icu_localization_backend& other) :
+            localization_backend(), paths_(other.paths_), domains_(other.domains_), locale_id_(other.locale_id_),
+            invalid_(true), use_ansi_encoding_(other.use_ansi_encoding_)
+        {}
+        icu_localization_backend* clone() const override { return new icu_localization_backend(*this); }
+
+        void set_option(const std::string& name, const std::string& value) override
+        {
+            invalid_ = true;
+            if(name == "locale")
+                locale_id_ = value;
+            else if(name == "message_path")
+                paths_.push_back(value);
+            else if(name == "message_application")
+                domains_.push_back(value);
+            else if(name == "use_ansi_encoding")
+                use_ansi_encoding_ = value == "true";
+        }
+        void clear_options() override
+        {
+            invalid_ = true;
+            use_ansi_encoding_ = false;
+            locale_id_.clear();
+            paths_.clear();
+            domains_.clear();
+        }
+
+        void prepare_data()
+        {
+            if(!invalid_)
+                return;
+            invalid_ = false;
+            real_id_ = locale_id_;
+            if(real_id_.empty()) {
+                bool utf8 = !use_ansi_encoding_;
+                real_id_ = util::get_system_locale(utf8);
+            }
+
+            util::locale_data d;
+            d.parse(real_id_);
+
+            data_.locale = icu::Locale::createCanonical(real_id_.c_str());
+            data_.encoding = d.encoding();
+            data_.utf8 = d.is_utf8();
+            language_ = d.language();
+            country_ = d.country();
+            variant_ = d.variant();
+        }
+
+        std::locale install(const std::locale& base, category_t category, char_facet_t type) override
+        {
+            prepare_data();
+
+            switch(category) {
+                case category_t::convert: return create_convert(base, data_, type);
+                case category_t::collation: return create_collate(base, data_, type);
+                case category_t::formatting: return create_formatting(base, data_, type);
+                case category_t::parsing: return create_parsing(base, data_, type);
+                case category_t::codepage: return create_codecvt(base, data_.encoding, type);
+                case category_t::message: {
+                    gnu_gettext::messages_info minf;
+                    minf.language = language_;
+                    minf.country = country_;
+                    minf.variant = variant_;
+                    minf.encoding = data_.encoding;
+                    std::copy(domains_.begin(),
+                              domains_.end(),
+                              std::back_inserter<gnu_gettext::messages_info::domains_type>(minf.domains));
+                    minf.paths = paths_;
+                    switch(type) {
+                        case char_facet_t::nochar: break;
+                        case char_facet_t::char_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char>(minf));
+                        case char_facet_t::wchar_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<wchar_t>(minf));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+                        case char_facet_t::char16_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char16_t>(minf));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+                        case char_facet_t::char32_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char32_t>(minf));
+#endif
+                    }
+                    return base;
+                }
+                case category_t::boundary: return create_boundary(base, data_, type);
+                case category_t::calendar: return create_calendar(base, data_);
+                case category_t::information: return util::create_info(base, real_id_);
+            }
+            return base;
+        }
+
+    private:
+        std::vector<std::string> paths_;
+        std::vector<std::string> domains_;
+        std::string locale_id_;
+
+        cdata data_;
+        std::string language_;
+        std::string country_;
+        std::string variant_;
+        std::string real_id_;
+        bool invalid_;
+        bool use_ansi_encoding_;
+    };
+
+    localization_backend* create_localization_backend()
+    {
+        return new icu_localization_backend();
+    }
+
+}}} // namespace boost::locale::impl_icu

externals/boost/libs/locale/src/boost/locale/icu/icu_backend.hpp

@@ -0,0 +1,18 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_ICU_LOCALIZATION_BACKEND_HPP
+#define BOOST_LOCALE_IMPL_ICU_LOCALIZATION_BACKEND_HPP
+
+#include <boost/locale/config.hpp>
+
+namespace boost { namespace locale {
+    class localization_backend;
+    namespace impl_icu {
+        localization_backend* create_localization_backend();
+    } // namespace impl_icu
+}}    // namespace boost::locale
+#endif

externals/boost/libs/locale/src/boost/locale/icu/icu_util.hpp

@@ -0,0 +1,49 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2021-2022 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_SRC_ICU_UTIL_HPP
+#define BOOST_SRC_ICU_UTIL_HPP
+
+#include <boost/locale/config.hpp>
+#ifdef BOOST_HAS_STDINT_H
+#    include <stdint.h> // Avoid ICU defining e.g. INT8_MIN causing macro redefinition warnings
+#endif
+#include <stdexcept>
+#include <string>
+#include <unicode/utypes.h>
+#include <unicode/uversion.h>
+
+#define BOOST_LOCALE_ICU_VERSION (U_ICU_VERSION_MAJOR_NUM * 100 + U_ICU_VERSION_MINOR_NUM)
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    inline void throw_icu_error(UErrorCode err, std::string desc) // LCOV_EXCL_LINE
+    {
+        if(!desc.empty())                                  // LCOV_EXCL_LINE
+            desc += ": ";                                  // LCOV_EXCL_LINE
+        throw std::runtime_error(desc + u_errorName(err)); // LCOV_EXCL_LINE
+    }
+
+    inline void check_and_throw_icu_error(UErrorCode err, const char* desc = "")
+    {
+        if(U_FAILURE(err))
+            throw_icu_error(err, desc); // LCOV_EXCL_LINE
+    }
+
+    /// Cast a pointer to an ICU object to a pointer to TargetType
+    /// using RTTI or ICUs "poor man's RTTI" to make it work with e.g. libc++ and hidden visibility
+    template<class TargetType, class SourceType>
+    TargetType* icu_cast(SourceType* p)
+    {
+        TargetType* result = dynamic_cast<TargetType*>(p);
+        if(!result && p && p->getDynamicClassID() == TargetType::getStaticClassID())
+            result = static_cast<TargetType*>(p);
+        return result;
+    }
+}}} // namespace boost::locale::impl_icu
+
+#endif

externals/boost/libs/locale/src/boost/locale/icu/numeric.cpp

@@ -0,0 +1,367 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/formatting.hpp>
+#include "boost/locale/icu/all_generator.hpp"
+#include "boost/locale/icu/cdata.hpp"
+#include "boost/locale/icu/formatter.hpp"
+#include "boost/locale/icu/formatters_cache.hpp"
+#include <algorithm>
+#include <ios>
+#include <limits>
+#include <locale>
+#include <string>
+#include <type_traits>
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    namespace detail {
+        template<typename T, bool integer = std::numeric_limits<T>::is_integer>
+        struct icu_format_type;
+
+        template<typename T>
+        struct icu_format_type<T, true> {
+            // ICU supports 32 and 64 bit ints, use the former as long as it fits, else the latter
+            typedef typename std::conditional<std::numeric_limits<T>::digits <= 31, int32_t, int64_t>::type type;
+        };
+        template<typename T>
+        struct icu_format_type<T, false> {
+            // Only float type ICU supports is double
+            typedef double type;
+        };
+
+        // ICU does not support uint64_t values so fall back to the parent/std formatting
+        // if the number is to large to fit into an int64_t
+        template<typename T,
+                 bool BigUInt = !std::numeric_limits<T>::is_signed && std::numeric_limits<T>::is_integer
+                                && (sizeof(T) >= sizeof(uint64_t))>
+        struct use_parent_traits {
+            static bool use(T /*v*/) { return false; }
+        };
+        template<typename T>
+        struct use_parent_traits<T, true> {
+            static bool use(T v) { return v > static_cast<T>(std::numeric_limits<int64_t>::max()); }
+        };
+
+        template<typename ValueType>
+        static bool use_parent(std::ios_base& ios, ValueType v)
+        {
+            const uint64_t flg = ios_info::get(ios).display_flags();
+            if(flg == flags::posix)
+                return true;
+            if(use_parent_traits<ValueType>::use(v))
+                return true;
+
+            if(!std::numeric_limits<ValueType>::is_integer)
+                return false;
+
+            if(flg == flags::number && (ios.flags() & std::ios_base::basefield) != std::ios_base::dec) {
+                return true;
+            }
+            return false;
+        }
+    } // namespace detail
+
+    template<typename CharType>
+    class num_format : public std::num_put<CharType> {
+    public:
+        typedef typename std::num_put<CharType>::iter_type iter_type;
+        typedef std::basic_string<CharType> string_type;
+        typedef CharType char_type;
+        typedef formatter<CharType> formatter_type;
+
+        num_format(const cdata& d, size_t refs = 0) : std::num_put<CharType>(refs), loc_(d.locale), enc_(d.encoding) {}
+
+    protected:
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, long val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, unsigned long val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, double val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, long double val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, long long val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, unsigned long long val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+
+    private:
+        template<typename ValueType>
+        iter_type do_real_put(iter_type out, std::ios_base& ios, char_type fill, ValueType val) const
+        {
+            if(detail::use_parent(ios, val))
+                return std::num_put<char_type>::do_put(out, ios, fill, val);
+
+            const auto formatter = formatter_type::create(ios, loc_, enc_);
+
+            if(!formatter)
+                return std::num_put<char_type>::do_put(out, ios, fill, val);
+
+            size_t code_points;
+            typedef typename detail::icu_format_type<ValueType>::type icu_type;
+            const string_type& str = formatter->format(static_cast<icu_type>(val), code_points);
+            std::streamsize on_left = 0, on_right = 0, points = code_points;
+            if(points < ios.width()) {
+                std::streamsize n = ios.width() - points;
+
+                std::ios_base::fmtflags flags = ios.flags() & std::ios_base::adjustfield;
+
+                // We do not really know internal point, so we assume that it does not
+                // exist. So according to the standard field should be right aligned
+                if(flags != std::ios_base::left)
+                    on_left = n;
+                on_right = n - on_left;
+            }
+            while(on_left > 0) {
+                *out++ = fill;
+                on_left--;
+            }
+            std::copy(str.begin(), str.end(), out);
+            while(on_right > 0) {
+                *out++ = fill;
+                on_right--;
+            }
+            ios.width(0);
+            return out;
+        }
+
+        icu::Locale loc_;
+        std::string enc_;
+
+    }; /// num_format
+
+    template<typename CharType>
+    class num_parse : public std::num_get<CharType> {
+    public:
+        num_parse(const cdata& d, size_t refs = 0) : std::num_get<CharType>(refs), loc_(d.locale), enc_(d.encoding) {}
+
+    protected:
+        typedef typename std::num_get<CharType>::iter_type iter_type;
+        typedef std::basic_string<CharType> string_type;
+        typedef CharType char_type;
+        typedef formatter<CharType> formatter_type;
+        typedef std::basic_istream<CharType> stream_type;
+
+        iter_type
+        do_get(iter_type in, iter_type end, std::ios_base& ios, std::ios_base::iostate& err, long& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         unsigned short& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         unsigned int& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         unsigned long& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type
+        do_get(iter_type in, iter_type end, std::ios_base& ios, std::ios_base::iostate& err, float& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type
+        do_get(iter_type in, iter_type end, std::ios_base& ios, std::ios_base::iostate& err, double& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         long double& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         long long& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         unsigned long long& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+    private:
+        //
+        // This is not really an efficient solution, but it works
+        //
+        template<typename ValueType>
+        iter_type
+        do_real_get(iter_type in, iter_type end, std::ios_base& ios, std::ios_base::iostate& err, ValueType& val) const
+        {
+            stream_type* stream_ptr = dynamic_cast<stream_type*>(&ios);
+            if(!stream_ptr || detail::use_parent(ios, ValueType(0))) {
+                return std::num_get<CharType>::do_get(in, end, ios, err, val);
+            }
+
+            const auto formatter = formatter_type::create(ios, loc_, enc_);
+            if(!formatter) {
+                return std::num_get<CharType>::do_get(in, end, ios, err, val);
+            }
+
+            string_type tmp;
+            tmp.reserve(64);
+
+            CharType c;
+            while(in != end && (((c = *in) <= 32 && (c > 0)) || c == 127)) // Assuming that ASCII is a subset
+                ++in;
+
+            while(tmp.size() < 4096 && in != end && *in != '\n') {
+                tmp += *in++;
+            }
+
+            typedef typename detail::icu_format_type<ValueType>::type icu_type;
+            icu_type value;
+            size_t parsed_chars;
+
+            if((parsed_chars = formatter->parse(tmp, value)) == 0 || !is_losless_castable<ValueType>(value)) {
+                err |= std::ios_base::failbit;
+            } else {
+                val = static_cast<ValueType>(value);
+            }
+
+            for(size_t n = tmp.size(); n > parsed_chars; n--) {
+                stream_ptr->putback(tmp[n - 1]);
+            }
+
+            in = iter_type(*stream_ptr);
+
+            if(in == end)
+                err |= std::ios_base::eofbit;
+            return in;
+        }
+
+        BOOST_LOCALE_START_CONST_CONDITION
+        template<typename TargetType, typename SrcType>
+        bool is_losless_castable(SrcType v) const
+        {
+            typedef std::numeric_limits<TargetType> target_limits;
+            typedef std::numeric_limits<SrcType> casted_limits;
+            if(v < 0 && !target_limits::is_signed)
+                return false;
+
+            constexpr TargetType max_val = target_limits::max();
+
+            if(sizeof(SrcType) > sizeof(TargetType) && v > static_cast<SrcType>(max_val))
+                return false;
+
+            if(target_limits::is_integer == casted_limits::is_integer)
+                return true;
+
+            if(target_limits::is_integer) { // and source is not
+                if(static_cast<SrcType>(static_cast<TargetType>(v)) != v)
+                    return false;
+            }
+            return true;
+        }
+        BOOST_LOCALE_END_CONST_CONDITION
+
+        icu::Locale loc_;
+        std::string enc_;
+    };
+
+    template<typename CharType>
+    std::locale install_formatting_facets(const std::locale& in, const cdata& cd)
+    {
+        std::locale tmp = std::locale(in, new num_format<CharType>(cd));
+        if(!std::has_facet<formatters_cache>(in)) {
+            tmp = std::locale(tmp, new formatters_cache(cd.locale));
+        }
+        return tmp;
+    }
+
+    template<typename CharType>
+    std::locale install_parsing_facets(const std::locale& in, const cdata& cd)
+    {
+        std::locale tmp = std::locale(in, new num_parse<CharType>(cd));
+        if(!std::has_facet<formatters_cache>(in)) {
+            tmp = std::locale(tmp, new formatters_cache(cd.locale));
+        }
+        return tmp;
+    }
+
+    std::locale create_formatting(const std::locale& in, const cdata& cd, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return install_formatting_facets<char>(in, cd);
+            case char_facet_t::wchar_f: return install_formatting_facets<wchar_t>(in, cd);
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return install_formatting_facets<char16_t>(in, cd);
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return install_formatting_facets<char32_t>(in, cd);
+#endif
+        }
+        return in;
+    }
+
+    std::locale create_parsing(const std::locale& in, const cdata& cd, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return install_parsing_facets<char>(in, cd);
+            case char_facet_t::wchar_f: return install_parsing_facets<wchar_t>(in, cd);
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return install_parsing_facets<char16_t>(in, cd);
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return install_parsing_facets<char32_t>(in, cd);
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_icu
+
+// boostinspect:nominmax

externals/boost/libs/locale/src/boost/locale/icu/time_zone.cpp

@@ -0,0 +1,217 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/icu/time_zone.hpp"
+#include <boost/locale/hold_ptr.hpp>
+#include "boost/locale/icu/icu_util.hpp"
+#include <boost/predef/os.h>
+
+//
+// Bug - when ICU tries to find a file that is equivalent to /etc/localtime it finds /usr/share/zoneinfo/localtime
+// that is just a symbolic link to /etc/localtime.
+//
+// It started in 4.0 and was fixed in version 4.6, also the fix was backported to the 4.4 branch so it should be
+// available from 4.4.3... So we test if the workaround is required
+//
+// It is also relevant only for Linux, BSD and Apple (as I see in ICU code)
+//
+
+#if BOOST_LOCALE_ICU_VERSION >= 400 && BOOST_LOCALE_ICU_VERSION <= 406 \
+  && (BOOST_LOCALE_ICU_VERSION != 404 || U_ICU_VERSION_PATCHLEVEL_NUM >= 3)
+#    if BOOST_OS_LINUX || BOOST_OS_BSD_FREE || defined(__APPLE__)
+#        define BOOST_LOCALE_WORKAROUND_ICU_BUG
+#    endif
+#endif
+
+#ifdef BOOST_LOCALE_WORKAROUND_ICU_BUG
+#    include <cstring>
+#    include <dirent.h>
+#    include <fstream>
+#    include <memory>
+#    include <pthread.h>
+#    include <sys/stat.h>
+#    include <sys/types.h>
+#    include <unistd.h>
+#endif
+
+namespace boost { namespace locale { namespace impl_icu {
+
+#ifndef BOOST_LOCALE_WORKAROUND_ICU_BUG
+
+    // This is normal behavior
+
+    icu::TimeZone* get_time_zone(const std::string& time_zone)
+    {
+        if(time_zone.empty()) {
+            return icu::TimeZone::createDefault();
+        } else {
+            icu::TimeZone* icu_tz = icu::TimeZone::createTimeZone(time_zone.c_str());
+            return icu_tz;
+        }
+    }
+
+#else
+
+    // This is a workaround for an ICU timezone detection bug.
+    // It is \b very ICU specific and should not be used
+    // in general. It is also designed to work only on
+    // specific patforms: Linux, BSD and Apple, where this bug may actually
+    // occur
+    namespace {
+
+        // Under BSD, Linux and Mac OS X dirent has normal size
+        // so no issues with readdir_r
+
+        class directory {
+        public:
+            directory(const char* name) : d(0), read_result(0)
+            {
+                d = opendir(name);
+                if(!d)
+                    return;
+            }
+            ~directory()
+            {
+                if(d)
+                    closedir(d);
+            }
+            bool is_open() { return d; }
+            const char* next()
+            {
+                if(d && readdir_r(d, &de, &read_result) == 0 && read_result != 0)
+                    return de.d_name;
+                return 0;
+            }
+
+        private:
+            DIR* d;
+            struct dirent de;
+            struct dirent* read_result;
+        };
+
+        bool files_equal(const std::string& left, const std::string& right)
+        {
+            char l[256], r[256];
+            std::ifstream ls(left.c_str());
+            if(!ls)
+                return false;
+            std::ifstream rs(right.c_str());
+            if(!rs)
+                return false;
+            do {
+                ls.read(l, sizeof(l));
+                rs.read(r, sizeof(r));
+                size_t n;
+                if((n = ls.gcount()) != size_t(rs.gcount()))
+                    return false;
+                if(memcmp(l, r, n) != 0)
+                    return false;
+            } while(!ls.eof() || !rs.eof());
+            if(bool(ls.eof()) != bool(rs.eof()))
+                return false;
+            return true;
+        }
+
+        std::string find_file_in(const std::string& ref, size_t size, const std::string& dir)
+        {
+            directory d(dir.c_str());
+            if(!d.is_open())
+                return std::string();
+
+            const char* name = 0;
+            while((name = d.next()) != 0) {
+                std::string file_name = name;
+                if(file_name == "." || file_name == ".." || file_name == "posixrules" || file_name == "localtime") {
+                    continue;
+                }
+                struct stat st;
+                std::string path = dir + "/" + file_name;
+                if(stat(path.c_str(), &st) == 0) {
+                    if(S_ISDIR(st.st_mode)) {
+                        std::string res = find_file_in(ref, size, path);
+                        if(!res.empty())
+                            return file_name + "/" + res;
+                    } else {
+                        if(size_t(st.st_size) == size && files_equal(path, ref)) {
+                            return file_name;
+                        }
+                    }
+                }
+            }
+            return std::string();
+        }
+
+        // This actually emulates ICU's search
+        // algorithm... just it ignores localtime
+        std::string detect_correct_time_zone()
+        {
+            const char* tz_dir = "/usr/share/zoneinfo";
+            const char* tz_file = "/etc/localtime";
+
+            struct stat st;
+            if(::stat(tz_file, &st) != 0)
+                return std::string();
+            size_t size = st.st_size;
+            std::string r = find_file_in(tz_file, size, tz_dir);
+            if(r.empty())
+                return r;
+            if(r.compare(0, 6, "posix/") == 0 || r.compare(0, 6, "right/", 6) == 0)
+                return r.substr(6);
+            return r;
+        }
+
+        // Using pthread as:
+        // - This bug is relevant for only Linux, BSD, Mac OS X and
+        //  pthreads are native threading API
+        // - The dependency on boost.thread may be removed when using
+        //   more recent ICU versions (so TLS would not be needed)
+        //
+        // This the dependency on Boost.Thread is eliminated
+
+        pthread_once_t init_tz = PTHREAD_ONCE_INIT;
+        std::string default_time_zone_name;
+
+        extern "C" {
+        static void init_tz_proc()
+        {
+            try {
+                default_time_zone_name = detect_correct_time_zone();
+            } catch(...) {
+            }
+        }
+        }
+
+        std::string get_time_zone_name()
+        {
+            pthread_once(&init_tz, init_tz_proc);
+            return default_time_zone_name;
+        }
+
+    } // namespace
+
+    icu::TimeZone* get_time_zone(const std::string& time_zone)
+    {
+        if(!time_zone.empty()) {
+            return icu::TimeZone::createTimeZone(time_zone.c_str());
+        }
+        hold_ptr<icu::TimeZone> tz(icu::TimeZone::createDefault());
+        icu::UnicodeString id;
+        tz->getID(id);
+        // Check if there is a bug?
+        if(id != icu::UnicodeString("localtime"))
+            return tz.release();
+        // Now let's deal with the bug and run the fixed
+        // search loop as that of ICU
+        std::string real_id = get_time_zone_name();
+        if(real_id.empty()) {
+            // if we failed fallback to ICU's time zone
+            return tz.release();
+        }
+        return icu::TimeZone::createTimeZone(real_id.c_str());
+    }
+#endif // bug workaround
+
+}}} // namespace boost::locale::impl_icu

externals/boost/libs/locale/src/boost/locale/icu/time_zone.hpp

@@ -0,0 +1,24 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_ICU_GET_TIME_ZONE_HPP
+#define BOOST_LOCALE_IMPL_ICU_GET_TIME_ZONE_HPP
+
+#include <boost/locale/config.hpp>
+#ifdef BOOST_HAS_STDINT_H
+#    include <stdint.h> // Avoid ICU defining e.g. INT8_MIN causing macro redefinition warnings
+#endif
+#include <string>
+#include <unicode/timezone.h>
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    // Provides a workaround for an ICU default timezone bug and also
+    // handles time_zone string correctly - if empty returns default
+    // otherwise returns the instance created with time_zone
+    icu::TimeZone* get_time_zone(const std::string& time_zone);
+}}} // namespace boost::locale::impl_icu
+#endif

externals/boost/libs/locale/src/boost/locale/icu/uconv.hpp

@@ -0,0 +1,306 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_SRC_LOCALE_ICU_UCONV_HPP
+#define BOOST_SRC_LOCALE_ICU_UCONV_HPP
+
+#include <boost/locale/encoding.hpp>
+#include "boost/locale/icu/icu_util.hpp"
+
+#include <memory>
+#include <string>
+#include <unicode/ucnv.h>
+#include <unicode/unistr.h>
+#include <unicode/ustring.h>
+#include <unicode/utf.h>
+#include <unicode/utf16.h>
+
+#ifdef BOOST_MSVC
+#    pragma warning(push)
+#    pragma warning(disable : 4244) // 'argument' : conversion from 'int'
+#    pragma warning(disable : 4267) // 'argument' : conversion from 'size_t'
+#endif
+
+namespace boost { namespace locale { namespace impl_icu {
+
+    enum class cpcvt_type { skip, stop };
+
+    template<typename CharType, int char_size = sizeof(CharType)>
+    class icu_std_converter {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        icu_std_converter(std::string charset, cpcvt_type cv = cpcvt_type::skip);
+        icu::UnicodeString icu(const char_type* begin, const char_type* end) const;
+        string_type std(const icu::UnicodeString& str) const;
+        size_t cut(const icu::UnicodeString& str,
+                   const char_type* begin,
+                   const char_type* end,
+                   size_t n,
+                   size_t from_u = 0,
+                   size_t from_c = 0) const;
+    };
+
+    template<typename CharType>
+    class icu_std_converter<CharType, 1> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        icu::UnicodeString icu_checked(const char_type* vb, const char_type* ve) const
+        {
+            return icu(vb, ve); // Already done
+        }
+        icu::UnicodeString icu(const char_type* vb, const char_type* ve) const
+        {
+            const char* begin = reinterpret_cast<const char*>(vb);
+            const char* end = reinterpret_cast<const char*>(ve);
+            uconv cvt(charset_, cvt_type_);
+            UErrorCode err = U_ZERO_ERROR;
+            icu::UnicodeString tmp(begin, end - begin, cvt.cvt(), err);
+            check_and_throw_icu_error(err);
+            return tmp;
+        }
+
+        string_type std(const icu::UnicodeString& str) const
+        {
+            uconv cvt(charset_, cvt_type_);
+            return cvt.go(str.getBuffer(), str.length(), max_len_);
+        }
+
+        icu_std_converter(std::string charset, cpcvt_type cvt_type = cpcvt_type::skip) :
+            charset_(charset), cvt_type_(cvt_type)
+        {
+            uconv cvt(charset_, cvt_type);
+            max_len_ = cvt.max_char_size();
+        }
+
+        size_t cut(const icu::UnicodeString& str,
+                   const char_type* begin,
+                   const char_type* end,
+                   size_t n,
+                   size_t from_u = 0,
+                   size_t from_char = 0) const
+        {
+            size_t code_points = str.countChar32(from_u, n);
+            uconv cvt(charset_, cvt_type_);
+            return cvt.cut(code_points, begin + from_char, end);
+        }
+
+        struct uconv {
+            uconv(const uconv& other) = delete;
+            void operator=(const uconv& other) = delete;
+
+            uconv(const std::string& charset, cpcvt_type cvt_type = cpcvt_type::skip)
+            {
+                UErrorCode err = U_ZERO_ERROR;
+                cvt_ = ucnv_open(charset.c_str(), &err);
+                if(!cvt_ || U_FAILURE(err)) {
+                    if(cvt_)
+                        ucnv_close(cvt_);
+                    throw conv::invalid_charset_error(charset);
+                }
+
+                try {
+                    if(cvt_type == cpcvt_type::skip) {
+                        ucnv_setFromUCallBack(cvt_, UCNV_FROM_U_CALLBACK_SKIP, 0, 0, 0, &err);
+                        check_and_throw_icu_error(err);
+
+                        err = U_ZERO_ERROR;
+                        ucnv_setToUCallBack(cvt_, UCNV_TO_U_CALLBACK_SKIP, 0, 0, 0, &err);
+                        check_and_throw_icu_error(err);
+                    } else {
+                        ucnv_setFromUCallBack(cvt_, UCNV_FROM_U_CALLBACK_STOP, 0, 0, 0, &err);
+                        check_and_throw_icu_error(err);
+
+                        err = U_ZERO_ERROR;
+                        ucnv_setToUCallBack(cvt_, UCNV_TO_U_CALLBACK_STOP, 0, 0, 0, &err);
+                        check_and_throw_icu_error(err);
+                    }
+                } catch(...) {
+                    ucnv_close(cvt_);
+                    throw;
+                }
+            }
+
+            int max_char_size() { return ucnv_getMaxCharSize(cvt_); }
+
+            string_type go(const UChar* buf, int length, int max_size)
+            {
+                string_type res;
+                res.resize(UCNV_GET_MAX_BYTES_FOR_STRING(length, max_size));
+                char* ptr = reinterpret_cast<char*>(&res[0]);
+                UErrorCode err = U_ZERO_ERROR;
+                int n = ucnv_fromUChars(cvt_, ptr, res.size(), buf, length, &err);
+                check_and_throw_icu_error(err);
+                res.resize(n);
+                return res;
+            }
+
+            size_t cut(size_t n, const char_type* begin, const char_type* end)
+            {
+                const char_type* saved = begin;
+                while(n > 0 && begin < end) {
+                    UErrorCode err = U_ZERO_ERROR;
+                    ucnv_getNextUChar(cvt_, &begin, end, &err);
+                    if(U_FAILURE(err))
+                        return 0;
+                    n--;
+                }
+                return begin - saved;
+            }
+
+            UConverter* cvt() { return cvt_; }
+
+            ~uconv() { ucnv_close(cvt_); }
+
+        private:
+            UConverter* cvt_;
+        };
+
+    private:
+        int max_len_;
+        std::string charset_;
+        cpcvt_type cvt_type_;
+    };
+
+    template<typename CharType>
+    class icu_std_converter<CharType, 2> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        icu::UnicodeString icu_checked(const char_type* begin, const char_type* end) const
+        {
+            icu::UnicodeString tmp(end - begin, 0, 0); // make inital capacity
+            while(begin != end) {
+                UChar cl = *begin++;
+                if(U16_IS_SINGLE(cl))
+                    tmp.append(static_cast<UChar32>(cl));
+                else if(U16_IS_LEAD(cl)) {
+                    if(begin == end) {
+                        throw_if_needed();
+                    } else {
+                        UChar ct = *begin++;
+                        if(!U16_IS_TRAIL(ct))
+                            throw_if_needed();
+                        else {
+                            UChar32 c = U16_GET_SUPPLEMENTARY(cl, ct);
+                            tmp.append(c);
+                        }
+                    }
+                } else
+                    throw_if_needed();
+            }
+            return tmp;
+        }
+        void throw_if_needed() const
+        {
+            if(mode_ == cpcvt_type::stop)
+                throw conv::conversion_error();
+        }
+        icu::UnicodeString icu(const char_type* vb, const char_type* ve) const
+        {
+            const UChar* begin = reinterpret_cast<const UChar*>(vb);
+            const UChar* end = reinterpret_cast<const UChar*>(ve);
+            icu::UnicodeString tmp(begin, end - begin);
+            return tmp;
+        }
+
+        string_type std(const icu::UnicodeString& str) const
+        {
+            const char_type* ptr = reinterpret_cast<const char_type*>(str.getBuffer());
+            return string_type(ptr, str.length());
+        }
+        size_t cut(const icu::UnicodeString& /*str*/,
+                   const char_type* /*begin*/,
+                   const char_type* /*end*/,
+                   size_t n,
+                   size_t /*from_u*/ = 0,
+                   size_t /*from_c*/ = 0) const
+        {
+            return n;
+        }
+
+        icu_std_converter(std::string /*charset*/, cpcvt_type mode = cpcvt_type::skip) : mode_(mode) {}
+
+    private:
+        cpcvt_type mode_;
+    };
+
+    template<typename CharType>
+    class icu_std_converter<CharType, 4> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        icu::UnicodeString icu_checked(const char_type* begin, const char_type* end) const
+        {
+            icu::UnicodeString tmp(end - begin, 0, 0); // make inital capacity
+            while(begin != end) {
+                UChar32 c = static_cast<UChar32>(*begin++);
+                if(U_IS_UNICODE_CHAR(c))
+                    tmp.append(c);
+                else
+                    throw_if_needed();
+            }
+            return tmp;
+        }
+        void throw_if_needed() const
+        {
+            if(mode_ == cpcvt_type::stop)
+                throw conv::conversion_error();
+        }
+
+        icu::UnicodeString icu(const char_type* begin, const char_type* end) const
+        {
+            icu::UnicodeString tmp(end - begin, 0, 0); // make inital capacity
+            while(begin != end) {
+                UChar32 c = static_cast<UChar32>(*begin++);
+                tmp.append(c);
+            }
+            return tmp;
+        }
+
+        string_type std(const icu::UnicodeString& str) const
+        {
+            string_type tmp;
+            tmp.resize(str.length());
+            UChar32* ptr = reinterpret_cast<UChar32*>(&tmp[0]);
+            int32_t len = 0;
+            UErrorCode code = U_ZERO_ERROR;
+            u_strToUTF32(ptr, tmp.size(), &len, str.getBuffer(), str.length(), &code);
+
+            check_and_throw_icu_error(code);
+
+            tmp.resize(len);
+
+            return tmp;
+        }
+
+        size_t cut(const icu::UnicodeString& str,
+                   const char_type* /*begin*/,
+                   const char_type* /*end*/,
+                   size_t n,
+                   size_t from_u = 0,
+                   size_t /*from_c*/ = 0) const
+        {
+            return str.countChar32(from_u, n);
+        }
+
+        icu_std_converter(std::string /*charset*/, cpcvt_type mode = cpcvt_type::skip) : mode_(mode) {}
+
+    private:
+        cpcvt_type mode_;
+    };
+}}} // namespace boost::locale::impl_icu
+
+#endif
+
+#ifdef BOOST_MSVC
+#pragma warning(pop)
+#endif

externals/boost/libs/locale/src/boost/locale/posix/all_generator.hpp

@@ -0,0 +1,32 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_POSIX_ALL_GENERATOR_HPP
+#define BOOST_LOCALE_IMPL_POSIX_ALL_GENERATOR_HPP
+
+#include <boost/locale/generator.hpp>
+#include <clocale>
+#include <locale>
+#include <memory>
+
+#ifdef __APPLE__
+#    include <xlocale.h>
+#endif
+
+namespace boost { namespace locale { namespace impl_posix {
+
+    std::locale create_convert(const std::locale& in, std::shared_ptr<locale_t> lc, char_facet_t type);
+
+    std::locale create_collate(const std::locale& in, std::shared_ptr<locale_t> lc, char_facet_t type);
+
+    std::locale create_formatting(const std::locale& in, std::shared_ptr<locale_t> lc, char_facet_t type);
+
+    std::locale create_parsing(const std::locale& in, std::shared_ptr<locale_t> lc, char_facet_t type);
+    std::locale create_codecvt(const std::locale& in, const std::string& encoding, char_facet_t type);
+
+}}} // namespace boost::locale::impl_posix
+
+#endif

externals/boost/libs/locale/src/boost/locale/posix/codecvt.cpp

@@ -0,0 +1,28 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2022-2023 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/encoding_errors.hpp>
+#include "boost/locale/posix/all_generator.hpp"
+#include "boost/locale/shared/iconv_codecvt.hpp"
+#include "boost/locale/util/encoding.hpp"
+#include <stdexcept>
+
+namespace boost { namespace locale { namespace impl_posix {
+
+    std::locale create_codecvt(const std::locale& in, const std::string& encoding, char_facet_t type)
+    {
+        if(util::normalize_encoding(encoding) == "utf8")
+            return util::create_utf8_codecvt(in, type);
+
+        try {
+            return util::create_simple_codecvt(in, encoding, type);
+        } catch(const conv::invalid_charset_error&) {
+            return util::create_codecvt(in, create_iconv_converter(encoding), type);
+        }
+    }
+
+}}} // namespace boost::locale::impl_posix

externals/boost/libs/locale/src/boost/locale/posix/collate.cpp

@@ -0,0 +1,98 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/generator.hpp>
+#if defined(__FreeBSD__)
+#    include <xlocale.h>
+#endif
+#include <clocale>
+#include <cstring>
+#include <ios>
+#include <locale>
+#include <stdexcept>
+#include <string>
+#include <vector>
+#include <wchar.h>
+
+#include "boost/locale/posix/all_generator.hpp"
+#include "boost/locale/shared/mo_hash.hpp"
+
+namespace boost { namespace locale { namespace impl_posix {
+
+    template<typename CharType>
+    struct coll_traits;
+
+    template<>
+    struct coll_traits<char> {
+        static size_t xfrm(char* out, const char* in, size_t n, locale_t l) { return strxfrm_l(out, in, n, l); }
+        static size_t coll(const char* left, const char* right, locale_t l) { return strcoll_l(left, right, l); }
+    };
+
+    template<>
+    struct coll_traits<wchar_t> {
+        static size_t xfrm(wchar_t* out, const wchar_t* in, size_t n, locale_t l) { return wcsxfrm_l(out, in, n, l); }
+        static size_t coll(const wchar_t* left, const wchar_t* right, locale_t l) { return wcscoll_l(left, right, l); }
+    };
+
+    template<typename CharType>
+    class collator : public std::collate<CharType> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+        collator(std::shared_ptr<locale_t> l, size_t refs = 0) : std::collate<CharType>(refs), lc_(std::move(l)) {}
+
+        int
+        do_compare(const char_type* lb, const char_type* le, const char_type* rb, const char_type* re) const override
+        {
+            string_type left(lb, le - lb);
+            string_type right(rb, re - rb);
+            int res = coll_traits<char_type>::coll(left.c_str(), right.c_str(), *lc_);
+            if(res < 0)
+                return -1;
+            if(res > 0)
+                return 1;
+            return 0;
+        }
+        long do_hash(const char_type* b, const char_type* e) const override
+        {
+            string_type s(do_transform(b, e));
+            const char* begin = reinterpret_cast<const char*>(s.c_str());
+            const char* end = begin + s.size() * sizeof(char_type);
+            return gnu_gettext::pj_winberger_hash_function(begin, end);
+        }
+        string_type do_transform(const char_type* b, const char_type* e) const override
+        {
+            string_type s(b, e - b);
+            std::vector<char_type> buf((e - b) * 2 + 1);
+            size_t n = coll_traits<char_type>::xfrm(&buf.front(), s.c_str(), buf.size(), *lc_);
+            if(n > buf.size()) {
+                buf.resize(n);
+                coll_traits<char_type>::xfrm(&buf.front(), s.c_str(), n, *lc_);
+            }
+            return string_type(&buf.front(), n);
+        }
+
+    private:
+        std::shared_ptr<locale_t> lc_;
+    };
+
+    std::locale create_collate(const std::locale& in, std::shared_ptr<locale_t> lc, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return std::locale(in, new collator<char>(std::move(lc)));
+            case char_facet_t::wchar_f: return std::locale(in, new collator<wchar_t>(std::move(lc)));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return std::locale(in, new collator<char16_t>(std::move(lc)));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return std::locale(in, new collator<char32_t>(std::move(lc)));
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_posix

externals/boost/libs/locale/src/boost/locale/posix/converter.cpp

@@ -0,0 +1,141 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/conversion.hpp>
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/generator.hpp>
+#include <cctype>
+#include <cstring>
+#include <langinfo.h>
+#include <locale>
+#include <stdexcept>
+#include <wctype.h>
+#if defined(__FreeBSD__)
+#    include <xlocale.h>
+#endif
+
+#include "boost/locale/posix/all_generator.hpp"
+
+namespace boost { namespace locale { namespace impl_posix {
+
+    template<typename CharType>
+    struct case_traits;
+
+    template<>
+    struct case_traits<char> {
+        static char lower(char c, locale_t lc) { return tolower_l(c, lc); }
+        static char upper(char c, locale_t lc) { return toupper_l(c, lc); }
+    };
+
+    template<>
+    struct case_traits<wchar_t> {
+        static wchar_t lower(wchar_t c, locale_t lc) { return towlower_l(c, lc); }
+        static wchar_t upper(wchar_t c, locale_t lc) { return towupper_l(c, lc); }
+    };
+
+    template<typename CharType>
+    class std_converter : public converter<CharType> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+        typedef std::ctype<char_type> ctype_type;
+        std_converter(std::shared_ptr<locale_t> lc, size_t refs = 0) : converter<CharType>(refs), lc_(std::move(lc)) {}
+        string_type convert(converter_base::conversion_type how,
+                            const char_type* begin,
+                            const char_type* end,
+                            int /*flags*/ = 0) const override
+        {
+            switch(how) {
+                case converter_base::upper_case: {
+                    string_type res;
+                    res.reserve(end - begin);
+                    while(begin != end) {
+                        res += case_traits<char_type>::upper(*begin++, *lc_);
+                    }
+                    return res;
+                }
+                case converter_base::lower_case:
+                case converter_base::case_folding: {
+                    string_type res;
+                    res.reserve(end - begin);
+                    while(begin != end) {
+                        res += case_traits<char_type>::lower(*begin++, *lc_);
+                    }
+                    return res;
+                }
+                case converter_base::normalization:
+                case converter_base::title_case: break;
+            }
+            return string_type(begin, end - begin);
+        }
+
+    private:
+        std::shared_ptr<locale_t> lc_;
+    };
+
+    class utf8_converter : public converter<char> {
+    public:
+        utf8_converter(std::shared_ptr<locale_t> lc, size_t refs = 0) : converter<char>(refs), lc_(std::move(lc)) {}
+        std::string convert(converter_base::conversion_type how,
+                            const char* begin,
+                            const char* end,
+                            int /*flags*/ = 0) const override
+        {
+            switch(how) {
+                case upper_case: {
+                    std::wstring tmp = conv::to_utf<wchar_t>(begin, end, "UTF-8");
+                    std::wstring wres;
+                    wres.reserve(tmp.size());
+                    for(unsigned i = 0; i < tmp.size(); i++)
+                        wres += towupper_l(tmp[i], *lc_);
+                    return conv::from_utf<wchar_t>(wres, "UTF-8");
+                }
+
+                case lower_case:
+                case case_folding: {
+                    std::wstring tmp = conv::to_utf<wchar_t>(begin, end, "UTF-8");
+                    std::wstring wres;
+                    wres.reserve(tmp.size());
+                    for(unsigned i = 0; i < tmp.size(); i++)
+                        wres += towlower_l(tmp[i], *lc_);
+                    return conv::from_utf<wchar_t>(wres, "UTF-8");
+                }
+                case normalization:
+                case title_case: break;
+            }
+            return std::string(begin, end - begin);
+        }
+
+    private:
+        std::shared_ptr<locale_t> lc_;
+    };
+
+    std::locale create_convert(const std::locale& in, std::shared_ptr<locale_t> lc, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: {
+                std::string encoding = nl_langinfo_l(CODESET, *lc);
+                for(unsigned i = 0; i < encoding.size(); i++)
+                    if('A' <= encoding[i] && encoding[i] <= 'Z')
+                        encoding[i] = encoding[i] - 'A' + 'a';
+                if(encoding == "utf-8" || encoding == "utf8" || encoding == "utf_8") {
+                    return std::locale(in, new utf8_converter(std::move(lc)));
+                }
+                return std::locale(in, new std_converter<char>(std::move(lc)));
+            }
+            case char_facet_t::wchar_f: return std::locale(in, new std_converter<wchar_t>(std::move(lc)));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return std::locale(in, new std_converter<char16_t>(std::move(lc)));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return std::locale(in, new std_converter<char32_t>(std::move(lc)));
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_posix

externals/boost/libs/locale/src/boost/locale/posix/numeric.cpp

@@ -0,0 +1,441 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#if defined(__FreeBSD__)
+#    include <xlocale.h>
+#endif
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/formatting.hpp>
+#include <boost/locale/generator.hpp>
+#include <boost/predef/os.h>
+#include <cctype>
+#include <cerrno>
+#include <cstdlib>
+#include <cstring>
+#include <ctime>
+#include <ios>
+#include <langinfo.h>
+#include <locale>
+#include <memory>
+#include <monetary.h>
+#include <sstream>
+#include <string>
+#include <vector>
+#include <wctype.h>
+
+#include "boost/locale/posix/all_generator.hpp"
+#include "boost/locale/util/numeric.hpp"
+
+namespace boost { namespace locale { namespace impl_posix {
+
+    template<typename CharType>
+    class num_format : public util::base_num_format<CharType> {
+    public:
+        typedef typename std::num_put<CharType>::iter_type iter_type;
+        typedef std::basic_string<CharType> string_type;
+        typedef CharType char_type;
+
+        num_format(std::shared_ptr<locale_t> lc, size_t refs = 0) :
+            util::base_num_format<CharType>(refs), lc_(std::move(lc))
+        {}
+
+    protected:
+        iter_type do_format_currency(bool intl,
+                                     iter_type out,
+                                     std::ios_base& /*ios*/,
+                                     char_type /*fill*/,
+                                     long double val) const override
+        {
+            char buf[4] = {};
+            const char* format = intl ? "%i" : "%n";
+            errno = 0;
+            ssize_t n = strfmon_l(buf, sizeof(buf), *lc_, format, static_cast<double>(val));
+            if(n >= 0)
+                return write_it(out, buf, n);
+
+            for(std::vector<char> tmp(sizeof(buf) * 2); tmp.size() <= 4098; tmp.resize(tmp.size() * 2)) {
+                n = strfmon_l(&tmp.front(), tmp.size(), *lc_, format, static_cast<double>(val));
+                if(n >= 0)
+                    return write_it(out, &tmp.front(), n);
+            }
+            return out;
+        }
+
+        std::ostreambuf_iterator<char> write_it(std::ostreambuf_iterator<char> out, const char* ptr, size_t n) const
+        {
+            for(size_t i = 0; i < n; i++)
+                *out++ = *ptr++;
+            return out;
+        }
+
+        std::ostreambuf_iterator<wchar_t>
+        write_it(std::ostreambuf_iterator<wchar_t> out, const char* ptr, size_t n) const
+        {
+            std::wstring tmp = conv::to_utf<wchar_t>(ptr, ptr + n, nl_langinfo_l(CODESET, *lc_));
+            for(size_t i = 0; i < tmp.size(); i++)
+                *out++ = tmp[i];
+            return out;
+        }
+
+    private:
+        std::shared_ptr<locale_t> lc_;
+
+    }; /// num_format
+
+    namespace {
+        std::string do_ftime(const char* format, const struct tm* t, locale_t lc)
+        {
+            char buf[16];
+            size_t n = strftime_l(buf, sizeof(buf), format, t, lc);
+            if(n == 0) {
+                // Note standard specifies that in case of error the function returns 0,
+                // however 0 may be actually valid output value of for example empty format
+                // or an output of %p in some locales
+                //
+                // Thus we try to guess that 1024 would be enough.
+                std::vector<char> v(1024);
+                n = strftime_l(v.data(), 1024, format, t, lc);
+                return std::string(v.data(), n);
+            }
+            return std::string(buf, n);
+        }
+        template<typename CharType>
+        std::basic_string<CharType> do_ftime(const CharType* format, const struct tm* t, locale_t lc)
+        {
+            const std::string encoding = nl_langinfo_l(CODESET, lc);
+            const std::string nformat = conv::from_utf(format, encoding);
+            const std::string nres = do_ftime(nformat.c_str(), t, lc);
+            return conv::to_utf<CharType>(nres, encoding);
+        }
+    } // namespace
+
+    template<typename CharType>
+    class time_put_posix : public std::time_put<CharType> {
+    public:
+        time_put_posix(std::shared_ptr<locale_t> lc, size_t refs = 0) :
+            std::time_put<CharType>(refs), lc_(std::move(lc))
+        {}
+        typedef typename std::time_put<CharType>::iter_type iter_type;
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        iter_type do_put(iter_type out,
+                         std::ios_base& /*ios*/,
+                         CharType /*fill*/,
+                         const std::tm* tm,
+                         char format,
+                         char modifier) const override
+        {
+            char_type fmt[4] = {'%',
+                                static_cast<char_type>(modifier != 0 ? modifier : format),
+                                static_cast<char_type>(modifier == 0 ? '\0' : format)};
+            string_type res = do_ftime(fmt, tm, *lc_);
+            for(unsigned i = 0; i < res.size(); i++)
+                *out++ = res[i];
+            return out;
+        }
+
+    private:
+        std::shared_ptr<locale_t> lc_;
+    };
+
+    template<typename CharType>
+    class ctype_posix;
+
+    template<>
+    class ctype_posix<char> : public std::ctype<char> {
+    public:
+        ctype_posix(std::shared_ptr<locale_t> lc) : lc_(std::move(lc)) {}
+
+        bool do_is(mask m, char c) const
+        {
+            if((m & space) && isspace_l(c, *lc_))
+                return true;
+            if((m & print) && isprint_l(c, *lc_))
+                return true;
+            if((m & cntrl) && iscntrl_l(c, *lc_))
+                return true;
+            if((m & upper) && isupper_l(c, *lc_))
+                return true;
+            if((m & lower) && islower_l(c, *lc_))
+                return true;
+            if((m & alpha) && isalpha_l(c, *lc_))
+                return true;
+            if((m & digit) && isdigit_l(c, *lc_))
+                return true;
+            if((m & xdigit) && isxdigit_l(c, *lc_))
+                return true;
+            if((m & punct) && ispunct_l(c, *lc_))
+                return true;
+            return false;
+        }
+        const char* do_is(const char* begin, const char* end, mask* m) const
+        {
+            while(begin != end) {
+                char c = *begin++;
+                int r = 0;
+                if(isspace_l(c, *lc_))
+                    r |= space;
+                if(isprint_l(c, *lc_))
+                    r |= cntrl;
+                if(iscntrl_l(c, *lc_))
+                    r |= space;
+                if(isupper_l(c, *lc_))
+                    r |= upper;
+                if(islower_l(c, *lc_))
+                    r |= lower;
+                if(isalpha_l(c, *lc_))
+                    r |= alpha;
+                if(isdigit_l(c, *lc_))
+                    r |= digit;
+                if(isxdigit_l(c, *lc_))
+                    r |= xdigit;
+                if(ispunct_l(c, *lc_))
+                    r |= punct;
+                // r actually should be mask, but some standard
+                // libraries (like STLPort)
+                // do not define operator | properly so using int+cast
+                *m++ = static_cast<mask>(r);
+            }
+            return begin;
+        }
+        const char* do_scan_is(mask m, const char* begin, const char* end) const
+        {
+            while(begin != end)
+                if(do_is(m, *begin))
+                    return begin;
+            return begin;
+        }
+        const char* do_scan_not(mask m, const char* begin, const char* end) const
+        {
+            while(begin != end)
+                if(!do_is(m, *begin))
+                    return begin;
+            return begin;
+        }
+        char toupper(char c) const { return toupper_l(c, *lc_); }
+        const char* toupper(char* begin, const char* end) const
+        {
+            for(; begin != end; begin++)
+                *begin = toupper_l(*begin, *lc_);
+            return begin;
+        }
+        char tolower(char c) const { return tolower_l(c, *lc_); }
+        const char* tolower(char* begin, const char* end) const
+        {
+            for(; begin != end; begin++)
+                *begin = tolower_l(*begin, *lc_);
+            return begin;
+        }
+
+    private:
+        std::shared_ptr<locale_t> lc_;
+    };
+
+    template<>
+    class ctype_posix<wchar_t> : public std::ctype<wchar_t> {
+    public:
+        ctype_posix(std::shared_ptr<locale_t> lc) : lc_(std::move(lc)) {}
+
+        bool do_is(mask m, wchar_t c) const
+        {
+            if((m & space) && iswspace_l(c, *lc_))
+                return true;
+            if((m & print) && iswprint_l(c, *lc_))
+                return true;
+            if((m & cntrl) && iswcntrl_l(c, *lc_))
+                return true;
+            if((m & upper) && iswupper_l(c, *lc_))
+                return true;
+            if((m & lower) && iswlower_l(c, *lc_))
+                return true;
+            if((m & alpha) && iswalpha_l(c, *lc_))
+                return true;
+            if((m & digit) && iswdigit_l(c, *lc_))
+                return true;
+            if((m & xdigit) && iswxdigit_l(c, *lc_))
+                return true;
+            if((m & punct) && iswpunct_l(c, *lc_))
+                return true;
+            return false;
+        }
+        const wchar_t* do_is(const wchar_t* begin, const wchar_t* end, mask* m) const
+        {
+            while(begin != end) {
+                wchar_t c = *begin++;
+                int r = 0;
+                if(iswspace_l(c, *lc_))
+                    r |= space;
+                if(iswprint_l(c, *lc_))
+                    r |= cntrl;
+                if(iswcntrl_l(c, *lc_))
+                    r |= space;
+                if(iswupper_l(c, *lc_))
+                    r |= upper;
+                if(iswlower_l(c, *lc_))
+                    r |= lower;
+                if(iswalpha_l(c, *lc_))
+                    r |= alpha;
+                if(iswdigit_l(c, *lc_))
+                    r |= digit;
+                if(iswxdigit_l(c, *lc_))
+                    r |= xdigit;
+                if(iswpunct_l(c, *lc_))
+                    r |= punct;
+                // r actually should be mask, but some standard
+                // libraries (like STLPort)
+                // do not define operator | properly so using int+cast
+                *m++ = static_cast<mask>(r);
+            }
+            return begin;
+        }
+        const wchar_t* do_scan_is(mask m, const wchar_t* begin, const wchar_t* end) const
+        {
+            while(begin != end)
+                if(do_is(m, *begin))
+                    return begin;
+            return begin;
+        }
+        const wchar_t* do_scan_not(mask m, const wchar_t* begin, const wchar_t* end) const
+        {
+            while(begin != end)
+                if(!do_is(m, *begin))
+                    return begin;
+            return begin;
+        }
+        wchar_t toupper(wchar_t c) const { return towupper_l(c, *lc_); }
+        const wchar_t* toupper(wchar_t* begin, const wchar_t* end) const
+        {
+            for(; begin != end; begin++)
+                *begin = towupper_l(*begin, *lc_);
+            return begin;
+        }
+        wchar_t tolower(wchar_t c) const { return tolower_l(c, *lc_); }
+        const wchar_t* tolower(wchar_t* begin, const wchar_t* end) const
+        {
+            for(; begin != end; begin++)
+                *begin = tolower_l(*begin, *lc_);
+            return begin;
+        }
+
+    private:
+        std::shared_ptr<locale_t> lc_;
+    };
+
+    struct basic_numpunct {
+        std::string grouping;
+        std::string thousands_sep;
+        std::string decimal_point;
+        basic_numpunct() : decimal_point(".") {}
+        basic_numpunct(locale_t lc)
+        {
+#if defined(__APPLE__) || defined(__FreeBSD__)
+            lconv* cv = localeconv_l(lc);
+            grouping = cv->grouping;
+            thousands_sep = cv->thousands_sep;
+            decimal_point = cv->decimal_point;
+#else
+            thousands_sep = nl_langinfo_l(THOUSEP, lc);
+            decimal_point = nl_langinfo_l(RADIXCHAR, lc);
+#    ifdef GROUPING
+            grouping = nl_langinfo_l(GROUPING, lc);
+#    endif
+#endif
+        }
+    };
+
+    template<typename CharType>
+    class num_punct_posix : public std::numpunct<CharType> {
+    public:
+        typedef std::basic_string<CharType> string_type;
+        num_punct_posix(locale_t lc, size_t refs = 0) : std::numpunct<CharType>(refs)
+        {
+            basic_numpunct np(lc);
+            to_str(np.thousands_sep, thousands_sep_, lc);
+            to_str(np.decimal_point, decimal_point_, lc);
+            grouping_ = np.grouping;
+            if(thousands_sep_.size() > 1)
+                grouping_ = std::string();
+            if(decimal_point_.size() > 1)
+                decimal_point_ = CharType('.');
+        }
+        void to_str(std::string& s1, std::string& s2, locale_t /*lc*/) { s2.swap(s1); }
+        void to_str(std::string& s1, std::wstring& s2, locale_t lc)
+        {
+            s2 = conv::to_utf<wchar_t>(s1, nl_langinfo_l(CODESET, lc));
+        }
+        CharType do_decimal_point() const override { return *decimal_point_.c_str(); }
+        CharType do_thousands_sep() const override { return *thousands_sep_.c_str(); }
+        std::string do_grouping() const override { return grouping_; }
+        string_type do_truename() const override
+        {
+            static const char t[] = "true";
+            return string_type(t, t + sizeof(t) - 1);
+        }
+        string_type do_falsename() const override
+        {
+            static const char t[] = "false";
+            return string_type(t, t + sizeof(t) - 1);
+        }
+
+    private:
+        string_type decimal_point_;
+        string_type thousands_sep_;
+        std::string grouping_;
+    };
+
+    template<typename CharType>
+    std::locale create_formatting_impl(const std::locale& in, std::shared_ptr<locale_t> lc)
+    {
+        std::locale tmp = std::locale(in, new num_punct_posix<CharType>(*lc));
+        tmp = std::locale(tmp, new ctype_posix<CharType>(lc));
+        tmp = std::locale(tmp, new time_put_posix<CharType>(lc));
+        tmp = std::locale(tmp, new num_format<CharType>(std::move(lc)));
+        return tmp;
+    }
+
+    template<typename CharType>
+    std::locale create_parsing_impl(const std::locale& in, std::shared_ptr<locale_t> lc)
+    {
+        std::locale tmp = std::locale(in, new num_punct_posix<CharType>(*lc));
+        tmp = std::locale(tmp, new ctype_posix<CharType>(std::move(lc)));
+        tmp = std::locale(tmp, new util::base_num_parse<CharType>());
+        return tmp;
+    }
+
+    std::locale create_formatting(const std::locale& in, std::shared_ptr<locale_t> lc, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return create_formatting_impl<char>(in, std::move(lc));
+            case char_facet_t::wchar_f: return create_formatting_impl<wchar_t>(in, std::move(lc));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return create_formatting_impl<char16_t>(in, lc);
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return create_formatting_impl<char32_t>(in, lc);
+#endif
+        }
+        return in;
+    }
+
+    std::locale create_parsing(const std::locale& in, std::shared_ptr<locale_t> lc, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return create_parsing_impl<char>(in, std::move(lc));
+            case char_facet_t::wchar_f: return create_parsing_impl<wchar_t>(in, std::move(lc));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return create_parsing_impl<char16_t>(in, lc);
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return create_parsing_impl<char32_t>(in, lc);
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_posix

externals/boost/libs/locale/src/boost/locale/posix/posix_backend.cpp

@@ -0,0 +1,156 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/posix/posix_backend.hpp"
+#include <boost/locale/gnu_gettext.hpp>
+#include <boost/locale/info.hpp>
+#include <boost/locale/localization_backend.hpp>
+#include <boost/locale/util.hpp>
+#include <boost/locale/util/locale_data.hpp>
+#include <algorithm>
+#include <iterator>
+#include <langinfo.h>
+#include <vector>
+#if defined(__FreeBSD__)
+#    include <xlocale.h>
+#endif
+
+#include "boost/locale/posix/all_generator.hpp"
+#include "boost/locale/util/gregorian.hpp"
+
+namespace boost { namespace locale { namespace impl_posix {
+
+    class posix_localization_backend : public localization_backend {
+    public:
+        posix_localization_backend() : invalid_(true) {}
+        posix_localization_backend(const posix_localization_backend& other) :
+            localization_backend(), paths_(other.paths_), domains_(other.domains_), locale_id_(other.locale_id_),
+            invalid_(true)
+        {}
+        posix_localization_backend* clone() const override { return new posix_localization_backend(*this); }
+
+        void set_option(const std::string& name, const std::string& value) override
+        {
+            invalid_ = true;
+            if(name == "locale")
+                locale_id_ = value;
+            else if(name == "message_path")
+                paths_.push_back(value);
+            else if(name == "message_application")
+                domains_.push_back(value);
+        }
+        void clear_options() override
+        {
+            invalid_ = true;
+            locale_id_.clear();
+            paths_.clear();
+            domains_.clear();
+        }
+
+        static void free_locale_by_ptr(locale_t* lc)
+        {
+            freelocale(*lc);
+            delete lc;
+        }
+
+        void prepare_data()
+        {
+            if(!invalid_)
+                return;
+            invalid_ = false;
+            lc_.reset();
+            real_id_ = locale_id_;
+            if(real_id_.empty())
+                real_id_ = util::get_system_locale();
+
+            locale_t tmp = newlocale(LC_ALL_MASK, real_id_.c_str(), 0);
+
+            if(!tmp) {
+                tmp = newlocale(LC_ALL_MASK, "C", 0);
+            }
+            if(!tmp) {
+                throw std::runtime_error("newlocale failed");
+            }
+
+            locale_t* tmp_p = 0;
+
+            try {
+                tmp_p = new locale_t();
+            } catch(...) {
+                freelocale(tmp);
+                throw;
+            }
+
+            *tmp_p = tmp;
+            lc_ = std::shared_ptr<locale_t>(tmp_p, free_locale_by_ptr);
+        }
+
+        std::locale install(const std::locale& base, category_t category, char_facet_t type) override
+        {
+            prepare_data();
+
+            switch(category) {
+                case category_t::convert: return create_convert(base, lc_, type);
+                case category_t::collation: return create_collate(base, lc_, type);
+                case category_t::formatting: return create_formatting(base, lc_, type);
+                case category_t::parsing: return create_parsing(base, lc_, type);
+                case category_t::codepage: return create_codecvt(base, nl_langinfo_l(CODESET, *lc_), type);
+                case category_t::calendar: {
+                    util::locale_data inf;
+                    inf.parse(real_id_);
+                    return util::install_gregorian_calendar(base, inf.country());
+                }
+                case category_t::message: {
+                    gnu_gettext::messages_info minf;
+                    util::locale_data inf;
+                    inf.parse(real_id_);
+                    minf.language = inf.language();
+                    minf.country = inf.country();
+                    minf.variant = inf.variant();
+                    minf.encoding = inf.encoding();
+                    std::copy(domains_.begin(),
+                              domains_.end(),
+                              std::back_inserter<gnu_gettext::messages_info::domains_type>(minf.domains));
+                    minf.paths = paths_;
+                    switch(type) {
+                        case char_facet_t::nochar: break;
+                        case char_facet_t::char_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char>(minf));
+                        case char_facet_t::wchar_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<wchar_t>(minf));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+                        case char_facet_t::char16_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char16_t>(minf));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+                        case char_facet_t::char32_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char32_t>(minf));
+#endif
+                    }
+                    return base;
+                }
+                case category_t::information: return util::create_info(base, real_id_);
+                case category_t::boundary: break; // Not implemented
+            }
+            return base;
+        }
+
+    private:
+        std::vector<std::string> paths_;
+        std::vector<std::string> domains_;
+        std::string locale_id_;
+        std::string real_id_;
+
+        bool invalid_;
+        std::shared_ptr<locale_t> lc_;
+    };
+
+    localization_backend* create_localization_backend()
+    {
+        return new posix_localization_backend();
+    }
+
+}}} // namespace boost::locale::impl_posix

externals/boost/libs/locale/src/boost/locale/posix/posix_backend.hpp

@@ -0,0 +1,15 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_POSIX_LOCALIZATION_BACKEND_HPP
+#define BOOST_LOCALE_IMPL_POSIX_LOCALIZATION_BACKEND_HPP
+namespace boost { namespace locale {
+    class localization_backend;
+    namespace impl_posix {
+        localization_backend* create_localization_backend();
+    } // namespace impl_posix
+}}    // namespace boost::locale
+#endif

externals/boost/libs/locale/src/boost/locale/shared/date_time.cpp

@@ -0,0 +1,424 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/date_time.hpp>
+#include <boost/locale/formatting.hpp>
+#include <boost/thread/locks.hpp>
+#include <boost/thread/mutex.hpp>
+#include <cmath>
+
+namespace boost { namespace locale {
+
+    using namespace period;
+
+    /////////////////////////
+    // Calendar
+    ////////////////////////
+
+    calendar::calendar(const std::locale& l, const std::string& zone) :
+        locale_(l), tz_(zone), impl_(std::use_facet<calendar_facet>(l).create_calendar())
+    {
+        impl_->set_timezone(tz_);
+    }
+
+    calendar::calendar(const std::string& zone) :
+        tz_(zone), impl_(std::use_facet<calendar_facet>(std::locale()).create_calendar())
+    {
+        impl_->set_timezone(tz_);
+    }
+
+    calendar::calendar(const std::locale& l) :
+        locale_(l), tz_(time_zone::global()), impl_(std::use_facet<calendar_facet>(l).create_calendar())
+    {
+        impl_->set_timezone(tz_);
+    }
+
+    calendar::calendar(std::ios_base& ios) :
+        locale_(ios.getloc()), tz_(ios_info::get(ios).time_zone()),
+        impl_(std::use_facet<calendar_facet>(locale_).create_calendar())
+    {
+        impl_->set_timezone(tz_);
+    }
+
+    calendar::calendar() :
+        tz_(time_zone::global()), impl_(std::use_facet<calendar_facet>(std::locale()).create_calendar())
+    {
+        impl_->set_timezone(tz_);
+    }
+
+    calendar::~calendar() = default;
+
+    calendar::calendar(const calendar& other) : locale_(other.locale_), tz_(other.tz_), impl_(other.impl_->clone()) {}
+
+    calendar& calendar::operator=(const calendar& other)
+    {
+        impl_.reset(other.impl_->clone());
+        locale_ = other.locale_;
+        tz_ = other.tz_;
+        return *this;
+    }
+
+    bool calendar::is_gregorian() const
+    {
+        return impl_->get_option(abstract_calendar::is_gregorian) != 0;
+    }
+
+    std::string calendar::get_time_zone() const
+    {
+        return tz_;
+    }
+
+    std::locale calendar::get_locale() const
+    {
+        return locale_;
+    }
+
+    int calendar::minimum(period_type f) const
+    {
+        return impl_->get_value(f.mark(), abstract_calendar::absolute_minimum);
+    }
+
+    int calendar::greatest_minimum(period_type f) const
+    {
+        return impl_->get_value(f.mark(), abstract_calendar::greatest_minimum);
+    }
+
+    int calendar::maximum(period_type f) const
+    {
+        return impl_->get_value(f.mark(), abstract_calendar::absolute_maximum);
+    }
+
+    int calendar::least_maximum(period_type f) const
+    {
+        return impl_->get_value(f.mark(), abstract_calendar::least_maximum);
+    }
+
+    int calendar::first_day_of_week() const
+    {
+        return impl_->get_value(period::marks::first_day_of_week, abstract_calendar::current);
+    }
+
+    bool calendar::operator==(const calendar& other) const
+    {
+        return impl_->same(other.impl_.get());
+    }
+
+    bool calendar::operator!=(const calendar& other) const
+    {
+        return !(*this == other);
+    }
+
+    //////////////////////////////////
+    // date_time
+    /////////////////
+
+    date_time::date_time() : impl_(std::use_facet<calendar_facet>(std::locale()).create_calendar())
+    {
+        impl_->set_timezone(time_zone::global());
+    }
+
+    date_time::date_time(const date_time& other) : impl_(other.impl_->clone()) {}
+
+    date_time::date_time(const date_time& other, const date_time_period_set& s)
+    {
+        impl_.reset(other.impl_->clone());
+        for(unsigned i = 0; i < s.size(); i++) {
+            impl_->set_value(s[i].type.mark(), s[i].value);
+        }
+        impl_->normalize();
+    }
+
+    date_time& date_time::operator=(const date_time& other)
+    {
+        impl_.reset(other.impl_->clone());
+        return *this;
+    }
+
+    date_time::date_time(double t) : impl_(std::use_facet<calendar_facet>(std::locale()).create_calendar())
+    {
+        impl_->set_timezone(time_zone::global());
+        time(t);
+    }
+
+    date_time::date_time(double t, const calendar& cal) : impl_(cal.impl_->clone())
+    {
+        time(t);
+    }
+
+    date_time::date_time(const calendar& cal) : impl_(cal.impl_->clone()) {}
+
+    date_time::date_time(const date_time_period_set& s) :
+        impl_(std::use_facet<calendar_facet>(std::locale()).create_calendar())
+    {
+        impl_->set_timezone(time_zone::global());
+        for(unsigned i = 0; i < s.size(); i++) {
+            impl_->set_value(s[i].type.mark(), s[i].value);
+        }
+        impl_->normalize();
+    }
+    date_time::date_time(const date_time_period_set& s, const calendar& cal) : impl_(cal.impl_->clone())
+    {
+        for(unsigned i = 0; i < s.size(); i++) {
+            impl_->set_value(s[i].type.mark(), s[i].value);
+        }
+        impl_->normalize();
+    }
+
+    date_time& date_time::operator=(const date_time_period_set& s)
+    {
+        for(unsigned i = 0; i < s.size(); i++)
+            impl_->set_value(s[i].type.mark(), s[i].value);
+        impl_->normalize();
+        return *this;
+    }
+
+    void date_time::set(period_type f, int v)
+    {
+        impl_->set_value(f.mark(), v);
+        impl_->normalize();
+    }
+
+    int date_time::get(period_type f) const
+    {
+        return impl_->get_value(f.mark(), abstract_calendar::current);
+    }
+
+    date_time date_time::operator+(const date_time_period& v) const
+    {
+        date_time tmp(*this);
+        tmp += v;
+        return tmp;
+    }
+
+    date_time date_time::operator-(const date_time_period& v) const
+    {
+        date_time tmp(*this);
+        tmp -= v;
+        return tmp;
+    }
+
+    date_time date_time::operator<<(const date_time_period& v) const
+    {
+        date_time tmp(*this);
+        tmp <<= v;
+        return tmp;
+    }
+
+    date_time date_time::operator>>(const date_time_period& v) const
+    {
+        date_time tmp(*this);
+        tmp >>= v;
+        return tmp;
+    }
+
+    date_time& date_time::operator+=(const date_time_period& v)
+    {
+        impl_->adjust_value(v.type.mark(), abstract_calendar::move, v.value);
+        return *this;
+    }
+
+    date_time& date_time::operator-=(const date_time_period& v)
+    {
+        impl_->adjust_value(v.type.mark(), abstract_calendar::move, -v.value);
+        return *this;
+    }
+
+    date_time& date_time::operator<<=(const date_time_period& v)
+    {
+        impl_->adjust_value(v.type.mark(), abstract_calendar::roll, v.value);
+        return *this;
+    }
+
+    date_time& date_time::operator>>=(const date_time_period& v)
+    {
+        impl_->adjust_value(v.type.mark(), abstract_calendar::roll, -v.value);
+        return *this;
+    }
+
+    date_time date_time::operator+(const date_time_period_set& v) const
+    {
+        date_time tmp(*this);
+        tmp += v;
+        return tmp;
+    }
+
+    date_time date_time::operator-(const date_time_period_set& v) const
+    {
+        date_time tmp(*this);
+        tmp -= v;
+        return tmp;
+    }
+
+    date_time date_time::operator<<(const date_time_period_set& v) const
+    {
+        date_time tmp(*this);
+        tmp <<= v;
+        return tmp;
+    }
+
+    date_time date_time::operator>>(const date_time_period_set& v) const
+    {
+        date_time tmp(*this);
+        tmp >>= v;
+        return tmp;
+    }
+
+    date_time& date_time::operator+=(const date_time_period_set& v)
+    {
+        for(unsigned i = 0; i < v.size(); i++) {
+            *this += v[i];
+        }
+        return *this;
+    }
+
+    date_time& date_time::operator-=(const date_time_period_set& v)
+    {
+        for(unsigned i = 0; i < v.size(); i++) {
+            *this -= v[i];
+        }
+        return *this;
+    }
+
+    date_time& date_time::operator<<=(const date_time_period_set& v)
+    {
+        for(unsigned i = 0; i < v.size(); i++) {
+            *this <<= v[i];
+        }
+        return *this;
+    }
+
+    date_time& date_time::operator>>=(const date_time_period_set& v)
+    {
+        for(unsigned i = 0; i < v.size(); i++) {
+            *this >>= v[i];
+        }
+        return *this;
+    }
+
+    double date_time::time() const
+    {
+        return impl_->get_time_ms() / 1000.;
+    }
+
+    void date_time::time(double v)
+    {
+        double seconds;
+        const double fract_seconds = std::modf(v, &seconds); // v = seconds + fract_seconds
+        posix_time ptime;
+        ptime.seconds = static_cast<int64_t>(seconds);
+        int64_t nano = static_cast<int64_t>(fract_seconds * 1e9);
+
+        constexpr int64_t ns_in_s = static_cast<int64_t>(1000) * 1000 * 1000;
+        if(seconds < 0 && nano != 0) {
+            assert(nano < 0); // Same sign
+            seconds -= 1;
+            nano = ns_in_s + nano;
+        }
+        if(nano < 0)
+            nano = 0;
+        else if(nano >= ns_in_s)
+            nano = ns_in_s - 1;
+        ptime.nanoseconds = static_cast<uint32_t>(nano);
+        impl_->set_time(ptime);
+    }
+
+    namespace {
+        int compare(const posix_time& left, const posix_time& right)
+        {
+            if(left.seconds < right.seconds)
+                return -1;
+            if(left.seconds > right.seconds)
+                return 1;
+            if(left.nanoseconds < right.nanoseconds)
+                return -1;
+            if(left.nanoseconds > right.nanoseconds)
+                return 1;
+            return 0;
+        }
+    } // namespace
+
+    bool date_time::operator==(const date_time& other) const
+    {
+        return compare(impl_->get_time(), other.impl_->get_time()) == 0;
+    }
+
+    bool date_time::operator!=(const date_time& other) const
+    {
+        return !(*this == other);
+    }
+
+    bool date_time::operator<(const date_time& other) const
+    {
+        return compare(impl_->get_time(), other.impl_->get_time()) < 0;
+    }
+
+    bool date_time::operator>=(const date_time& other) const
+    {
+        return !(*this < other);
+    }
+
+    bool date_time::operator>(const date_time& other) const
+    {
+        return compare(impl_->get_time(), other.impl_->get_time()) > 0;
+    }
+
+    bool date_time::operator<=(const date_time& other) const
+    {
+        return !(*this > other);
+    }
+
+    void date_time::swap(date_time& other)
+    {
+        impl_.swap(other.impl_);
+    }
+
+    int date_time::difference(const date_time& other, period_type f) const
+    {
+        return impl_->difference(*other.impl_.get(), f.mark());
+    }
+
+    int date_time::maximum(period_type f) const
+    {
+        return impl_->get_value(f.mark(), abstract_calendar::actual_maximum);
+    }
+
+    int date_time::minimum(period_type f) const
+    {
+        return impl_->get_value(f.mark(), abstract_calendar::actual_minimum);
+    }
+
+    bool date_time::is_in_daylight_saving_time() const
+    {
+        return impl_->get_option(abstract_calendar::is_dst) != 0;
+    }
+
+    namespace time_zone {
+        boost::mutex& tz_mutex()
+        {
+            static boost::mutex m;
+            return m;
+        }
+        std::string& tz_id()
+        {
+            static std::string id;
+            return id;
+        }
+        std::string global()
+        {
+            boost::unique_lock<boost::mutex> lock(tz_mutex());
+            std::string id = tz_id();
+            return id;
+        }
+        std::string global(const std::string& new_id)
+        {
+            boost::unique_lock<boost::mutex> lock(tz_mutex());
+            std::string id = tz_id();
+            tz_id() = new_id;
+            return id;
+        }
+    } // namespace time_zone
+
+}} // namespace boost::locale

externals/boost/libs/locale/src/boost/locale/shared/format.cpp

@@ -0,0 +1,166 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/format.hpp>
+#include <boost/locale/generator.hpp>
+#include <boost/locale/info.hpp>
+#include <cstdlib>
+#include <iostream>
+#include <limits>
+
+namespace boost { namespace locale { namespace detail {
+    struct format_parser::data {
+        unsigned position;
+        std::streamsize precision;
+        std::ios_base::fmtflags flags;
+        ios_info info;
+        std::locale saved_locale;
+        bool restore_locale;
+        void* cookie;
+        void (*imbuer)(void*, const std::locale&);
+    };
+
+    format_parser::format_parser(std::ios_base& ios, void* cookie, void (*imbuer)(void*, const std::locale&)) :
+        ios_(ios), d(new data)
+    {
+        d->position = std::numeric_limits<unsigned>::max();
+        d->precision = ios.precision();
+        d->flags = ios.flags();
+        d->info = ios_info::get(ios);
+        d->saved_locale = ios.getloc();
+        d->restore_locale = false;
+        d->cookie = cookie;
+        d->imbuer = imbuer;
+    }
+
+    void format_parser::imbue(const std::locale& l)
+    {
+        d->imbuer(d->cookie, l);
+    }
+
+    format_parser::~format_parser() = default;
+
+    void format_parser::restore()
+    {
+        ios_info::get(ios_) = d->info;
+        ios_.width(0);
+        ios_.flags(d->flags);
+        if(d->restore_locale)
+            imbue(d->saved_locale);
+    }
+
+    unsigned format_parser::get_position()
+    {
+        return d->position;
+    }
+
+    void format_parser::set_one_flag(const std::string& key, const std::string& value)
+    {
+        if(key.empty())
+            return;
+        unsigned i;
+        for(i = 0; i < key.size(); i++) {
+            if(key[i] < '0' || '9' < key[i])
+                break;
+        }
+        if(i == key.size()) {
+            d->position = atoi(key.c_str()) - 1;
+            return;
+        }
+
+        if(key == "num" || key == "number") {
+            as::number(ios_);
+
+            if(value == "hex")
+                ios_.setf(std::ios_base::hex, std::ios_base::basefield);
+            else if(value == "oct")
+                ios_.setf(std::ios_base::oct, std::ios_base::basefield);
+            else if(value == "sci" || value == "scientific")
+                ios_.setf(std::ios_base::scientific, std::ios_base::floatfield);
+            else if(value == "fix" || value == "fixed")
+                ios_.setf(std::ios_base::fixed, std::ios_base::floatfield);
+        } else if(key == "cur" || key == "currency") {
+            as::currency(ios_);
+            if(value == "iso")
+                as::currency_iso(ios_);
+            else if(value == "nat" || value == "national")
+                as::currency_national(ios_);
+        } else if(key == "per" || key == "percent") {
+            as::percent(ios_);
+        } else if(key == "date") {
+            as::date(ios_);
+            if(value == "s" || value == "short")
+                as::date_short(ios_);
+            else if(value == "m" || value == "medium")
+                as::date_medium(ios_);
+            else if(value == "l" || value == "long")
+                as::date_long(ios_);
+            else if(value == "f" || value == "full")
+                as::date_full(ios_);
+        } else if(key == "time") {
+            as::time(ios_);
+            if(value == "s" || value == "short")
+                as::time_short(ios_);
+            else if(value == "m" || value == "medium")
+                as::time_medium(ios_);
+            else if(value == "l" || value == "long")
+                as::time_long(ios_);
+            else if(value == "f" || value == "full")
+                as::time_full(ios_);
+        } else if(key == "dt" || key == "datetime") {
+            as::datetime(ios_);
+            if(value == "s" || value == "short") {
+                as::date_short(ios_);
+                as::time_short(ios_);
+            } else if(value == "m" || value == "medium") {
+                as::date_medium(ios_);
+                as::time_medium(ios_);
+            } else if(value == "l" || value == "long") {
+                as::date_long(ios_);
+                as::time_long(ios_);
+            } else if(value == "f" || value == "full") {
+                as::date_full(ios_);
+                as::time_full(ios_);
+            }
+        } else if(key == "spell" || key == "spellout") {
+            as::spellout(ios_);
+        } else if(key == "ord" || key == "ordinal") {
+            as::ordinal(ios_);
+        } else if(key == "left" || key == "<")
+            ios_.setf(std::ios_base::left, std::ios_base::adjustfield);
+        else if(key == "right" || key == ">")
+            ios_.setf(std::ios_base::right, std::ios_base::adjustfield);
+        else if(key == "gmt")
+            as::gmt(ios_);
+        else if(key == "local")
+            as::local_time(ios_);
+        else if(key == "timezone" || key == "tz")
+            ios_info::get(ios_).time_zone(value);
+        else if(key == "w" || key == "width")
+            ios_.width(atoi(value.c_str()));
+        else if(key == "p" || key == "precision")
+            ios_.precision(atoi(value.c_str()));
+        else if(key == "locale") {
+            if(!d->restore_locale) {
+                d->saved_locale = ios_.getloc();
+                d->restore_locale = true;
+            }
+
+            std::string encoding = std::use_facet<info>(d->saved_locale).encoding();
+            generator gen;
+            gen.categories(category_t::formatting);
+
+            std::locale new_loc;
+            if(value.find('.') == std::string::npos)
+                new_loc = gen(value + "." + encoding);
+            else
+                new_loc = gen(value);
+
+            imbue(new_loc);
+        }
+    }
+}}} // namespace boost::locale::detail
+// boostinspect:nominmax

externals/boost/libs/locale/src/boost/locale/shared/formatting.cpp

@@ -0,0 +1,131 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/date_time.hpp>
+#include <boost/locale/formatting.hpp>
+#include "boost/locale/shared/ios_prop.hpp"
+#include <algorithm>
+#include <typeinfo>
+
+namespace boost { namespace locale {
+
+    ios_info::string_set::string_set() : type(0), size(0), ptr(0) {}
+    ios_info::string_set::~string_set()
+    {
+        delete[] ptr;
+    }
+    ios_info::string_set::string_set(const string_set& other)
+    {
+        if(other.ptr != 0) {
+            ptr = new char[other.size];
+            size = other.size;
+            type = other.type;
+            memcpy(ptr, other.ptr, size);
+        } else {
+            ptr = 0;
+            size = 0;
+            type = 0;
+        }
+    }
+
+    void ios_info::string_set::swap(string_set& other)
+    {
+        std::swap(type, other.type);
+        std::swap(size, other.size);
+        std::swap(ptr, other.ptr);
+    }
+
+    ios_info::string_set& ios_info::string_set::operator=(string_set other)
+    {
+        swap(other);
+        return *this;
+    }
+
+    ios_info::ios_info() : flags_(0), domain_id_(0), time_zone_(time_zone::global()) {}
+
+    ios_info::~ios_info() = default;
+
+    ios_info::ios_info(const ios_info&) = default;
+    ios_info& ios_info::operator=(const ios_info&) = default;
+
+    void ios_info::display_flags(uint64_t f)
+    {
+        flags_ = (flags_ & ~uint64_t(flags::display_flags_mask)) | f;
+    }
+    uint64_t ios_info::display_flags() const
+    {
+        return flags_ & flags::display_flags_mask;
+    }
+
+    void ios_info::currency_flags(uint64_t f)
+    {
+        flags_ = (flags_ & ~uint64_t(flags::currency_flags_mask)) | f;
+    }
+    uint64_t ios_info::currency_flags() const
+    {
+        return flags_ & flags::currency_flags_mask;
+    }
+
+    void ios_info::date_flags(uint64_t f)
+    {
+        flags_ = (flags_ & ~uint64_t(flags::date_flags_mask)) | f;
+    }
+    uint64_t ios_info::date_flags() const
+    {
+        return flags_ & flags::date_flags_mask;
+    }
+
+    void ios_info::time_flags(uint64_t f)
+    {
+        flags_ = (flags_ & ~uint64_t(flags::time_flags_mask)) | f;
+    }
+    uint64_t ios_info::time_flags() const
+    {
+        return flags_ & flags::time_flags_mask;
+    }
+
+    void ios_info::domain_id(int id)
+    {
+        domain_id_ = id;
+    }
+    int ios_info::domain_id() const
+    {
+        return domain_id_;
+    }
+
+    void ios_info::time_zone(const std::string& tz)
+    {
+        time_zone_ = tz;
+    }
+    std::string ios_info::time_zone() const
+    {
+        return time_zone_;
+    }
+
+    const ios_info::string_set& ios_info::date_time_pattern_set() const
+    {
+        return datetime_;
+    }
+
+    ios_info::string_set& ios_info::date_time_pattern_set()
+    {
+        return datetime_;
+    }
+
+    ios_info& ios_info::get(std::ios_base& ios)
+    {
+        return impl::ios_prop<ios_info>::get(ios);
+    }
+
+    void ios_info::on_imbue() {}
+
+    namespace {
+        struct initializer {
+            initializer() { impl::ios_prop<ios_info>::global_init(); }
+        } initializer_instance;
+    } // namespace
+
+}} // namespace boost::locale

externals/boost/libs/locale/src/boost/locale/shared/generator.cpp

@@ -0,0 +1,192 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/generator.hpp>
+#include <boost/locale/localization_backend.hpp>
+#include <boost/thread/locks.hpp>
+#include <boost/thread/mutex.hpp>
+#include <algorithm>
+#include <map>
+#include <vector>
+
+namespace boost { namespace locale {
+    struct generator::data {
+        data(const localization_backend_manager& mgr) :
+            cats(all_categories), chars(all_characters), caching_enabled(false), use_ansi_encoding(false),
+            backend_manager(mgr)
+        {}
+
+        typedef std::map<std::string, std::locale> cached_type;
+        mutable cached_type cached;
+        mutable boost::mutex cached_lock;
+
+        category_t cats;
+        char_facet_t chars;
+
+        bool caching_enabled;
+        bool use_ansi_encoding;
+
+        std::vector<std::string> paths;
+        std::vector<std::string> domains;
+
+        std::map<std::string, std::vector<std::string>> options;
+
+        localization_backend_manager backend_manager;
+    };
+
+    generator::generator(const localization_backend_manager& mgr) : d(new generator::data(mgr)) {}
+    generator::generator() : d(new generator::data(localization_backend_manager::global())) {}
+    generator::~generator() = default;
+
+    category_t generator::categories() const
+    {
+        return d->cats;
+    }
+    void generator::categories(category_t t)
+    {
+        d->cats = t;
+    }
+
+    void generator::characters(char_facet_t t)
+    {
+        d->chars = t;
+    }
+
+    char_facet_t generator::characters() const
+    {
+        return d->chars;
+    }
+
+    void generator::add_messages_domain(const std::string& domain)
+    {
+        if(std::find(d->domains.begin(), d->domains.end(), domain) == d->domains.end())
+            d->domains.push_back(domain);
+    }
+
+    void generator::set_default_messages_domain(const std::string& domain)
+    {
+        std::vector<std::string>::iterator p;
+        if((p = std::find(d->domains.begin(), d->domains.end(), domain)) != d->domains.end()) {
+            d->domains.erase(p);
+        }
+        d->domains.insert(d->domains.begin(), domain);
+    }
+
+    void generator::clear_domains()
+    {
+        d->domains.clear();
+    }
+    void generator::add_messages_path(const std::string& path)
+    {
+        d->paths.push_back(path);
+    }
+    void generator::clear_paths()
+    {
+        d->paths.clear();
+    }
+    void generator::clear_cache()
+    {
+        d->cached.clear();
+    }
+
+    std::locale generator::generate(const std::string& id) const
+    {
+        std::locale base = std::locale::classic();
+
+        return generate(base, id);
+    }
+
+    std::locale generator::generate(const std::locale& base, const std::string& id) const
+    {
+        if(d->caching_enabled) {
+            boost::unique_lock<boost::mutex> guard(d->cached_lock);
+            data::cached_type::const_iterator p = d->cached.find(id);
+            if(p != d->cached.end()) {
+                return p->second;
+            }
+        }
+        hold_ptr<localization_backend> backend(d->backend_manager.create());
+        set_all_options(*backend, id);
+
+        std::locale result = base;
+        category_t facets = d->cats;
+        char_facet_t chars = d->chars;
+
+        for(category_t facet = per_character_facet_first; facet <= per_character_facet_last; ++facet) {
+            if(!(facets & facet))
+                continue;
+            for(char_facet_t ch = character_facet_first; ch <= character_facet_last; ++ch) {
+                if(ch & chars)
+                    result = backend->install(result, facet, ch);
+            }
+        }
+        for(category_t facet = non_character_facet_first; facet <= non_character_facet_last; ++facet) {
+            if(facets & facet)
+                result = backend->install(result, facet, char_facet_t::nochar);
+        }
+        if(d->caching_enabled) {
+            boost::unique_lock<boost::mutex> guard(d->cached_lock);
+            data::cached_type::const_iterator p = d->cached.find(id);
+            if(p == d->cached.end()) {
+                d->cached[id] = result;
+            }
+        }
+        return result;
+    }
+
+    bool generator::use_ansi_encoding() const
+    {
+        return d->use_ansi_encoding;
+    }
+
+    void generator::use_ansi_encoding(bool v)
+    {
+        d->use_ansi_encoding = v;
+    }
+
+    bool generator::locale_cache_enabled() const
+    {
+        return d->caching_enabled;
+    }
+    void generator::locale_cache_enabled(bool enabled)
+    {
+        d->caching_enabled = enabled;
+    }
+
+    void generator::set_all_options(localization_backend& backend, const std::string& id) const
+    {
+        backend.set_option("locale", id);
+        if(d->use_ansi_encoding)
+            backend.set_option("use_ansi_encoding", "true");
+        for(size_t i = 0; i < d->domains.size(); i++)
+            backend.set_option("message_application", d->domains[i]);
+        for(size_t i = 0; i < d->paths.size(); i++)
+            backend.set_option("message_path", d->paths[i]);
+    }
+
+    // Sanity check
+
+    static_assert((char_facet_t::char_f | char_facet_t::wchar_f) & char_facet_t::char_f, "!");
+    static_assert((char_facet_t::char_f | char_facet_t::wchar_f) & char_facet_t::wchar_f, "!");
+    static_assert(!((all_characters ^ char_facet_t::wchar_f) & char_facet_t::wchar_f), "!");
+
+    static_assert((category_t::calendar | category_t::convert) & category_t::calendar, "!");
+    static_assert((category_t::calendar | category_t::convert) & category_t::convert, "!");
+    static_assert(!((all_categories ^ category_t::calendar) & category_t::calendar), "!");
+
+#ifndef BOOST_NO_CXX14_CONSTEXPR
+    template<typename T>
+    constexpr T inc_enum(T v)
+    {
+        return ++v;
+    }
+    static_assert(inc_enum(char_facet_t::nochar) == char_facet_t::char_f, "!");
+    static_assert(inc_enum(char_facet_t::char_f) == char_facet_t::wchar_f, "!");
+    static_assert(inc_enum(category_t::convert) == category_t::collation, "!");
+#endif
+
+}} // namespace boost::locale

externals/boost/libs/locale/src/boost/locale/shared/iconv_codecvt.cpp

@@ -0,0 +1,179 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2022-2023 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "iconv_codecvt.hpp"
+#include <boost/assert.hpp>
+#include <array>
+#include <cerrno>
+#include <limits>
+#include <vector>
+#ifdef BOOST_LOCALE_WITH_ICONV
+#    include "boost/locale/util/iconv.hpp"
+#endif
+
+namespace boost { namespace locale {
+
+#ifdef BOOST_LOCALE_WITH_ICONV
+    static const char* utf32_encoding()
+    {
+        union {
+            char one;
+            uint32_t value;
+        } test;
+        test.value = 1;
+        return (test.one == 1) ? "UTF-32LE" : "UTF-32BE";
+    }
+
+    class mb2_iconv_converter : public util::base_converter {
+    public:
+        mb2_iconv_converter(const std::string& encoding) : encoding_(encoding)
+        {
+            iconv_handle d = iconv_open(utf32_encoding(), encoding.c_str());
+            if(!d)
+                throw std::runtime_error("Unsupported encoding" + encoding);
+
+            for(unsigned c = 0; c < first_byte_table_.size(); c++) {
+                const char ibuf[2] = {char(c), 0};
+                size_t insize = sizeof(ibuf);
+                uint32_t obuf[2] = {illegal, illegal};
+                size_t outsize = sizeof(obuf);
+                // Basic single codepoint conversion
+                call_iconv(d, ibuf, &insize, reinterpret_cast<char*>(obuf), &outsize);
+                if(insize == 0 && outsize == 0 && obuf[1] == 0)
+                    first_byte_table_[c] = obuf[0];
+                else {
+                    // Test if this is illegal first byte or incomplete
+                    insize = 1;
+                    outsize = sizeof(obuf);
+                    call_iconv(d, nullptr, nullptr, nullptr, nullptr);
+                    size_t res = call_iconv(d, ibuf, &insize, reinterpret_cast<char*>(obuf), &outsize);
+
+                    // Now if this single byte starts a sequence we add incomplete
+                    // to know to ask that we need two bytes, otherwise it may only be illegal
+
+                    first_byte_table_[c] = (res == size_t(-1) && errno == EINVAL) ? incomplete : illegal;
+                }
+            }
+        }
+
+        mb2_iconv_converter(const mb2_iconv_converter& other) :
+            first_byte_table_(other.first_byte_table_), encoding_(other.encoding_)
+        {}
+
+        bool is_thread_safe() const override { return false; }
+
+        mb2_iconv_converter* clone() const override { return new mb2_iconv_converter(*this); }
+
+        uint32_t to_unicode(const char*& begin, const char* end) override
+        {
+            if(begin == end)
+                return incomplete;
+
+            const unsigned char seq0 = *begin;
+
+#    if defined(BOOST_GCC_VERSION) && BOOST_GCC_VERSION >= 40600
+#        pragma GCC diagnostic push
+#        pragma GCC diagnostic ignored "-Wtype-limits"
+#    endif
+            static_assert(std::numeric_limits<unsigned char>::max()
+                            < std::tuple_size<decltype(first_byte_table_)>::value,
+                          "Wrong table size");
+#    if defined(BOOST_GCC_VERSION) && BOOST_GCC_VERSION >= 40600
+#        pragma GCC diagnostic pop
+#    endif
+
+            const uint32_t index = first_byte_table_[seq0];
+            if(index == illegal)
+                return illegal;
+            if(index != incomplete) {
+                begin++;
+                return index;
+            } else if(begin + 1 == end)
+                return incomplete;
+
+            open(to_utf_, utf32_encoding(), encoding_.c_str());
+
+            // maybe illegal or may be double byte
+
+            const char inseq[3] = {static_cast<char>(seq0), begin[1], 0};
+            size_t insize = sizeof(inseq);
+            uint32_t result[2] = {illegal, illegal};
+            size_t outsize = sizeof(result);
+            call_iconv(to_utf_, inseq, &insize, reinterpret_cast<char*>(result), &outsize);
+            if(outsize == 0 && insize == 0 && result[1] == 0) {
+                begin += 2;
+                return result[0];
+            }
+            return illegal;
+        }
+
+        uint32_t from_unicode(uint32_t cp, char* begin, const char* end) override
+        {
+            if(cp == 0) {
+                if(begin != end) {
+                    *begin = 0;
+                    return 1;
+                } else {
+                    return incomplete;
+                }
+            }
+
+            open(from_utf_, encoding_.c_str(), utf32_encoding());
+
+            const uint32_t inbuf[2] = {cp, 0};
+            size_t insize = sizeof(inbuf);
+            char outseq[3] = {0};
+            size_t outsize = 3;
+
+            call_iconv(from_utf_, reinterpret_cast<const char*>(inbuf), &insize, outseq, &outsize);
+
+            if(insize != 0 || outsize > 1)
+                return illegal;
+            size_t len = 2 - outsize;
+            size_t reminder = end - begin;
+            if(reminder < len)
+                return incomplete;
+            for(unsigned i = 0; i < len; i++)
+                *begin++ = outseq[i];
+            return static_cast<uint32_t>(len);
+        }
+
+        int max_len() const override
+        {
+            return 2;
+        }
+
+    private:
+        std::array<uint32_t, 256> first_byte_table_;
+        std::string encoding_;
+        iconv_handle to_utf_, from_utf_;
+
+        static void open(iconv_handle& d, const char* to, const char* from)
+        {
+            if(!d)
+                d = iconv_open(to, from);
+            BOOST_ASSERT(d);
+        }
+    };
+
+    std::unique_ptr<util::base_converter> create_iconv_converter(const std::string& encoding)
+    {
+        try {
+            return std::unique_ptr<util::base_converter>(new mb2_iconv_converter(encoding));
+        } catch(const std::exception&) {
+            return nullptr;
+        }
+    }
+
+#else // no iconv
+    std::unique_ptr<util::base_converter> create_iconv_converter(const std::string& /*encoding*/)
+    {
+        return nullptr;
+    }
+#endif
+
+}} // namespace boost::locale

externals/boost/libs/locale/src/boost/locale/shared/iconv_codecvt.hpp

@@ -0,0 +1,20 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_ICONV_CODECVT_HPP
+#define BOOST_LOCALE_ICONV_CODECVT_HPP
+
+#include <boost/locale/util.hpp>
+#include <memory>
+#include <string>
+
+namespace boost { namespace locale {
+    BOOST_LOCALE_DECL
+    std::unique_ptr<util::base_converter> create_iconv_converter(const std::string& encoding);
+
+}} // namespace boost::locale
+
+#endif

externals/boost/libs/locale/src/boost/locale/shared/ids.cpp

@@ -0,0 +1,108 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/boundary.hpp>
+#include <boost/locale/collator.hpp>
+#include <boost/locale/conversion.hpp>
+#include <boost/locale/date_time_facet.hpp>
+#include <boost/locale/info.hpp>
+#include <boost/locale/message.hpp>
+#include <boost/core/ignore_unused.hpp>
+
+namespace boost { namespace locale {
+
+    std::locale::id info::id;
+    // Make sure we have the VTable here (Export/Import issues)
+    info::~info() = default;
+
+    std::locale::id calendar_facet::id;
+    calendar_facet::~calendar_facet() = default;
+
+    abstract_calendar::~abstract_calendar() = default;
+
+    std::locale::id converter<char>::id;
+    converter<char>::~converter() = default;
+    std::locale::id base_message_format<char>::id;
+    base_message_format<char>::~base_message_format() = default;
+
+    std::locale::id converter<wchar_t>::id;
+    converter<wchar_t>::~converter() = default;
+    std::locale::id base_message_format<wchar_t>::id;
+    base_message_format<wchar_t>::~base_message_format() = default;
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+
+    std::locale::id converter<char16_t>::id;
+    converter<char16_t>::~converter() = default;
+    std::locale::id base_message_format<char16_t>::id;
+    base_message_format<char16_t>::~base_message_format() = default;
+
+#endif
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+
+    std::locale::id converter<char32_t>::id;
+    converter<char32_t>::~converter() = default;
+    std::locale::id base_message_format<char32_t>::id;
+    base_message_format<char32_t>::~base_message_format() = default;
+
+#endif
+
+    namespace boundary {
+
+        std::locale::id boundary_indexing<char>::id;
+        boundary_indexing<char>::~boundary_indexing() = default;
+
+        std::locale::id boundary_indexing<wchar_t>::id;
+        boundary_indexing<wchar_t>::~boundary_indexing() = default;
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+        std::locale::id boundary_indexing<char16_t>::id;
+        boundary_indexing<char16_t>::~boundary_indexing() = default;
+#endif
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+        std::locale::id boundary_indexing<char32_t>::id;
+        boundary_indexing<char32_t>::~boundary_indexing() = default;
+#endif
+    } // namespace boundary
+
+    namespace {
+        // Initialize each facet once to avoid issues where doing so
+        // in a multithreaded environment could cause problems (races)
+        struct init_all {
+            init_all()
+            {
+                const std::locale& l = std::locale::classic();
+                init_by<char>(l);
+                init_by<wchar_t>(l);
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+                init_by<char16_t>(l);
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+                init_by<char32_t>(l);
+#endif
+
+                init_facet<info>(l);
+                init_facet<calendar_facet>(l);
+            }
+            template<typename Char>
+            void init_by(const std::locale& l)
+            {
+                init_facet<boundary::boundary_indexing<Char>>(l);
+                init_facet<converter<Char>>(l);
+                init_facet<message_format<Char>>(l);
+            }
+            template<typename Facet>
+            void init_facet(const std::locale& l)
+            {
+                // Use the facet to initialize e.g. their std::locale::id
+                ignore_unused(std::has_facet<Facet>(l));
+            }
+        } facet_initializer;
+    } // namespace
+
+}} // namespace boost::locale

externals/boost/libs/locale/src/boost/locale/shared/ios_prop.hpp

@@ -0,0 +1,65 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2022 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_SRC_LOCALE_IOS_PROP_HPP
+#define BOOST_SRC_LOCALE_IOS_PROP_HPP
+
+#include <boost/locale/config.hpp>
+#include <boost/assert.hpp>
+#include <ios>
+
+namespace boost { namespace locale { namespace impl {
+
+    template<typename Property>
+    class BOOST_SYMBOL_VISIBLE ios_prop {
+    public:
+        static Property& get(std::ios_base& ios)
+        {
+            Property* result = get_impl(ios);
+            return result ? *result : create(ios);
+        }
+
+        static void global_init() { get_id(); }
+
+    private:
+        static Property* get_impl(std::ios_base& ios) { return static_cast<Property*>(ios.pword(get_id())); }
+
+        static Property& create(std::ios_base& ios)
+        {
+            BOOST_ASSERT_MSG(!get_impl(ios), "Called create while the property already exists");
+            const int id = get_id();
+            ios.register_callback(callback, id);
+            Property* value = new Property();
+            ios.pword(id) = value;
+            return *value;
+        }
+
+        static void callback(std::ios_base::event ev, std::ios_base& ios, int id)
+        {
+            Property* prop = get_impl(ios);
+            if(!prop)
+                return;
+            switch(ev) {
+                case std::ios_base::erase_event:
+                    delete prop;
+                    ios.pword(id) = nullptr;
+                    break;
+                case std::ios_base::copyfmt_event: ios.pword(id) = new Property(*prop); break;
+                case std::ios_base::imbue_event: prop->on_imbue(); break;
+                default: break;
+            }
+        }
+        static int get_id()
+        {
+            static int id = std::ios_base::xalloc();
+            return id;
+        }
+    };
+
+}}} // namespace boost::locale::impl
+
+#endif

externals/boost/libs/locale/src/boost/locale/shared/localization_backend.cpp

@@ -0,0 +1,249 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/hold_ptr.hpp>
+#include <boost/locale/localization_backend.hpp>
+#include <boost/thread/locks.hpp>
+#include <boost/thread/mutex.hpp>
+#include <memory>
+#include <vector>
+
+#ifdef BOOST_LOCALE_WITH_ICU
+#    include "boost/locale/icu/icu_backend.hpp"
+#endif
+
+#ifndef BOOST_LOCALE_NO_POSIX_BACKEND
+#    include "boost/locale/posix/posix_backend.hpp"
+#endif
+
+#ifndef BOOST_LOCALE_NO_STD_BACKEND
+#    include "boost/locale/std/std_backend.hpp"
+#endif
+
+#ifndef BOOST_LOCALE_NO_WINAPI_BACKEND
+#    include "boost/locale/win32/win_backend.hpp"
+#endif
+
+namespace boost { namespace locale {
+    localization_backend::~localization_backend() = default;
+
+    class localization_backend_manager::impl {
+    public:
+        impl(const impl& other) : default_backends_(other.default_backends_)
+        {
+            for(all_backends_type::const_iterator p = other.all_backends_.begin(); p != other.all_backends_.end(); ++p)
+            {
+                all_backends_type::value_type v;
+                v.first = p->first;
+                v.second.reset(p->second->clone());
+                all_backends_.push_back(v);
+            }
+        }
+        impl() : default_backends_(32, -1) {}
+
+        impl& operator=(const impl&) = delete;
+
+        localization_backend* create() const
+        {
+            std::vector<std::shared_ptr<localization_backend>> backends;
+            for(unsigned i = 0; i < all_backends_.size(); i++)
+                backends.push_back(all_backends_[i].second);
+            return new actual_backend(backends, default_backends_);
+        }
+        void adopt_backend(const std::string& name, localization_backend* backend_ptr)
+        {
+            std::shared_ptr<localization_backend> sptr(backend_ptr);
+            if(all_backends_.empty()) {
+                all_backends_.push_back(std::make_pair(name, sptr));
+                for(unsigned i = 0; i < default_backends_.size(); i++)
+                    default_backends_[i] = 0;
+            } else {
+                for(unsigned i = 0; i < all_backends_.size(); i++)
+                    if(all_backends_[i].first == name)
+                        return;
+                all_backends_.push_back(std::make_pair(name, sptr));
+            }
+        }
+
+        void select(const std::string& backend_name, category_t category = all_categories)
+        {
+            unsigned id;
+            for(id = 0; id < all_backends_.size(); ++id) {
+                if(all_backends_[id].first == backend_name)
+                    break;
+            }
+            if(id == all_backends_.size())
+                return;
+            category_t flag = category_first;
+            for(unsigned i = 0; i < default_backends_.size(); ++flag, ++i) {
+                if(category & flag) {
+                    default_backends_[i] = id;
+                }
+            }
+        }
+
+        void remove_all_backends()
+        {
+            all_backends_.clear();
+            for(unsigned i = 0; i < default_backends_.size(); i++) {
+                default_backends_[i] = -1;
+            }
+        }
+        std::vector<std::string> get_all_backends() const
+        {
+            std::vector<std::string> res;
+            all_backends_type::const_iterator p;
+            for(p = all_backends_.begin(); p != all_backends_.end(); ++p) {
+                res.push_back(p->first);
+            }
+            return res;
+        }
+
+    private:
+        class actual_backend : public localization_backend {
+        public:
+            actual_backend(const std::vector<std::shared_ptr<localization_backend>>& backends,
+                           const std::vector<int>& index) :
+                index_(index)
+            {
+                backends_.resize(backends.size());
+                for(unsigned i = 0; i < backends.size(); i++) {
+                    backends_[i].reset(backends[i]->clone());
+                }
+            }
+            actual_backend* clone() const override { return new actual_backend(backends_, index_); }
+            void set_option(const std::string& name, const std::string& value) override
+            {
+                for(unsigned i = 0; i < backends_.size(); i++)
+                    backends_[i]->set_option(name, value);
+            }
+            void clear_options() override
+            {
+                for(unsigned i = 0; i < backends_.size(); i++)
+                    backends_[i]->clear_options();
+            }
+            std::locale install(const std::locale& l, category_t category, char_facet_t type) override
+            {
+                unsigned id = 0;
+                for(category_t v = category_first; v != category; ++v, ++id) {
+                    if(v == category_last)
+                        return l;
+                }
+                if(id >= index_.size() || index_[id] == -1)
+                    return l;
+                return backends_[index_[id]]->install(l, category, type);
+            }
+
+        private:
+            std::vector<std::shared_ptr<localization_backend>> backends_;
+            std::vector<int> index_;
+        };
+
+        typedef std::vector<std::pair<std::string, std::shared_ptr<localization_backend>>> all_backends_type;
+        all_backends_type all_backends_;
+        std::vector<int> default_backends_;
+    };
+
+    localization_backend_manager::localization_backend_manager() : pimpl_(new impl()) {}
+
+    localization_backend_manager::~localization_backend_manager() = default;
+
+    localization_backend_manager::localization_backend_manager(const localization_backend_manager& other) :
+        pimpl_(new impl(*other.pimpl_))
+    {}
+
+    localization_backend_manager& localization_backend_manager::operator=(const localization_backend_manager& other)
+    {
+        pimpl_.reset(new impl(*other.pimpl_));
+        return *this;
+    }
+
+    std::unique_ptr<localization_backend> localization_backend_manager::get() const
+    {
+        return std::unique_ptr<localization_backend>(pimpl_->create());
+    }
+    void localization_backend_manager::add_backend(const std::string& name,
+                                                   std::unique_ptr<localization_backend> backend)
+    {
+        pimpl_->adopt_backend(name, backend.release());
+    }
+
+    localization_backend* localization_backend_manager::create() const
+    {
+        return pimpl_->create();
+    }
+    void localization_backend_manager::adopt_backend(const std::string& name, localization_backend* backend)
+    {
+        pimpl_->adopt_backend(name, backend);
+    }
+
+    void localization_backend_manager::remove_all_backends()
+    {
+        pimpl_->remove_all_backends();
+    }
+    std::vector<std::string> localization_backend_manager::get_all_backends() const
+    {
+        return pimpl_->get_all_backends();
+    }
+    void localization_backend_manager::select(const std::string& backend_name, category_t category)
+    {
+        pimpl_->select(backend_name, category);
+    }
+
+    namespace {
+        // prevent initialization order fiasco
+        boost::mutex& localization_backend_manager_mutex()
+        {
+            static boost::mutex the_mutex;
+            return the_mutex;
+        }
+        // prevent initialization order fiasco
+        localization_backend_manager& localization_backend_manager_global()
+        {
+            static localization_backend_manager the_manager;
+            return the_manager;
+        }
+
+        struct init {
+            init()
+            {
+                localization_backend_manager mgr;
+#ifdef BOOST_LOCALE_WITH_ICU
+                mgr.adopt_backend("icu", impl_icu::create_localization_backend());
+#endif
+
+#ifndef BOOST_LOCALE_NO_POSIX_BACKEND
+                mgr.adopt_backend("posix", impl_posix::create_localization_backend());
+#endif
+
+#ifndef BOOST_LOCALE_NO_WINAPI_BACKEND
+                mgr.adopt_backend("winapi", impl_win::create_localization_backend());
+#endif
+
+#ifndef BOOST_LOCALE_NO_STD_BACKEND
+                mgr.adopt_backend("std", impl_std::create_localization_backend());
+#endif
+
+                localization_backend_manager::global(mgr);
+            }
+        } do_init;
+    } // namespace
+
+    localization_backend_manager localization_backend_manager::global()
+    {
+        boost::unique_lock<boost::mutex> lock(localization_backend_manager_mutex());
+        localization_backend_manager mgr = localization_backend_manager_global();
+        return mgr;
+    }
+    localization_backend_manager localization_backend_manager::global(const localization_backend_manager& in)
+    {
+        boost::unique_lock<boost::mutex> lock(localization_backend_manager_mutex());
+        localization_backend_manager mgr = localization_backend_manager_global();
+        localization_backend_manager_global() = in;
+        return mgr;
+    }
+
+}} // namespace boost::locale

externals/boost/libs/locale/src/boost/locale/shared/message.cpp

@@ -0,0 +1,678 @@
+//
+// Copyright (c) 2009-2015 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#define BOOST_DETAIL_NO_CONTAINER_FWD
+
+// Need _wfopen which is an extension on MinGW but not on MinGW-w64
+// So remove the strict-mode define on (only) MinGW before including anything
+#if defined(__MINGW32__) && defined(__STRICT_ANSI__)
+#    include <_mingw.h>
+#    ifndef __MINGW64_VERSION_MAJOR
+#        undef __STRICT_ANSI__
+#    endif
+#endif
+
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/gnu_gettext.hpp>
+#include <boost/locale/hold_ptr.hpp>
+#include <boost/locale/message.hpp>
+#include "boost/locale/shared/mo_hash.hpp"
+#include "boost/locale/shared/mo_lambda.hpp"
+#include "boost/locale/util/encoding.hpp"
+#include <boost/version.hpp>
+#include <algorithm>
+#include <cstdio>
+#include <cstring>
+#include <iostream>
+#include <map>
+#include <memory>
+#include <unordered_map>
+#include <vector>
+
+namespace boost { namespace locale { namespace gnu_gettext {
+
+    class c_file {
+        c_file(const c_file&);
+        void operator=(const c_file&);
+
+    public:
+        FILE* file;
+
+        c_file() : file(0) {}
+        ~c_file() { close(); }
+
+        void close()
+        {
+            if(file) {
+                fclose(file);
+                file = 0;
+            }
+        }
+
+#if defined(BOOST_WINDOWS)
+
+        bool open(const std::string& file_name, const std::string& encoding)
+        {
+            close();
+
+            // Under windows we have to use "_wfopen" to get
+            // access to path's with Unicode in them
+            //
+            // As not all standard C++ libraries support nonstandard std::istream::open(wchar_t const *)
+            // we would use old and good stdio and _wfopen CRTL functions
+
+            std::wstring wfile_name = conv::to_utf<wchar_t>(file_name, encoding);
+            file = _wfopen(wfile_name.c_str(), L"rb");
+
+            return file != 0;
+        }
+
+#else // POSIX systems do not have all this Wide API crap, as native codepages are UTF-8
+
+        // We do not use encoding as we use native file name encoding
+
+        bool open(const std::string& file_name, const std::string& /* encoding */)
+        {
+            close();
+
+            file = fopen(file_name.c_str(), "rb");
+
+            return file != 0;
+        }
+
+#endif
+    };
+
+    class mo_file {
+    public:
+        typedef std::pair<const char*, const char*> pair_type;
+
+        mo_file(std::vector<char>& file) : native_byteorder_(true), size_(0)
+        {
+            load_file(file);
+            init();
+        }
+
+        mo_file(FILE* file) : native_byteorder_(true), size_(0)
+        {
+            load_file(file);
+            init();
+        }
+
+        pair_type find(const char* context_in, const char* key_in) const
+        {
+            pair_type null_pair((const char*)0, (const char*)0);
+            if(hash_size_ == 0)
+                return null_pair;
+            uint32_t hkey = 0;
+            if(context_in == 0)
+                hkey = pj_winberger_hash_function(key_in);
+            else {
+                pj_winberger_hash::state_type st = pj_winberger_hash::initial_state;
+                st = pj_winberger_hash::update_state(st, context_in);
+                st = pj_winberger_hash::update_state(st, '\4'); // EOT
+                st = pj_winberger_hash::update_state(st, key_in);
+                hkey = st;
+            }
+            uint32_t incr = 1 + hkey % (hash_size_ - 2);
+            hkey %= hash_size_;
+            uint32_t orig = hkey;
+
+            do {
+                uint32_t idx = get(hash_offset_ + 4 * hkey);
+                /// Not found
+                if(idx == 0)
+                    return null_pair;
+                /// If equal values return translation
+                if(key_equals(key(idx - 1), context_in, key_in))
+                    return value(idx - 1);
+                /// Rehash
+                hkey = (hkey + incr) % hash_size_;
+            } while(hkey != orig);
+            return null_pair;
+        }
+
+        static bool key_equals(const char* real_key, const char* cntx, const char* key)
+        {
+            if(cntx == 0)
+                return strcmp(real_key, key) == 0;
+            else {
+                size_t real_len = strlen(real_key);
+                size_t cntx_len = strlen(cntx);
+                size_t key_len = strlen(key);
+                if(cntx_len + 1 + key_len != real_len)
+                    return false;
+                return memcmp(real_key, cntx, cntx_len) == 0 && real_key[cntx_len] == '\4'
+                       && memcmp(real_key + cntx_len + 1, key, key_len) == 0;
+            }
+        }
+
+        const char* key(int id) const
+        {
+            uint32_t off = get(keys_offset_ + id * 8 + 4);
+            return data_ + off;
+        }
+
+        pair_type value(int id) const
+        {
+            uint32_t len = get(translations_offset_ + id * 8);
+            uint32_t off = get(translations_offset_ + id * 8 + 4);
+            if(off >= file_size_ || off + len >= file_size_)
+                throw std::runtime_error("Bad mo-file format");
+            return pair_type(&data_[off], &data_[off] + len);
+        }
+
+        bool has_hash() const { return hash_size_ != 0; }
+
+        size_t size() const { return size_; }
+
+        bool empty() { return size_ == 0; }
+
+    private:
+        void init()
+        {
+            // Read all format sizes
+            size_ = get(8);
+            keys_offset_ = get(12);
+            translations_offset_ = get(16);
+            hash_size_ = get(20);
+            hash_offset_ = get(24);
+        }
+
+        void load_file(std::vector<char>& data)
+        {
+            vdata_.swap(data);
+            file_size_ = vdata_.size();
+            data_ = &vdata_[0];
+            if(file_size_ < 4)
+                throw std::runtime_error("invalid 'mo' file format - the file is too short");
+            uint32_t magic = 0;
+            memcpy(&magic, data_, 4);
+            if(magic == 0x950412de)
+                native_byteorder_ = true;
+            else if(magic == 0xde120495)
+                native_byteorder_ = false;
+            else
+                throw std::runtime_error("Invalid file format - invalid magic number");
+        }
+
+        void load_file(FILE* file)
+        {
+            uint32_t magic = 0;
+            // if the size is wrong magic would be wrong
+            // ok to ignore fread result
+            size_t four_bytes = fread(&magic, 4, 1, file);
+            (void)four_bytes; // shut GCC
+
+            if(magic == 0x950412de)
+                native_byteorder_ = true;
+            else if(magic == 0xde120495)
+                native_byteorder_ = false;
+            else
+                throw std::runtime_error("Invalid file format");
+
+            fseek(file, 0, SEEK_END);
+            long len = ftell(file);
+            if(len < 0) {
+                throw std::runtime_error("Wrong file object");
+            }
+            fseek(file, 0, SEEK_SET);
+            vdata_.resize(len + 1, 0); // +1 to make sure the vector is not empty
+            if(fread(&vdata_.front(), 1, len, file) != unsigned(len))
+                throw std::runtime_error("Failed to read file");
+            data_ = &vdata_[0];
+            file_size_ = len;
+        }
+
+        uint32_t get(unsigned offset) const
+        {
+            uint32_t tmp;
+            if(offset > file_size_ - 4) {
+                throw std::runtime_error("Bad mo-file format");
+            }
+            memcpy(&tmp, data_ + offset, 4);
+            convert(tmp);
+            return tmp;
+        }
+
+        void convert(uint32_t& v) const
+        {
+            if(native_byteorder_)
+                return;
+            v = ((v & 0xFF) << 24) | ((v & 0xFF00) << 8) | ((v & 0xFF0000) >> 8) | ((v & 0xFF000000) >> 24);
+        }
+
+        uint32_t keys_offset_;
+        uint32_t translations_offset_;
+        uint32_t hash_size_;
+        uint32_t hash_offset_;
+
+        const char* data_;
+        size_t file_size_;
+        std::vector<char> vdata_;
+        bool native_byteorder_;
+        size_t size_;
+    };
+
+    template<typename CharType>
+    struct mo_file_use_traits {
+        static constexpr bool in_use = false;
+        typedef CharType char_type;
+        typedef std::pair<const char_type*, const char_type*> pair_type;
+        static pair_type use(const mo_file& /*mo*/, const char_type* /*context*/, const char_type* /*key*/)
+        {
+            return pair_type((const char_type*)(0), (const char_type*)(0));
+        }
+    };
+
+    template<>
+    struct mo_file_use_traits<char> {
+        static constexpr bool in_use = true;
+        typedef char char_type;
+        typedef std::pair<const char_type*, const char_type*> pair_type;
+        static pair_type use(const mo_file& mo, const char* context, const char* key) { return mo.find(context, key); }
+    };
+
+    template<typename CharType>
+    class converter {
+    public:
+        converter(std::string /*out_enc*/, std::string in_enc) : in_(in_enc) {}
+
+        std::basic_string<CharType> operator()(const char* begin, const char* end)
+        {
+            return conv::to_utf<CharType>(begin, end, in_, conv::stop);
+        }
+
+    private:
+        std::string in_;
+    };
+
+    template<>
+    class converter<char> {
+    public:
+        converter(std::string out_enc, std::string in_enc) : out_(out_enc), in_(in_enc) {}
+
+        std::string operator()(const char* begin, const char* end)
+        {
+            return conv::between(begin, end, out_, in_, conv::stop);
+        }
+
+    private:
+        std::string out_, in_;
+    };
+
+    template<typename CharType>
+    struct message_key {
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+
+        message_key(const string_type& c = string_type()) : c_context_(0), c_key_(0)
+        {
+            size_t pos = c.find(char_type(4));
+            if(pos == string_type::npos) {
+                key_ = c;
+            } else {
+                context_ = c.substr(0, pos);
+                key_ = c.substr(pos + 1);
+            }
+        }
+        message_key(const char_type* c, const char_type* k) : c_key_(k)
+        {
+            static const char_type empty = 0;
+            if(c != 0)
+                c_context_ = c;
+            else
+                c_context_ = &empty;
+        }
+        bool operator<(const message_key& other) const
+        {
+            int cc = compare(context(), other.context());
+            if(cc != 0)
+                return cc < 0;
+            return compare(key(), other.key()) < 0;
+        }
+        bool operator==(const message_key& other) const
+        {
+            return compare(context(), other.context()) == 0 && compare(key(), other.key()) == 0;
+        }
+        bool operator!=(const message_key& other) const { return !(*this == other); }
+        const char_type* context() const
+        {
+            if(c_context_)
+                return c_context_;
+            return context_.c_str();
+        }
+        const char_type* key() const
+        {
+            if(c_key_)
+                return c_key_;
+            return key_.c_str();
+        }
+
+    private:
+        static int compare(const char_type* l, const char_type* r)
+        {
+            typedef std::char_traits<char_type> traits_type;
+            for(;;) {
+                char_type cl = *l++;
+                char_type cr = *r++;
+                if(cl == 0 && cr == 0)
+                    return 0;
+                if(traits_type::lt(cl, cr))
+                    return -1;
+                if(traits_type::lt(cr, cl))
+                    return 1;
+            }
+        }
+        string_type context_;
+        string_type key_;
+        const char_type* c_context_;
+        const char_type* c_key_;
+    };
+
+    template<typename CharType>
+    struct hash_function {
+        size_t operator()(const message_key<CharType>& msg) const
+        {
+            pj_winberger_hash::state_type state = pj_winberger_hash::initial_state;
+            const CharType* p = msg.context();
+            if(*p != 0) {
+                const CharType* e = util::str_end(p);
+                state = pj_winberger_hash::update_state(state,
+                                                        reinterpret_cast<const char*>(p),
+                                                        reinterpret_cast<const char*>(e));
+                state = pj_winberger_hash::update_state(state, '\4');
+            }
+            p = msg.key();
+            const CharType* e = util::str_end(p);
+            state = pj_winberger_hash::update_state(state,
+                                                    reinterpret_cast<const char*>(p),
+                                                    reinterpret_cast<const char*>(e));
+            return state;
+        }
+    };
+
+    // By default for wide types the conversion is not required
+    template<typename CharType>
+    const CharType* runtime_conversion(const CharType* msg,
+                                       std::basic_string<CharType>& /*buffer*/,
+                                       bool /*do_conversion*/,
+                                       const std::string& /*locale_encoding*/,
+                                       const std::string& /*key_encoding*/)
+    {
+        return msg;
+    }
+
+    // But still need to specialize for char
+    template<>
+    const char* runtime_conversion(const char* msg,
+                                   std::string& buffer,
+                                   bool do_conversion,
+                                   const std::string& locale_encoding,
+                                   const std::string& key_encoding)
+    {
+        if(!do_conversion)
+            return msg;
+        if(detail::is_us_ascii_string(msg))
+            return msg;
+        std::string tmp = conv::between(msg, locale_encoding, key_encoding, conv::skip);
+        buffer.swap(tmp);
+        return buffer.c_str();
+    }
+
+    template<typename CharType>
+    class mo_message : public message_format<CharType> {
+        typedef CharType char_type;
+        typedef std::basic_string<CharType> string_type;
+        typedef message_key<CharType> key_type;
+        typedef std::unordered_map<key_type, string_type, hash_function<CharType>> catalog_type;
+        typedef std::vector<catalog_type> catalogs_set_type;
+        typedef std::map<std::string, int> domains_map_type;
+
+    public:
+        typedef std::pair<const CharType*, const CharType*> pair_type;
+
+        const char_type* get(int domain_id, const char_type* context, const char_type* in_id) const override
+        {
+            return get_string(domain_id, context, in_id).first;
+        }
+
+        const char_type* get(int domain_id, const char_type* context, const char_type* single_id, int n) const override
+        {
+            pair_type ptr = get_string(domain_id, context, single_id);
+            if(!ptr.first)
+                return nullptr;
+            int form = 0;
+            if(plural_forms_.at(domain_id))
+                form = (*plural_forms_[domain_id])(n);
+            else
+                form = n == 1 ? 0 : 1; // Fallback to English plural form
+
+            const CharType* p = ptr.first;
+            for(int i = 0; p < ptr.second && i < form; i++) {
+                p = std::find(p, ptr.second, CharType(0));
+                if(p == ptr.second)
+                    return nullptr;
+                ++p;
+            }
+            if(p >= ptr.second)
+                return nullptr;
+            return p;
+        }
+
+        int domain(const std::string& domain) const override
+        {
+            domains_map_type::const_iterator p = domains_.find(domain);
+            if(p == domains_.end())
+                return -1;
+            return p->second;
+        }
+
+        mo_message(const messages_info& inf) : key_conversion_required_(false)
+        {
+            std::string language = inf.language;
+            std::string variant = inf.variant;
+            std::string country = inf.country;
+            std::string encoding = inf.encoding;
+            std::string lc_cat = inf.locale_category;
+            const std::vector<messages_info::domain>& domains = inf.domains;
+            const std::vector<std::string>& search_paths = inf.paths;
+
+            // List of fallbacks: en_US@euro, en@euro, en_US, en.
+            std::vector<std::string> paths;
+
+            if(!variant.empty() && !country.empty())
+                paths.push_back(language + "_" + country + "@" + variant);
+
+            if(!variant.empty())
+                paths.push_back(language + "@" + variant);
+
+            if(!country.empty())
+                paths.push_back(language + "_" + country);
+
+            paths.push_back(language);
+
+            catalogs_.resize(domains.size());
+            mo_catalogs_.resize(domains.size());
+            plural_forms_.resize(domains.size());
+
+            for(unsigned i = 0; i < domains.size(); i++) {
+                std::string domain = domains[i].name;
+                std::string key_encoding = domains[i].encoding;
+                domains_[domain] = i;
+
+                bool found = false;
+                for(unsigned j = 0; !found && j < paths.size(); j++) {
+                    for(unsigned k = 0; !found && k < search_paths.size(); k++) {
+                        std::string full_path = search_paths[k] + "/" + paths[j] + "/" + lc_cat + "/" + domain + ".mo";
+                        found = load_file(full_path, encoding, key_encoding, i, inf.callback);
+                    }
+                }
+            }
+        }
+
+        const char_type* convert(const char_type* msg, string_type& buffer) const override
+        {
+            return runtime_conversion<char_type>(msg,
+                                                 buffer,
+                                                 key_conversion_required_,
+                                                 locale_encoding_,
+                                                 key_encoding_);
+        }
+
+    private:
+        bool load_file(const std::string& file_name,
+                       const std::string& locale_encoding,
+                       const std::string& key_encoding,
+                       int idx,
+                       const messages_info::callback_type& callback)
+        {
+            locale_encoding_ = locale_encoding;
+            key_encoding_ = key_encoding;
+
+            key_conversion_required_ =
+              sizeof(CharType) == 1 && !util::are_encodings_equal(locale_encoding, key_encoding);
+
+            std::shared_ptr<mo_file> mo;
+
+            if(callback) {
+                std::vector<char> vfile = callback(file_name, locale_encoding);
+                if(vfile.empty())
+                    return false;
+                mo.reset(new mo_file(vfile));
+            } else {
+                c_file the_file;
+                the_file.open(file_name, locale_encoding);
+                if(!the_file.file)
+                    return false;
+                mo.reset(new mo_file(the_file.file));
+            }
+
+            std::string plural = extract(mo->value(0).first, "plural=", "\r\n;");
+
+            std::string mo_encoding = extract(mo->value(0).first, "charset=", " \r\n;");
+
+            if(mo_encoding.empty())
+                throw std::runtime_error("Invalid mo-format, encoding is not specified");
+
+            if(!plural.empty())
+                plural_forms_[idx] = lambda::compile(plural.c_str());
+
+            if(mo_useable_directly(mo_encoding, *mo))
+                mo_catalogs_[idx] = mo;
+            else {
+                converter<CharType> cvt_value(locale_encoding, mo_encoding);
+                converter<CharType> cvt_key(key_encoding, mo_encoding);
+                for(unsigned i = 0; i < mo->size(); i++) {
+                    const char* ckey = mo->key(i);
+                    string_type skey = cvt_key(ckey, ckey + strlen(ckey));
+                    key_type key(skey);
+
+                    mo_file::pair_type tmp = mo->value(i);
+                    string_type value = cvt_value(tmp.first, tmp.second);
+                    catalogs_[idx][key].swap(value);
+                }
+            }
+            return true;
+        }
+
+        // Check if the mo file as-is is useful
+        // 1. It is char and not wide character
+        // 2. The locale encoding and mo encoding is same
+        // 3. The source strings encoding and mo encoding is same or all
+        //    mo key strings are US-ASCII
+        bool mo_useable_directly(const std::string& mo_encoding, const mo_file& mo)
+        {
+            BOOST_LOCALE_START_CONST_CONDITION
+            if(sizeof(CharType) != 1)
+                return false;
+            BOOST_LOCALE_END_CONST_CONDITION
+            if(!mo.has_hash())
+                return false;
+            if(!util::are_encodings_equal(mo_encoding, locale_encoding_))
+                return false;
+            if(util::are_encodings_equal(mo_encoding, key_encoding_)) {
+                return true;
+            }
+            for(unsigned i = 0; i < mo.size(); i++) {
+                if(!detail::is_us_ascii_string(mo.key(i))) {
+                    return false;
+                }
+            }
+            return true;
+        }
+
+        static std::string extract(const std::string& meta, const std::string& key, const char* separator)
+        {
+            size_t pos = meta.find(key);
+            if(pos == std::string::npos)
+                return "";
+            pos += key.size(); /// size of charset=
+            size_t end_pos = meta.find_first_of(separator, pos);
+            return meta.substr(pos, end_pos - pos);
+        }
+
+        pair_type get_string(int domain_id, const char_type* context, const char_type* in_id) const
+        {
+            pair_type null_pair((const CharType*)0, (const CharType*)0);
+            if(domain_id < 0 || size_t(domain_id) >= catalogs_.size())
+                return null_pair;
+            BOOST_LOCALE_START_CONST_CONDITION
+            if(mo_file_use_traits<char_type>::in_use && mo_catalogs_[domain_id]) {
+                BOOST_LOCALE_END_CONST_CONDITION
+                return mo_file_use_traits<char_type>::use(*mo_catalogs_[domain_id], context, in_id);
+            } else {
+                key_type key(context, in_id);
+                const catalog_type& cat = catalogs_[domain_id];
+                typename catalog_type::const_iterator p = cat.find(key);
+                if(p == cat.end()) {
+                    return null_pair;
+                }
+                return pair_type(p->second.data(), p->second.data() + p->second.size());
+            }
+        }
+
+        catalogs_set_type catalogs_;
+        std::vector<std::shared_ptr<mo_file>> mo_catalogs_;
+        std::vector<std::shared_ptr<lambda::plural>> plural_forms_;
+        domains_map_type domains_;
+
+        std::string locale_encoding_;
+        std::string key_encoding_;
+        bool key_conversion_required_;
+    };
+
+    template<>
+    message_format<char>* create_messages_facet(const messages_info& info)
+    {
+        return new mo_message<char>(info);
+    }
+
+    template<>
+    message_format<wchar_t>* create_messages_facet(const messages_info& info)
+    {
+        return new mo_message<wchar_t>(info);
+    }
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+
+    template<>
+    message_format<char16_t>* create_messages_facet(const messages_info& info)
+    {
+        return new mo_message<char16_t>(info);
+    }
+#endif
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+
+    template<>
+    message_format<char32_t>* create_messages_facet(const messages_info& info)
+    {
+        return new mo_message<char32_t>(info);
+    }
+#endif
+
+}}} // namespace boost::locale::gnu_gettext

externals/boost/libs/locale/src/boost/locale/shared/mo_hash.hpp

@@ -0,0 +1,51 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/cstdint.hpp>
+
+namespace boost { namespace locale { namespace gnu_gettext {
+
+    struct pj_winberger_hash {
+        typedef uint32_t state_type;
+
+        static constexpr state_type initial_state = 0;
+
+        static state_type update_state(state_type value, char c)
+        {
+            value = (value << 4) + static_cast<unsigned char>(c);
+            uint32_t high = (value & 0xF0000000U);
+            if(high != 0)
+                value = (value ^ (high >> 24)) ^ high;
+            return value;
+        }
+        static state_type update_state(state_type value, const char* ptr)
+        {
+            while(*ptr)
+                value = update_state(value, *ptr++);
+            return value;
+        }
+        static state_type update_state(state_type value, const char* begin, const char* end)
+        {
+            while(begin != end)
+                value = update_state(value, *begin++);
+            return value;
+        }
+    };
+
+    inline pj_winberger_hash::state_type pj_winberger_hash_function(const char* ptr)
+    {
+        pj_winberger_hash::state_type state = pj_winberger_hash::initial_state;
+        state = pj_winberger_hash::update_state(state, ptr);
+        return state;
+    }
+
+    inline pj_winberger_hash::state_type pj_winberger_hash_function(const char* begin, const char* end)
+    {
+        pj_winberger_hash::state_type state = pj_winberger_hash::initial_state;
+        state = pj_winberger_hash::update_state(state, begin, end);
+        return state;
+    }
+}}} // namespace boost::locale::gnu_gettext

externals/boost/libs/locale/src/boost/locale/shared/mo_lambda.cpp

@@ -0,0 +1,373 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/shared/mo_lambda.hpp"
+#include <cstdlib>
+#include <cstring>
+
+#ifdef BOOST_MSVC
+#    pragma warning(disable : 4512) // assignment operator could not be generated
+#endif
+
+namespace boost { namespace locale { namespace gnu_gettext { namespace lambda {
+
+    namespace { // anon
+        struct identity : public plural {
+            int operator()(int n) const override { return n; };
+            identity* clone() const override { return new identity(); }
+        };
+
+        struct unary : public plural {
+            unary(plural_ptr ptr) : op1(ptr) {}
+
+        protected:
+            plural_ptr op1;
+        };
+
+        struct binary : public plural {
+            binary(plural_ptr p1, plural_ptr p2) : op1(p1), op2(p2) {}
+
+        protected:
+            plural_ptr op1, op2;
+        };
+
+        struct number : public plural {
+            number(int v) : val(v) {}
+            int operator()(int /*n*/) const override { return val; }
+            number* clone() const override { return new number(val); }
+
+        private:
+            int val;
+        };
+
+#define UNOP(name, oper)                                               \
+    struct name : public unary {                                       \
+        name(plural_ptr op) : unary(op) {}                             \
+        int operator()(int n) const override { return oper(*op1)(n); } \
+        name* clone() const override                                   \
+        {                                                              \
+            plural_ptr op1_copy(op1->clone());                         \
+            return new name(op1_copy);                                 \
+        }                                                              \
+    };
+
+#define BINOP(name, oper)                                                       \
+    struct name : public binary {                                               \
+        name(plural_ptr p1, plural_ptr p2) : binary(p1, p2) {}                  \
+                                                                                \
+        int operator()(int n) const override { return (*op1)(n)oper(*op2)(n); } \
+        name* clone() const override                                            \
+        {                                                                       \
+            plural_ptr op1_copy(op1->clone());                                  \
+            plural_ptr op2_copy(op2->clone());                                  \
+            return new name(op1_copy, op2_copy);                                \
+        }                                                                       \
+    };
+
+#define BINOPD(name, oper)                                     \
+    struct name : public binary {                              \
+        name(plural_ptr p1, plural_ptr p2) : binary(p1, p2) {} \
+        int operator()(int n) const override                   \
+        {                                                      \
+            int v1 = (*op1)(n);                                \
+            int v2 = (*op2)(n);                                \
+            return v2 == 0 ? 0 : v1 oper v2;                   \
+        }                                                      \
+        name* clone() const override                           \
+        {                                                      \
+            plural_ptr op1_copy(op1->clone());                 \
+            plural_ptr op2_copy(op2->clone());                 \
+            return new name(op1_copy, op2_copy);               \
+        }                                                      \
+    };
+
+        enum { END = 0, SHL = 256, SHR, GTE, LTE, EQ, NEQ, AND, OR, NUM, VARIABLE };
+
+        UNOP(l_not, !)
+        UNOP(minus, -)
+        UNOP(bin_not, ~)
+
+        BINOP(mul, *)
+        BINOPD(div, /)
+        BINOPD(mod, %)
+        static int level10[] = {3, '*', '/', '%'};
+
+        BINOP(add, +)
+        BINOP(sub, -)
+        static int level9[] = {2, '+', '-'};
+
+        BINOP(shl, <<)
+        BINOP(shr, >>)
+        static int level8[] = {2, SHL, SHR};
+
+        BINOP(gt, >)
+        BINOP(lt, <)
+        BINOP(gte, >=)
+        BINOP(lte, <=)
+        static int level7[] = {4, '<', '>', GTE, LTE};
+
+        BINOP(eq, ==)
+        BINOP(neq, !=)
+        static int level6[] = {2, EQ, NEQ};
+
+        BINOP(bin_and, &)
+        static int level5[] = {1, '&'};
+
+        BINOP(bin_xor, ^)
+        static int level4[] = {1, '^'};
+
+        BINOP(bin_or, |)
+        static int level3[] = {1, '|'};
+
+        BINOP(l_and, &&)
+        static int level2[] = {1, AND};
+
+        BINOP(l_or, ||)
+        static int level1[] = {1, OR};
+
+        struct conditional : public plural {
+            conditional(plural_ptr p1, plural_ptr p2, plural_ptr p3) : op1(p1), op2(p2), op3(p3) {}
+            int operator()(int n) const override { return (*op1)(n) ? (*op2)(n) : (*op3)(n); }
+            conditional* clone() const override
+            {
+                plural_ptr op1_copy(op1->clone());
+                plural_ptr op2_copy(op2->clone());
+                plural_ptr op3_copy(op3->clone());
+                return new conditional(op1_copy, op2_copy, op3_copy);
+            }
+
+        private:
+            plural_ptr op1, op2, op3;
+        };
+
+        plural_ptr bin_factory(int value, plural_ptr left, plural_ptr right)
+        {
+            switch(value) {
+                case '/': return plural_ptr(new div(left, right));
+                case '*': return plural_ptr(new mul(left, right));
+                case '%': return plural_ptr(new mod(left, right));
+                case '+': return plural_ptr(new add(left, right));
+                case '-': return plural_ptr(new sub(left, right));
+                case SHL: return plural_ptr(new shl(left, right));
+                case SHR: return plural_ptr(new shr(left, right));
+                case '>': return plural_ptr(new gt(left, right));
+                case '<': return plural_ptr(new lt(left, right));
+                case GTE: return plural_ptr(new gte(left, right));
+                case LTE: return plural_ptr(new lte(left, right));
+                case EQ: return plural_ptr(new eq(left, right));
+                case NEQ: return plural_ptr(new neq(left, right));
+                case '&': return plural_ptr(new bin_and(left, right));
+                case '^': return plural_ptr(new bin_xor(left, right));
+                case '|': return plural_ptr(new bin_or(left, right));
+                case AND: return plural_ptr(new l_and(left, right));
+                case OR: return plural_ptr(new l_or(left, right));
+                default: return plural_ptr();
+            }
+        }
+
+        static inline bool is_in(int v, int* p)
+        {
+            int len = *p;
+            p++;
+            while(len && *p != v) {
+                p++;
+                len--;
+            }
+            return len != 0;
+        }
+
+        class tokenizer {
+        public:
+            tokenizer(const char* s)
+            {
+                text = s;
+                pos = 0;
+                step();
+            };
+            int get(int* val = NULL)
+            {
+                int iv = int_value;
+                int res = next_tocken;
+                step();
+                if(val && res == NUM) {
+                    *val = iv;
+                }
+                return res;
+            };
+            int next(int* val = NULL)
+            {
+                if(val && next_tocken == NUM) {
+                    *val = int_value;
+                    return NUM;
+                }
+                return next_tocken;
+            }
+
+        private:
+            const char* text;
+            size_t pos;
+            int next_tocken;
+            int int_value;
+            bool is_blank(char c) { return c == ' ' || c == '\r' || c == '\n' || c == '\t'; }
+            bool isdigit(char c) { return '0' <= c && c <= '9'; }
+            void step()
+            {
+                while(text[pos] && is_blank(text[pos]))
+                    pos++;
+                const char* ptr = text + pos;
+                char* tmp_ptr;
+                if(strncmp(ptr, "<<", 2) == 0) {
+                    pos += 2;
+                    next_tocken = SHL;
+                } else if(strncmp(ptr, ">>", 2) == 0) {
+                    pos += 2;
+                    next_tocken = SHR;
+                } else if(strncmp(ptr, "&&", 2) == 0) {
+                    pos += 2;
+                    next_tocken = AND;
+                } else if(strncmp(ptr, "||", 2) == 0) {
+                    pos += 2;
+                    next_tocken = OR;
+                } else if(strncmp(ptr, "<=", 2) == 0) {
+                    pos += 2;
+                    next_tocken = LTE;
+                } else if(strncmp(ptr, ">=", 2) == 0) {
+                    pos += 2;
+                    next_tocken = GTE;
+                } else if(strncmp(ptr, "==", 2) == 0) {
+                    pos += 2;
+                    next_tocken = EQ;
+                } else if(strncmp(ptr, "!=", 2) == 0) {
+                    pos += 2;
+                    next_tocken = NEQ;
+                } else if(*ptr == 'n') {
+                    pos++;
+                    next_tocken = VARIABLE;
+                } else if(isdigit(*ptr)) {
+                    int_value = strtol(text + pos, &tmp_ptr, 0);
+                    pos = tmp_ptr - text;
+                    next_tocken = NUM;
+                } else if(*ptr == '\0') {
+                    next_tocken = 0;
+                } else {
+                    next_tocken = *ptr;
+                    pos++;
+                }
+            }
+        };
+
+#define BINARY_EXPR(expr, hexpr, list)      \
+    plural_ptr expr()                       \
+    {                                       \
+        plural_ptr op1, op2;                \
+        if((op1 = hexpr()).get() == 0)      \
+            return plural_ptr();            \
+        while(is_in(t.next(), list)) {      \
+            int o = t.get();                \
+            if((op2 = hexpr()).get() == 0)  \
+                return plural_ptr();        \
+            op1 = bin_factory(o, op1, op2); \
+        }                                   \
+        return op1;                         \
+    }
+
+        class parser {
+        public:
+            parser(tokenizer& tin) : t(tin){};
+
+            plural_ptr compile()
+            {
+                plural_ptr res = cond_expr();
+                if(res.get() && t.next() != END) {
+                    return plural_ptr();
+                };
+                return res;
+            }
+
+        private:
+            plural_ptr value_expr()
+            {
+                plural_ptr op;
+                if(t.next() == '(') {
+                    t.get();
+                    if((op = cond_expr()).get() == 0)
+                        return plural_ptr();
+                    if(t.get() != ')')
+                        return plural_ptr();
+                    return op;
+                } else if(t.next() == NUM) {
+                    int value;
+                    t.get(&value);
+                    return plural_ptr(new number(value));
+                } else if(t.next() == VARIABLE) {
+                    t.get();
+                    return plural_ptr(new identity());
+                }
+                return plural_ptr();
+            };
+
+            plural_ptr un_expr()
+            {
+                plural_ptr op1;
+                static int level_unary[] = {3, '-', '!', '~'};
+                if(is_in(t.next(), level_unary)) {
+                    int op = t.get();
+                    if((op1 = un_expr()).get() == 0)
+                        return plural_ptr();
+                    switch(op) {
+                        case '-': return plural_ptr(new minus(op1));
+                        case '!': return plural_ptr(new l_not(op1));
+                        case '~': return plural_ptr(new bin_not(op1));
+                        default: return plural_ptr();
+                    }
+                } else {
+                    return value_expr();
+                }
+            };
+
+            BINARY_EXPR(l10, un_expr, level10);
+            BINARY_EXPR(l9, l10, level9);
+            BINARY_EXPR(l8, l9, level8);
+            BINARY_EXPR(l7, l8, level7);
+            BINARY_EXPR(l6, l7, level6);
+            BINARY_EXPR(l5, l6, level5);
+            BINARY_EXPR(l4, l5, level4);
+            BINARY_EXPR(l3, l4, level3);
+            BINARY_EXPR(l2, l3, level2);
+            BINARY_EXPR(l1, l2, level1);
+
+            plural_ptr cond_expr()
+            {
+                plural_ptr cond, case1, case2;
+                if((cond = l1()).get() == 0)
+                    return plural_ptr();
+                if(t.next() == '?') {
+                    t.get();
+                    if((case1 = cond_expr()).get() == 0)
+                        return plural_ptr();
+                    if(t.get() != ':')
+                        return plural_ptr();
+                    if((case2 = cond_expr()).get() == 0)
+                        return plural_ptr();
+                } else {
+                    return cond;
+                }
+                return plural_ptr(new conditional(cond, case1, case2));
+            }
+
+            tokenizer& t;
+        };
+
+    } // namespace
+
+    plural_ptr compile(const char* str)
+    {
+        tokenizer t(str);
+        parser p(t);
+        return p.compile();
+    }
+
+}}}} // namespace boost::locale::gnu_gettext::lambda

externals/boost/libs/locale/src/boost/locale/shared/mo_lambda.hpp

@@ -0,0 +1,27 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_SRC_LOCALE_MO_LAMBDA_HPP_INCLUDED
+#define BOOST_SRC_LOCALE_MO_LAMBDA_HPP_INCLUDED
+
+#include <boost/locale/config.hpp>
+#include <memory>
+
+namespace boost { namespace locale { namespace gnu_gettext { namespace lambda {
+
+    struct plural {
+        virtual int operator()(int n) const = 0;
+        virtual plural* clone() const = 0;
+        virtual ~plural() = default;
+    };
+
+    typedef std::shared_ptr<plural> plural_ptr;
+
+    plural_ptr compile(const char* c_expression);
+
+}}}} // namespace boost::locale::gnu_gettext::lambda
+
+#endif

externals/boost/libs/locale/src/boost/locale/std/all_generator.hpp

@@ -0,0 +1,44 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_STD_ALL_GENERATOR_HPP
+#define BOOST_LOCALE_IMPL_STD_ALL_GENERATOR_HPP
+
+#include <boost/locale/generator.hpp>
+#include <locale>
+#include <string>
+
+namespace boost { namespace locale { namespace impl_std {
+    enum class utf8_support { none, native, native_with_wide, from_wide };
+
+    std::locale create_convert(const std::locale& in,
+                               const std::string& locale_name,
+                               char_facet_t type,
+                               utf8_support utf = utf8_support::none);
+
+    std::locale create_collate(const std::locale& in,
+                               const std::string& locale_name,
+                               char_facet_t type,
+                               utf8_support utf = utf8_support::none);
+
+    std::locale create_formatting(const std::locale& in,
+                                  const std::string& locale_name,
+                                  char_facet_t type,
+                                  utf8_support utf = utf8_support::none);
+
+    std::locale create_parsing(const std::locale& in,
+                               const std::string& locale_name,
+                               char_facet_t type,
+                               utf8_support utf = utf8_support::none);
+
+    std::locale create_codecvt(const std::locale& in,
+                               const std::string& locale_name,
+                               char_facet_t type,
+                               utf8_support utf = utf8_support::none);
+
+}}} // namespace boost::locale::impl_std
+
+#endif

externals/boost/libs/locale/src/boost/locale/std/codecvt.cpp

@@ -0,0 +1,38 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/util.hpp>
+#include "boost/locale/std/all_generator.hpp"
+#include <locale>
+
+namespace boost { namespace locale { namespace impl_std {
+    template<typename CharType>
+    std::locale codecvt_bychar(const std::locale& in, const std::string& locale_name)
+    {
+        return std::locale(in, new std::codecvt_byname<CharType, char, std::mbstate_t>(locale_name.c_str()));
+    }
+
+    std::locale
+    create_codecvt(const std::locale& in, const std::string& locale_name, char_facet_t type, utf8_support utf)
+    {
+        if(utf == utf8_support::from_wide)
+            return util::create_utf8_codecvt(in, type);
+
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return codecvt_bychar<char>(in, locale_name);
+            case char_facet_t::wchar_f: return codecvt_bychar<wchar_t>(in, locale_name);
+#if defined(BOOST_LOCALE_ENABLE_CHAR16_T)
+            case char_facet_t::char16_f: return codecvt_bychar<char16_t>(in, locale_name);
+#endif
+#if defined(BOOST_LOCALE_ENABLE_CHAR32_T)
+            case char_facet_t::char32_f: return codecvt_bychar<char32_t>(in, locale_name);
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_std

externals/boost/libs/locale/src/boost/locale/std/collate.cpp

@@ -0,0 +1,92 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/encoding.hpp>
+#include "boost/locale/std/all_generator.hpp"
+#include <ios>
+#include <locale>
+#include <string>
+
+namespace boost { namespace locale { namespace impl_std {
+
+    class utf8_collator_from_wide : public std::collate<char> {
+    public:
+        typedef std::collate<wchar_t> wfacet;
+        utf8_collator_from_wide(const std::locale& base, size_t refs = 0) : std::collate<char>(refs), base_(base) {}
+        int do_compare(const char* lb, const char* le, const char* rb, const char* re) const override
+        {
+            std::wstring l = conv::to_utf<wchar_t>(lb, le, "UTF-8");
+            std::wstring r = conv::to_utf<wchar_t>(rb, re, "UTF-8");
+            return std::use_facet<wfacet>(base_).compare(l.c_str(),
+                                                         l.c_str() + l.size(),
+                                                         r.c_str(),
+                                                         r.c_str() + r.size());
+        }
+        long do_hash(const char* b, const char* e) const override
+        {
+            std::wstring tmp = conv::to_utf<wchar_t>(b, e, "UTF-8");
+            return std::use_facet<wfacet>(base_).hash(tmp.c_str(), tmp.c_str() + tmp.size());
+        }
+        std::string do_transform(const char* b, const char* e) const override
+        {
+            std::wstring tmp = conv::to_utf<wchar_t>(b, e, "UTF-8");
+            std::wstring wkey = std::use_facet<wfacet>(base_).transform(tmp.c_str(), tmp.c_str() + tmp.size());
+            std::string key;
+            BOOST_LOCALE_START_CONST_CONDITION
+            if(sizeof(wchar_t) == 2)
+                key.reserve(wkey.size() * 2);
+            else
+                key.reserve(wkey.size() * 3);
+            for(unsigned i = 0; i < wkey.size(); i++) {
+                if(sizeof(wchar_t) == 2) {
+                    uint16_t tv = static_cast<uint16_t>(wkey[i]);
+                    key += char(tv >> 8);
+                    key += char(tv & 0xFF);
+                } else { // 4
+                    uint32_t tv = static_cast<uint32_t>(wkey[i]);
+                    // 21 bit
+                    key += char((tv >> 16) & 0xFF);
+                    key += char((tv >> 8) & 0xFF);
+                    key += char(tv & 0xFF);
+                }
+            }
+            BOOST_LOCALE_END_CONST_CONDITION
+            return key;
+        }
+
+    private:
+        std::locale base_;
+    };
+
+    std::locale
+    create_collate(const std::locale& in, const std::string& locale_name, char_facet_t type, utf8_support utf)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: {
+                if(utf == utf8_support::from_wide) {
+                    std::locale base =
+                      std::locale(std::locale::classic(), new std::collate_byname<wchar_t>(locale_name.c_str()));
+                    return std::locale(in, new utf8_collator_from_wide(base));
+                } else {
+                    return std::locale(in, new std::collate_byname<char>(locale_name.c_str()));
+                }
+            }
+
+            case char_facet_t::wchar_f: return std::locale(in, new std::collate_byname<wchar_t>(locale_name.c_str()));
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return std::locale(in, new std::collate_byname<char16_t>(locale_name.c_str()));
+#endif
+
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return std::locale(in, new std::collate_byname<char32_t>(locale_name.c_str()));
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_std

externals/boost/libs/locale/src/boost/locale/std/converter.cpp

@@ -0,0 +1,124 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/conversion.hpp>
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/generator.hpp>
+#include <locale>
+#include <stdexcept>
+#include <vector>
+
+#include "boost/locale/std/all_generator.hpp"
+
+namespace boost { namespace locale { namespace impl_std {
+
+    template<typename CharType>
+    class std_converter : public converter<CharType> {
+    public:
+        typedef CharType char_type;
+        typedef std::basic_string<char_type> string_type;
+        typedef std::ctype<char_type> ctype_type;
+        std_converter(const std::locale& base, size_t refs = 0) : converter<CharType>(refs), base_(base) {}
+        string_type convert(converter_base::conversion_type how,
+                            const char_type* begin,
+                            const char_type* end,
+                            int /*flags*/ = 0) const override
+        {
+            switch(how) {
+                case converter_base::upper_case:
+                case converter_base::lower_case:
+                case converter_base::case_folding: {
+                    const ctype_type& ct = std::use_facet<ctype_type>(base_);
+                    size_t len = end - begin;
+                    std::vector<char_type> res(len + 1, 0);
+                    char_type* lbegin = &res[0];
+                    std::copy(begin, end, lbegin);
+                    if(how == converter_base::upper_case)
+                        ct.toupper(lbegin, lbegin + len);
+                    else
+                        ct.tolower(lbegin, lbegin + len);
+                    return string_type(lbegin, len);
+                }
+                case converter_base::normalization:
+                case converter_base::title_case: break;
+            }
+            return string_type(begin, end - begin);
+        }
+
+    private:
+        std::locale base_;
+    };
+
+    class utf8_converter : public converter<char> {
+    public:
+        typedef std::ctype<char> ctype_type;
+        typedef std::ctype<wchar_t> wctype_type;
+        utf8_converter(const std::locale& base, size_t refs = 0) : converter<char>(refs), base_(base) {}
+        std::string convert(converter_base::conversion_type how,
+                            const char* begin,
+                            const char* end,
+                            int /*flags*/ = 0) const override
+        {
+            switch(how) {
+                case upper_case:
+                case lower_case:
+                case case_folding: {
+                    std::wstring tmp = conv::to_utf<wchar_t>(begin, end, "UTF-8");
+                    const wctype_type& ct = std::use_facet<wctype_type>(base_);
+                    size_t len = tmp.size();
+                    std::vector<wchar_t> res(len + 1, 0);
+                    wchar_t* lbegin = &res[0];
+                    std::copy(tmp.c_str(), tmp.c_str() + len, lbegin);
+                    if(how == upper_case)
+                        ct.toupper(lbegin, lbegin + len);
+                    else
+                        ct.tolower(lbegin, lbegin + len);
+                    return conv::from_utf<wchar_t>(lbegin, lbegin + len, "UTF-8");
+                }
+                case title_case:
+                case normalization: break;
+            }
+            return std::string(begin, end - begin);
+        }
+
+    private:
+        std::locale base_;
+    };
+
+    std::locale
+    create_convert(const std::locale& in, const std::string& locale_name, char_facet_t type, utf8_support utf)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: {
+                if(utf == utf8_support::native_with_wide || utf == utf8_support::from_wide) {
+                    std::locale base(std::locale::classic(), new std::ctype_byname<wchar_t>(locale_name.c_str()));
+                    return std::locale(in, new utf8_converter(base));
+                }
+                std::locale base(std::locale::classic(), new std::ctype_byname<char>(locale_name.c_str()));
+                return std::locale(in, new std_converter<char>(base));
+            }
+            case char_facet_t::wchar_f: {
+                std::locale base(std::locale::classic(), new std::ctype_byname<wchar_t>(locale_name.c_str()));
+                return std::locale(in, new std_converter<wchar_t>(base));
+            }
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: {
+                std::locale base(std::locale::classic(), new std::ctype_byname<char16_t>(locale_name.c_str()));
+                return std::locale(in, new std_converter<char16_t>(base));
+            }
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: {
+                std::locale base(std::locale::classic(), new std::ctype_byname<char32_t>(locale_name.c_str()));
+                return std::locale(in, new std_converter<char32_t>(base));
+            }
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_std

externals/boost/libs/locale/src/boost/locale/std/numeric.cpp

@@ -0,0 +1,377 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/formatting.hpp>
+#include <boost/locale/generator.hpp>
+#include <cstdlib>
+#include <ios>
+#include <locale>
+#include <sstream>
+#include <string>
+
+#include "boost/locale/std/all_generator.hpp"
+#include "boost/locale/util/numeric.hpp"
+
+namespace boost { namespace locale { namespace impl_std {
+
+    template<typename CharType>
+    class time_put_from_base : public std::time_put<CharType> {
+    public:
+        time_put_from_base(const std::locale& base, size_t refs = 0) : std::time_put<CharType>(refs), base_(base) {}
+        typedef typename std::time_put<CharType>::iter_type iter_type;
+
+        iter_type do_put(iter_type out,
+                         std::ios_base& /*ios*/,
+                         CharType fill,
+                         const std::tm* tm,
+                         char format,
+                         char modifier) const override
+        {
+            std::basic_stringstream<CharType> ss;
+            ss.imbue(base_);
+            return std::use_facet<std::time_put<CharType>>(base_).put(out, ss, fill, tm, format, modifier);
+        }
+
+    private:
+        std::locale base_;
+    };
+
+    class utf8_time_put_from_wide : public std::time_put<char> {
+    public:
+        utf8_time_put_from_wide(const std::locale& base, size_t refs = 0) : std::time_put<char>(refs), base_(base) {}
+        iter_type do_put(iter_type out,
+                         std::ios_base& /*ios*/,
+                         char fill,
+                         const std::tm* tm,
+                         char format,
+                         char modifier = 0) const override
+        {
+            std::basic_ostringstream<wchar_t> wtmps;
+            wtmps.imbue(base_);
+            std::use_facet<std::time_put<wchar_t>>(base_)
+              .put(wtmps, wtmps, wchar_t(fill), tm, wchar_t(format), wchar_t(modifier));
+            std::wstring wtmp = wtmps.str();
+            std::string const tmp = conv::from_utf<wchar_t>(wtmp, "UTF-8");
+            for(unsigned i = 0; i < tmp.size(); i++) {
+                *out++ = tmp[i];
+            }
+            return out;
+        }
+
+    private:
+        std::locale base_;
+    };
+
+    class utf8_numpunct_from_wide : public std::numpunct<char> {
+    public:
+        utf8_numpunct_from_wide(const std::locale& base, size_t refs = 0) : std::numpunct<char>(refs)
+        {
+            typedef std::numpunct<wchar_t> wfacet_type;
+            const wfacet_type& wfacet = std::use_facet<wfacet_type>(base);
+
+            truename_ = conv::from_utf<wchar_t>(wfacet.truename(), "UTF-8");
+            falsename_ = conv::from_utf<wchar_t>(wfacet.falsename(), "UTF-8");
+
+            wchar_t tmp_decimal_point = wfacet.decimal_point();
+            wchar_t tmp_thousands_sep = wfacet.thousands_sep();
+            std::string tmp_grouping = wfacet.grouping();
+
+            if(32 <= tmp_thousands_sep && tmp_thousands_sep <= 126 && 32 <= tmp_decimal_point
+               && tmp_decimal_point <= 126) {
+                thousands_sep_ = static_cast<char>(tmp_thousands_sep);
+                decimal_point_ = static_cast<char>(tmp_decimal_point);
+                grouping_ = tmp_grouping;
+            } else if(32 <= tmp_decimal_point && tmp_decimal_point <= 126 && tmp_thousands_sep == 0xA0) {
+                // workaround common bug - substitute NBSP with ordinary space
+                thousands_sep_ = ' ';
+                decimal_point_ = static_cast<char>(tmp_decimal_point);
+                grouping_ = tmp_grouping;
+            } else if(32 <= tmp_decimal_point && tmp_decimal_point <= 126) {
+                thousands_sep_ = ',';
+                decimal_point_ = static_cast<char>(tmp_decimal_point);
+                grouping_ = std::string();
+            } else {
+                thousands_sep_ = ',';
+                decimal_point_ = '.';
+                grouping_ = std::string();
+            }
+        }
+
+        char do_decimal_point() const override { return decimal_point_; }
+        char do_thousands_sep() const override { return thousands_sep_; }
+        std::string do_grouping() const override { return grouping_; }
+        std::string do_truename() const override { return truename_; }
+        std::string do_falsename() const override { return falsename_; }
+
+    private:
+        std::string truename_;
+        std::string falsename_;
+        char thousands_sep_;
+        char decimal_point_;
+        std::string grouping_;
+    };
+
+    template<bool Intl>
+    class utf8_moneypunct_from_wide : public std::moneypunct<char, Intl> {
+    public:
+        utf8_moneypunct_from_wide(const std::locale& base, size_t refs = 0) : std::moneypunct<char, Intl>(refs)
+        {
+            typedef std::moneypunct<wchar_t, Intl> wfacet_type;
+            const wfacet_type& wfacet = std::use_facet<wfacet_type>(base);
+
+            curr_symbol_ = conv::from_utf<wchar_t>(wfacet.curr_symbol(), "UTF-8");
+            positive_sign_ = conv::from_utf<wchar_t>(wfacet.positive_sign(), "UTF-8");
+            negative_sign_ = conv::from_utf<wchar_t>(wfacet.negative_sign(), "UTF-8");
+            frac_digits_ = wfacet.frac_digits();
+            pos_format_ = wfacet.pos_format();
+            neg_format_ = wfacet.neg_format();
+
+            wchar_t tmp_decimal_point = wfacet.decimal_point();
+            wchar_t tmp_thousands_sep = wfacet.thousands_sep();
+            std::string tmp_grouping = wfacet.grouping();
+            if(32 <= tmp_thousands_sep && tmp_thousands_sep <= 126 && 32 <= tmp_decimal_point
+               && tmp_decimal_point <= 126) {
+                thousands_sep_ = static_cast<char>(tmp_thousands_sep);
+                decimal_point_ = static_cast<char>(tmp_decimal_point);
+                grouping_ = tmp_grouping;
+            } else if(32 <= tmp_decimal_point && tmp_decimal_point <= 126 && tmp_thousands_sep == 0xA0) {
+                // workaround common bug - substitute NBSP with ordinary space
+                thousands_sep_ = ' ';
+                decimal_point_ = static_cast<char>(tmp_decimal_point);
+                grouping_ = tmp_grouping;
+            } else if(32 <= tmp_decimal_point && tmp_decimal_point <= 126) {
+                thousands_sep_ = ',';
+                decimal_point_ = static_cast<char>(tmp_decimal_point);
+                grouping_ = std::string();
+            } else {
+                thousands_sep_ = ',';
+                decimal_point_ = '.';
+                grouping_ = std::string();
+            }
+        }
+
+        char do_decimal_point() const override { return decimal_point_; }
+
+        char do_thousands_sep() const override { return thousands_sep_; }
+
+        std::string do_grouping() const override { return grouping_; }
+
+        std::string do_curr_symbol() const override { return curr_symbol_; }
+        std::string do_positive_sign() const override { return positive_sign_; }
+        std::string do_negative_sign() const override { return negative_sign_; }
+
+        int do_frac_digits() const override { return frac_digits_; }
+
+        std::money_base::pattern do_pos_format() const override { return pos_format_; }
+
+        std::money_base::pattern do_neg_format() const override { return neg_format_; }
+
+    private:
+        char thousands_sep_;
+        char decimal_point_;
+        std::string grouping_;
+        std::string curr_symbol_;
+        std::string positive_sign_;
+        std::string negative_sign_;
+        int frac_digits_;
+        std::money_base::pattern pos_format_, neg_format_;
+    };
+
+    class utf8_numpunct : public std::numpunct_byname<char> {
+    public:
+        typedef std::numpunct_byname<char> base_type;
+        utf8_numpunct(const char* name, size_t refs = 0) : std::numpunct_byname<char>(name, refs) {}
+        char do_thousands_sep() const override
+        {
+            unsigned char bs = base_type::do_thousands_sep();
+            if(bs > 127)
+                if(bs == 0xA0)
+                    return ' ';
+                else
+                    return 0;
+            else
+                return bs;
+        }
+        std::string do_grouping() const override
+        {
+            unsigned char bs = base_type::do_thousands_sep();
+            if(bs > 127 && bs != 0xA0)
+                return std::string();
+            return base_type::do_grouping();
+        }
+    };
+
+    template<bool Intl>
+    class utf8_moneypunct : public std::moneypunct_byname<char, Intl> {
+    public:
+        typedef std::moneypunct_byname<char, Intl> base_type;
+        utf8_moneypunct(const char* name, size_t refs = 0) : std::moneypunct_byname<char, Intl>(name, refs) {}
+        char do_thousands_sep() const override
+        {
+            unsigned char bs = base_type::do_thousands_sep();
+            if(bs > 127)
+                if(bs == 0xA0)
+                    return ' ';
+                else
+                    return 0;
+            else
+                return bs;
+        }
+        std::string do_grouping() const override
+        {
+            unsigned char bs = base_type::do_thousands_sep();
+            if(bs > 127 && bs != 0xA0)
+                return std::string();
+            return base_type::do_grouping();
+        }
+    };
+
+    template<typename CharType>
+    std::locale create_basic_parsing(const std::locale& in, const std::string& locale_name)
+    {
+        std::locale tmp = std::locale(in, new std::numpunct_byname<CharType>(locale_name.c_str()));
+        tmp = std::locale(tmp, new std::moneypunct_byname<CharType, true>(locale_name.c_str()));
+        tmp = std::locale(tmp, new std::moneypunct_byname<CharType, false>(locale_name.c_str()));
+        tmp = std::locale(tmp, new std::ctype_byname<CharType>(locale_name.c_str()));
+        return tmp;
+    }
+
+    template<typename CharType>
+    std::locale create_basic_formatting(const std::locale& in, const std::string& locale_name)
+    {
+        std::locale tmp = create_basic_parsing<CharType>(in, locale_name);
+        std::locale base(locale_name.c_str());
+        tmp = std::locale(tmp, new time_put_from_base<CharType>(base));
+        return tmp;
+    }
+
+    std::locale
+    create_formatting(const std::locale& in, const std::string& locale_name, char_facet_t type, utf8_support utf)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: {
+                switch(utf) {
+                    case utf8_support::from_wide: {
+                        std::locale base = std::locale(locale_name.c_str());
+
+                        std::locale tmp = std::locale(in, new utf8_time_put_from_wide(base));
+                        tmp = std::locale(tmp, new utf8_numpunct_from_wide(base));
+                        tmp = std::locale(tmp, new utf8_moneypunct_from_wide<true>(base));
+                        tmp = std::locale(tmp, new utf8_moneypunct_from_wide<false>(base));
+                        return std::locale(tmp, new util::base_num_format<char>());
+                    }
+                    case utf8_support::native: {
+                        std::locale base = std::locale(locale_name.c_str());
+
+                        std::locale tmp = std::locale(in, new time_put_from_base<char>(base));
+                        tmp = std::locale(tmp, new utf8_numpunct(locale_name.c_str()));
+                        tmp = std::locale(tmp, new utf8_moneypunct<true>(locale_name.c_str()));
+                        tmp = std::locale(tmp, new utf8_moneypunct<false>(locale_name.c_str()));
+                        return std::locale(tmp, new util::base_num_format<char>());
+                    }
+                    case utf8_support::native_with_wide: {
+                        std::locale base = std::locale(locale_name.c_str());
+
+                        std::locale tmp = std::locale(in, new time_put_from_base<char>(base));
+                        tmp = std::locale(tmp, new utf8_numpunct_from_wide(base));
+                        tmp = std::locale(tmp, new utf8_moneypunct_from_wide<true>(base));
+                        tmp = std::locale(tmp, new utf8_moneypunct_from_wide<false>(base));
+                        return std::locale(tmp, new util::base_num_format<char>());
+                    }
+                    case utf8_support::none: break;
+                }
+                std::locale tmp = create_basic_formatting<char>(in, locale_name);
+                tmp = std::locale(tmp, new util::base_num_format<char>());
+                return tmp;
+            }
+            case char_facet_t::wchar_f: {
+                std::locale tmp = create_basic_formatting<wchar_t>(in, locale_name);
+                tmp = std::locale(tmp, new util::base_num_format<wchar_t>());
+                return tmp;
+            }
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: {
+                std::locale tmp = create_basic_formatting<char16_t>(in, locale_name);
+                tmp = std::locale(tmp, new util::base_num_format<char16_t>());
+                return tmp;
+            }
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: {
+                std::locale tmp = create_basic_formatting<char32_t>(in, locale_name);
+                tmp = std::locale(tmp, new util::base_num_format<char32_t>());
+                return tmp;
+            }
+#endif
+        }
+        return in;
+    }
+
+    std::locale
+    create_parsing(const std::locale& in, const std::string& locale_name, char_facet_t type, utf8_support utf)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: {
+                switch(utf) {
+                    case utf8_support::from_wide: {
+                        std::locale base = std::locale::classic();
+
+                        base = std::locale(base, new std::numpunct_byname<wchar_t>(locale_name.c_str()));
+                        base = std::locale(base, new std::moneypunct_byname<wchar_t, true>(locale_name.c_str()));
+                        base = std::locale(base, new std::moneypunct_byname<wchar_t, false>(locale_name.c_str()));
+
+                        std::locale tmp = std::locale(in, new utf8_numpunct_from_wide(base));
+                        tmp = std::locale(tmp, new utf8_moneypunct_from_wide<true>(base));
+                        tmp = std::locale(tmp, new utf8_moneypunct_from_wide<false>(base));
+                        return std::locale(tmp, new util::base_num_parse<char>());
+                    }
+                    case utf8_support::native: {
+                        std::locale tmp = std::locale(in, new utf8_numpunct(locale_name.c_str()));
+                        tmp = std::locale(tmp, new utf8_moneypunct<true>(locale_name.c_str()));
+                        tmp = std::locale(tmp, new utf8_moneypunct<false>(locale_name.c_str()));
+                        return std::locale(tmp, new util::base_num_parse<char>());
+                    }
+                    case utf8_support::native_with_wide: {
+                        std::locale base = std::locale(locale_name.c_str());
+
+                        std::locale tmp = std::locale(in, new utf8_numpunct_from_wide(base));
+                        tmp = std::locale(tmp, new utf8_moneypunct_from_wide<true>(base));
+                        tmp = std::locale(tmp, new utf8_moneypunct_from_wide<false>(base));
+                        return std::locale(tmp, new util::base_num_parse<char>());
+                    }
+                    case utf8_support::none: break;
+                }
+                std::locale tmp = create_basic_parsing<char>(in, locale_name);
+                tmp = std::locale(in, new util::base_num_parse<char>());
+                return tmp;
+            }
+            case char_facet_t::wchar_f: {
+                std::locale tmp = create_basic_parsing<wchar_t>(in, locale_name);
+                tmp = std::locale(in, new util::base_num_parse<wchar_t>());
+                return tmp;
+            }
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: {
+                std::locale tmp = create_basic_parsing<char16_t>(in, locale_name);
+                tmp = std::locale(in, new util::base_num_parse<char16_t>());
+                return tmp;
+            }
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: {
+                std::locale tmp = create_basic_parsing<char32_t>(in, locale_name);
+                tmp = std::locale(in, new util::base_num_parse<char32_t>());
+                return tmp;
+            }
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_std

externals/boost/libs/locale/src/boost/locale/std/std_backend.cpp

@@ -0,0 +1,208 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/std/std_backend.hpp"
+#include <boost/locale/gnu_gettext.hpp>
+#include <boost/locale/localization_backend.hpp>
+#include <boost/locale/util.hpp>
+#include <boost/locale/util/locale_data.hpp>
+#include <algorithm>
+#include <iterator>
+#include <vector>
+
+#if defined(BOOST_WINDOWS)
+#    ifndef NOMINMAX
+#        define NOMINMAX
+#    endif
+#    include "boost/locale/encoding/conv.hpp"
+#    include "boost/locale/util/encoding.hpp"
+#    include "boost/locale/win32/lcid.hpp"
+#    include <windows.h>
+#endif
+#include "boost/locale/std/all_generator.hpp"
+#include "boost/locale/util/gregorian.hpp"
+
+namespace boost { namespace locale { namespace impl_std {
+
+    class std_localization_backend : public localization_backend {
+    public:
+        std_localization_backend() : invalid_(true), use_ansi_encoding_(false) {}
+        std_localization_backend(const std_localization_backend& other) :
+            localization_backend(), paths_(other.paths_), domains_(other.domains_), locale_id_(other.locale_id_),
+            invalid_(true), use_ansi_encoding_(other.use_ansi_encoding_)
+        {}
+        std_localization_backend* clone() const override { return new std_localization_backend(*this); }
+
+        void set_option(const std::string& name, const std::string& value) override
+        {
+            invalid_ = true;
+            if(name == "locale")
+                locale_id_ = value;
+            else if(name == "message_path")
+                paths_.push_back(value);
+            else if(name == "message_application")
+                domains_.push_back(value);
+            else if(name == "use_ansi_encoding")
+                use_ansi_encoding_ = value == "true";
+        }
+        void clear_options() override
+        {
+            invalid_ = true;
+            use_ansi_encoding_ = false;
+            locale_id_.clear();
+            paths_.clear();
+            domains_.clear();
+        }
+
+        void prepare_data()
+        {
+            if(!invalid_)
+                return;
+            invalid_ = false;
+            std::string lid = locale_id_;
+            if(lid.empty()) {
+                bool use_utf8 = !use_ansi_encoding_;
+                lid = util::get_system_locale(use_utf8);
+            }
+            in_use_id_ = lid;
+            data_.parse(lid);
+            name_ = "C";
+
+#if defined(BOOST_WINDOWS)
+            const std::pair<std::string, int> wl_inf = to_windows_name(lid);
+            const std::string& win_name = wl_inf.first;
+            const int win_codepage = wl_inf.second;
+#endif
+
+            if(!data_.is_utf8()) {
+                if(loadable(lid))
+                    name_ = lid;
+#if defined(BOOST_WINDOWS)
+                else if(loadable(win_name) && win_codepage == util::encoding_to_windows_codepage(data_.encoding()))
+                    name_ = win_name;
+#endif
+                utf_mode_ = utf8_support::none;
+            } else {
+                if(loadable(lid)) {
+                    name_ = lid;
+                    utf_mode_ = utf8_support::native_with_wide;
+#if defined(BOOST_WINDOWS)
+                    // This isn't fully correct:
+                    // It will treat the 2-Byte wchar_t as UTF-16 encoded while it may be UCS-2
+                    // std::basic_filebuf explicitely disallows using suche multi-byte codecvts
+                    // but it works in practice so far, so use it instead of failing for codepoints above U+FFFF
+                    utf_mode_ = utf8_support::from_wide;
+#endif
+                }
+#if defined(BOOST_WINDOWS)
+                else if(loadable(win_name))
+                {
+                    name_ = win_name;
+                    utf_mode_ = utf8_support::from_wide;
+                }
+#endif
+                else
+                    utf_mode_ = utf8_support::none;
+            }
+        }
+
+#if defined(BOOST_WINDOWS)
+        std::pair<std::string, int> to_windows_name(const std::string& l)
+        {
+            std::pair<std::string, int> res("C", 0);
+            unsigned lcid = impl_win::locale_to_lcid(l);
+            char win_lang[256] = {0};
+            char win_country[256] = {0};
+            char win_codepage[10] = {0};
+            if(GetLocaleInfoA(lcid, LOCALE_SENGLANGUAGE, win_lang, sizeof(win_lang)) == 0)
+                return res;
+            std::string lc_name = win_lang;
+            if(GetLocaleInfoA(lcid, LOCALE_SENGCOUNTRY, win_country, sizeof(win_country)) != 0) {
+                lc_name += "_";
+                lc_name += win_country;
+            }
+
+            res.first = lc_name;
+
+            if(GetLocaleInfoA(lcid, LOCALE_IDEFAULTANSICODEPAGE, win_codepage, sizeof(win_codepage)) != 0)
+                res.second = atoi(win_codepage);
+            return res;
+        }
+#endif
+
+        bool loadable(std::string name)
+        {
+            try {
+                std::locale l(name.c_str());
+                return true;
+            } catch(const std::exception& /*e*/) {
+                return false;
+            }
+        }
+
+        std::locale install(const std::locale& base, category_t category, char_facet_t type) override
+        {
+            prepare_data();
+
+            switch(category) {
+                case category_t::convert: return create_convert(base, name_, type, utf_mode_);
+                case category_t::collation: return create_collate(base, name_, type, utf_mode_);
+                case category_t::formatting: return create_formatting(base, name_, type, utf_mode_);
+                case category_t::parsing: return create_parsing(base, name_, type, utf_mode_);
+                case category_t::codepage: return create_codecvt(base, name_, type, utf_mode_);
+                case category_t::calendar: return util::install_gregorian_calendar(base, data_.country());
+                case category_t::message: {
+                    gnu_gettext::messages_info minf;
+                    minf.language = data_.language();
+                    minf.country = data_.country();
+                    minf.variant = data_.variant();
+                    minf.encoding = data_.encoding();
+                    std::copy(domains_.begin(),
+                              domains_.end(),
+                              std::back_inserter<gnu_gettext::messages_info::domains_type>(minf.domains));
+                    minf.paths = paths_;
+                    switch(type) {
+                        case char_facet_t::nochar: break;
+                        case char_facet_t::char_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char>(minf));
+                        case char_facet_t::wchar_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<wchar_t>(minf));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+                        case char_facet_t::char16_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char16_t>(minf));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+                        case char_facet_t::char32_f:
+                            return std::locale(base, gnu_gettext::create_messages_facet<char32_t>(minf));
+#endif
+                    }
+                    return base;
+                }
+                case category_t::information: return util::create_info(base, in_use_id_);
+                case category_t::boundary: break; // Not implemented
+            }
+            return base;
+        }
+
+    private:
+        std::vector<std::string> paths_;
+        std::vector<std::string> domains_;
+        std::string locale_id_;
+
+        util::locale_data data_;
+        std::string name_;
+        std::string in_use_id_;
+        utf8_support utf_mode_;
+        bool invalid_;
+        bool use_ansi_encoding_;
+    };
+
+    localization_backend* create_localization_backend()
+    {
+        return new std_localization_backend();
+    }
+
+}}} // namespace boost::locale::impl_std

externals/boost/libs/locale/src/boost/locale/std/std_backend.hpp

@@ -0,0 +1,15 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_STD_LOCALIZATION_BACKEND_HPP
+#define BOOST_LOCALE_IMPL_STD_LOCALIZATION_BACKEND_HPP
+namespace boost { namespace locale {
+    class localization_backend;
+    namespace impl_std {
+        localization_backend* create_localization_backend();
+    } // namespace impl_std
+}}    // namespace boost::locale
+#endif

externals/boost/libs/locale/src/boost/locale/util/codecvt_converter.cpp

@@ -0,0 +1,325 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/generator.hpp>
+#include <boost/locale/utf8_codecvt.hpp>
+#include <boost/locale/util.hpp>
+#include <algorithm>
+#include <cstddef>
+#include <cstring>
+
+#include "boost/locale/encoding/conv.hpp"
+#include "boost/locale/util/encoding.hpp"
+
+#ifdef BOOST_MSVC
+#    pragma warning(disable : 4244) // loose data
+#endif
+
+namespace boost { namespace locale { namespace util {
+
+    base_converter::~base_converter() = default;
+
+    class utf8_converter : public base_converter {
+    public:
+        int max_len() const override { return 4; }
+
+        utf8_converter* clone() const override { return new utf8_converter(); }
+
+        bool is_thread_safe() const override { return true; }
+
+        uint32_t to_unicode(const char*& begin, const char* end) override
+        {
+            const char* p = begin;
+
+            utf::code_point c = utf::utf_traits<char>::decode(p, end);
+
+            if(c == utf::illegal)
+                return illegal;
+
+            if(c == utf::incomplete)
+                return incomplete;
+
+            begin = p;
+            return c;
+        }
+
+        uint32_t from_unicode(uint32_t u, char* begin, const char* end) override
+        {
+            if(!utf::is_valid_codepoint(u))
+                return illegal;
+            int width = utf::utf_traits<char>::width(u);
+            std::ptrdiff_t d = end - begin;
+            if(d < width)
+                return incomplete;
+            utf::utf_traits<char>::encode(u, begin);
+            return width;
+        }
+    }; // utf8_converter
+
+    class simple_converter_impl {
+    public:
+        static constexpr int hash_table_size = 1024;
+
+        simple_converter_impl(const std::string& encoding)
+        {
+            for(unsigned i = 0; i < 128; i++)
+                to_unicode_tbl_[i] = i;
+            for(unsigned i = 128; i < 256; i++) {
+                char buf[2] = {char(i), 0};
+                uint32_t uchar = utf::illegal;
+                try {
+                    std::wstring const tmp = conv::to_utf<wchar_t>(buf, buf + 1, encoding, conv::stop);
+                    if(tmp.size() == 1) {
+                        uchar = tmp[0];
+                    } else {
+                        uchar = utf::illegal;
+                    }
+                } catch(const conv::conversion_error& /*e*/) {
+                    uchar = utf::illegal;
+                }
+                to_unicode_tbl_[i] = uchar;
+            }
+            for(int i = 0; i < hash_table_size; i++)
+                from_unicode_tbl_[i] = 0;
+            for(unsigned i = 1; i < 256; i++) {
+                if(to_unicode_tbl_[i] != utf::illegal) {
+                    unsigned pos = to_unicode_tbl_[i] % hash_table_size;
+                    while(from_unicode_tbl_[pos] != 0)
+                        pos = (pos + 1) % hash_table_size;
+                    from_unicode_tbl_[pos] = i;
+                }
+            }
+        }
+
+        uint32_t to_unicode(const char*& begin, const char* end) const
+        {
+            if(begin == end)
+                return utf::incomplete;
+            unsigned char c = *begin++;
+            return to_unicode_tbl_[c];
+        }
+        uint32_t from_unicode(uint32_t u, char* begin, const char* end) const
+        {
+            if(begin == end)
+                return utf::incomplete;
+            if(u == 0) {
+                *begin = 0;
+                return 1;
+            }
+            unsigned pos = u % hash_table_size;
+            unsigned char c;
+            while((c = from_unicode_tbl_[pos]) != 0 && to_unicode_tbl_[c] != u)
+                pos = (pos + 1) % hash_table_size;
+            if(c == 0)
+                return utf::illegal;
+            *begin = c;
+            return 1;
+        }
+
+    private:
+        uint32_t to_unicode_tbl_[256];
+        unsigned char from_unicode_tbl_[hash_table_size];
+    };
+
+    class simple_converter : public base_converter {
+    public:
+        simple_converter(const std::string& encoding) : cvt_(encoding) {}
+
+        int max_len() const override { return 1; }
+
+        bool is_thread_safe() const override { return true; }
+        base_converter* clone() const override { return new simple_converter(*this); }
+
+        uint32_t to_unicode(const char*& begin, const char* end) override { return cvt_.to_unicode(begin, end); }
+        uint32_t from_unicode(uint32_t u, char* begin, const char* end) override
+        {
+            return cvt_.from_unicode(u, begin, end);
+        }
+
+    private:
+        simple_converter_impl cvt_;
+    };
+
+    template<typename CharType>
+    class simple_codecvt : public generic_codecvt<CharType, simple_codecvt<CharType>> {
+    public:
+        simple_codecvt(const std::string& encoding, size_t refs = 0) :
+            generic_codecvt<CharType, simple_codecvt<CharType>>(refs), cvt_(encoding)
+        {}
+
+        struct state_type {};
+        static state_type initial_state(generic_codecvt_base::initial_convertion_state /* unused */)
+        {
+            return state_type();
+        }
+        static int max_encoding_length() { return 1; }
+
+        utf::code_point to_unicode(state_type&, const char*& begin, const char* end) const
+        {
+            return cvt_.to_unicode(begin, end);
+        }
+
+        utf::code_point from_unicode(state_type&, utf::code_point u, char* begin, const char* end) const
+        {
+            return cvt_.from_unicode(u, begin, end);
+        }
+
+    private:
+        simple_converter_impl cvt_;
+    };
+
+    namespace {
+        const char* simple_encoding_table[] = {
+          "cp1250",      "cp1251",      "cp1252",      "cp1253",      "cp1254",      "cp1255",
+          "cp1256",      "cp1257",      "iso88591",    "iso885913",   "iso885915",   "iso88592",
+          "iso88593",    "iso88594",    "iso88595",    "iso88596",    "iso88597",    "iso88598",
+          "iso88599",    "koi8r",       "koi8u",       "usascii",     "windows1250", "windows1251",
+          "windows1252", "windows1253", "windows1254", "windows1255", "windows1256", "windows1257"};
+
+        bool compare_strings(const char* l, const char* r)
+        {
+            return strcmp(l, r) < 0;
+        }
+    } // namespace
+
+    bool check_is_simple_encoding(const std::string& encoding)
+    {
+        std::string norm = util::normalize_encoding(encoding);
+        return std::binary_search<const char**>(simple_encoding_table,
+                                                simple_encoding_table
+                                                  + sizeof(simple_encoding_table) / sizeof(const char*),
+                                                norm.c_str(),
+                                                compare_strings);
+    }
+
+    std::unique_ptr<base_converter> create_simple_converter(const std::string& encoding)
+    {
+        return std::unique_ptr<base_converter>(create_simple_converter_new_ptr(encoding));
+    }
+    base_converter* create_simple_converter_new_ptr(const std::string& encoding)
+    {
+        if(check_is_simple_encoding(encoding))
+            return new simple_converter(encoding);
+        return 0;
+    }
+
+    std::unique_ptr<base_converter> create_utf8_converter()
+    {
+        return std::unique_ptr<base_converter>(create_utf8_converter_new_ptr());
+    }
+
+    base_converter* create_utf8_converter_new_ptr()
+    {
+        return new utf8_converter();
+    }
+
+    template<typename CharType>
+    class code_converter : public generic_codecvt<CharType, code_converter<CharType>> {
+    public:
+        typedef std::unique_ptr<base_converter> base_converter_ptr;
+        typedef base_converter_ptr state_type;
+
+        code_converter(base_converter_ptr cvt, size_t refs = 0) :
+            generic_codecvt<CharType, code_converter<CharType>>(refs), cvt_(std::move(cvt))
+        {
+            max_len_ = cvt_->max_len();
+            thread_safe_ = cvt_->is_thread_safe();
+        }
+
+        int max_encoding_length() const { return max_len_; }
+
+        base_converter_ptr initial_state(generic_codecvt_base::initial_convertion_state /* unused */) const
+        {
+            base_converter_ptr r;
+            if(!thread_safe_)
+                r.reset(cvt_->clone());
+            return r;
+        }
+
+        utf::code_point to_unicode(base_converter_ptr& ptr, const char*& begin, const char* end) const
+        {
+            if(thread_safe_)
+                return cvt_->to_unicode(begin, end);
+            else
+                return ptr->to_unicode(begin, end);
+        }
+
+        utf::code_point from_unicode(base_converter_ptr& ptr, utf::code_point u, char* begin, const char* end) const
+        {
+            if(thread_safe_)
+                return cvt_->from_unicode(u, begin, end);
+            else
+                return ptr->from_unicode(u, begin, end);
+        }
+
+    private:
+        base_converter_ptr cvt_;
+        int max_len_;
+        bool thread_safe_;
+    };
+
+    std::locale create_codecvt(const std::locale& in, std::unique_ptr<base_converter> cvt, char_facet_t type)
+    {
+        if(!cvt)
+            cvt.reset(new base_converter());
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return std::locale(in, new code_converter<char>(std::move(cvt)));
+            case char_facet_t::wchar_f: return std::locale(in, new code_converter<wchar_t>(std::move(cvt)));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return std::locale(in, new code_converter<char16_t>(std::move(cvt)));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return std::locale(in, new code_converter<char32_t>(std::move(cvt)));
+#endif
+        }
+        return in;
+    }
+
+    /// Install utf8 codecvt to UTF-16 or UTF-32 into locale \a in and return
+    /// new locale that is based on \a in and uses new facet.
+    std::locale create_utf8_codecvt(const std::locale& in, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return std::locale(in, new utf8_codecvt<char>());
+            case char_facet_t::wchar_f: return std::locale(in, new utf8_codecvt<wchar_t>());
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return std::locale(in, new utf8_codecvt<char16_t>());
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return std::locale(in, new utf8_codecvt<char32_t>());
+#endif
+        }
+        return in;
+    }
+
+    /// This function installs codecvt that can be used for conversion between single byte
+    /// character encodings like ISO-8859-1, koi8-r, windows-1255 and Unicode code points,
+    ///
+    /// Throws invalid_charset_error if the character set is not supported or isn't single byte character
+    /// set
+    std::locale create_simple_codecvt(const std::locale& in, const std::string& encoding, char_facet_t type)
+    {
+        if(!check_is_simple_encoding(encoding))
+            throw boost::locale::conv::invalid_charset_error("Invalid simple encoding " + encoding);
+
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return std::locale(in, new simple_codecvt<char>(encoding));
+            case char_facet_t::wchar_f: return std::locale(in, new simple_codecvt<wchar_t>(encoding));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: return std::locale(in, new simple_codecvt<char16_t>(encoding));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: return std::locale(in, new simple_codecvt<char32_t>(encoding));
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::util

externals/boost/libs/locale/src/boost/locale/util/default_locale.cpp

@@ -0,0 +1,66 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/util.hpp>
+#include <cstdlib>
+
+#if BOOST_LOCALE_USE_WIN32_API
+#    ifndef NOMINMAX
+#        define NOMINMAX
+#    endif
+#    include <windows.h>
+#endif
+
+#if BOOST_LOCALE_USE_WIN32_API
+// Get information about the user default locale and put it into the buffer.
+// Return true on success
+template<size_t N>
+static bool get_user_default_locale_info(LCTYPE lcType, char (&buf)[N])
+{
+    return GetLocaleInfoA(LOCALE_USER_DEFAULT, lcType, buf, N) != 0;
+}
+#endif
+
+namespace boost { namespace locale { namespace util {
+    std::string get_system_locale(bool use_utf8_on_windows)
+    {
+        const char* lang = 0;
+        if(!lang || !*lang)
+            lang = getenv("LC_ALL");
+        if(!lang || !*lang)
+            lang = getenv("LC_CTYPE");
+        if(!lang || !*lang)
+            lang = getenv("LANG");
+#if !BOOST_LOCALE_USE_WIN32_API
+        (void)use_utf8_on_windows; // not relevant for non-windows
+        if(!lang || !*lang)
+            lang = "C";
+        return lang;
+#else
+        if(lang && *lang)
+            return lang;
+
+        char buf[10]{};
+        if(!get_user_default_locale_info(LOCALE_SISO639LANGNAME, buf))
+            return "C";
+        std::string lc_name = buf;
+        if(get_user_default_locale_info(LOCALE_SISO3166CTRYNAME, buf)) {
+            lc_name += "_";
+            lc_name += buf;
+        }
+        if(use_utf8_on_windows || !get_user_default_locale_info(LOCALE_IDEFAULTANSICODEPAGE, buf))
+            lc_name += ".UTF-8";
+        else {
+            if(atoi(buf) == 0)
+                lc_name += ".UTF-8";
+            else
+                lc_name.append(".windows-").append(buf);
+        }
+        return lc_name;
+
+#endif
+    }
+}}} // namespace boost::locale::util

externals/boost/libs/locale/src/boost/locale/util/encoding.cpp

@@ -0,0 +1,78 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2022-2023 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/util/encoding.hpp"
+#include "boost/locale/util/string.hpp"
+#include <boost/assert.hpp>
+#if BOOST_LOCALE_USE_WIN32_API
+#    include "boost/locale/util/win_codepages.hpp"
+#    ifndef NOMINMAX
+#        define NOMINMAX
+#    endif
+#    include <windows.h>
+#endif
+#include <algorithm>
+#include <cstring>
+
+namespace boost { namespace locale { namespace util {
+    static std::string do_normalize_encoding(const char* encoding, const size_t len)
+    {
+        std::string result;
+        result.reserve(len);
+        for(char c = *encoding; c != 0; c = *(++encoding)) {
+            if(is_lower_ascii(c) || is_numeric_ascii(c))
+                result += c;
+            else if(is_upper_ascii(c))
+                result += char(c - 'A' + 'a');
+        }
+        return result;
+    }
+
+    std::string normalize_encoding(const std::string& encoding)
+    {
+        return do_normalize_encoding(encoding.c_str(), encoding.size());
+    }
+
+    std::string normalize_encoding(const char* encoding)
+    {
+        return do_normalize_encoding(encoding, std::strlen(encoding));
+    }
+
+#if BOOST_LOCALE_USE_WIN32_API
+    static int normalized_encoding_to_windows_codepage(const std::string& encoding)
+    {
+        constexpr size_t n = sizeof(all_windows_encodings) / sizeof(all_windows_encodings[0]);
+        windows_encoding* begin = all_windows_encodings;
+        windows_encoding* end = all_windows_encodings + n;
+
+        windows_encoding* ptr = std::lower_bound(begin, end, encoding.c_str());
+        while(ptr != end && ptr->name == encoding) {
+            if(ptr->was_tested)
+                return ptr->codepage;
+            else if(IsValidCodePage(ptr->codepage)) {
+                // the thread safety is not an issue, maximum
+                // it would be checked more then once
+                ptr->was_tested = 1;
+                return ptr->codepage;
+            } else
+                ++ptr;
+        }
+        return -1;
+    }
+
+    int encoding_to_windows_codepage(const char* encoding)
+    {
+        return normalized_encoding_to_windows_codepage(normalize_encoding(encoding));
+    }
+
+    int encoding_to_windows_codepage(const std::string& encoding)
+    {
+        return normalized_encoding_to_windows_codepage(normalize_encoding(encoding));
+    }
+
+#endif
+}}} // namespace boost::locale::util

externals/boost/libs/locale/src/boost/locale/util/encoding.hpp

@@ -0,0 +1,55 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2022-2023 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_UTIL_ENCODING_HPP
+#define BOOST_LOCALE_UTIL_ENCODING_HPP
+
+#include <boost/locale/config.hpp>
+#include <cstdint>
+#include <string>
+
+namespace boost { namespace locale { namespace util {
+
+    /// Get the UTF encoding name of the given \a CharType
+    template<typename CharType>
+    const char* utf_name()
+    {
+        constexpr auto CharSize = sizeof(CharType);
+        static_assert(CharSize == 1 || CharSize == 2 || CharSize == 4, "Unknown Character Encoding");
+        switch(CharSize) {
+            case 1: return "UTF-8";
+            case 2: {
+                const int16_t endianMark = 1;
+                const bool isLittleEndian = reinterpret_cast<const char*>(&endianMark)[0] == 1;
+                return isLittleEndian ? "UTF-16LE" : "UTF-16BE";
+            }
+            case 4: {
+                const int32_t endianMark = 1;
+                const bool isLittleEndian = reinterpret_cast<const char*>(&endianMark)[0] == 1;
+                return isLittleEndian ? "UTF-32LE" : "UTF-32BE";
+            }
+        }
+        BOOST_UNREACHABLE_RETURN("Unknown UTF");
+    }
+
+    /// Make encoding lowercase and remove all non-alphanumeric characters
+    BOOST_LOCALE_DECL std::string normalize_encoding(const std::string& encoding);
+    BOOST_LOCALE_DECL std::string normalize_encoding(const char* encoding);
+    /// True if the normalized encodings are equal
+    inline bool are_encodings_equal(const std::string& l, const std::string& r)
+    {
+        return normalize_encoding(l) == normalize_encoding(r);
+    }
+
+#if BOOST_LOCALE_USE_WIN32_API
+    int encoding_to_windows_codepage(const char* encoding);
+    int encoding_to_windows_codepage(const std::string& encoding);
+#endif
+
+}}} // namespace boost::locale::util
+
+#endif

externals/boost/libs/locale/src/boost/locale/util/gregorian.cpp

@@ -0,0 +1,716 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include "boost/locale/util/gregorian.hpp"
+#include <boost/locale/date_time.hpp>
+#include <boost/locale/date_time_facet.hpp>
+#include <boost/locale/hold_ptr.hpp>
+#include "boost/locale/util/timezone.hpp"
+#include <boost/assert.hpp>
+#include <algorithm>
+#include <cstdlib>
+#include <ctime>
+#include <ios>
+#include <limits>
+#include <locale>
+#include <memory>
+#include <string>
+
+namespace boost { namespace locale { namespace util {
+    namespace {
+
+        int is_leap(int year)
+        {
+            if(year % 400 == 0)
+                return 1;
+            if(year % 100 == 0)
+                return 0;
+            if(year % 4 == 0)
+                return 1;
+            return 0;
+        }
+
+        int days_in_month(int year, int month)
+        {
+            constexpr int tbl[2][12] = {{31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31},
+                                        {31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31}};
+            return tbl[is_leap(year)][month - 1];
+        }
+
+        constexpr int days_from_0_impl(int year_m1)
+        {
+            return 365 * year_m1 + (year_m1 / 400) - (year_m1 / 100) + (year_m1 / 4);
+        }
+        constexpr int days_from_0(int year)
+        {
+            return days_from_0_impl(year - 1);
+        }
+
+        constexpr int days_from_0_to_1970 = days_from_0(1970);
+        constexpr int days_from_1970(int year)
+        {
+            return days_from_0(year) - days_from_0_to_1970;
+        }
+
+        int days_from_1jan(int year, int month, int day)
+        {
+            constexpr int days[2][12] = {{0, 31, 59, 90, 120, 151, 181, 212, 243, 273, 304, 334},
+                                         {0, 31, 60, 91, 121, 152, 182, 213, 244, 274, 305, 335}};
+            return days[is_leap(year)][month - 1] + day - 1;
+        }
+
+        std::time_t internal_timegm(const std::tm* t)
+        {
+            int year = t->tm_year + 1900;
+            int month = t->tm_mon;
+            if(month > 11) {
+                year += month / 12;
+                month %= 12;
+            } else if(month < 0) {
+                int years_diff = (-month + 11) / 12;
+                year -= years_diff;
+                month += 12 * years_diff;
+            }
+            month++;
+            int day = t->tm_mday;
+            int day_of_year = days_from_1jan(year, month, day);
+            int days_since_epoch = days_from_1970(year) + day_of_year;
+
+            std::time_t seconds_in_day = 3600 * 24;
+            std::time_t result = seconds_in_day * days_since_epoch + 3600 * t->tm_hour + 60 * t->tm_min + t->tm_sec;
+
+            return result;
+        }
+
+    } // namespace
+
+    namespace {
+
+        // Locale dependent data
+
+        bool comparator(const char* left, const char* right)
+        {
+            return strcmp(left, right) < 0;
+        }
+
+        // Ref: CLDR 1.9 common/supplemental/supplementalData.xml
+        //
+        // monday - default
+        // fri - MV
+        // sat - AE AF BH DJ DZ EG ER ET IQ IR JO KE KW LY MA OM QA SA SD SO SY TN YE
+        // sun - AR AS AZ BW CA CN FO GE GL GU HK IL IN JM JP KG KR LA MH MN MO MP MT NZ PH PK SG TH TT TW UM US UZ VI
+        // ZW
+
+        int first_day_of_week(const char* terr)
+        {
+            constexpr const char* sat[] = {"AE", "AF", "BH", "DJ", "DZ", "EG", "ER", "ET", "IQ", "IR", "JO", "KE",
+                                           "KW", "LY", "MA", "OM", "QA", "SA", "SD", "SO", "SY", "TN", "YE"};
+            constexpr const char* sunday[] = {"AR", "AS", "AZ", "BW", "CA", "CN", "FO", "GE", "GL", "GU", "HK", "IL",
+                                              "IN", "JM", "JP", "KG", "KR", "LA", "MH", "MN", "MO", "MP", "MT", "NZ",
+                                              "PH", "PK", "SG", "TH", "TT", "TW", "UM", "US", "UZ", "VI", "ZW"};
+            if(strcmp(terr, "MV") == 0)
+                return 5; // fri
+            if(std::binary_search<const char* const*>(sat, sat + sizeof(sat) / (sizeof(sat[0])), terr, comparator))
+                return 6; // sat
+            if(std::binary_search<const char* const*>(sunday,
+                                                      sunday + sizeof(sunday) / (sizeof(sunday[0])),
+                                                      terr,
+                                                      comparator))
+                return 0; // sun
+            // default
+            return 1; // mon
+        }
+    } // namespace
+
+    class gregorian_calendar : public abstract_calendar {
+    public:
+        gregorian_calendar(const std::string& terr)
+        {
+            first_day_of_week_ = first_day_of_week(terr.c_str());
+            time_ = std::time(0);
+            is_local_ = true;
+            tzoff_ = 0;
+            from_time(time_);
+        }
+
+        /// Make a polymorphic copy of the calendar
+        gregorian_calendar* clone() const override { return new gregorian_calendar(*this); }
+
+        /// Set specific \a value for period \a p, note not all values are settable.
+        void set_value(period::marks::period_mark m, int value) override
+        {
+            using namespace period::marks;
+            switch(m) {
+                case era: ///< Era i.e. AC, BC in Gregorian and Julian calendar, range [0,1]
+                    return;
+                case year:          ///< Year, it is calendar specific
+                case extended_year: ///< Extended year for Gregorian/Julian calendars, where 1 BC == 0, 2 BC == -1.
+                    tm_updated_.tm_year = value - 1900;
+                    break;
+                case month: tm_updated_.tm_mon = value; break;
+                case day: tm_updated_.tm_mday = value; break;
+                case hour: ///< 24 clock hour [0..23]
+                    tm_updated_.tm_hour = value;
+                    break;
+                case hour_12: ///< 12 clock hour [0..11]
+                    tm_updated_.tm_hour = tm_updated_.tm_hour / 12 * 12 + value;
+                    break;
+                case am_pm: ///< am or pm marker, [0..1]
+                    tm_updated_.tm_hour = 12 * value + tm_updated_.tm_hour % 12;
+                    break;
+                case minute: ///< minute [0..59]
+                    tm_updated_.tm_min = value;
+                    break;
+                case second: tm_updated_.tm_sec = value; break;
+                case day_of_year:
+                    normalize();
+                    tm_updated_.tm_mday += (value - (tm_updated_.tm_yday + 1));
+                    break;
+                case day_of_week: ///< Day of week, starting from Sunday, [1..7]
+                    if(value < 1) // make sure it is positive
+                        value += (-value / 7) * 7 + 7;
+                    // convert to local DOW
+                    value = (value - 1 - first_day_of_week_ + 14) % 7 + 1;
+                    BOOST_FALLTHROUGH;
+                case day_of_week_local: ///< Local day of week, for example in France Monday is 1, in US Sunday is 1,
+                                        ///< [1..7]
+                    normalize();
+                    tm_updated_.tm_mday += (value - 1) - (tm_updated_.tm_wday - first_day_of_week_ + 7) % 7;
+                    break;
+                case day_of_week_in_month: ///< Original number of the day of the week in month. (1st sunday, 2nd sunday
+                                           ///< etc)
+                case week_of_year:  ///< The week number in the year, 4 is the minimal number of days to be in month
+                case week_of_month: ///< The week number within current month
+                {
+                    normalize();
+                    int current_week = get_value(m, current);
+                    int diff = 7 * (value - current_week);
+                    tm_updated_.tm_mday += diff;
+                } break;
+                case period::marks::first_day_of_week: ///< For example Sunday in US, Monday in France
+                case invalid: return;
+            }
+            normalized_ = false;
+        }
+
+        void normalize() override
+        {
+            if(!normalized_) {
+                std::tm val = tm_updated_;
+                val.tm_isdst = -1;
+                val.tm_wday = -1; // indicator of error
+                std::time_t point = -1;
+                if(is_local_) {
+                    point = std::mktime(&val);
+                    if(point == static_cast<std::time_t>(-1)) {
+#ifndef BOOST_WINDOWS
+                        // windows does not handle negative time_t, under other plaforms
+                        // it may be actually valid value in  1969-12-31 23:59:59
+                        // so we check that a filed was updated - does not happen in case of error
+                        if(val.tm_wday == -1)
+#endif
+                        {
+                            throw date_time_error("boost::locale::gregorian_calendar: invalid time");
+                        }
+                    }
+                } else {
+                    point = internal_timegm(&val);
+#ifdef BOOST_WINDOWS
+                    // Windows uses TLS, thread safe
+                    std::tm* revert_point = 0;
+                    if(point < 0 || (revert_point = gmtime(&point)) == 0)
+                        throw date_time_error("boost::locale::gregorian_calendar time is out of range");
+                    val = *revert_point;
+#else
+                    if(!gmtime_r(&point, &val))
+                        throw date_time_error("boost::locale::gregorian_calendar invalid time");
+#endif
+                }
+
+                time_ = point - tzoff_;
+                tm_ = val;
+                tm_updated_ = val;
+                normalized_ = true;
+            }
+        }
+
+        int get_week_number(int day, int wday) const
+        {
+            /// This is the number of days that are considered within
+            /// period such that the week belongs there
+            constexpr int days_in_full_week = 4;
+
+            // Always use local week start
+            int current_dow = (wday - first_day_of_week_ + 7) % 7;
+            // Calculate local week day of Jan 1st.
+            int first_week_day = (current_dow + 700 - day) % 7;
+            // adding something big dividable by 7
+
+            int start_of_period_in_weeks;
+            if(first_week_day < days_in_full_week) {
+                start_of_period_in_weeks = -first_week_day;
+            } else {
+                start_of_period_in_weeks = 7 - first_week_day;
+            }
+            int week_number_in_days = day - start_of_period_in_weeks;
+            if(week_number_in_days < 0)
+                return -1;
+            return week_number_in_days / 7 + 1;
+        }
+
+        /// Get specific value for period \a p according to a value_type \a v
+        int get_value(period::marks::period_mark m, value_type v) const override
+        {
+            using namespace period::marks;
+            switch(m) {
+                case era: return 1;
+                case year:
+                case extended_year:
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum:
+#ifdef BOOST_WINDOWS
+                            return 1970; // Unix epoch windows can't handle negative time_t
+#else
+                            if(sizeof(std::time_t) == 4)
+                                return 1901; // minimal year with 32 bit time_t
+                            else
+                                return 1;
+#endif
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum:
+                            BOOST_LOCALE_START_CONST_CONDITION
+                            if(sizeof(std::time_t) == 4)
+                                return 2038; // Y2K38 - maximal with 32 bit time_t
+                            else
+                                return std::numeric_limits<int>::max()
+                                       / 365; // Reasonably large but we can still get the days without overflowing
+                            BOOST_LOCALE_END_CONST_CONDITION
+                        case current: return tm_.tm_year + 1900;
+                    };
+                    break;
+                case month:
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 0;
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum: return 11;
+                        case current: return tm_.tm_mon;
+                    };
+                    break;
+                case day:
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 1;
+                        case absolute_maximum: return 31;
+                        case least_maximum: return 28;
+                        case actual_maximum: return days_in_month(tm_.tm_year + 1900, tm_.tm_mon + 1);
+                        case current: return tm_.tm_mday;
+                    };
+                    break;
+                case day_of_year: ///< The number of day in year, starting from 1
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 1;
+                        case absolute_maximum: return 366;
+                        case least_maximum: return 365;
+                        case actual_maximum: return is_leap(tm_.tm_year + 1900) ? 366 : 365;
+                        case current: return tm_.tm_yday + 1;
+                    }
+                    break;
+                case day_of_week: ///< Day of week, starting from Sunday, [1..7]
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 1;
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum: return 7;
+                        case current: return tm_.tm_wday + 1;
+                    }
+                    break;
+                case day_of_week_local: ///< Local day of week, for example in France Monday is 1, in US Sunday is 1,
+                                        ///< [1..7]
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 1;
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum: return 7;
+                        case current: return (tm_.tm_wday - first_day_of_week_ + 7) % 7 + 1;
+                    }
+                    break;
+                case hour: ///< 24 clock hour [0..23]
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 0;
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum: return 23;
+                        case current: return tm_.tm_hour;
+                    }
+                    break;
+                case hour_12: ///< 12 clock hour [0..11]
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 0;
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum: return 11;
+                        case current: return tm_.tm_hour % 12;
+                    }
+                    break;
+                case am_pm: ///< am or pm marker, [0..1]
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 0;
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum: return 1;
+                        case current: return tm_.tm_hour >= 12 ? 1 : 0;
+                    }
+                    break;
+                case minute: ///< minute [0..59]
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 0;
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum: return 59;
+                        case current: return tm_.tm_min;
+                    }
+                    break;
+                case second: ///< second [0..59]
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 0;
+                        case absolute_maximum:
+                        case least_maximum:
+                        case actual_maximum: return 59;
+                        case current: return tm_.tm_sec;
+                    }
+                    break;
+                case period::marks::first_day_of_week: ///< For example Sunday in US, Monday in France
+                    return first_day_of_week_ + 1;
+
+                case week_of_year: ///< The week number in the year
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 1;
+                        case absolute_maximum: return 53;
+                        case least_maximum: return 52;
+                        case actual_maximum: {
+                            int year = tm_.tm_year + 1900;
+                            int end_of_year_days = (is_leap(year) ? 366 : 365) - 1;
+                            int dow_of_end_of_year = (end_of_year_days - tm_.tm_yday + tm_.tm_wday) % 7;
+                            return get_week_number(end_of_year_days, dow_of_end_of_year);
+                        }
+                        case current: {
+                            int val = get_week_number(tm_.tm_yday, tm_.tm_wday);
+                            if(val < 0)
+                                return 53;
+                            return val;
+                        }
+                    }
+                    break;
+                case week_of_month: ///< The week number within current month
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 1;
+                        case absolute_maximum: return 5;
+                        case least_maximum: return 4;
+                        case actual_maximum: {
+                            int end_of_month_days = days_in_month(tm_.tm_year + 1900, tm_.tm_mon + 1);
+                            int dow_of_end_of_month = (end_of_month_days - tm_.tm_mday + tm_.tm_wday) % 7;
+                            return get_week_number(end_of_month_days, dow_of_end_of_month);
+                        }
+                        case current: {
+                            int val = get_week_number(tm_.tm_mday, tm_.tm_wday);
+                            if(val < 0)
+                                return 5;
+                            return val;
+                        }
+                    }
+                    break;
+                case day_of_week_in_month: ///< Original number of the day of the week in month.
+                    switch(v) {
+                        case absolute_minimum:
+                        case greatest_minimum:
+                        case actual_minimum: return 1;
+                        case absolute_maximum: return 5;
+                        case least_maximum: return 4;
+                        case actual_maximum:
+                            if(tm_.tm_mon == 1 && !is_leap(tm_.tm_year + 1900)) {
+                                // only february in non leap year is 28 days, the rest
+                                // has more then 4 weeks
+                                return 4;
+                            }
+                            return 5;
+                        case current: return (tm_.tm_mday - 1) / 7 + 1;
+                    }
+                    break;
+                case invalid: BOOST_ASSERT_MSG(false, "Shouldn't use 'invalid' value."); break;
+            }
+            return 0;
+        }
+
+        /// Set current time point
+        void set_time(const posix_time& p) override
+        {
+            from_time(static_cast<std::time_t>(p.seconds));
+        }
+        posix_time get_time() const override
+        {
+            posix_time pt = {time_, 0};
+            return pt;
+        }
+        double get_time_ms() const override
+        {
+            return time_ * 1e3;
+        }
+
+        /// Set option for calendar, for future use
+        void set_option(calendar_option_type opt, int /*v*/) override
+        {
+            switch(opt) {
+                case is_gregorian: throw date_time_error("is_gregorian is not settable options for calendar");
+                case is_dst: throw date_time_error("is_dst is not settable options for calendar");
+            }
+        }
+        /// Get option for calendar, currently only check if it is Gregorian calendar
+        int get_option(calendar_option_type opt) const override
+        {
+            switch(opt) {
+                case is_gregorian: return 1;
+                case is_dst: return tm_.tm_isdst == 1;
+            }
+            return 0;
+        }
+
+        /// Adjust period's \a p value by \a difference items using a update_type \a u.
+        /// Note: not all values are adjustable
+        void adjust_value(period::marks::period_mark m, update_type u, int difference) override
+        {
+            switch(u) {
+                case move: {
+                    using namespace period::marks;
+                    switch(m) {
+                        case year:          ///< Year, it is calendar specific
+                        case extended_year: ///< Extended year for Gregorian/Julian calendars, where 1 BC == 0, 2 BC ==
+                                            ///< -1.
+                            tm_updated_.tm_year += difference;
+                            break;
+                        case month: tm_updated_.tm_mon += difference; break;
+                        case day:
+                        case day_of_year:
+                        case day_of_week:       ///< Day of week, starting from Sunday, [1..7]
+                        case day_of_week_local: ///< Local day of week, for example in France Monday is 1, in US Sunday
+                                                ///< is 1, [1..7]
+                            tm_updated_.tm_mday += difference;
+                            break;
+                        case hour:    ///< 24 clock hour [0..23]
+                        case hour_12: ///< 12 clock hour [0..11]
+                            tm_updated_.tm_hour += difference;
+                            break;
+                        case am_pm: ///< am or pm marker, [0..1]
+                            tm_updated_.tm_hour += 12 * difference;
+                            break;
+                        case minute: ///< minute [0..59]
+                            tm_updated_.tm_min += difference;
+                            break;
+                        case second: tm_updated_.tm_sec += difference; break;
+                        case week_of_year:         ///< The week number in the year
+                        case week_of_month:        ///< The week number within current month
+                        case day_of_week_in_month: ///< Original number of the day of the week in month.
+                            tm_updated_.tm_mday += difference * 7;
+                            break;
+                        case era:
+                        case period::marks::first_day_of_week:
+                        case invalid: break; // Not adjustable and ignored
+                    }
+                    normalized_ = false;
+                    normalize();
+                } break;
+                case roll: {
+                    const int cur_min = get_value(m, actual_minimum);
+                    const int cur_max = get_value(m, actual_maximum);
+                    BOOST_ASSERT(cur_max >= cur_min);
+                    const int range = cur_max - cur_min + 1;
+                    int value = get_value(m, current) - cur_min;
+                    BOOST_ASSERT(value >= 0 && value < range);
+                    BOOST_ASSERT_MSG(difference <= std::numeric_limits<int>::max(), "Input is to large");
+                    value = (value + difference) % range;
+                    // If the sum above was negative the result of the modulo operation "can" be negative too.
+                    if(value < 0)
+                        value += range;
+                    BOOST_ASSERT(value >= 0 && value < range);
+                    set_value(m, value + cur_min);
+                    normalize();
+                }
+            }
+        }
+
+        int get_diff(period::marks::period_mark m, int diff, const gregorian_calendar* other) const
+        {
+            if(diff == 0)
+                return 0;
+            hold_ptr<gregorian_calendar> self(clone());
+            self->adjust_value(m, move, diff);
+            if(diff > 0) {
+                if(self->time_ > other->time_)
+                    return diff - 1;
+                else
+                    return diff;
+            } else {
+                if(self->time_ < other->time_)
+                    return diff + 1;
+                else
+                    return diff;
+            }
+        }
+
+        /// Calculate the difference between this calendar  and \a other in \a p units
+        int difference(const abstract_calendar& other_cal, period::marks::period_mark m) const override
+        {
+            hold_ptr<gregorian_calendar> keeper;
+            const gregorian_calendar* other = dynamic_cast<const gregorian_calendar*>(&other_cal);
+            if(!other) {
+                keeper.reset(clone());
+                keeper->set_time(other_cal.get_time());
+                other = keeper.get();
+            }
+
+            int factor = 1; // for weeks vs days handling
+
+            using namespace period::marks;
+            switch(m) {
+                case era: return 0;
+                case year:
+                case extended_year: {
+                    int diff = other->tm_.tm_year - tm_.tm_year;
+                    return get_diff(period::marks::year, diff, other);
+                }
+                case month: {
+                    int diff = 12 * (other->tm_.tm_year - tm_.tm_year) + other->tm_.tm_mon - tm_.tm_mon;
+                    return get_diff(period::marks::month, diff, other);
+                }
+                case day_of_week_in_month:
+                case week_of_month:
+                case week_of_year: factor = 7; BOOST_FALLTHROUGH;
+                case day:
+                case day_of_year:
+                case day_of_week:
+                case day_of_week_local: {
+                    int diff = other->tm_.tm_yday - tm_.tm_yday;
+                    if(other->tm_.tm_year != tm_.tm_year) {
+                        diff += days_from_0(other->tm_.tm_year + 1900) - days_from_0(tm_.tm_year + 1900);
+                    }
+                    return get_diff(period::marks::day, diff, other) / factor;
+                }
+                case am_pm: return static_cast<int>((other->time_ - time_) / (3600 * 12));
+                case hour:
+                case hour_12: return static_cast<int>((other->time_ - time_) / 3600);
+                case minute: return static_cast<int>((other->time_ - time_) / 60);
+                case second: return static_cast<int>(other->time_ - time_);
+                case invalid:
+                case period::marks::first_day_of_week: break; // Not adjustable
+            }
+            return 0;
+        }
+
+        /// Set time zone, empty - use system
+        void set_timezone(const std::string& tz) override
+        {
+            if(tz.empty()) {
+                is_local_ = true;
+                tzoff_ = 0;
+            } else {
+                is_local_ = false;
+                tzoff_ = parse_tz(tz);
+            }
+            from_time(time_);
+            time_zone_name_ = tz;
+        }
+        std::string get_timezone() const override
+        {
+            return time_zone_name_;
+        }
+
+        bool same(const abstract_calendar* other) const override
+        {
+            const gregorian_calendar* gcal = dynamic_cast<const gregorian_calendar*>(other);
+            if(!gcal)
+                return false;
+            return gcal->tzoff_ == tzoff_ && gcal->is_local_ == is_local_
+                   && gcal->first_day_of_week_ == first_day_of_week_;
+        }
+
+    private:
+        void from_time(std::time_t point)
+        {
+            std::time_t real_point = point + tzoff_;
+            std::tm* t = 0;
+#ifdef BOOST_WINDOWS
+            // Windows uses TLS, thread safe
+            t = is_local_ ? localtime(&real_point) : gmtime(&real_point);
+#else
+            std::tm tmp_tm;
+            t = is_local_ ? localtime_r(&real_point, &tmp_tm) : gmtime_r(&real_point, &tmp_tm);
+#endif
+            if(!t) {
+                throw date_time_error("boost::locale::gregorian_calendar: invalid time point");
+            }
+            tm_ = *t;
+            tm_updated_ = *t;
+            normalized_ = true;
+            time_ = point;
+        }
+        int first_day_of_week_;
+        std::time_t time_;
+        std::tm tm_;
+        std::tm tm_updated_;
+        bool normalized_;
+        bool is_local_;
+        int tzoff_;
+        std::string time_zone_name_;
+    };
+
+    abstract_calendar* create_gregorian_calendar(const std::string& terr)
+    {
+        return new gregorian_calendar(terr);
+    }
+
+    class gregorian_facet : public calendar_facet {
+    public:
+        gregorian_facet(const std::string& terr, size_t refs = 0) : calendar_facet(refs), terr_(terr) {}
+        abstract_calendar* create_calendar() const override { return create_gregorian_calendar(terr_); }
+
+    private:
+        std::string terr_;
+    };
+
+    std::locale install_gregorian_calendar(const std::locale& in, const std::string& terr)
+    {
+        return std::locale(in, new gregorian_facet(terr));
+    }
+
+}}} // namespace boost::locale::util
+
+// boostinspect:nominmax

externals/boost/libs/locale/src/boost/locale/util/gregorian.hpp

@@ -0,0 +1,18 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_SRC_UTIL_GREGORIAN_HPP
+#define BOOST_LOCALE_SRC_UTIL_GREGORIAN_HPP
+
+#include <locale>
+
+namespace boost { namespace locale { namespace util {
+
+    std::locale install_gregorian_calendar(const std::locale& in, const std::string& terr);
+
+}}} // namespace boost::locale::util
+
+#endif

externals/boost/libs/locale/src/boost/locale/util/iconv.hpp

@@ -0,0 +1,92 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_ICONV_FIXER_HPP
+#define BOOST_LOCALE_ICONV_FIXER_HPP
+
+#include <boost/core/exchange.hpp>
+#include <iconv.h>
+
+namespace boost { namespace locale {
+    class iconv_handle {
+        iconv_t h_;
+        void close()
+        {
+            if(*this)
+                iconv_close(h_);
+        }
+
+    public:
+        iconv_handle(iconv_t h = iconv_t(-1)) : h_(h) {}
+        iconv_handle(iconv_handle&& rhs) noexcept : h_(exchange(rhs.h_, iconv_t(-1))) {}
+        iconv_handle& operator=(iconv_handle&& rhs) noexcept
+        {
+            h_ = exchange(rhs.h_, iconv_t(-1));
+            return *this;
+        }
+        iconv_handle& operator=(iconv_t h)
+        {
+            close();
+            h_ = h;
+            return *this;
+        }
+        ~iconv_handle() { close(); }
+
+        operator iconv_t() const { return h_; }
+        explicit operator bool() const { return h_ != iconv_t(-1); }
+    };
+
+    extern "C" {
+#if defined(__ICONV_F_HIDE_INVALID) && defined(__FreeBSD__)
+#    define BOOST_LOCALE_ICONV_FUNC __iconv
+#    define BOOST_LOCALE_ICONV_FLAGS , __ICONV_F_HIDE_INVALID, 0
+
+    // GNU variant
+    typedef size_t (*const_iconv_ptr_type)(iconv_t, const char**, size_t*, char**, size_t*, uint32_t, size_t*);
+    // POSIX variant
+    typedef size_t (*nonconst_iconv_ptr_type)(iconv_t, char**, size_t*, char**, size_t*, uint32_t, size_t*);
+#else
+#    define BOOST_LOCALE_ICONV_FUNC iconv
+#    define BOOST_LOCALE_ICONV_FLAGS
+
+    typedef size_t (*const_iconv_ptr_type)(iconv_t, const char**, size_t*, char**, size_t*);
+    typedef size_t (*nonconst_iconv_ptr_type)(iconv_t, char**, size_t*, char**, size_t*);
+#endif
+    }
+
+    inline size_t
+    call_iconv_impl(const_iconv_ptr_type ptr, iconv_t d, const char** in, size_t* insize, char** out, size_t* outsize)
+    {
+        return ptr(d, in, insize, out, outsize BOOST_LOCALE_ICONV_FLAGS);
+    }
+    inline size_t call_iconv_impl(nonconst_iconv_ptr_type ptr,
+                                  iconv_t d,
+                                  const char** in,
+                                  size_t* insize,
+                                  char** out,
+                                  size_t* outsize)
+    {
+        return ptr(d, const_cast<char**>(in), insize, out, outsize BOOST_LOCALE_ICONV_FLAGS);
+    }
+
+    inline size_t call_iconv(iconv_t d, const char** in, size_t* insize, char** out, size_t* outsize)
+    {
+        return call_iconv_impl(BOOST_LOCALE_ICONV_FUNC, d, in, insize, out, outsize);
+    }
+
+    // Convenience overload when the adjusted in/out ptrs are not required
+    inline size_t call_iconv(iconv_t d, const char* in, size_t* insize, char* out, size_t* outsize)
+    {
+        return call_iconv(d, &in, insize, &out, outsize);
+    }
+    // Disambiguation
+    inline size_t call_iconv(iconv_t d, std::nullptr_t, std::nullptr_t, std::nullptr_t, std::nullptr_t)
+    {
+        return call_iconv_impl(BOOST_LOCALE_ICONV_FUNC, d, nullptr, nullptr, nullptr, nullptr);
+    }
+}} // namespace boost::locale
+
+#endif

externals/boost/libs/locale/src/boost/locale/util/info.cpp

@@ -0,0 +1,52 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/generator.hpp>
+#include <boost/locale/info.hpp>
+#include <boost/locale/util.hpp>
+#include <boost/locale/util/locale_data.hpp>
+#include <cstdlib>
+#include <ios>
+#include <locale>
+#include <sstream>
+#include <string>
+
+namespace boost { namespace locale { namespace util {
+
+    class simple_info : public info {
+    public:
+        simple_info(const std::string& name, size_t refs = 0) : info(refs), name_(name) { d.parse(name); }
+        std::string get_string_property(string_propery v) const override
+        {
+            switch(v) {
+                case language_property: return d.language();
+                case country_property: return d.country();
+                case variant_property: return d.variant();
+                case encoding_property: return d.encoding();
+                case name_property: return name_;
+            }
+            return "";
+        }
+
+        int get_integer_property(integer_property v) const override
+        {
+            switch(v) {
+                case utf8_property: return d.is_utf8();
+            }
+            return 0;
+        }
+
+    private:
+        locale_data d;
+        std::string name_;
+    };
+
+    std::locale create_info(const std::locale& in, const std::string& name)
+    {
+        return std::locale(in, new simple_info(name));
+    }
+
+}}} // namespace boost::locale::util

externals/boost/libs/locale/src/boost/locale/util/locale_data.cpp

@@ -0,0 +1,160 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+// Copyright (c) 2022-2023 Alexander Grund
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/util/locale_data.hpp>
+#include "boost/locale/encoding/conv.hpp"
+#include "boost/locale/util/encoding.hpp"
+#include "boost/locale/util/string.hpp"
+#include <boost/assert.hpp>
+#include <algorithm>
+#include <stdexcept>
+#include <string>
+
+namespace boost { namespace locale { namespace util {
+    locale_data::locale_data()
+    {
+        reset();
+    }
+
+    locale_data::locale_data(const std::string& locale_name)
+    {
+        if(!parse(locale_name))
+            throw std::invalid_argument("Failed to parse locale name: " + locale_name);
+    }
+
+    void locale_data::reset()
+    {
+        language_ = "C";
+        country_.clear();
+        encoding_ = "US-ASCII";
+        variant_.clear();
+        utf8_ = false;
+    }
+
+    std::string locale_data::to_string() const
+    {
+        std::string result = language_;
+        if(!country_.empty())
+            (result += '_') += country_;
+        if(!encoding_.empty() && !util::are_encodings_equal(encoding_, "US-ASCII"))
+            (result += '.') += encoding_;
+        if(!variant_.empty())
+            (result += '@') += variant_;
+        return result;
+    }
+
+    bool locale_data::parse(const std::string& locale_name)
+    {
+        reset();
+        return parse_from_lang(locale_name);
+    }
+
+    bool locale_data::parse_from_lang(const std::string& input)
+    {
+        const auto end = input.find_first_of("-_@.");
+        std::string tmp = input.substr(0, end);
+        if(tmp.empty())
+            return false;
+        // lowercase ASCII
+        for(char& c : tmp) {
+            if(is_upper_ascii(c))
+                c += 'a' - 'A';
+            else if(!is_lower_ascii(c))
+                return false;
+        }
+        if(tmp != "c" && tmp != "posix") // Keep default
+            language_ = tmp;
+
+        if(end >= input.size())
+            return true;
+        else if(input[end] == '-' || input[end] == '_')
+            return parse_from_country(input.substr(end + 1));
+        else if(input[end] == '.')
+            return parse_from_encoding(input.substr(end + 1));
+        else {
+            BOOST_ASSERT_MSG(input[end] == '@', "Unexpected delimiter");
+            return parse_from_variant(input.substr(end + 1));
+        }
+    }
+
+    bool locale_data::parse_from_country(const std::string& input)
+    {
+        if(language_ == "C")
+            return false;
+
+        const auto end = input.find_first_of("@.");
+        std::string tmp = input.substr(0, end);
+        if(tmp.empty())
+            return false;
+
+        // Make uppercase
+        for(char& c : tmp) {
+            if(util::is_lower_ascii(c))
+                c += 'A' - 'a';
+        }
+        // If it's ALL uppercase ASCII, assume ISO 3166 country id
+        if(std::find_if_not(tmp.begin(), tmp.end(), util::is_upper_ascii) != tmp.end()) {
+            // else handle special cases:
+            //   - en_US_POSIX is an alias for C
+            //   - M49 country code: 3 digits
+            if(language_ == "en" && tmp == "US_POSIX") {
+                language_ = "C";
+                tmp.clear();
+            } else if(tmp.size() != 3u || std::find_if_not(tmp.begin(), tmp.end(), util::is_numeric_ascii) != tmp.end())
+                return false;
+        }
+
+        country_ = tmp;
+        if(end >= input.size())
+            return true;
+        else if(input[end] == '.')
+            return parse_from_encoding(input.substr(end + 1));
+        else {
+            BOOST_ASSERT_MSG(input[end] == '@', "Unexpected delimiter");
+            return parse_from_variant(input.substr(end + 1));
+        }
+    }
+
+    bool locale_data::parse_from_encoding(const std::string& input)
+    {
+        const auto end = input.find_first_of('@');
+        std::string tmp = input.substr(0, end);
+        if(tmp.empty())
+            return false;
+        // No assumptions, but uppercase
+        for(char& c : tmp) {
+            if(util::is_lower_ascii(c))
+                c += 'A' - 'a';
+        }
+        encoding_ = tmp;
+
+        utf8_ = util::normalize_encoding(encoding_) == "utf8";
+
+        if(end >= input.size())
+            return true;
+        else {
+            BOOST_ASSERT_MSG(input[end] == '@', "Unexpected delimiter");
+            return parse_from_variant(input.substr(end + 1));
+        }
+    }
+
+    bool locale_data::parse_from_variant(const std::string& input)
+    {
+        if(language_ == "C")
+            return false;
+        if(input.empty())
+            return false;
+        variant_ = input;
+        // No assumptions, just make it lowercase
+        for(char& c : variant_) {
+            if(util::is_upper_ascii(c))
+                c += 'a' - 'A';
+        }
+        return true;
+    }
+
+}}} // namespace boost::locale::util

externals/boost/libs/locale/src/boost/locale/util/numeric.hpp

@@ -0,0 +1,383 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_UTIL_NUMERIC_HPP
+#define BOOST_LOCALE_IMPL_UTIL_NUMERIC_HPP
+#include <boost/locale/formatting.hpp>
+#include <boost/locale/info.hpp>
+#include <boost/predef/os.h>
+#include <cstdlib>
+#include <ctime>
+#include <ios>
+#include <locale>
+#include <sstream>
+#include <string>
+#include <vector>
+
+#include "boost/locale/util/timezone.hpp"
+
+namespace boost { namespace locale { namespace util {
+
+    template<typename CharType>
+    struct formatting_size_traits {
+        static size_t size(const std::basic_string<CharType>& s, const std::locale& /*l*/) { return s.size(); }
+    };
+
+    template<>
+    struct formatting_size_traits<char> {
+        static size_t size(const std::string& s, const std::locale& l)
+        {
+            if(!std::has_facet<info>(l))
+                return s.size();
+            if(!std::use_facet<info>(l).utf8())
+                return s.size();
+            // count code points, poor man's text size
+            size_t res = 0;
+            for(size_t i = 0; i < s.size(); i++) {
+                unsigned char c = s[i];
+                if(c <= 127)
+                    res++;
+                else if((c & 0xC0) == 0xC0) { // first UTF-8 byte
+                    res++;
+                }
+            }
+            return res;
+        }
+    };
+
+    template<typename CharType>
+    class base_num_format : public std::num_put<CharType> {
+    public:
+        typedef typename std::num_put<CharType>::iter_type iter_type;
+        typedef std::basic_string<CharType> string_type;
+        typedef CharType char_type;
+
+        base_num_format(size_t refs = 0) : std::num_put<CharType>(refs) {}
+
+    protected:
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, long val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, unsigned long val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, double val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, long double val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, long long val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+        iter_type do_put(iter_type out, std::ios_base& ios, char_type fill, unsigned long long val) const override
+        {
+            return do_real_put(out, ios, fill, val);
+        }
+
+    private:
+        template<typename ValueType>
+        iter_type do_real_put(iter_type out, std::ios_base& ios, char_type fill, ValueType val) const
+        {
+            typedef std::num_put<char_type> super;
+
+            ios_info& info = ios_info::get(ios);
+
+            switch(info.display_flags()) {
+                case flags::posix: {
+                    typedef std::basic_ostringstream<char_type> sstream_type;
+                    sstream_type ss;
+                    ss.imbue(std::locale::classic());
+                    ss.flags(ios.flags());
+                    ss.precision(ios.precision());
+                    ss.width(ios.width());
+                    iter_type ret_ptr = super::do_put(out, ss, fill, val);
+                    ios.width(0);
+                    return ret_ptr;
+                }
+                case flags::date: return format_time(out, ios, fill, static_cast<std::time_t>(val), 'x');
+                case flags::time: return format_time(out, ios, fill, static_cast<std::time_t>(val), 'X');
+                case flags::datetime: return format_time(out, ios, fill, static_cast<std::time_t>(val), 'c');
+                case flags::strftime:
+                    return format_time(out,
+                                       ios,
+                                       fill,
+                                       static_cast<std::time_t>(val),
+                                       info.date_time_pattern<char_type>());
+                case flags::currency: {
+                    bool nat = info.currency_flags() == flags::currency_default
+                               || info.currency_flags() == flags::currency_national;
+                    bool intl = !nat;
+                    return do_format_currency(intl, out, ios, fill, static_cast<long double>(val));
+                }
+
+                case flags::number:
+                case flags::percent:
+                case flags::spellout:
+                case flags::ordinal: break;
+            }
+            return super::do_put(out, ios, fill, val);
+        }
+
+        virtual iter_type
+        do_format_currency(bool intl, iter_type out, std::ios_base& ios, char_type fill, long double val) const
+        {
+            if(intl)
+                return format_currency<true>(out, ios, fill, val);
+            else
+                return format_currency<false>(out, ios, fill, val);
+        }
+
+        template<bool intl>
+        iter_type format_currency(iter_type out, std::ios_base& ios, char_type fill, long double val) const
+        {
+            std::locale loc = ios.getloc();
+            int digits = std::use_facet<std::moneypunct<char_type, intl>>(loc).frac_digits();
+            while(digits > 0) {
+                val *= 10;
+                digits--;
+            }
+            std::ios_base::fmtflags f = ios.flags();
+            ios.flags(f | std::ios_base::showbase);
+            out = std::use_facet<std::money_put<char_type>>(loc).put(out, intl, ios, fill, val);
+            ios.flags(f);
+            return out;
+        }
+
+        iter_type format_time(iter_type out, std::ios_base& ios, char_type fill, std::time_t time, char c) const
+        {
+            string_type fmt;
+            fmt += char_type('%');
+            fmt += char_type(c);
+            return format_time(out, ios, fill, time, fmt);
+        }
+
+        iter_type format_time(iter_type out,
+                              std::ios_base& ios,
+                              char_type fill,
+                              std::time_t time,
+                              const string_type& format) const
+        {
+            std::string tz = ios_info::get(ios).time_zone();
+            std::tm tm;
+#if BOOST_OS_LINUX || BOOST_OS_BSD_FREE || defined(__APPLE__)
+            std::vector<char> tmp_buf(tz.c_str(), tz.c_str() + tz.size() + 1);
+#endif
+            if(tz.empty()) {
+#ifdef BOOST_WINDOWS
+                /// Windows uses TLS
+                tm = *localtime(&time);
+#else
+                localtime_r(&time, &tm);
+#endif
+            } else {
+                int gmtoff = parse_tz(tz);
+                time += gmtoff;
+#ifdef BOOST_WINDOWS
+                /// Windows uses TLS
+                tm = *gmtime(&time);
+#else
+                gmtime_r(&time, &tm);
+#endif
+
+#if BOOST_OS_LINUX || BOOST_OS_BSD_FREE || defined(__APPLE__)
+                // These have extra fields to specify timezone
+                if(gmtoff != 0) {
+                    // bsd and apple want tm_zone be non-const
+                    tm.tm_zone = &tmp_buf.front();
+                    tm.tm_gmtoff = gmtoff;
+                }
+#endif
+            }
+            std::basic_ostringstream<char_type> tmp_out;
+            std::use_facet<std::time_put<char_type>>(ios.getloc())
+              .put(tmp_out, tmp_out, fill, &tm, format.c_str(), format.c_str() + format.size());
+            string_type str = tmp_out.str();
+            std::streamsize on_left = 0, on_right = 0;
+            std::streamsize points = formatting_size_traits<char_type>::size(str, ios.getloc());
+            if(points < ios.width()) {
+                std::streamsize n = ios.width() - points;
+
+                std::ios_base::fmtflags flags = ios.flags() & std::ios_base::adjustfield;
+
+                // we do not really know internal point, so we assume that it does not
+                // exist. so according to the standard field should be right aligned
+                if(flags != std::ios_base::left)
+                    on_left = n;
+                on_right = n - on_left;
+            }
+            while(on_left > 0) {
+                *out++ = fill;
+                on_left--;
+            }
+            std::copy(str.begin(), str.end(), out);
+            while(on_right > 0) {
+                *out++ = fill;
+                on_right--;
+            }
+            ios.width(0);
+            return out;
+        }
+
+    }; /// num_format
+
+    template<typename CharType>
+    class base_num_parse : public std::num_get<CharType> {
+    public:
+        base_num_parse(size_t refs = 0) : std::num_get<CharType>(refs) {}
+
+    protected:
+        typedef typename std::num_get<CharType>::iter_type iter_type;
+        typedef std::basic_string<CharType> string_type;
+        typedef CharType char_type;
+
+        iter_type
+        do_get(iter_type in, iter_type end, std::ios_base& ios, std::ios_base::iostate& err, long& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         unsigned short& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         unsigned int& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         unsigned long& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type
+        do_get(iter_type in, iter_type end, std::ios_base& ios, std::ios_base::iostate& err, float& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type
+        do_get(iter_type in, iter_type end, std::ios_base& ios, std::ios_base::iostate& err, double& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         long double& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         long long& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+        iter_type do_get(iter_type in,
+                         iter_type end,
+                         std::ios_base& ios,
+                         std::ios_base::iostate& err,
+                         unsigned long long& val) const override
+        {
+            return do_real_get(in, end, ios, err, val);
+        }
+
+    private:
+        template<typename ValueType>
+        iter_type
+        do_real_get(iter_type in, iter_type end, std::ios_base& ios, std::ios_base::iostate& err, ValueType& val) const
+        {
+            typedef std::num_get<char_type> super;
+
+            ios_info& info = ios_info::get(ios);
+
+            switch(info.display_flags()) {
+                case flags::posix: {
+                    std::stringstream ss;
+                    ss.imbue(std::locale::classic());
+                    ss.flags(ios.flags());
+                    ss.precision(ios.precision());
+                    return super::do_get(in, end, ss, err, val);
+                }
+                case flags::currency: {
+                    long double ret_val = 0;
+                    if(info.currency_flags() == flags::currency_default
+                       || info.currency_flags() == flags::currency_national)
+                        in = parse_currency<false>(in, end, ios, err, ret_val);
+                    else
+                        in = parse_currency<true>(in, end, ios, err, ret_val);
+                    if(!(err & std::ios_base::failbit))
+                        val = static_cast<ValueType>(ret_val);
+                    return in;
+                }
+
+                // date-time parsing is not supported
+                // due to buggy standard
+                case flags::date:
+                case flags::time:
+                case flags::datetime:
+                case flags::strftime:
+
+                case flags::number:
+                case flags::percent:
+                case flags::spellout:
+                case flags::ordinal: break;
+            }
+            return super::do_get(in, end, ios, err, val);
+        }
+
+        template<bool intl>
+        iter_type parse_currency(iter_type in,
+                                 iter_type end,
+                                 std::ios_base& ios,
+                                 std::ios_base::iostate& err,
+                                 long double& val) const
+        {
+            std::locale loc = ios.getloc();
+            int digits = std::use_facet<std::moneypunct<char_type, intl>>(loc).frac_digits();
+            long double rval;
+            in = std::use_facet<std::money_get<char_type>>(loc).get(in, end, intl, ios, err, rval);
+            if(!(err & std::ios::failbit)) {
+                while(digits > 0) {
+                    rval /= 10;
+                    digits--;
+                }
+                val = rval;
+            }
+            return in;
+        }
+    };
+
+}}} // namespace boost::locale::util
+
+#endif

externals/boost/libs/locale/src/boost/locale/util/timezone.hpp

@@ -0,0 +1,47 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_UTIL_TIMEZONE_HPP
+#define BOOST_LOCALE_IMPL_UTIL_TIMEZONE_HPP
+#include <cstdlib>
+#include <cstring>
+#include <string>
+
+namespace boost { namespace locale { namespace util {
+    inline int parse_tz(const std::string& tz)
+    {
+        int gmtoff = 0;
+        std::string ltz;
+        for(unsigned i = 0; i < tz.size(); i++) {
+            if('a' <= tz[i] && tz[i] <= 'z')
+                ltz += tz[i] - 'a' + 'A';
+            else if(tz[i] == ' ')
+                ;
+            else
+                ltz += tz[i];
+        }
+        if(ltz.compare(0, 3, "GMT") != 0 && ltz.compare(0, 3, "UTC") != 0)
+            return 0;
+        if(ltz.size() <= 3)
+            return 0;
+        const char* begin = ltz.c_str() + 3;
+        char* end = 0;
+        int hours = strtol(begin, &end, 10);
+        if(end != begin) {
+            gmtoff += hours * 3600;
+        }
+        if(*end == ':') {
+            begin = end + 1;
+            int minutes = strtol(begin, &end, 10);
+            if(end != begin)
+                gmtoff += minutes * 60;
+        }
+        return gmtoff;
+    }
+
+}}} // namespace boost::locale::util
+
+#endif

externals/boost/libs/locale/src/boost/locale/util/win_codepages.hpp

@@ -0,0 +1,181 @@
+#ifndef BOOST_LOCALE_IMPL_WIN_CODEPAGES_HPP
+#define BOOST_LOCALE_IMPL_WIN_CODEPAGES_HPP
+
+#include <boost/locale/config.hpp>
+#include <cstring>
+
+namespace boost { namespace locale { namespace util {
+
+    struct windows_encoding {
+        const char* name;
+        unsigned codepage;
+        unsigned was_tested;
+    };
+
+    inline bool operator<(const windows_encoding& l, const char* name)
+    {
+        return strcmp(l.name, name) < 0;
+    }
+
+    static windows_encoding all_windows_encodings[] = {
+      {"asmo708", 708, 0},
+      {"big5", 950, 0},
+      {"cp1025", 21025, 0},
+      {"cp1250", 1250, 0},
+      {"cp1251", 1251, 0},
+      {"cp1252", 1252, 0},
+      {"cp1253", 1253, 0},
+      {"cp1254", 1254, 0},
+      {"cp1255", 1255, 0},
+      {"cp1256", 1256, 0},
+      {"cp1257", 1257, 0},
+      {"cp866", 866, 0},
+      {"cp874", 874, 0},
+      {"cp875", 875, 0},
+      {"cp932", 932, 0},
+      {"cp936", 936, 0},
+      {"csiso2022jp", 50221, 0},
+      {"dos720", 720, 0},
+      {"dos862", 862, 0},
+      {"euccn", 51936, 0},
+      {"eucjp", 20932, 0},
+      {"euckr", 51949, 0},
+      {"gb18030", 54936, 0},
+      {"gb2312", 936, 0},
+      {"gbk", 936, 0},
+      {"hzgb2312", 52936, 0},
+      {"ibm00858", 858, 0},
+      {"ibm00924", 20924, 0},
+      {"ibm01026", 1026, 0},
+      {"ibm01047", 1047, 0},
+      {"ibm01140", 1140, 0},
+      {"ibm01141", 1141, 0},
+      {"ibm01142", 1142, 0},
+      {"ibm01143", 1143, 0},
+      {"ibm01144", 1144, 0},
+      {"ibm01145", 1145, 0},
+      {"ibm01146", 1146, 0},
+      {"ibm01147", 1147, 0},
+      {"ibm01148", 1148, 0},
+      {"ibm01149", 1149, 0},
+      {"ibm037", 37, 0},
+      {"ibm273", 20273, 0},
+      {"ibm277", 20277, 0},
+      {"ibm278", 20278, 0},
+      {"ibm280", 20280, 0},
+      {"ibm284", 20284, 0},
+      {"ibm285", 20285, 0},
+      {"ibm290", 20290, 0},
+      {"ibm297", 20297, 0},
+      {"ibm420", 20420, 0},
+      {"ibm423", 20423, 0},
+      {"ibm424", 20424, 0},
+      {"ibm437", 437, 0},
+      {"ibm500", 500, 0},
+      {"ibm737", 737, 0},
+      {"ibm775", 775, 0},
+      {"ibm850", 850, 0},
+      {"ibm852", 852, 0},
+      {"ibm855", 855, 0},
+      {"ibm857", 857, 0},
+      {"ibm860", 860, 0},
+      {"ibm861", 861, 0},
+      {"ibm863", 863, 0},
+      {"ibm864", 864, 0},
+      {"ibm865", 865, 0},
+      {"ibm869", 869, 0},
+      {"ibm870", 870, 0},
+      {"ibm871", 20871, 0},
+      {"ibm880", 20880, 0},
+      {"ibm905", 20905, 0},
+      {"ibmthai", 20838, 0},
+      {"iso2022jp", 50220, 0},
+      {"iso2022jp", 50222, 0},
+      {"iso2022kr", 50225, 0},
+      {"iso88591", 28591, 0},
+      {"iso885913", 28603, 0},
+      {"iso885915", 28605, 0},
+      {"iso88592", 28592, 0},
+      {"iso88593", 28593, 0},
+      {"iso88594", 28594, 0},
+      {"iso88595", 28595, 0},
+      {"iso88596", 28596, 0},
+      {"iso88597", 28597, 0},
+      {"iso88598", 28598, 0},
+      {"iso88598i", 38598, 0},
+      {"iso88599", 28599, 0},
+      {"johab", 1361, 0},
+      {"koi8r", 20866, 0},
+      {"koi8u", 21866, 0},
+      {"ksc56011987", 949, 0},
+      {"latin1", 28591, 0},
+      {"latin1", 1252, 0},
+      {"macintosh", 10000, 0},
+      {"ms936", 936, 0},
+      {"shiftjis", 932, 0},
+      {"sjis", 932, 0},
+      {"unicodefffe", 1201, 0},
+      {"usascii", 20127, 0},
+      {"utf16", 1200, 0},
+      {"utf32", 12000, 0},
+      {"utf32be", 12001, 0},
+      {"utf7", 65000, 0},
+      {"utf8", 65001, 0},
+      {"windows1250", 1250, 0},
+      {"windows1251", 1251, 0},
+      {"windows1252", 1252, 0},
+      {"windows1253", 1253, 0},
+      {"windows1254", 1254, 0},
+      {"windows1255", 1255, 0},
+      {"windows1256", 1256, 0},
+      {"windows1257", 1257, 0},
+      {"windows1258", 1258, 0},
+      {"windows874", 874, 0},
+      {"windows932", 932, 0},
+      {"windows936", 936, 0},
+      {"xchinesecns", 20000, 0},
+      {"xchineseeten", 20002, 0},
+      {"xcp20001", 20001, 0},
+      {"xcp20003", 20003, 0},
+      {"xcp20004", 20004, 0},
+      {"xcp20005", 20005, 0},
+      {"xcp20261", 20261, 0},
+      {"xcp20269", 20269, 0},
+      {"xcp20936", 20936, 0},
+      {"xcp20949", 20949, 0},
+      {"xcp50227", 50227, 0},
+      {"xebcdickoreanextended", 20833, 0},
+      {"xeuropa", 29001, 0},
+      {"xia5", 20105, 0},
+      {"xia5german", 20106, 0},
+      {"xia5norwegian", 20108, 0},
+      {"xia5swedish", 20107, 0},
+      {"xisciias", 57006, 0},
+      {"xisciibe", 57003, 0},
+      {"xisciide", 57002, 0},
+      {"xisciigu", 57010, 0},
+      {"xisciika", 57008, 0},
+      {"xisciima", 57009, 0},
+      {"xisciior", 57007, 0},
+      {"xisciipa", 57011, 0},
+      {"xisciita", 57004, 0},
+      {"xisciite", 57005, 0},
+      {"xmacarabic", 10004, 0},
+      {"xmacce", 10029, 0},
+      {"xmacchinesesimp", 10008, 0},
+      {"xmacchinesetrad", 10002, 0},
+      {"xmaccroatian", 10082, 0},
+      {"xmaccyrillic", 10007, 0},
+      {"xmacgreek", 10006, 0},
+      {"xmachebrew", 10005, 0},
+      {"xmacicelandic", 10079, 0},
+      {"xmacjapanese", 10001, 0},
+      {"xmackorean", 10003, 0},
+      {"xmacromanian", 10010, 0},
+      {"xmacthai", 10021, 0},
+      {"xmacturkish", 10081, 0},
+      {"xmacukrainian", 10017, 0},
+    };
+}}} // namespace boost::locale::util
+
+#endif

externals/boost/libs/locale/src/boost/locale/win32/all_generator.hpp

@@ -0,0 +1,29 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_WIN32_ALL_GENERATOR_HPP
+#define BOOST_LOCALE_IMPL_WIN32_ALL_GENERATOR_HPP
+
+#include <boost/locale/generator.hpp>
+#include <locale>
+
+namespace boost { namespace locale { namespace impl_win {
+
+    class winlocale;
+
+    std::locale create_convert(const std::locale& in, const winlocale& lc, char_facet_t type);
+
+    std::locale create_collate(const std::locale& in, const winlocale& lc, char_facet_t type);
+
+    std::locale create_formatting(const std::locale& in, const winlocale& lc, char_facet_t type);
+
+    std::locale create_parsing(const std::locale& in, const winlocale& lc, char_facet_t type);
+
+    std::locale create_codecvt(const std::locale& in, char_facet_t type);
+
+}}} // namespace boost::locale::impl_win
+
+#endif

externals/boost/libs/locale/src/boost/locale/win32/api.hpp

@@ -0,0 +1,324 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#ifndef BOOST_LOCALE_IMPL_WIN32_API_HPP
+#define BOOST_LOCALE_IMPL_WIN32_API_HPP
+
+#include <ctime>
+#include <iomanip>
+#include <limits>
+#include <sstream>
+#include <stdexcept>
+#include <string>
+#include <vector>
+
+#include "boost/locale/win32/lcid.hpp"
+
+#ifndef NOMINMAX
+#    define NOMINMAX
+#endif
+#ifndef UNICODE
+#    define UNICODE
+#endif
+#include <windows.h>
+
+#include <boost/locale/collator.hpp>
+#include <boost/locale/conversion.hpp>
+
+namespace boost { namespace locale { namespace impl_win {
+
+    struct numeric_info {
+        std::wstring thousands_sep;
+        std::wstring decimal_point;
+        std::string grouping;
+    };
+
+    inline DWORD collation_level_to_flag(collate_level level)
+    {
+        switch(level) {
+            case collate_level::primary: return NORM_IGNORESYMBOLS | NORM_IGNORECASE | NORM_IGNORENONSPACE;
+            case collate_level::secondary: return NORM_IGNORESYMBOLS | NORM_IGNORECASE;
+            case collate_level::tertiary: return NORM_IGNORESYMBOLS;
+            case collate_level::quaternary:
+            case collate_level::identical: return 0;
+        }
+        return 0;
+    }
+
+    class winlocale {
+    public:
+        winlocale() : lcid(0) {}
+
+        winlocale(const std::string& name) { lcid = locale_to_lcid(name); }
+
+        unsigned lcid;
+
+        bool is_c() const { return lcid == 0; }
+    };
+
+    ////////////////////////////////////////////////////////////////////////
+    ///
+    /// Number Format
+    ///
+    ////////////////////////////////////////////////////////////////////////
+
+    inline numeric_info wcsnumformat_l(const winlocale& l)
+    {
+        numeric_info res;
+        res.decimal_point = L'.';
+        unsigned lcid = l.lcid;
+
+        if(lcid == 0)
+            return res;
+
+        // limits according to MSDN
+        constexpr int th_size = 4;
+        constexpr int de_size = 4;
+        constexpr int gr_size = 10;
+
+        wchar_t th[th_size] = {0};
+        wchar_t de[de_size] = {0};
+        wchar_t gr[gr_size] = {0};
+
+        if(GetLocaleInfoW(lcid, LOCALE_STHOUSAND, th, th_size) == 0
+           || GetLocaleInfoW(lcid, LOCALE_SDECIMAL, de, de_size) == 0
+           || GetLocaleInfoW(lcid, LOCALE_SGROUPING, gr, gr_size) == 0)
+        {
+            return res;
+        }
+        res.decimal_point = de;
+        res.thousands_sep = th;
+        bool inf_group = false;
+        for(unsigned i = 0; gr[i]; i++) {
+            if(gr[i] == L';')
+                continue;
+            if(L'1' <= gr[i] && gr[i] <= L'9') {
+                res.grouping += char(gr[i] - L'0');
+            } else if(gr[i] == L'0')
+                inf_group = true;
+        }
+        if(!inf_group) {
+            BOOST_LOCALE_START_CONST_CONDITION
+            if(std::numeric_limits<char>::is_signed) {
+                res.grouping += std::numeric_limits<char>::min();
+            } else {
+                res.grouping += std::numeric_limits<char>::max();
+            }
+            BOOST_LOCALE_END_CONST_CONDITION
+        }
+        return res;
+    }
+
+    inline std::wstring win_map_string_l(unsigned flags, const wchar_t* begin, const wchar_t* end, const winlocale& l)
+    {
+        std::wstring res;
+        if(end - begin > std::numeric_limits<int>::max())
+            throw std::length_error("String to long for int type");
+        int len = LCMapStringW(l.lcid, flags, begin, static_cast<int>(end - begin), 0, 0);
+        if(len == 0)
+            return res;
+        if(len == std::numeric_limits<int>::max())
+            throw std::length_error("String to long for int type");
+        std::vector<wchar_t> buf(len + 1);
+        int l2 =
+          LCMapStringW(l.lcid, flags, begin, static_cast<int>(end - begin), &buf.front(), static_cast<int>(buf.size()));
+        res.assign(&buf.front(), l2);
+        return res;
+    }
+
+    ////////////////////////////////////////////////////////////////////////
+    ///
+    /// Collation
+    ///
+    ////////////////////////////////////////////////////////////////////////
+
+    inline int wcscoll_l(collate_level level,
+                         const wchar_t* lb,
+                         const wchar_t* le,
+                         const wchar_t* rb,
+                         const wchar_t* re,
+                         const winlocale& l)
+    {
+        if(le - lb > std::numeric_limits<int>::max() || re - rb > std::numeric_limits<int>::max())
+            throw std::length_error("String to long for int type");
+        const int result = CompareStringW(l.lcid,
+                                          collation_level_to_flag(level),
+                                          lb,
+                                          static_cast<int>(le - lb),
+                                          rb,
+                                          static_cast<int>(re - rb));
+        return result - 2; // Subtract 2 to get the meaning of <0, ==0, and >0
+    }
+
+    ////////////////////////////////////////////////////////////////////////
+    ///
+    /// Money Format
+    ///
+    ////////////////////////////////////////////////////////////////////////
+
+    inline std::wstring wcsfmon_l(double value, const winlocale& l)
+    {
+        std::wostringstream ss;
+        ss.imbue(std::locale::classic());
+
+        ss << std::setprecision(std::numeric_limits<double>::digits10 + 1) << value;
+        std::wstring sval = ss.str();
+        int len = GetCurrencyFormatW(l.lcid, 0, sval.c_str(), 0, 0, 0);
+        std::vector<wchar_t> buf(len + 1);
+        GetCurrencyFormatW(l.lcid, 0, sval.c_str(), 0, &buf.front(), len);
+        return &buf.front();
+    }
+
+    ////////////////////////////////////////////////////////////////////////
+    ///
+    /// Time Format
+    ///
+    ////////////////////////////////////////////////////////////////////////
+
+    inline std::wstring wcs_format_date_l(const wchar_t* format, SYSTEMTIME const* tm, const winlocale& l)
+    {
+        int len = GetDateFormatW(l.lcid, 0, tm, format, 0, 0);
+        std::vector<wchar_t> buf(len + 1);
+        GetDateFormatW(l.lcid, 0, tm, format, &buf.front(), len);
+        return &buf.front();
+    }
+
+    inline std::wstring wcs_format_time_l(const wchar_t* format, SYSTEMTIME const* tm, const winlocale& l)
+    {
+        int len = GetTimeFormatW(l.lcid, 0, tm, format, 0, 0);
+        std::vector<wchar_t> buf(len + 1);
+        GetTimeFormatW(l.lcid, 0, tm, format, &buf.front(), len);
+        return &buf.front();
+    }
+
+    inline std::wstring wcsfold(const wchar_t* begin, const wchar_t* end)
+    {
+        winlocale l;
+        l.lcid = 0x0409; // en-US
+        return win_map_string_l(LCMAP_LOWERCASE, begin, end, l);
+    }
+
+    inline std::wstring wcsnormalize(norm_type norm, const wchar_t* begin, const wchar_t* end)
+    {
+        // We use FoldString, under Vista it actually does normalization;
+        // under XP and below it does something similar, half job, better then nothing
+        unsigned flags = MAP_PRECOMPOSED;
+        switch(norm) {
+            case norm_nfd: flags = MAP_COMPOSITE; break;
+            case norm_nfc: flags = MAP_PRECOMPOSED; break;
+            case norm_nfkd: flags = MAP_FOLDCZONE; break;
+            case norm_nfkc: flags = MAP_FOLDCZONE | MAP_COMPOSITE; break;
+        }
+
+        if(end - begin > std::numeric_limits<int>::max())
+            throw std::length_error("String to long for int type");
+        int len = FoldStringW(flags, begin, static_cast<int>(end - begin), 0, 0);
+        if(len == 0)
+            return std::wstring();
+        if(len == std::numeric_limits<int>::max())
+            throw std::length_error("String to long for int type");
+        std::vector<wchar_t> v(len + 1);
+        len = FoldStringW(flags, begin, static_cast<int>(end - begin), &v.front(), len + 1);
+        return std::wstring(&v.front(), len);
+    }
+
+    inline std::wstring wcsxfrm_l(collate_level level, const wchar_t* begin, const wchar_t* end, const winlocale& l)
+    {
+        int flag = LCMAP_SORTKEY | collation_level_to_flag(level);
+
+        return win_map_string_l(flag, begin, end, l);
+    }
+
+    inline std::wstring towupper_l(const wchar_t* begin, const wchar_t* end, const winlocale& l)
+    {
+        return win_map_string_l(LCMAP_UPPERCASE | LCMAP_LINGUISTIC_CASING, begin, end, l);
+    }
+
+    inline std::wstring towlower_l(const wchar_t* begin, const wchar_t* end, const winlocale& l)
+    {
+        return win_map_string_l(LCMAP_LOWERCASE | LCMAP_LINGUISTIC_CASING, begin, end, l);
+    }
+
+    inline std::wstring wcsftime_l(char c, const std::tm* tm, const winlocale& l)
+    {
+        SYSTEMTIME wtm = SYSTEMTIME();
+        wtm.wYear = static_cast<WORD>(tm->tm_year + 1900);
+        wtm.wMonth = static_cast<WORD>(tm->tm_mon + 1);
+        wtm.wDayOfWeek = static_cast<WORD>(tm->tm_wday);
+        wtm.wDay = static_cast<WORD>(tm->tm_mday);
+        wtm.wHour = static_cast<WORD>(tm->tm_hour);
+        wtm.wMinute = static_cast<WORD>(tm->tm_min);
+        wtm.wSecond = static_cast<WORD>(tm->tm_sec);
+        switch(c) {
+            case 'a': // Abbr Weekday
+                return wcs_format_date_l(L"ddd", &wtm, l);
+            case 'A': // Full Weekday
+                return wcs_format_date_l(L"dddd", &wtm, l);
+            case 'b': // Abbr Month
+                return wcs_format_date_l(L"MMM", &wtm, l);
+            case 'B': // Full Month
+                return wcs_format_date_l(L"MMMM", &wtm, l);
+            case 'c': // DateTile Full
+                return wcs_format_date_l(0, &wtm, l) + L" " + wcs_format_time_l(0, &wtm, l);
+            // not supported by WIN ;(
+            //  case 'C': // Century -> 1980 -> 19
+            //  retur
+            case 'd': // Day of Month [01,31]
+                return wcs_format_date_l(L"dd", &wtm, l);
+            case 'D': // %m/%d/%y
+                return wcs_format_date_l(L"MM/dd/yy", &wtm, l);
+            case 'e': // Day of Month [1,31]
+                return wcs_format_date_l(L"d", &wtm, l);
+            case 'h': // == b
+                return wcs_format_date_l(L"MMM", &wtm, l);
+            case 'H': // 24 clock hour 00,23
+                return wcs_format_time_l(L"HH", &wtm, l);
+            case 'I': // 12 clock hour 01,12
+                return wcs_format_time_l(L"hh", &wtm, l);
+            /*
+            case 'j': // day of year 001,366
+                return "D";*/
+            case 'm': // month as [01,12]
+                return wcs_format_date_l(L"MM", &wtm, l);
+            case 'M': // minute [00,59]
+                return wcs_format_time_l(L"mm", &wtm, l);
+            case 'n': // \n
+                return L"\n";
+            case 'p': // am-pm
+                return wcs_format_time_l(L"tt", &wtm, l);
+            case 'r': // time with AM/PM %I:%M:%S %p
+                return wcs_format_time_l(L"hh:mm:ss tt", &wtm, l);
+            case 'R': // %H:%M
+                return wcs_format_time_l(L"HH:mm", &wtm, l);
+            case 'S': // second [00,61]
+                return wcs_format_time_l(L"ss", &wtm, l);
+            case 't': // \t
+                return L"\t";
+            case 'T': // %H:%M:%S
+                return wcs_format_time_l(L"HH:mm:ss", &wtm, l);
+                /*          case 'u': // weekday 1,7 1=Monday
+                        case 'U': // week number of year [00,53] Sunday first
+                        case 'V': // week number of year [01,53] Monday first
+                        case 'w': // weekday 0,7 0=Sunday
+                        case 'W': // week number of year [00,53] Monday first, */
+            case 'x': // Date
+                return wcs_format_date_l(0, &wtm, l);
+            case 'X': // Time
+                return wcs_format_time_l(0, &wtm, l);
+            case 'y': // Year [00-99]
+                return wcs_format_date_l(L"yy", &wtm, l);
+            case 'Y': // Year 1998
+                return wcs_format_date_l(L"yyyy", &wtm, l);
+            case '%': // %
+                return L"%";
+            default: return L"";
+        }
+    }
+
+}}} // namespace boost::locale::impl_win
+
+// boostinspect:nominmax
+#endif

externals/boost/libs/locale/src/boost/locale/win32/collate.cpp

@@ -0,0 +1,121 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/generator.hpp>
+#include "boost/locale/shared/mo_hash.hpp"
+#include "boost/locale/win32/api.hpp"
+#include <ios>
+#include <locale>
+#include <string>
+
+namespace boost { namespace locale { namespace impl_win {
+
+    class utf8_collator : public collator<char> {
+    public:
+        utf8_collator(winlocale lc, size_t refs = 0) : collator<char>(refs), lc_(lc) {}
+        int
+        do_compare(collate_level level, const char* lb, const char* le, const char* rb, const char* re) const override
+        {
+            std::wstring l = conv::to_utf<wchar_t>(lb, le, "UTF-8");
+            std::wstring r = conv::to_utf<wchar_t>(rb, re, "UTF-8");
+            return wcscoll_l(level, l.c_str(), l.c_str() + l.size(), r.c_str(), r.c_str() + r.size(), lc_);
+        }
+        long do_hash(collate_level level, const char* b, const char* e) const override
+        {
+            std::string key = do_transform(level, b, e);
+            return gnu_gettext::pj_winberger_hash_function(key.c_str(), key.c_str() + key.size());
+        }
+        std::string do_transform(collate_level level, const char* b, const char* e) const override
+        {
+            std::wstring tmp = conv::to_utf<wchar_t>(b, e, "UTF-8");
+            std::wstring wkey = wcsxfrm_l(level, tmp.c_str(), tmp.c_str() + tmp.size(), lc_);
+            std::string key;
+            BOOST_LOCALE_START_CONST_CONDITION
+            if(sizeof(wchar_t) == 2)
+                key.reserve(wkey.size() * 2);
+            else
+                key.reserve(wkey.size() * 3);
+            for(unsigned i = 0; i < wkey.size(); i++) {
+                if(sizeof(wchar_t) == 2) {
+                    uint16_t tv = static_cast<uint16_t>(wkey[i]);
+                    key += char(tv >> 8);
+                    key += char(tv & 0xFF);
+                } else { // 4
+                    uint32_t tv = static_cast<uint32_t>(wkey[i]);
+                    // 21 bit
+                    key += char((tv >> 16) & 0xFF);
+                    key += char((tv >> 8) & 0xFF);
+                    key += char(tv & 0xFF);
+                }
+            }
+            BOOST_LOCALE_END_CONST_CONDITION
+            return key;
+        }
+
+    private:
+        winlocale lc_;
+    };
+
+    class utf16_collator : public collator<wchar_t> {
+    public:
+        typedef std::collate<wchar_t> wfacet;
+        utf16_collator(winlocale lc, size_t refs = 0) : collator<wchar_t>(refs), lc_(lc) {}
+        int do_compare(collate_level level,
+                       const wchar_t* lb,
+                       const wchar_t* le,
+                       const wchar_t* rb,
+                       const wchar_t* re) const override
+        {
+            return wcscoll_l(level, lb, le, rb, re, lc_);
+        }
+        long do_hash(collate_level level, const wchar_t* b, const wchar_t* e) const override
+        {
+            std::wstring key = do_transform(level, b, e);
+            const char* begin = reinterpret_cast<const char*>(key.c_str());
+            const char* end = begin + key.size() * sizeof(wchar_t);
+            return gnu_gettext::pj_winberger_hash_function(begin, end);
+        }
+        std::wstring do_transform(collate_level level, const wchar_t* b, const wchar_t* e) const override
+        {
+            return wcsxfrm_l(level, b, e, lc_);
+        }
+
+    private:
+        winlocale lc_;
+    };
+
+    std::locale create_collate(const std::locale& in, const winlocale& lc, char_facet_t type)
+    {
+        if(lc.is_c()) {
+            switch(type) {
+                case char_facet_t::nochar: break;
+                case char_facet_t::char_f: return std::locale(in, new std::collate_byname<char>("C"));
+                case char_facet_t::wchar_f: return std::locale(in, new std::collate_byname<wchar_t>("C"));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+                case char_facet_t::char16_f: return std::locale(in, new collate_byname<char16_t>("C"));
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+                case char_facet_t::char32_f: return std::locale(in, new collate_byname<char32_t>("C"));
+#endif
+            }
+        } else {
+            switch(type) {
+                case char_facet_t::nochar: break;
+                case char_facet_t::char_f: return std::locale(in, new utf8_collator(lc));
+                case char_facet_t::wchar_f: return std::locale(in, new utf16_collator(lc));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+                case char_facet_t::char16_f: break;
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+                case char_facet_t::char32_f: break;
+#endif
+            }
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_win

externals/boost/libs/locale/src/boost/locale/win32/converter.cpp

@@ -0,0 +1,82 @@
+//
+// Copyright (c) 2009-2011 Artyom Beilis (Tonkikh)
+//
+// Distributed under the Boost Software License, Version 1.0.
+// https://www.boost.org/LICENSE_1_0.txt
+
+#include <boost/locale/conversion.hpp>
+#include <boost/locale/encoding.hpp>
+#include <boost/locale/generator.hpp>
+#include "boost/locale/win32/all_generator.hpp"
+#include "boost/locale/win32/api.hpp"
+#include <cstring>
+#include <locale>
+#include <stdexcept>
+
+namespace boost { namespace locale { namespace impl_win {
+
+    class utf16_converter : public converter<wchar_t> {
+    public:
+        utf16_converter(const winlocale& lc, size_t refs = 0) : converter<wchar_t>(refs), lc_(lc) {}
+        std::wstring convert(converter_base::conversion_type how,
+                             const wchar_t* begin,
+                             const wchar_t* end,
+                             int flags = 0) const override
+        {
+            switch(how) {
+                case converter_base::upper_case: return towupper_l(begin, end, lc_);
+                case converter_base::lower_case: return towlower_l(begin, end, lc_);
+                case converter_base::case_folding: return wcsfold(begin, end);
+                case converter_base::normalization: return wcsnormalize(static_cast<norm_type>(flags), begin, end);
+                case converter_base::title_case: break;
+            }
+            return std::wstring(begin, end - begin);
+        }
+
+    private:
+        winlocale lc_;
+    };
+
+    class utf8_converter : public converter<char> {
+    public:
+        utf8_converter(const winlocale& lc, size_t refs = 0) : converter<char>(refs), lc_(lc) {}
+        std::string
+        convert(converter_base::conversion_type how, const char* begin, const char* end, int flags = 0) const override
+        {
+            std::wstring tmp = conv::to_utf<wchar_t>(begin, end, "UTF-8");
+            const wchar_t* wb = tmp.c_str();
+            const wchar_t* we = wb + tmp.size();
+
+            std::wstring res;
+
+            switch(how) {
+                case upper_case: res = towupper_l(wb, we, lc_); break;
+                case lower_case: res = towlower_l(wb, we, lc_); break;
+                case case_folding: res = wcsfold(wb, we); break;
+                case normalization: res = wcsnormalize(static_cast<norm_type>(flags), wb, we); break;
+                case title_case: break;
+            }
+            return conv::from_utf(res, "UTF-8");
+        }
+
+    private:
+        winlocale lc_;
+    };
+
+    std::locale create_convert(const std::locale& in, const winlocale& lc, char_facet_t type)
+    {
+        switch(type) {
+            case char_facet_t::nochar: break;
+            case char_facet_t::char_f: return std::locale(in, new utf8_converter(lc));
+            case char_facet_t::wchar_f: return std::locale(in, new utf16_converter(lc));
+#ifdef BOOST_LOCALE_ENABLE_CHAR16_T
+            case char_facet_t::char16_f: break;
+#endif
+#ifdef BOOST_LOCALE_ENABLE_CHAR32_T
+            case char_facet_t::char32_f: break;
+#endif
+        }
+        return in;
+    }
+
+}}} // namespace boost::locale::impl_win